Merge branch 'fix/polyfill-toSplice' into deploy/dev

.claude/skills/frontend-testing/SKILL.md

@@ -0,0 +1,322 @@
+---
+name: frontend-testing
+description: Generate Vitest + React Testing Library tests for Dify frontend components, hooks, and utilities. Triggers on testing, spec files, coverage, Vitest, RTL, unit tests, integration tests, or write/review test requests.
+---
+
+# Dify Frontend Testing Skill
+
+This skill enables Claude to generate high-quality, comprehensive frontend tests for the Dify project following established conventions and best practices.
+
+> **⚠️ Authoritative Source**: This skill is derived from `web/testing/testing.md`. Use Vitest mock/timer APIs (`vi.*`).
+
+## When to Apply This Skill
+
+Apply this skill when the user:
+
+- Asks to **write tests** for a component, hook, or utility
+- Asks to **review existing tests** for completeness
+- Mentions **Vitest**, **React Testing Library**, **RTL**, or **spec files**
+- Requests **test coverage** improvement
+- Uses `pnpm analyze-component` output as context
+- Mentions **testing**, **unit tests**, or **integration tests** for frontend code
+- Wants to understand **testing patterns** in the Dify codebase
+
+**Do NOT apply** when:
+
+- User is asking about backend/API tests (Python/pytest)
+- User is asking about E2E tests (Playwright/Cypress)
+- User is only asking conceptual questions without code context
+
+## Quick Reference
+
+### Tech Stack
+
+| Tool | Version | Purpose |
+|------|---------|---------|
+| Vitest | 4.0.16 | Test runner |
+| React Testing Library | 16.0 | Component testing |
+| jsdom | - | Test environment |
+| nock | 14.0 | HTTP mocking |
+| TypeScript | 5.x | Type safety |
+
+### Key Commands
+
+```bash
+# Run all tests
+pnpm test
+
+# Watch mode
+pnpm test:watch
+
+# Run specific file
+pnpm test -- path/to/file.spec.tsx
+
+# Generate coverage report
+pnpm test -- --coverage
+
+# Analyze component complexity
+pnpm analyze-component <path>
+
+# Review existing test
+pnpm analyze-component <path> --review
+```
+
+### File Naming
+
+- Test files: `ComponentName.spec.tsx` (same directory as component)
+- Integration tests: `web/__tests__/` directory
+
+## Test Structure Template
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import Component from './index'
+
+// ✅ Import real project components (DO NOT mock these)
+// import Loading from '@/app/components/base/loading'
+// import { ChildComponent } from './child-component'
+
+// ✅ Mock external dependencies only
+vi.mock('@/service/api')
+vi.mock('next/navigation', () => ({
+  useRouter: () => ({ push: vi.fn() }),
+  usePathname: () => '/test',
+}))
+
+// Shared state for mocks (if needed)
+let mockSharedState = false
+
+describe('ComponentName', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()  // ✅ Reset mocks BEFORE each test
+    mockSharedState = false  // ✅ Reset shared state
+  })
+
+  // Rendering tests (REQUIRED)
+  describe('Rendering', () => {
+    it('should render without crashing', () => {
+      // Arrange
+      const props = { title: 'Test' }
+      
+      // Act
+      render(<Component {...props} />)
+      
+      // Assert
+      expect(screen.getByText('Test')).toBeInTheDocument()
+    })
+  })
+
+  // Props tests (REQUIRED)
+  describe('Props', () => {
+    it('should apply custom className', () => {
+      render(<Component className="custom" />)
+      expect(screen.getByRole('button')).toHaveClass('custom')
+    })
+  })
+
+  // User Interactions
+  describe('User Interactions', () => {
+    it('should handle click events', () => {
+      const handleClick = vi.fn()
+      render(<Component onClick={handleClick} />)
+      
+      fireEvent.click(screen.getByRole('button'))
+      
+      expect(handleClick).toHaveBeenCalledTimes(1)
+    })
+  })
+
+  // Edge Cases (REQUIRED)
+  describe('Edge Cases', () => {
+    it('should handle null data', () => {
+      render(<Component data={null} />)
+      expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty array', () => {
+      render(<Component items={[]} />)
+      expect(screen.getByText(/empty/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+## Testing Workflow (CRITICAL)
+
+### ⚠️ Incremental Approach Required
+
+**NEVER generate all test files at once.** For complex components or multi-file directories:
+
+1. **Analyze & Plan**: List all files, order by complexity (simple → complex)
+1. **Process ONE at a time**: Write test → Run test → Fix if needed → Next
+1. **Verify before proceeding**: Do NOT continue to next file until current passes
+
+```
+For each file:
+  ┌────────────────────────────────────────┐
+  │ 1. Write test                          │
+  │ 2. Run: pnpm test -- <file>.spec.tsx   │
+  │ 3. PASS? → Mark complete, next file    │
+  │    FAIL? → Fix first, then continue    │
+  └────────────────────────────────────────┘
+```
+
+### Complexity-Based Order
+
+Process in this order for multi-file testing:
+
+1. 🟢 Utility functions (simplest)
+1. 🟢 Custom hooks
+1. 🟡 Simple components (presentational)
+1. 🟡 Medium components (state, effects)
+1. 🔴 Complex components (API, routing)
+1. 🔴 Integration tests (index files - last)
+
+### When to Refactor First
+
+- **Complexity > 50**: Break into smaller pieces before testing
+- **500+ lines**: Consider splitting before testing
+- **Many dependencies**: Extract logic into hooks first
+
+> 📖 See `references/workflow.md` for complete workflow details and todo list format.
+
+## Testing Strategy
+
+### Path-Level Testing (Directory Testing)
+
+When assigned to test a directory/path, test **ALL content** within that path:
+
+- Test all components, hooks, utilities in the directory (not just `index` file)
+- Use incremental approach: one file at a time, verify each before proceeding
+- Goal: 100% coverage of ALL files in the directory
+
+### Integration Testing First
+
+**Prefer integration testing** when writing tests for a directory:
+
+- ✅ **Import real project components** directly (including base components and siblings)
+- ✅ **Only mock**: API services (`@/service/*`), `next/navigation`, complex context providers
+- ❌ **DO NOT mock** base components (`@/app/components/base/*`)
+- ❌ **DO NOT mock** sibling/child components in the same directory
+
+> See [Test Structure Template](#test-structure-template) for correct import/mock patterns.
+
+## Core Principles
+
+### 1. AAA Pattern (Arrange-Act-Assert)
+
+Every test should clearly separate:
+
+- **Arrange**: Setup test data and render component
+- **Act**: Perform user actions
+- **Assert**: Verify expected outcomes
+
+### 2. Black-Box Testing
+
+- Test observable behavior, not implementation details
+- Use semantic queries (getByRole, getByLabelText)
+- Avoid testing internal state directly
+- **Prefer pattern matching over hardcoded strings** in assertions:
+
+```typescript
+// ❌ Avoid: hardcoded text assertions
+expect(screen.getByText('Loading...')).toBeInTheDocument()
+
+// ✅ Better: role-based queries
+expect(screen.getByRole('status')).toBeInTheDocument()
+
+// ✅ Better: pattern matching
+expect(screen.getByText(/loading/i)).toBeInTheDocument()
+```
+
+### 3. Single Behavior Per Test
+
+Each test verifies ONE user-observable behavior:
+
+```typescript
+// ✅ Good: One behavior
+it('should disable button when loading', () => {
+  render(<Button loading />)
+  expect(screen.getByRole('button')).toBeDisabled()
+})
+
+// ❌ Bad: Multiple behaviors
+it('should handle loading state', () => {
+  render(<Button loading />)
+  expect(screen.getByRole('button')).toBeDisabled()
+  expect(screen.getByText('Loading...')).toBeInTheDocument()
+  expect(screen.getByRole('button')).toHaveClass('loading')
+})
+```
+
+### 4. Semantic Naming
+
+Use `should <behavior> when <condition>`:
+
+```typescript
+it('should show error message when validation fails')
+it('should call onSubmit when form is valid')
+it('should disable input when isReadOnly is true')
+```
+
+## Required Test Scenarios
+
+### Always Required (All Components)
+
+1. **Rendering**: Component renders without crashing
+1. **Props**: Required props, optional props, default values
+1. **Edge Cases**: null, undefined, empty values, boundary conditions
+
+### Conditional (When Present)
+
+| Feature | Test Focus |
+|---------|-----------|
+| `useState` | Initial state, transitions, cleanup |
+| `useEffect` | Execution, dependencies, cleanup |
+| Event handlers | All onClick, onChange, onSubmit, keyboard |
+| API calls | Loading, success, error states |
+| Routing | Navigation, params, query strings |
+| `useCallback`/`useMemo` | Referential equality |
+| Context | Provider values, consumer behavior |
+| Forms | Validation, submission, error display |
+
+## Coverage Goals (Per File)
+
+For each test file generated, aim for:
+
+- ✅ **100%** function coverage
+- ✅ **100%** statement coverage
+- ✅ **>95%** branch coverage
+- ✅ **>95%** line coverage
+
+> **Note**: For multi-file directories, process one file at a time with full coverage each. See `references/workflow.md`.
+
+## Detailed Guides
+
+For more detailed information, refer to:
+
+- `references/workflow.md` - **Incremental testing workflow** (MUST READ for multi-file testing)
+- `references/mocking.md` - Mock patterns and best practices
+- `references/async-testing.md` - Async operations and API calls
+- `references/domain-components.md` - Workflow, Dataset, Configuration testing
+- `references/common-patterns.md` - Frequently used testing patterns
+- `references/checklist.md` - Test generation checklist and validation steps
+
+## Authoritative References
+
+### Primary Specification (MUST follow)
+
+- **`web/testing/testing.md`** - The canonical testing specification. This skill is derived from this document.
+
+### Reference Examples in Codebase
+
+- `web/utils/classnames.spec.ts` - Utility function tests
+- `web/app/components/base/button/index.spec.tsx` - Component tests
+- `web/__mocks__/provider-context.ts` - Mock factory example
+
+### Project Configuration
+
+- `web/vitest.config.ts` - Vitest configuration
+- `web/vitest.setup.ts` - Test environment setup
+- `web/testing/analyze-component.js` - Component analysis tool
+- Modules are not mocked automatically. Global mocks live in `web/vitest.setup.ts` (for example `react-i18next`, `next/image`); mock other modules like `ky` or `mime` locally in test files.

.claude/skills/frontend-testing/assets/component-test.template.tsx

@@ -0,0 +1,296 @@
+/**
+ * Test Template for React Components
+ *
+ * WHY THIS STRUCTURE?
+ * - Organized sections make tests easy to navigate and maintain
+ * - Mocks at top ensure consistent test isolation
+ * - Factory functions reduce duplication and improve readability
+ * - describe blocks group related scenarios for better debugging
+ *
+ * INSTRUCTIONS:
+ * 1. Replace `ComponentName` with your component name
+ * 2. Update import path
+ * 3. Add/remove test sections based on component features (use analyze-component)
+ * 4. Follow AAA pattern: Arrange → Act → Assert
+ *
+ * RUN FIRST: pnpm analyze-component <path> to identify required test scenarios
+ */
+
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+// import ComponentName from './index'
+
+// ============================================================================
+// Mocks
+// ============================================================================
+// WHY: Mocks must be hoisted to top of file (Vitest requirement).
+// They run BEFORE imports, so keep them before component imports.
+
+// i18n (automatically mocked)
+// WHY: Global mock in web/vitest.setup.ts is auto-loaded by Vitest setup
+// No explicit mock needed - it returns translation keys as-is
+// Override only if custom translations are required:
+// vi.mock('react-i18next', () => ({
+//   useTranslation: () => ({
+//     t: (key: string) => {
+//       const customTranslations: Record<string, string> = {
+//         'my.custom.key': 'Custom Translation',
+//       }
+//       return customTranslations[key] || key
+//     },
+//   }),
+// }))
+
+// Router (if component uses useRouter, usePathname, useSearchParams)
+// WHY: Isolates tests from Next.js routing, enables testing navigation behavior
+// const mockPush = vi.fn()
+// vi.mock('next/navigation', () => ({
+//   useRouter: () => ({ push: mockPush }),
+//   usePathname: () => '/test-path',
+// }))
+
+// API services (if component fetches data)
+// WHY: Prevents real network calls, enables testing all states (loading/success/error)
+// vi.mock('@/service/api')
+// import * as api from '@/service/api'
+// const mockedApi = vi.mocked(api)
+
+// Shared mock state (for portal/dropdown components)
+// WHY: Portal components like PortalToFollowElem need shared state between
+// parent and child mocks to correctly simulate open/close behavior
+// let mockOpenState = false
+
+// ============================================================================
+// Test Data Factories
+// ============================================================================
+// WHY FACTORIES?
+// - Avoid hard-coded test data scattered across tests
+// - Easy to create variations with overrides
+// - Type-safe when using actual types from source
+// - Single source of truth for default test values
+
+// const createMockProps = (overrides = {}) => ({
+//   // Default props that make component render successfully
+//   ...overrides,
+// })
+
+// const createMockItem = (overrides = {}) => ({
+//   id: 'item-1',
+//   name: 'Test Item',
+//   ...overrides,
+// })
+
+// ============================================================================
+// Test Helpers
+// ============================================================================
+
+// const renderComponent = (props = {}) => {
+//   return render(<ComponentName {...createMockProps(props)} />)
+// }
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('ComponentName', () => {
+  // WHY beforeEach with clearAllMocks?
+  // - Ensures each test starts with clean slate
+  // - Prevents mock call history from leaking between tests
+  // - MUST be beforeEach (not afterEach) to reset BEFORE assertions like toHaveBeenCalledTimes
+  beforeEach(() => {
+    vi.clearAllMocks()
+    // Reset shared mock state if used (CRITICAL for portal/dropdown tests)
+    // mockOpenState = false
+  })
+
+  // --------------------------------------------------------------------------
+  // Rendering Tests (REQUIRED - Every component MUST have these)
+  // --------------------------------------------------------------------------
+  // WHY: Catches import errors, missing providers, and basic render issues
+  describe('Rendering', () => {
+    it('should render without crashing', () => {
+      // Arrange - Setup data and mocks
+      // const props = createMockProps()
+
+      // Act - Render the component
+      // render(<ComponentName {...props} />)
+
+      // Assert - Verify expected output
+      // Prefer getByRole for accessibility; it's what users "see"
+      // expect(screen.getByRole('...')).toBeInTheDocument()
+    })
+
+    it('should render with default props', () => {
+      // WHY: Verifies component works without optional props
+      // render(<ComponentName />)
+      // expect(screen.getByText('...')).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Props Tests (REQUIRED - Every component MUST test prop behavior)
+  // --------------------------------------------------------------------------
+  // WHY: Props are the component's API contract. Test them thoroughly.
+  describe('Props', () => {
+    it('should apply custom className', () => {
+      // WHY: Common pattern in Dify - components should merge custom classes
+      // render(<ComponentName className="custom-class" />)
+      // expect(screen.getByTestId('component')).toHaveClass('custom-class')
+    })
+
+    it('should use default values for optional props', () => {
+      // WHY: Verifies TypeScript defaults work at runtime
+      // render(<ComponentName />)
+      // expect(screen.getByRole('...')).toHaveAttribute('...', 'default-value')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // User Interactions (if component has event handlers - on*, handle*)
+  // --------------------------------------------------------------------------
+  // WHY: Event handlers are core functionality. Test from user's perspective.
+  describe('User Interactions', () => {
+    it('should call onClick when clicked', async () => {
+      // WHY userEvent over fireEvent?
+      // - userEvent simulates real user behavior (focus, hover, then click)
+      // - fireEvent is lower-level, doesn't trigger all browser events
+      // const user = userEvent.setup()
+      // const handleClick = vi.fn()
+      // render(<ComponentName onClick={handleClick} />)
+      //
+      // await user.click(screen.getByRole('button'))
+      //
+      // expect(handleClick).toHaveBeenCalledTimes(1)
+    })
+
+    it('should call onChange when value changes', async () => {
+      // const user = userEvent.setup()
+      // const handleChange = vi.fn()
+      // render(<ComponentName onChange={handleChange} />)
+      //
+      // await user.type(screen.getByRole('textbox'), 'new value')
+      //
+      // expect(handleChange).toHaveBeenCalled()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // State Management (if component uses useState/useReducer)
+  // --------------------------------------------------------------------------
+  // WHY: Test state through observable UI changes, not internal state values
+  describe('State Management', () => {
+    it('should update state on interaction', async () => {
+      // WHY test via UI, not state?
+      // - State is implementation detail; UI is what users see
+      // - If UI works correctly, state must be correct
+      // const user = userEvent.setup()
+      // render(<ComponentName />)
+      //
+      // // Initial state - verify what user sees
+      // expect(screen.getByText('Initial')).toBeInTheDocument()
+      //
+      // // Trigger state change via user action
+      // await user.click(screen.getByRole('button'))
+      //
+      // // New state - verify UI updated
+      // expect(screen.getByText('Updated')).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Async Operations (if component fetches data - useSWR, useQuery, fetch)
+  // --------------------------------------------------------------------------
+  // WHY: Async operations have 3 states users experience: loading, success, error
+  describe('Async Operations', () => {
+    it('should show loading state', () => {
+      // WHY never-resolving promise?
+      // - Keeps component in loading state for assertion
+      // - Alternative: use fake timers
+      // mockedApi.fetchData.mockImplementation(() => new Promise(() => {}))
+      // render(<ComponentName />)
+      //
+      // expect(screen.getByText(/loading/i)).toBeInTheDocument()
+    })
+
+    it('should show data on success', async () => {
+      // WHY waitFor?
+      // - Component updates asynchronously after fetch resolves
+      // - waitFor retries assertion until it passes or times out
+      // mockedApi.fetchData.mockResolvedValue({ items: ['Item 1'] })
+      // render(<ComponentName />)
+      //
+      // await waitFor(() => {
+      //   expect(screen.getByText('Item 1')).toBeInTheDocument()
+      // })
+    })
+
+    it('should show error on failure', async () => {
+      // mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+      // render(<ComponentName />)
+      //
+      // await waitFor(() => {
+      //   expect(screen.getByText(/error/i)).toBeInTheDocument()
+      // })
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases (REQUIRED - Every component MUST handle edge cases)
+  // --------------------------------------------------------------------------
+  // WHY: Real-world data is messy. Components must handle:
+  // - Null/undefined from API failures or optional fields
+  // - Empty arrays/strings from user clearing data
+  // - Boundary values (0, MAX_INT, special characters)
+  describe('Edge Cases', () => {
+    it('should handle null value', () => {
+      // WHY test null specifically?
+      // - API might return null for missing data
+      // - Prevents "Cannot read property of null" in production
+      // render(<ComponentName value={null} />)
+      // expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle undefined value', () => {
+      // WHY test undefined separately from null?
+      // - TypeScript treats them differently
+      // - Optional props are undefined, not null
+      // render(<ComponentName value={undefined} />)
+      // expect(screen.getByText(/no data/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty array', () => {
+      // WHY: Empty state often needs special UI (e.g., "No items yet")
+      // render(<ComponentName items={[]} />)
+      // expect(screen.getByText(/empty/i)).toBeInTheDocument()
+    })
+
+    it('should handle empty string', () => {
+      // WHY: Empty strings are truthy in JS but visually empty
+      // render(<ComponentName text="" />)
+      // expect(screen.getByText(/placeholder/i)).toBeInTheDocument()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Accessibility (optional but recommended for Dify's enterprise users)
+  // --------------------------------------------------------------------------
+  // WHY: Dify has enterprise customers who may require accessibility compliance
+  describe('Accessibility', () => {
+    it('should have accessible name', () => {
+      // WHY getByRole with name?
+      // - Tests that screen readers can identify the element
+      // - Enforces proper labeling practices
+      // render(<ComponentName label="Test Label" />)
+      // expect(screen.getByRole('button', { name: /test label/i })).toBeInTheDocument()
+    })
+
+    it('should support keyboard navigation', async () => {
+      // WHY: Some users can't use a mouse
+      // const user = userEvent.setup()
+      // render(<ComponentName />)
+      //
+      // await user.tab()
+      // expect(screen.getByRole('button')).toHaveFocus()
+    })
+  })
+})

.claude/skills/frontend-testing/assets/hook-test.template.ts

@@ -0,0 +1,207 @@
+/**
+ * Test Template for Custom Hooks
+ *
+ * Instructions:
+ * 1. Replace `useHookName` with your hook name
+ * 2. Update import path
+ * 3. Add/remove test sections based on hook features
+ */
+
+import { renderHook, act, waitFor } from '@testing-library/react'
+// import { useHookName } from './use-hook-name'
+
+// ============================================================================
+// Mocks
+// ============================================================================
+
+// API services (if hook fetches data)
+// vi.mock('@/service/api')
+// import * as api from '@/service/api'
+// const mockedApi = vi.mocked(api)
+
+// ============================================================================
+// Test Helpers
+// ============================================================================
+
+// Wrapper for hooks that need context
+// const createWrapper = (contextValue = {}) => {
+//   return ({ children }: { children: React.ReactNode }) => (
+//     <SomeContext.Provider value={contextValue}>
+//       {children}
+//     </SomeContext.Provider>
+//   )
+// }
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('useHookName', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  // --------------------------------------------------------------------------
+  // Initial State
+  // --------------------------------------------------------------------------
+  describe('Initial State', () => {
+    it('should return initial state', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // expect(result.current.value).toBe(initialValue)
+      // expect(result.current.isLoading).toBe(false)
+    })
+
+    it('should accept initial value from props', () => {
+      // const { result } = renderHook(() => useHookName({ initialValue: 'custom' }))
+      //
+      // expect(result.current.value).toBe('custom')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // State Updates
+  // --------------------------------------------------------------------------
+  describe('State Updates', () => {
+    it('should update value when setValue is called', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // act(() => {
+      //   result.current.setValue('new value')
+      // })
+      //
+      // expect(result.current.value).toBe('new value')
+    })
+
+    it('should reset to initial value', () => {
+      // const { result } = renderHook(() => useHookName({ initialValue: 'initial' }))
+      //
+      // act(() => {
+      //   result.current.setValue('changed')
+      // })
+      // expect(result.current.value).toBe('changed')
+      //
+      // act(() => {
+      //   result.current.reset()
+      // })
+      // expect(result.current.value).toBe('initial')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Async Operations
+  // --------------------------------------------------------------------------
+  describe('Async Operations', () => {
+    it('should fetch data on mount', async () => {
+      // mockedApi.fetchData.mockResolvedValue({ data: 'test' })
+      //
+      // const { result } = renderHook(() => useHookName())
+      //
+      // // Initially loading
+      // expect(result.current.isLoading).toBe(true)
+      //
+      // // Wait for data
+      // await waitFor(() => {
+      //   expect(result.current.isLoading).toBe(false)
+      // })
+      //
+      // expect(result.current.data).toEqual({ data: 'test' })
+    })
+
+    it('should handle fetch error', async () => {
+      // mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+      //
+      // const { result } = renderHook(() => useHookName())
+      //
+      // await waitFor(() => {
+      //   expect(result.current.error).toBeTruthy()
+      // })
+      //
+      // expect(result.current.error?.message).toBe('Network error')
+    })
+
+    it('should refetch when dependency changes', async () => {
+      // mockedApi.fetchData.mockResolvedValue({ data: 'test' })
+      //
+      // const { result, rerender } = renderHook(
+      //   ({ id }) => useHookName(id),
+      //   { initialProps: { id: '1' } }
+      // )
+      //
+      // await waitFor(() => {
+      //   expect(mockedApi.fetchData).toHaveBeenCalledWith('1')
+      // })
+      //
+      // rerender({ id: '2' })
+      //
+      // await waitFor(() => {
+      //   expect(mockedApi.fetchData).toHaveBeenCalledWith('2')
+      // })
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Side Effects
+  // --------------------------------------------------------------------------
+  describe('Side Effects', () => {
+    it('should call callback when value changes', () => {
+      // const callback = vi.fn()
+      // const { result } = renderHook(() => useHookName({ onChange: callback }))
+      //
+      // act(() => {
+      //   result.current.setValue('new value')
+      // })
+      //
+      // expect(callback).toHaveBeenCalledWith('new value')
+    })
+
+    it('should cleanup on unmount', () => {
+      // const cleanup = vi.fn()
+      // vi.spyOn(window, 'addEventListener')
+      // vi.spyOn(window, 'removeEventListener')
+      //
+      // const { unmount } = renderHook(() => useHookName())
+      //
+      // expect(window.addEventListener).toHaveBeenCalled()
+      //
+      // unmount()
+      //
+      // expect(window.removeEventListener).toHaveBeenCalled()
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases
+  // --------------------------------------------------------------------------
+  describe('Edge Cases', () => {
+    it('should handle null input', () => {
+      // const { result } = renderHook(() => useHookName(null))
+      //
+      // expect(result.current.value).toBeNull()
+    })
+
+    it('should handle rapid updates', () => {
+      // const { result } = renderHook(() => useHookName())
+      //
+      // act(() => {
+      //   result.current.setValue('1')
+      //   result.current.setValue('2')
+      //   result.current.setValue('3')
+      // })
+      //
+      // expect(result.current.value).toBe('3')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // With Context (if hook uses context)
+  // --------------------------------------------------------------------------
+  describe('With Context', () => {
+    it('should use context value', () => {
+      // const wrapper = createWrapper({ someValue: 'context-value' })
+      // const { result } = renderHook(() => useHookName(), { wrapper })
+      //
+      // expect(result.current.contextValue).toBe('context-value')
+    })
+  })
+})

.claude/skills/frontend-testing/assets/utility-test.template.ts

@@ -0,0 +1,154 @@
+/**
+ * Test Template for Utility Functions
+ *
+ * Instructions:
+ * 1. Replace `utilityFunction` with your function name
+ * 2. Update import path
+ * 3. Use test.each for data-driven tests
+ */
+
+// import { utilityFunction } from './utility'
+
+// ============================================================================
+// Tests
+// ============================================================================
+
+describe('utilityFunction', () => {
+  // --------------------------------------------------------------------------
+  // Basic Functionality
+  // --------------------------------------------------------------------------
+  describe('Basic Functionality', () => {
+    it('should return expected result for valid input', () => {
+      // expect(utilityFunction('input')).toBe('expected-output')
+    })
+
+    it('should handle multiple arguments', () => {
+      // expect(utilityFunction('a', 'b', 'c')).toBe('abc')
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Data-Driven Tests
+  // --------------------------------------------------------------------------
+  describe('Input/Output Mapping', () => {
+    test.each([
+      // [input, expected]
+      ['input1', 'output1'],
+      ['input2', 'output2'],
+      ['input3', 'output3'],
+    ])('should return %s for input %s', (input, expected) => {
+      // expect(utilityFunction(input)).toBe(expected)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Edge Cases
+  // --------------------------------------------------------------------------
+  describe('Edge Cases', () => {
+    it('should handle empty string', () => {
+      // expect(utilityFunction('')).toBe('')
+    })
+
+    it('should handle null', () => {
+      // expect(utilityFunction(null)).toBe(null)
+      // or
+      // expect(() => utilityFunction(null)).toThrow()
+    })
+
+    it('should handle undefined', () => {
+      // expect(utilityFunction(undefined)).toBe(undefined)
+      // or
+      // expect(() => utilityFunction(undefined)).toThrow()
+    })
+
+    it('should handle empty array', () => {
+      // expect(utilityFunction([])).toEqual([])
+    })
+
+    it('should handle empty object', () => {
+      // expect(utilityFunction({})).toEqual({})
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Boundary Conditions
+  // --------------------------------------------------------------------------
+  describe('Boundary Conditions', () => {
+    it('should handle minimum value', () => {
+      // expect(utilityFunction(0)).toBe(0)
+    })
+
+    it('should handle maximum value', () => {
+      // expect(utilityFunction(Number.MAX_SAFE_INTEGER)).toBe(...)
+    })
+
+    it('should handle negative numbers', () => {
+      // expect(utilityFunction(-1)).toBe(...)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Type Coercion (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Type Handling', () => {
+    it('should handle numeric string', () => {
+      // expect(utilityFunction('123')).toBe(123)
+    })
+
+    it('should handle boolean', () => {
+      // expect(utilityFunction(true)).toBe(...)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Error Cases
+  // --------------------------------------------------------------------------
+  describe('Error Handling', () => {
+    it('should throw for invalid input', () => {
+      // expect(() => utilityFunction('invalid')).toThrow('Error message')
+    })
+
+    it('should throw with specific error type', () => {
+      // expect(() => utilityFunction('invalid')).toThrow(ValidationError)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Complex Objects (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Object Handling', () => {
+    it('should preserve object structure', () => {
+      // const input = { a: 1, b: 2 }
+      // expect(utilityFunction(input)).toEqual({ a: 1, b: 2 })
+    })
+
+    it('should handle nested objects', () => {
+      // const input = { nested: { deep: 'value' } }
+      // expect(utilityFunction(input)).toEqual({ nested: { deep: 'transformed' } })
+    })
+
+    it('should not mutate input', () => {
+      // const input = { a: 1 }
+      // const inputCopy = { ...input }
+      // utilityFunction(input)
+      // expect(input).toEqual(inputCopy)
+    })
+  })
+
+  // --------------------------------------------------------------------------
+  // Array Handling (if applicable)
+  // --------------------------------------------------------------------------
+  describe('Array Handling', () => {
+    it('should process all elements', () => {
+      // expect(utilityFunction([1, 2, 3])).toEqual([2, 4, 6])
+    })
+
+    it('should handle single element array', () => {
+      // expect(utilityFunction([1])).toEqual([2])
+    })
+
+    it('should preserve order', () => {
+      // expect(utilityFunction(['c', 'a', 'b'])).toEqual(['c', 'a', 'b'])
+    })
+  })
+})

.claude/skills/frontend-testing/references/async-testing.md

@@ -0,0 +1,345 @@
+# Async Testing Guide
+
+## Core Async Patterns
+
+### 1. waitFor - Wait for Condition
+
+```typescript
+import { render, screen, waitFor } from '@testing-library/react'
+
+it('should load and display data', async () => {
+  render(<DataComponent />)
+  
+  // Wait for element to appear
+  await waitFor(() => {
+    expect(screen.getByText('Loaded Data')).toBeInTheDocument()
+  })
+})
+
+it('should hide loading spinner after load', async () => {
+  render(<DataComponent />)
+  
+  // Wait for element to disappear
+  await waitFor(() => {
+    expect(screen.queryByText('Loading...')).not.toBeInTheDocument()
+  })
+})
+```
+
+### 2. findBy\* - Async Queries
+
+```typescript
+it('should show user name after fetch', async () => {
+  render(<UserProfile />)
+  
+  // findBy returns a promise, auto-waits up to 1000ms
+  const userName = await screen.findByText('John Doe')
+  expect(userName).toBeInTheDocument()
+  
+  // findByRole with options
+  const button = await screen.findByRole('button', { name: /submit/i })
+  expect(button).toBeEnabled()
+})
+```
+
+### 3. userEvent for Async Interactions
+
+```typescript
+import userEvent from '@testing-library/user-event'
+
+it('should submit form', async () => {
+  const user = userEvent.setup()
+  const onSubmit = vi.fn()
+  
+  render(<Form onSubmit={onSubmit} />)
+  
+  // userEvent methods are async
+  await user.type(screen.getByLabelText('Email'), 'test@example.com')
+  await user.click(screen.getByRole('button', { name: /submit/i }))
+  
+  await waitFor(() => {
+    expect(onSubmit).toHaveBeenCalledWith({ email: 'test@example.com' })
+  })
+})
+```
+
+## Fake Timers
+
+### When to Use Fake Timers
+
+- Testing components with `setTimeout`/`setInterval`
+- Testing debounce/throttle behavior
+- Testing animations or delayed transitions
+- Testing polling or retry logic
+
+### Basic Fake Timer Setup
+
+```typescript
+describe('Debounced Search', () => {
+  beforeEach(() => {
+    vi.useFakeTimers()
+  })
+
+  afterEach(() => {
+    vi.useRealTimers()
+  })
+
+  it('should debounce search input', async () => {
+    const onSearch = vi.fn()
+    render(<SearchInput onSearch={onSearch} debounceMs={300} />)
+    
+    // Type in the input
+    fireEvent.change(screen.getByRole('textbox'), { target: { value: 'query' } })
+    
+    // Search not called immediately
+    expect(onSearch).not.toHaveBeenCalled()
+    
+    // Advance timers
+    vi.advanceTimersByTime(300)
+    
+    // Now search is called
+    expect(onSearch).toHaveBeenCalledWith('query')
+  })
+})
+```
+
+### Fake Timers with Async Code
+
+```typescript
+it('should retry on failure', async () => {
+  vi.useFakeTimers()
+  const fetchData = vi.fn()
+    .mockRejectedValueOnce(new Error('Network error'))
+    .mockResolvedValueOnce({ data: 'success' })
+  
+  render(<RetryComponent fetchData={fetchData} retryDelayMs={1000} />)
+  
+  // First call fails
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(1)
+  })
+  
+  // Advance timer for retry
+  vi.advanceTimersByTime(1000)
+  
+  // Second call succeeds
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(2)
+    expect(screen.getByText('success')).toBeInTheDocument()
+  })
+  
+  vi.useRealTimers()
+})
+```
+
+### Common Fake Timer Utilities
+
+```typescript
+// Run all pending timers
+vi.runAllTimers()
+
+// Run only pending timers (not new ones created during execution)
+vi.runOnlyPendingTimers()
+
+// Advance by specific time
+vi.advanceTimersByTime(1000)
+
+// Get current fake time
+Date.now()
+
+// Clear all timers
+vi.clearAllTimers()
+```
+
+## API Testing Patterns
+
+### Loading → Success → Error States
+
+```typescript
+describe('DataFetcher', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should show loading state', () => {
+    mockedApi.fetchData.mockImplementation(() => new Promise(() => {})) // Never resolves
+    
+    render(<DataFetcher />)
+    
+    expect(screen.getByTestId('loading-spinner')).toBeInTheDocument()
+  })
+
+  it('should show data on success', async () => {
+    mockedApi.fetchData.mockResolvedValue({ items: ['Item 1', 'Item 2'] })
+    
+    render(<DataFetcher />)
+    
+    // Use findBy* for multiple async elements (better error messages than waitFor with multiple assertions)
+    const item1 = await screen.findByText('Item 1')
+    const item2 = await screen.findByText('Item 2')
+    expect(item1).toBeInTheDocument()
+    expect(item2).toBeInTheDocument()
+    
+    expect(screen.queryByTestId('loading-spinner')).not.toBeInTheDocument()
+  })
+
+  it('should show error on failure', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Failed to fetch'))
+    
+    render(<DataFetcher />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/failed to fetch/i)).toBeInTheDocument()
+    })
+  })
+
+  it('should retry on error', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+    
+    render(<DataFetcher />)
+    
+    await waitFor(() => {
+      expect(screen.getByRole('button', { name: /retry/i })).toBeInTheDocument()
+    })
+    
+    mockedApi.fetchData.mockResolvedValue({ items: ['Item 1'] })
+    fireEvent.click(screen.getByRole('button', { name: /retry/i }))
+    
+    await waitFor(() => {
+      expect(screen.getByText('Item 1')).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### Testing Mutations
+
+```typescript
+it('should submit form and show success', async () => {
+  const user = userEvent.setup()
+  mockedApi.createItem.mockResolvedValue({ id: '1', name: 'New Item' })
+  
+  render(<CreateItemForm />)
+  
+  await user.type(screen.getByLabelText('Name'), 'New Item')
+  await user.click(screen.getByRole('button', { name: /create/i }))
+  
+  // Button should be disabled during submission
+  expect(screen.getByRole('button', { name: /creating/i })).toBeDisabled()
+  
+  await waitFor(() => {
+    expect(screen.getByText(/created successfully/i)).toBeInTheDocument()
+  })
+  
+  expect(mockedApi.createItem).toHaveBeenCalledWith({ name: 'New Item' })
+})
+```
+
+## useEffect Testing
+
+### Testing Effect Execution
+
+```typescript
+it('should fetch data on mount', async () => {
+  const fetchData = vi.fn().mockResolvedValue({ data: 'test' })
+  
+  render(<ComponentWithEffect fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledTimes(1)
+  })
+})
+```
+
+### Testing Effect Dependencies
+
+```typescript
+it('should refetch when id changes', async () => {
+  const fetchData = vi.fn().mockResolvedValue({ data: 'test' })
+  
+  const { rerender } = render(<ComponentWithEffect id="1" fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledWith('1')
+  })
+  
+  rerender(<ComponentWithEffect id="2" fetchData={fetchData} />)
+  
+  await waitFor(() => {
+    expect(fetchData).toHaveBeenCalledWith('2')
+    expect(fetchData).toHaveBeenCalledTimes(2)
+  })
+})
+```
+
+### Testing Effect Cleanup
+
+```typescript
+it('should cleanup subscription on unmount', () => {
+  const subscribe = vi.fn()
+  const unsubscribe = vi.fn()
+  subscribe.mockReturnValue(unsubscribe)
+  
+  const { unmount } = render(<SubscriptionComponent subscribe={subscribe} />)
+  
+  expect(subscribe).toHaveBeenCalledTimes(1)
+  
+  unmount()
+  
+  expect(unsubscribe).toHaveBeenCalledTimes(1)
+})
+```
+
+## Common Async Pitfalls
+
+### ❌ Don't: Forget to await
+
+```typescript
+// Bad - test may pass even if assertion fails
+it('should load data', () => {
+  render(<Component />)
+  waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+
+// Good - properly awaited
+it('should load data', async () => {
+  render(<Component />)
+  await waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+```
+
+### ❌ Don't: Use multiple assertions in single waitFor
+
+```typescript
+// Bad - if first assertion fails, won't know about second
+await waitFor(() => {
+  expect(screen.getByText('Title')).toBeInTheDocument()
+  expect(screen.getByText('Description')).toBeInTheDocument()
+})
+
+// Good - separate waitFor or use findBy
+const title = await screen.findByText('Title')
+const description = await screen.findByText('Description')
+expect(title).toBeInTheDocument()
+expect(description).toBeInTheDocument()
+```
+
+### ❌ Don't: Mix fake timers with real async
+
+```typescript
+// Bad - fake timers don't work well with real Promises
+vi.useFakeTimers()
+await waitFor(() => {
+  expect(screen.getByText('Data')).toBeInTheDocument()
+}) // May timeout!
+
+// Good - use runAllTimers or advanceTimersByTime
+vi.useFakeTimers()
+render(<Component />)
+vi.runAllTimers()
+expect(screen.getByText('Data')).toBeInTheDocument()
+```

.claude/skills/frontend-testing/references/checklist.md

@@ -0,0 +1,205 @@
+# Test Generation Checklist
+
+Use this checklist when generating or reviewing tests for Dify frontend components.
+
+## Pre-Generation
+
+- [ ] Read the component source code completely
+- [ ] Identify component type (component, hook, utility, page)
+- [ ] Run `pnpm analyze-component <path>` if available
+- [ ] Note complexity score and features detected
+- [ ] Check for existing tests in the same directory
+- [ ] **Identify ALL files in the directory** that need testing (not just index)
+
+## Testing Strategy
+
+### ⚠️ Incremental Workflow (CRITICAL for Multi-File)
+
+- [ ] **NEVER generate all tests at once** - process one file at a time
+- [ ] Order files by complexity: utilities → hooks → simple → complex → integration
+- [ ] Create a todo list to track progress before starting
+- [ ] For EACH file: write → run test → verify pass → then next
+- [ ] **DO NOT proceed** to next file until current one passes
+
+### Path-Level Coverage
+
+- [ ] **Test ALL files** in the assigned directory/path
+- [ ] List all components, hooks, utilities that need coverage
+- [ ] Decide: single spec file (integration) or multiple spec files (unit)
+
+### Complexity Assessment
+
+- [ ] Run `pnpm analyze-component <path>` for complexity score
+- [ ] **Complexity > 50**: Consider refactoring before testing
+- [ ] **500+ lines**: Consider splitting before testing
+- [ ] **30-50 complexity**: Use multiple describe blocks, organized structure
+
+### Integration vs Mocking
+
+- [ ] **DO NOT mock base components** (`Loading`, `Button`, `Tooltip`, etc.)
+- [ ] Import real project components instead of mocking
+- [ ] Only mock: API calls, complex context providers, third-party libs with side effects
+- [ ] Prefer integration testing when using single spec file
+
+## Required Test Sections
+
+### All Components MUST Have
+
+- [ ] **Rendering tests** - Component renders without crashing
+- [ ] **Props tests** - Required props, optional props, default values
+- [ ] **Edge cases** - null, undefined, empty values, boundaries
+
+### Conditional Sections (Add When Feature Present)
+
+| Feature | Add Tests For |
+|---------|---------------|
+| `useState` | Initial state, transitions, cleanup |
+| `useEffect` | Execution, dependencies, cleanup |
+| Event handlers | onClick, onChange, onSubmit, keyboard |
+| API calls | Loading, success, error states |
+| Routing | Navigation, params, query strings |
+| `useCallback`/`useMemo` | Referential equality |
+| Context | Provider values, consumer behavior |
+| Forms | Validation, submission, error display |
+
+## Code Quality Checklist
+
+### Structure
+
+- [ ] Uses `describe` blocks to group related tests
+- [ ] Test names follow `should <behavior> when <condition>` pattern
+- [ ] AAA pattern (Arrange-Act-Assert) is clear
+- [ ] Comments explain complex test scenarios
+
+### Mocks
+
+- [ ] **DO NOT mock base components** (`@/app/components/base/*`)
+- [ ] `vi.clearAllMocks()` in `beforeEach` (not `afterEach`)
+- [ ] Shared mock state reset in `beforeEach`
+- [ ] i18n uses global mock (auto-loaded in `web/vitest.setup.ts`); only override locally for custom translations
+- [ ] Router mocks match actual Next.js API
+- [ ] Mocks reflect actual component conditional behavior
+- [ ] Only mock: API services, complex context providers, third-party libs
+
+### Queries
+
+- [ ] Prefer semantic queries (`getByRole`, `getByLabelText`)
+- [ ] Use `queryBy*` for absence assertions
+- [ ] Use `findBy*` for async elements
+- [ ] `getByTestId` only as last resort
+
+### Async
+
+- [ ] All async tests use `async/await`
+- [ ] `waitFor` wraps async assertions
+- [ ] Fake timers properly setup/teardown
+- [ ] No floating promises
+
+### TypeScript
+
+- [ ] No `any` types without justification
+- [ ] Mock data uses actual types from source
+- [ ] Factory functions have proper return types
+
+## Coverage Goals (Per File)
+
+For the current file being tested:
+
+- [ ] 100% function coverage
+- [ ] 100% statement coverage
+- [ ] >95% branch coverage
+- [ ] >95% line coverage
+
+## Post-Generation (Per File)
+
+**Run these checks after EACH test file, not just at the end:**
+
+- [ ] Run `pnpm test -- path/to/file.spec.tsx` - **MUST PASS before next file**
+- [ ] Fix any failures immediately
+- [ ] Mark file as complete in todo list
+- [ ] Only then proceed to next file
+
+### After All Files Complete
+
+- [ ] Run full directory test: `pnpm test -- path/to/directory/`
+- [ ] Check coverage report: `pnpm test -- --coverage`
+- [ ] Run `pnpm lint:fix` on all test files
+- [ ] Run `pnpm type-check:tsgo`
+
+## Common Issues to Watch
+
+### False Positives
+
+```typescript
+// ❌ Mock doesn't match actual behavior
+vi.mock('./Component', () => () => <div>Mocked</div>)
+
+// ✅ Mock matches actual conditional logic
+vi.mock('./Component', () => ({ isOpen }: any) =>
+  isOpen ? <div>Content</div> : null
+)
+```
+
+### State Leakage
+
+```typescript
+// ❌ Shared state not reset
+let mockState = false
+vi.mock('./useHook', () => () => mockState)
+
+// ✅ Reset in beforeEach
+beforeEach(() => {
+  mockState = false
+})
+```
+
+### Async Race Conditions
+
+```typescript
+// ❌ Not awaited
+it('loads data', () => {
+  render(<Component />)
+  expect(screen.getByText('Data')).toBeInTheDocument()
+})
+
+// ✅ Properly awaited
+it('loads data', async () => {
+  render(<Component />)
+  await waitFor(() => {
+    expect(screen.getByText('Data')).toBeInTheDocument()
+  })
+})
+```
+
+### Missing Edge Cases
+
+Always test these scenarios:
+
+- `null` / `undefined` inputs
+- Empty strings / arrays / objects
+- Boundary values (0, -1, MAX_INT)
+- Error states
+- Loading states
+- Disabled states
+
+## Quick Commands
+
+```bash
+# Run specific test
+pnpm test -- path/to/file.spec.tsx
+
+# Run with coverage
+pnpm test -- --coverage path/to/file.spec.tsx
+
+# Watch mode
+pnpm test:watch -- path/to/file.spec.tsx
+
+# Update snapshots (use sparingly)
+pnpm test -- -u path/to/file.spec.tsx
+
+# Analyze component
+pnpm analyze-component path/to/component.tsx
+
+# Review existing test
+pnpm analyze-component path/to/component.tsx --review
+```

.claude/skills/frontend-testing/references/common-patterns.md

@@ -0,0 +1,449 @@
+# Common Testing Patterns
+
+## Query Priority
+
+Use queries in this order (most to least preferred):
+
+```typescript
+// 1. getByRole - Most recommended (accessibility)
+screen.getByRole('button', { name: /submit/i })
+screen.getByRole('textbox', { name: /email/i })
+screen.getByRole('heading', { level: 1 })
+
+// 2. getByLabelText - Form fields
+screen.getByLabelText('Email address')
+screen.getByLabelText(/password/i)
+
+// 3. getByPlaceholderText - When no label
+screen.getByPlaceholderText('Search...')
+
+// 4. getByText - Non-interactive elements
+screen.getByText('Welcome to Dify')
+screen.getByText(/loading/i)
+
+// 5. getByDisplayValue - Current input value
+screen.getByDisplayValue('current value')
+
+// 6. getByAltText - Images
+screen.getByAltText('Company logo')
+
+// 7. getByTitle - Tooltip elements
+screen.getByTitle('Close')
+
+// 8. getByTestId - Last resort only!
+screen.getByTestId('custom-element')
+```
+
+## Event Handling Patterns
+
+### Click Events
+
+```typescript
+// Basic click
+fireEvent.click(screen.getByRole('button'))
+
+// With userEvent (preferred for realistic interaction)
+const user = userEvent.setup()
+await user.click(screen.getByRole('button'))
+
+// Double click
+await user.dblClick(screen.getByRole('button'))
+
+// Right click
+await user.pointer({ keys: '[MouseRight]', target: screen.getByRole('button') })
+```
+
+### Form Input
+
+```typescript
+const user = userEvent.setup()
+
+// Type in input
+await user.type(screen.getByRole('textbox'), 'Hello World')
+
+// Clear and type
+await user.clear(screen.getByRole('textbox'))
+await user.type(screen.getByRole('textbox'), 'New value')
+
+// Select option
+await user.selectOptions(screen.getByRole('combobox'), 'option-value')
+
+// Check checkbox
+await user.click(screen.getByRole('checkbox'))
+
+// Upload file
+const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+await user.upload(screen.getByLabelText(/upload/i), file)
+```
+
+### Keyboard Events
+
+```typescript
+const user = userEvent.setup()
+
+// Press Enter
+await user.keyboard('{Enter}')
+
+// Press Escape
+await user.keyboard('{Escape}')
+
+// Keyboard shortcut
+await user.keyboard('{Control>}a{/Control}') // Ctrl+A
+
+// Tab navigation
+await user.tab()
+
+// Arrow keys
+await user.keyboard('{ArrowDown}')
+await user.keyboard('{ArrowUp}')
+```
+
+## Component State Testing
+
+### Testing State Transitions
+
+```typescript
+describe('Counter', () => {
+  it('should increment count', async () => {
+    const user = userEvent.setup()
+    render(<Counter initialCount={0} />)
+    
+    // Initial state
+    expect(screen.getByText('Count: 0')).toBeInTheDocument()
+    
+    // Trigger transition
+    await user.click(screen.getByRole('button', { name: /increment/i }))
+    
+    // New state
+    expect(screen.getByText('Count: 1')).toBeInTheDocument()
+  })
+})
+```
+
+### Testing Controlled Components
+
+```typescript
+describe('ControlledInput', () => {
+  it('should call onChange with new value', async () => {
+    const user = userEvent.setup()
+    const handleChange = vi.fn()
+    
+    render(<ControlledInput value="" onChange={handleChange} />)
+    
+    await user.type(screen.getByRole('textbox'), 'a')
+    
+    expect(handleChange).toHaveBeenCalledWith('a')
+  })
+
+  it('should display controlled value', () => {
+    render(<ControlledInput value="controlled" onChange={vi.fn()} />)
+    
+    expect(screen.getByRole('textbox')).toHaveValue('controlled')
+  })
+})
+```
+
+## Conditional Rendering Testing
+
+```typescript
+describe('ConditionalComponent', () => {
+  it('should show loading state', () => {
+    render(<DataDisplay isLoading={true} data={null} />)
+    
+    expect(screen.getByText(/loading/i)).toBeInTheDocument()
+    expect(screen.queryByTestId('data-content')).not.toBeInTheDocument()
+  })
+
+  it('should show error state', () => {
+    render(<DataDisplay isLoading={false} data={null} error="Failed to load" />)
+    
+    expect(screen.getByText(/failed to load/i)).toBeInTheDocument()
+  })
+
+  it('should show data when loaded', () => {
+    render(<DataDisplay isLoading={false} data={{ name: 'Test' }} />)
+    
+    expect(screen.getByText('Test')).toBeInTheDocument()
+  })
+
+  it('should show empty state when no data', () => {
+    render(<DataDisplay isLoading={false} data={[]} />)
+    
+    expect(screen.getByText(/no data/i)).toBeInTheDocument()
+  })
+})
+```
+
+## List Rendering Testing
+
+```typescript
+describe('ItemList', () => {
+  const items = [
+    { id: '1', name: 'Item 1' },
+    { id: '2', name: 'Item 2' },
+    { id: '3', name: 'Item 3' },
+  ]
+
+  it('should render all items', () => {
+    render(<ItemList items={items} />)
+    
+    expect(screen.getAllByRole('listitem')).toHaveLength(3)
+    items.forEach(item => {
+      expect(screen.getByText(item.name)).toBeInTheDocument()
+    })
+  })
+
+  it('should handle item selection', async () => {
+    const user = userEvent.setup()
+    const onSelect = vi.fn()
+    
+    render(<ItemList items={items} onSelect={onSelect} />)
+    
+    await user.click(screen.getByText('Item 2'))
+    
+    expect(onSelect).toHaveBeenCalledWith(items[1])
+  })
+
+  it('should handle empty list', () => {
+    render(<ItemList items={[]} />)
+    
+    expect(screen.getByText(/no items/i)).toBeInTheDocument()
+  })
+})
+```
+
+## Modal/Dialog Testing
+
+```typescript
+describe('Modal', () => {
+  it('should not render when closed', () => {
+    render(<Modal isOpen={false} onClose={vi.fn()} />)
+    
+    expect(screen.queryByRole('dialog')).not.toBeInTheDocument()
+  })
+
+  it('should render when open', () => {
+    render(<Modal isOpen={true} onClose={vi.fn()} />)
+    
+    expect(screen.getByRole('dialog')).toBeInTheDocument()
+  })
+
+  it('should call onClose when clicking overlay', async () => {
+    const user = userEvent.setup()
+    const handleClose = vi.fn()
+    
+    render(<Modal isOpen={true} onClose={handleClose} />)
+    
+    await user.click(screen.getByTestId('modal-overlay'))
+    
+    expect(handleClose).toHaveBeenCalled()
+  })
+
+  it('should call onClose when pressing Escape', async () => {
+    const user = userEvent.setup()
+    const handleClose = vi.fn()
+    
+    render(<Modal isOpen={true} onClose={handleClose} />)
+    
+    await user.keyboard('{Escape}')
+    
+    expect(handleClose).toHaveBeenCalled()
+  })
+
+  it('should trap focus inside modal', async () => {
+    const user = userEvent.setup()
+    
+    render(
+      <Modal isOpen={true} onClose={vi.fn()}>
+        <button>First</button>
+        <button>Second</button>
+      </Modal>
+    )
+    
+    // Focus should cycle within modal
+    await user.tab()
+    expect(screen.getByText('First')).toHaveFocus()
+    
+    await user.tab()
+    expect(screen.getByText('Second')).toHaveFocus()
+    
+    await user.tab()
+    expect(screen.getByText('First')).toHaveFocus() // Cycles back
+  })
+})
+```
+
+## Form Testing
+
+```typescript
+describe('LoginForm', () => {
+  it('should submit valid form', async () => {
+    const user = userEvent.setup()
+    const onSubmit = vi.fn()
+    
+    render(<LoginForm onSubmit={onSubmit} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'test@example.com')
+    await user.type(screen.getByLabelText(/password/i), 'password123')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(onSubmit).toHaveBeenCalledWith({
+      email: 'test@example.com',
+      password: 'password123',
+    })
+  })
+
+  it('should show validation errors', async () => {
+    const user = userEvent.setup()
+    
+    render(<LoginForm onSubmit={vi.fn()} />)
+    
+    // Submit empty form
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByText(/email is required/i)).toBeInTheDocument()
+    expect(screen.getByText(/password is required/i)).toBeInTheDocument()
+  })
+
+  it('should validate email format', async () => {
+    const user = userEvent.setup()
+    
+    render(<LoginForm onSubmit={vi.fn()} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'invalid-email')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByText(/invalid email/i)).toBeInTheDocument()
+  })
+
+  it('should disable submit button while submitting', async () => {
+    const user = userEvent.setup()
+    const onSubmit = vi.fn(() => new Promise(resolve => setTimeout(resolve, 100)))
+    
+    render(<LoginForm onSubmit={onSubmit} />)
+    
+    await user.type(screen.getByLabelText(/email/i), 'test@example.com')
+    await user.type(screen.getByLabelText(/password/i), 'password123')
+    await user.click(screen.getByRole('button', { name: /sign in/i }))
+    
+    expect(screen.getByRole('button', { name: /signing in/i })).toBeDisabled()
+    
+    await waitFor(() => {
+      expect(screen.getByRole('button', { name: /sign in/i })).toBeEnabled()
+    })
+  })
+})
+```
+
+## Data-Driven Tests with test.each
+
+```typescript
+describe('StatusBadge', () => {
+  test.each([
+    ['success', 'bg-green-500'],
+    ['warning', 'bg-yellow-500'],
+    ['error', 'bg-red-500'],
+    ['info', 'bg-blue-500'],
+  ])('should apply correct class for %s status', (status, expectedClass) => {
+    render(<StatusBadge status={status} />)
+    
+    expect(screen.getByTestId('status-badge')).toHaveClass(expectedClass)
+  })
+
+  test.each([
+    { input: null, expected: 'Unknown' },
+    { input: undefined, expected: 'Unknown' },
+    { input: '', expected: 'Unknown' },
+    { input: 'invalid', expected: 'Unknown' },
+  ])('should show "Unknown" for invalid input: $input', ({ input, expected }) => {
+    render(<StatusBadge status={input} />)
+    
+    expect(screen.getByText(expected)).toBeInTheDocument()
+  })
+})
+```
+
+## Debugging Tips
+
+```typescript
+// Print entire DOM
+screen.debug()
+
+// Print specific element
+screen.debug(screen.getByRole('button'))
+
+// Log testing playground URL
+screen.logTestingPlaygroundURL()
+
+// Pretty print DOM
+import { prettyDOM } from '@testing-library/react'
+console.log(prettyDOM(screen.getByRole('dialog')))
+
+// Check available roles
+import { getRoles } from '@testing-library/react'
+console.log(getRoles(container))
+```
+
+## Common Mistakes to Avoid
+
+### ❌ Don't Use Implementation Details
+
+```typescript
+// Bad - testing implementation
+expect(component.state.isOpen).toBe(true)
+expect(wrapper.find('.internal-class').length).toBe(1)
+
+// Good - testing behavior
+expect(screen.getByRole('dialog')).toBeInTheDocument()
+```
+
+### ❌ Don't Forget Cleanup
+
+```typescript
+// Bad - may leak state between tests
+it('test 1', () => {
+  render(<Component />)
+})
+
+// Good - cleanup is automatic with RTL, but reset mocks
+beforeEach(() => {
+  vi.clearAllMocks()
+})
+```
+
+### ❌ Don't Use Exact String Matching (Prefer Black-Box Assertions)
+
+```typescript
+// ❌ Bad - hardcoded strings are brittle
+expect(screen.getByText('Submit Form')).toBeInTheDocument()
+expect(screen.getByText('Loading...')).toBeInTheDocument()
+
+// ✅ Good - role-based queries (most semantic)
+expect(screen.getByRole('button', { name: /submit/i })).toBeInTheDocument()
+expect(screen.getByRole('status')).toBeInTheDocument()
+
+// ✅ Good - pattern matching (flexible)
+expect(screen.getByText(/submit/i)).toBeInTheDocument()
+expect(screen.getByText(/loading/i)).toBeInTheDocument()
+
+// ✅ Good - test behavior, not exact UI text
+expect(screen.getByRole('button')).toBeDisabled()
+expect(screen.getByRole('alert')).toBeInTheDocument()
+```
+
+**Why prefer black-box assertions?**
+
+- Text content may change (i18n, copy updates)
+- Role-based queries test accessibility
+- Pattern matching is resilient to minor changes
+- Tests focus on behavior, not implementation details
+
+### ❌ Don't Assert on Absence Without Query
+
+```typescript
+// Bad - throws if not found
+expect(screen.getByText('Error')).not.toBeInTheDocument() // Error!
+
+// Good - use queryBy for absence assertions
+expect(screen.queryByText('Error')).not.toBeInTheDocument()
+```

.claude/skills/frontend-testing/references/domain-components.md

@@ -0,0 +1,523 @@
+# Domain-Specific Component Testing
+
+This guide covers testing patterns for Dify's domain-specific components.
+
+## Workflow Components (`workflow/`)
+
+Workflow components handle node configuration, data flow, and graph operations.
+
+### Key Test Areas
+
+1. **Node Configuration**
+1. **Data Validation**
+1. **Variable Passing**
+1. **Edge Connections**
+1. **Error Handling**
+
+### Example: Node Configuration Panel
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import NodeConfigPanel from './node-config-panel'
+import { createMockNode, createMockWorkflowContext } from '@/__mocks__/workflow'
+
+// Mock workflow context
+vi.mock('@/app/components/workflow/hooks', () => ({
+  useWorkflowStore: () => mockWorkflowStore,
+  useNodesInteractions: () => mockNodesInteractions,
+}))
+
+let mockWorkflowStore = {
+  nodes: [],
+  edges: [],
+  updateNode: vi.fn(),
+}
+
+let mockNodesInteractions = {
+  handleNodeSelect: vi.fn(),
+  handleNodeDelete: vi.fn(),
+}
+
+describe('NodeConfigPanel', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockWorkflowStore = {
+      nodes: [],
+      edges: [],
+      updateNode: vi.fn(),
+    }
+  })
+
+  describe('Node Configuration', () => {
+    it('should render node type selector', () => {
+      const node = createMockNode({ type: 'llm' })
+      render(<NodeConfigPanel node={node} />)
+      
+      expect(screen.getByLabelText(/model/i)).toBeInTheDocument()
+    })
+
+    it('should update node config on change', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'llm' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      await user.selectOptions(screen.getByLabelText(/model/i), 'gpt-4')
+      
+      expect(mockWorkflowStore.updateNode).toHaveBeenCalledWith(
+        node.id,
+        expect.objectContaining({ model: 'gpt-4' })
+      )
+    })
+  })
+
+  describe('Data Validation', () => {
+    it('should show error for invalid input', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'code' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      // Enter invalid code
+      const codeInput = screen.getByLabelText(/code/i)
+      await user.clear(codeInput)
+      await user.type(codeInput, 'invalid syntax {{{')
+      
+      await waitFor(() => {
+        expect(screen.getByText(/syntax error/i)).toBeInTheDocument()
+      })
+    })
+
+    it('should validate required fields', async () => {
+      const node = createMockNode({ type: 'http', data: { url: '' } })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      fireEvent.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/url is required/i)).toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Variable Passing', () => {
+    it('should display available variables from upstream nodes', () => {
+      const upstreamNode = createMockNode({
+        id: 'node-1',
+        type: 'start',
+        data: { outputs: [{ name: 'user_input', type: 'string' }] },
+      })
+      const currentNode = createMockNode({
+        id: 'node-2',
+        type: 'llm',
+      })
+      
+      mockWorkflowStore.nodes = [upstreamNode, currentNode]
+      mockWorkflowStore.edges = [{ source: 'node-1', target: 'node-2' }]
+      
+      render(<NodeConfigPanel node={currentNode} />)
+      
+      // Variable selector should show upstream variables
+      fireEvent.click(screen.getByRole('button', { name: /add variable/i }))
+      
+      expect(screen.getByText('user_input')).toBeInTheDocument()
+    })
+
+    it('should insert variable into prompt template', async () => {
+      const user = userEvent.setup()
+      const node = createMockNode({ type: 'llm' })
+      
+      render(<NodeConfigPanel node={node} />)
+      
+      // Click variable button
+      await user.click(screen.getByRole('button', { name: /insert variable/i }))
+      await user.click(screen.getByText('user_input'))
+      
+      const promptInput = screen.getByLabelText(/prompt/i)
+      expect(promptInput).toHaveValue(expect.stringContaining('{{user_input}}'))
+    })
+  })
+})
+```
+
+## Dataset Components (`dataset/`)
+
+Dataset components handle file uploads, data display, and search/filter operations.
+
+### Key Test Areas
+
+1. **File Upload**
+1. **File Type Validation**
+1. **Pagination**
+1. **Search & Filtering**
+1. **Data Format Handling**
+
+### Example: Document Uploader
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import DocumentUploader from './document-uploader'
+
+vi.mock('@/service/datasets', () => ({
+  uploadDocument: vi.fn(),
+  parseDocument: vi.fn(),
+}))
+
+import * as datasetService from '@/service/datasets'
+const mockedService = vi.mocked(datasetService)
+
+describe('DocumentUploader', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  describe('File Upload', () => {
+    it('should accept valid file types', async () => {
+      const user = userEvent.setup()
+      const onUpload = vi.fn()
+      mockedService.uploadDocument.mockResolvedValue({ id: 'doc-1' })
+      
+      render(<DocumentUploader onUpload={onUpload} />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      const input = screen.getByLabelText(/upload/i)
+      
+      await user.upload(input, file)
+      
+      await waitFor(() => {
+        expect(mockedService.uploadDocument).toHaveBeenCalledWith(
+          expect.any(FormData)
+        )
+      })
+    })
+
+    it('should reject invalid file types', async () => {
+      const user = userEvent.setup()
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.exe', { type: 'application/x-msdownload' })
+      const input = screen.getByLabelText(/upload/i)
+      
+      await user.upload(input, file)
+      
+      expect(screen.getByText(/unsupported file type/i)).toBeInTheDocument()
+      expect(mockedService.uploadDocument).not.toHaveBeenCalled()
+    })
+
+    it('should show upload progress', async () => {
+      const user = userEvent.setup()
+      
+      // Mock upload with progress
+      mockedService.uploadDocument.mockImplementation(() => {
+        return new Promise((resolve) => {
+          setTimeout(() => resolve({ id: 'doc-1' }), 100)
+        })
+      })
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      expect(screen.getByRole('progressbar')).toBeInTheDocument()
+      
+      await waitFor(() => {
+        expect(screen.queryByRole('progressbar')).not.toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Error Handling', () => {
+    it('should handle upload failure', async () => {
+      const user = userEvent.setup()
+      mockedService.uploadDocument.mockRejectedValue(new Error('Upload failed'))
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      await waitFor(() => {
+        expect(screen.getByText(/upload failed/i)).toBeInTheDocument()
+      })
+    })
+
+    it('should allow retry after failure', async () => {
+      const user = userEvent.setup()
+      mockedService.uploadDocument
+        .mockRejectedValueOnce(new Error('Network error'))
+        .mockResolvedValueOnce({ id: 'doc-1' })
+      
+      render(<DocumentUploader />)
+      
+      const file = new File(['content'], 'test.pdf', { type: 'application/pdf' })
+      await user.upload(screen.getByLabelText(/upload/i), file)
+      
+      await waitFor(() => {
+        expect(screen.getByRole('button', { name: /retry/i })).toBeInTheDocument()
+      })
+      
+      await user.click(screen.getByRole('button', { name: /retry/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/uploaded successfully/i)).toBeInTheDocument()
+      })
+    })
+  })
+})
+```
+
+### Example: Document List with Pagination
+
+```typescript
+describe('DocumentList', () => {
+  describe('Pagination', () => {
+    it('should load first page on mount', async () => {
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '1', name: 'Doc 1' }],
+        total: 50,
+        page: 1,
+        pageSize: 10,
+      })
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 1')).toBeInTheDocument()
+      })
+      
+      expect(mockedService.getDocuments).toHaveBeenCalledWith('ds-1', { page: 1 })
+    })
+
+    it('should navigate to next page', async () => {
+      const user = userEvent.setup()
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '1', name: 'Doc 1' }],
+        total: 50,
+        page: 1,
+        pageSize: 10,
+      })
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 1')).toBeInTheDocument()
+      })
+      
+      mockedService.getDocuments.mockResolvedValue({
+        data: [{ id: '11', name: 'Doc 11' }],
+        total: 50,
+        page: 2,
+        pageSize: 10,
+      })
+      
+      await user.click(screen.getByRole('button', { name: /next/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText('Doc 11')).toBeInTheDocument()
+      })
+    })
+  })
+
+  describe('Search & Filtering', () => {
+    it('should filter by search query', async () => {
+      const user = userEvent.setup()
+      vi.useFakeTimers()
+      
+      render(<DocumentList datasetId="ds-1" />)
+      
+      await user.type(screen.getByPlaceholderText(/search/i), 'test query')
+      
+      // Debounce
+      vi.advanceTimersByTime(300)
+      
+      await waitFor(() => {
+        expect(mockedService.getDocuments).toHaveBeenCalledWith(
+          'ds-1',
+          expect.objectContaining({ search: 'test query' })
+        )
+      })
+      
+      vi.useRealTimers()
+    })
+  })
+})
+```
+
+## Configuration Components (`app/configuration/`, `config/`)
+
+Configuration components handle forms, validation, and data persistence.
+
+### Key Test Areas
+
+1. **Form Validation**
+1. **Save/Reset**
+1. **Required vs Optional Fields**
+1. **Configuration Persistence**
+1. **Error Feedback**
+
+### Example: App Configuration Form
+
+```typescript
+import { render, screen, fireEvent, waitFor } from '@testing-library/react'
+import userEvent from '@testing-library/user-event'
+import AppConfigForm from './app-config-form'
+
+vi.mock('@/service/apps', () => ({
+  updateAppConfig: vi.fn(),
+  getAppConfig: vi.fn(),
+}))
+
+import * as appService from '@/service/apps'
+const mockedService = vi.mocked(appService)
+
+describe('AppConfigForm', () => {
+  const defaultConfig = {
+    name: 'My App',
+    description: '',
+    icon: 'default',
+    openingStatement: '',
+  }
+
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockedService.getAppConfig.mockResolvedValue(defaultConfig)
+  })
+
+  describe('Form Validation', () => {
+    it('should require app name', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Clear name field
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      expect(screen.getByText(/name is required/i)).toBeInTheDocument()
+      expect(mockedService.updateAppConfig).not.toHaveBeenCalled()
+    })
+
+    it('should validate name length', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toBeInTheDocument()
+      })
+      
+      // Enter very long name
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'a'.repeat(101))
+      
+      expect(screen.getByText(/name must be less than 100 characters/i)).toBeInTheDocument()
+    })
+
+    it('should allow empty optional fields', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockResolvedValue({ success: true })
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Leave description empty (optional)
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(mockedService.updateAppConfig).toHaveBeenCalled()
+      })
+    })
+  })
+
+  describe('Save/Reset Functionality', () => {
+    it('should save configuration', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockResolvedValue({ success: true })
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'Updated App')
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(mockedService.updateAppConfig).toHaveBeenCalledWith(
+          'app-1',
+          expect.objectContaining({ name: 'Updated App' })
+        )
+      })
+      
+      expect(screen.getByText(/saved successfully/i)).toBeInTheDocument()
+    })
+
+    it('should reset to default values', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Make changes
+      await user.clear(screen.getByLabelText(/name/i))
+      await user.type(screen.getByLabelText(/name/i), 'Changed Name')
+      
+      // Reset
+      await user.click(screen.getByRole('button', { name: /reset/i }))
+      
+      expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+    })
+
+    it('should show unsaved changes warning', async () => {
+      const user = userEvent.setup()
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      // Make changes
+      await user.type(screen.getByLabelText(/name/i), ' Updated')
+      
+      expect(screen.getByText(/unsaved changes/i)).toBeInTheDocument()
+    })
+  })
+
+  describe('Error Handling', () => {
+    it('should show error on save failure', async () => {
+      const user = userEvent.setup()
+      mockedService.updateAppConfig.mockRejectedValue(new Error('Server error'))
+      
+      render(<AppConfigForm appId="app-1" />)
+      
+      await waitFor(() => {
+        expect(screen.getByLabelText(/name/i)).toHaveValue('My App')
+      })
+      
+      await user.click(screen.getByRole('button', { name: /save/i }))
+      
+      await waitFor(() => {
+        expect(screen.getByText(/failed to save/i)).toBeInTheDocument()
+      })
+    })
+  })
+})
+```

.claude/skills/frontend-testing/references/mocking.md

@@ -0,0 +1,366 @@
+# Mocking Guide for Dify Frontend Tests
+
+## ⚠️ Important: What NOT to Mock
+
+### DO NOT Mock Base Components
+
+**Never mock components from `@/app/components/base/`** such as:
+
+- `Loading`, `Spinner`
+- `Button`, `Input`, `Select`
+- `Tooltip`, `Modal`, `Dropdown`
+- `Icon`, `Badge`, `Tag`
+
+**Why?**
+
+- Base components will have their own dedicated tests
+- Mocking them creates false positives (tests pass but real integration fails)
+- Using real components tests actual integration behavior
+
+```typescript
+// ❌ WRONG: Don't mock base components
+vi.mock('@/app/components/base/loading', () => () => <div>Loading</div>)
+vi.mock('@/app/components/base/button', () => ({ children }: any) => <button>{children}</button>)
+
+// ✅ CORRECT: Import and use real base components
+import Loading from '@/app/components/base/loading'
+import Button from '@/app/components/base/button'
+// They will render normally in tests
+```
+
+### What TO Mock
+
+Only mock these categories:
+
+1. **API services** (`@/service/*`) - Network calls
+1. **Complex context providers** - When setup is too difficult
+1. **Third-party libraries with side effects** - `next/navigation`, external SDKs
+1. **i18n** - Always mock to return keys
+
+## Mock Placement
+
+| Location | Purpose |
+|----------|---------|
+| `web/vitest.setup.ts` | Global mocks shared by all tests (for example `react-i18next`, `next/image`) |
+| `web/__mocks__/` | Reusable mock factories shared across multiple test files |
+| Test file | Test-specific mocks, inline with `vi.mock()` |
+
+Modules are not mocked automatically. Use `vi.mock` in test files, or add global mocks in `web/vitest.setup.ts`.
+
+## Essential Mocks
+
+### 1. i18n (Auto-loaded via Global Mock)
+
+A global mock is defined in `web/vitest.setup.ts` and is auto-loaded by Vitest setup.
+**No explicit mock needed** for most tests - it returns translation keys as-is.
+
+For tests requiring custom translations, override the mock:
+
+```typescript
+vi.mock('react-i18next', () => ({
+  useTranslation: () => ({
+    t: (key: string) => {
+      const translations: Record<string, string> = {
+        'my.custom.key': 'Custom translation',
+      }
+      return translations[key] || key
+    },
+  }),
+}))
+```
+
+### 2. Next.js Router
+
+```typescript
+const mockPush = vi.fn()
+const mockReplace = vi.fn()
+
+vi.mock('next/navigation', () => ({
+  useRouter: () => ({
+    push: mockPush,
+    replace: mockReplace,
+    back: vi.fn(),
+    prefetch: vi.fn(),
+  }),
+  usePathname: () => '/current-path',
+  useSearchParams: () => new URLSearchParams('?key=value'),
+}))
+
+describe('Component', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+  })
+
+  it('should navigate on click', () => {
+    render(<Component />)
+    fireEvent.click(screen.getByRole('button'))
+    expect(mockPush).toHaveBeenCalledWith('/expected-path')
+  })
+})
+```
+
+### 3. Portal Components (with Shared State)
+
+```typescript
+// ⚠️ Important: Use shared state for components that depend on each other
+let mockPortalOpenState = false
+
+vi.mock('@/app/components/base/portal-to-follow-elem', () => ({
+  PortalToFollowElem: ({ children, open, ...props }: any) => {
+    mockPortalOpenState = open || false  // Update shared state
+    return <div data-testid="portal" data-open={open}>{children}</div>
+  },
+  PortalToFollowElemContent: ({ children }: any) => {
+    // ✅ Matches actual: returns null when portal is closed
+    if (!mockPortalOpenState) return null
+    return <div data-testid="portal-content">{children}</div>
+  },
+  PortalToFollowElemTrigger: ({ children }: any) => (
+    <div data-testid="portal-trigger">{children}</div>
+  ),
+}))
+
+describe('Component', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    mockPortalOpenState = false  // ✅ Reset shared state
+  })
+})
+```
+
+### 4. API Service Mocks
+
+```typescript
+import * as api from '@/service/api'
+
+vi.mock('@/service/api')
+
+const mockedApi = vi.mocked(api)
+
+describe('Component', () => {
+  beforeEach(() => {
+    vi.clearAllMocks()
+    
+    // Setup default mock implementation
+    mockedApi.fetchData.mockResolvedValue({ data: [] })
+  })
+
+  it('should show data on success', async () => {
+    mockedApi.fetchData.mockResolvedValue({ data: [{ id: 1 }] })
+    
+    render(<Component />)
+    
+    await waitFor(() => {
+      expect(screen.getByText('1')).toBeInTheDocument()
+    })
+  })
+
+  it('should show error on failure', async () => {
+    mockedApi.fetchData.mockRejectedValue(new Error('Network error'))
+    
+    render(<Component />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/error/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### 5. HTTP Mocking with Nock
+
+```typescript
+import nock from 'nock'
+
+const GITHUB_HOST = 'https://api.github.com'
+const GITHUB_PATH = '/repos/owner/repo'
+
+const mockGithubApi = (status: number, body: Record<string, unknown>, delayMs = 0) => {
+  return nock(GITHUB_HOST)
+    .get(GITHUB_PATH)
+    .delay(delayMs)
+    .reply(status, body)
+}
+
+describe('GithubComponent', () => {
+  afterEach(() => {
+    nock.cleanAll()
+  })
+
+  it('should display repo info', async () => {
+    mockGithubApi(200, { name: 'dify', stars: 1000 })
+    
+    render(<GithubComponent />)
+    
+    await waitFor(() => {
+      expect(screen.getByText('dify')).toBeInTheDocument()
+    })
+  })
+
+  it('should handle API error', async () => {
+    mockGithubApi(500, { message: 'Server error' })
+    
+    render(<GithubComponent />)
+    
+    await waitFor(() => {
+      expect(screen.getByText(/error/i)).toBeInTheDocument()
+    })
+  })
+})
+```
+
+### 6. Context Providers
+
+```typescript
+import { ProviderContext } from '@/context/provider-context'
+import { createMockProviderContextValue, createMockPlan } from '@/__mocks__/provider-context'
+
+describe('Component with Context', () => {
+  it('should render for free plan', () => {
+    const mockContext = createMockPlan('sandbox')
+    
+    render(
+      <ProviderContext.Provider value={mockContext}>
+        <Component />
+      </ProviderContext.Provider>
+    )
+    
+    expect(screen.getByText('Upgrade')).toBeInTheDocument()
+  })
+
+  it('should render for pro plan', () => {
+    const mockContext = createMockPlan('professional')
+    
+    render(
+      <ProviderContext.Provider value={mockContext}>
+        <Component />
+      </ProviderContext.Provider>
+    )
+    
+    expect(screen.queryByText('Upgrade')).not.toBeInTheDocument()
+  })
+})
+```
+
+### 7. SWR / React Query
+
+```typescript
+// SWR
+vi.mock('swr', () => ({
+  __esModule: true,
+  default: vi.fn(),
+}))
+
+import useSWR from 'swr'
+const mockedUseSWR = vi.mocked(useSWR)
+
+describe('Component with SWR', () => {
+  it('should show loading state', () => {
+    mockedUseSWR.mockReturnValue({
+      data: undefined,
+      error: undefined,
+      isLoading: true,
+    })
+    
+    render(<Component />)
+    expect(screen.getByText(/loading/i)).toBeInTheDocument()
+  })
+})
+
+// React Query
+import { QueryClient, QueryClientProvider } from '@tanstack/react-query'
+
+const createTestQueryClient = () => new QueryClient({
+  defaultOptions: {
+    queries: { retry: false },
+    mutations: { retry: false },
+  },
+})
+
+const renderWithQueryClient = (ui: React.ReactElement) => {
+  const queryClient = createTestQueryClient()
+  return render(
+    <QueryClientProvider client={queryClient}>
+      {ui}
+    </QueryClientProvider>
+  )
+}
+```
+
+## Mock Best Practices
+
+### ✅ DO
+
+1. **Use real base components** - Import from `@/app/components/base/` directly
+1. **Use real project components** - Prefer importing over mocking
+1. **Reset mocks in `beforeEach`**, not `afterEach`
+1. **Match actual component behavior** in mocks (when mocking is necessary)
+1. **Use factory functions** for complex mock data
+1. **Import actual types** for type safety
+1. **Reset shared mock state** in `beforeEach`
+
+### ❌ DON'T
+
+1. **Don't mock base components** (`Loading`, `Button`, `Tooltip`, etc.)
+1. Don't mock components you can import directly
+1. Don't create overly simplified mocks that miss conditional logic
+1. Don't forget to clean up nock after each test
+1. Don't use `any` types in mocks without necessity
+
+### Mock Decision Tree
+
+```
+Need to use a component in test?
+│
+├─ Is it from @/app/components/base/*?
+│  └─ YES → Import real component, DO NOT mock
+│
+├─ Is it a project component?
+│  └─ YES → Prefer importing real component
+│           Only mock if setup is extremely complex
+│
+├─ Is it an API service (@/service/*)?
+│  └─ YES → Mock it
+│
+├─ Is it a third-party lib with side effects?
+│  └─ YES → Mock it (next/navigation, external SDKs)
+│
+└─ Is it i18n?
+   └─ YES → Uses shared mock (auto-loaded). Override only for custom translations
+```
+
+## Factory Function Pattern
+
+```typescript
+// __mocks__/data-factories.ts
+import type { User, Project } from '@/types'
+
+export const createMockUser = (overrides: Partial<User> = {}): User => ({
+  id: 'user-1',
+  name: 'Test User',
+  email: 'test@example.com',
+  role: 'member',
+  createdAt: new Date().toISOString(),
+  ...overrides,
+})
+
+export const createMockProject = (overrides: Partial<Project> = {}): Project => ({
+  id: 'project-1',
+  name: 'Test Project',
+  description: 'A test project',
+  owner: createMockUser(),
+  members: [],
+  createdAt: new Date().toISOString(),
+  ...overrides,
+})
+
+// Usage in tests
+it('should display project owner', () => {
+  const project = createMockProject({
+    owner: createMockUser({ name: 'John Doe' }),
+  })
+  
+  render(<ProjectCard project={project} />)
+  expect(screen.getByText('John Doe')).toBeInTheDocument()
+})
+```

.claude/skills/frontend-testing/references/workflow.md

@@ -0,0 +1,269 @@
+# Testing Workflow Guide
+
+This guide defines the workflow for generating tests, especially for complex components or directories with multiple files.
+
+## Scope Clarification
+
+This guide addresses **multi-file workflow** (how to process multiple test files). For coverage requirements within a single test file, see `web/testing/testing.md` § Coverage Goals.
+
+| Scope | Rule |
+|-------|------|
+| **Single file** | Complete coverage in one generation (100% function, >95% branch) |
+| **Multi-file directory** | Process one file at a time, verify each before proceeding |
+
+## ⚠️ Critical Rule: Incremental Approach for Multi-File Testing
+
+When testing a **directory with multiple files**, **NEVER generate all test files at once.** Use an incremental, verify-as-you-go approach.
+
+### Why Incremental?
+
+| Batch Approach (❌) | Incremental Approach (✅) |
+|---------------------|---------------------------|
+| Generate 5+ tests at once | Generate 1 test at a time |
+| Run tests only at the end | Run test immediately after each file |
+| Multiple failures compound | Single point of failure, easy to debug |
+| Hard to identify root cause | Clear cause-effect relationship |
+| Mock issues affect many files | Mock issues caught early |
+| Messy git history | Clean, atomic commits possible |
+
+## Single File Workflow
+
+When testing a **single component, hook, or utility**:
+
+```
+1. Read source code completely
+2. Run `pnpm analyze-component <path>` (if available)
+3. Check complexity score and features detected
+4. Write the test file
+5. Run test: `pnpm test -- <file>.spec.tsx`
+6. Fix any failures
+7. Verify coverage meets goals (100% function, >95% branch)
+```
+
+## Directory/Multi-File Workflow (MUST FOLLOW)
+
+When testing a **directory or multiple files**, follow this strict workflow:
+
+### Step 1: Analyze and Plan
+
+1. **List all files** that need tests in the directory
+1. **Categorize by complexity**:
+   - 🟢 **Simple**: Utility functions, simple hooks, presentational components
+   - 🟡 **Medium**: Components with state, effects, or event handlers
+   - 🔴 **Complex**: Components with API calls, routing, or many dependencies
+1. **Order by dependency**: Test dependencies before dependents
+1. **Create a todo list** to track progress
+
+### Step 2: Determine Processing Order
+
+Process files in this recommended order:
+
+```
+1. Utility functions (simplest, no React)
+2. Custom hooks (isolated logic)
+3. Simple presentational components (few/no props)
+4. Medium complexity components (state, effects)
+5. Complex components (API, routing, many deps)
+6. Container/index components (integration tests - last)
+```
+
+**Rationale**:
+
+- Simpler files help establish mock patterns
+- Hooks used by components should be tested first
+- Integration tests (index files) depend on child components working
+
+### Step 3: Process Each File Incrementally
+
+**For EACH file in the ordered list:**
+
+```
+┌─────────────────────────────────────────────┐
+│  1. Write test file                         │
+│  2. Run: pnpm test -- <file>.spec.tsx       │
+│  3. If FAIL → Fix immediately, re-run       │
+│  4. If PASS → Mark complete in todo list    │
+│  5. ONLY THEN proceed to next file          │
+└─────────────────────────────────────────────┘
+```
+
+**DO NOT proceed to the next file until the current one passes.**
+
+### Step 4: Final Verification
+
+After all individual tests pass:
+
+```bash
+# Run all tests in the directory together
+pnpm test -- path/to/directory/
+
+# Check coverage
+pnpm test -- --coverage path/to/directory/
+```
+
+## Component Complexity Guidelines
+
+Use `pnpm analyze-component <path>` to assess complexity before testing.
+
+### 🔴 Very Complex Components (Complexity > 50)
+
+**Consider refactoring BEFORE testing:**
+
+- Break component into smaller, testable pieces
+- Extract complex logic into custom hooks
+- Separate container and presentational layers
+
+**If testing as-is:**
+
+- Use integration tests for complex workflows
+- Use `test.each()` for data-driven testing
+- Multiple `describe` blocks for organization
+- Consider testing major sections separately
+
+### 🟡 Medium Complexity (Complexity 30-50)
+
+- Group related tests in `describe` blocks
+- Test integration scenarios between internal parts
+- Focus on state transitions and side effects
+- Use helper functions to reduce test complexity
+
+### 🟢 Simple Components (Complexity < 30)
+
+- Standard test structure
+- Focus on props, rendering, and edge cases
+- Usually straightforward to test
+
+### 📏 Large Files (500+ lines)
+
+Regardless of complexity score:
+
+- **Strongly consider refactoring** before testing
+- If testing as-is, test major sections separately
+- Create helper functions for test setup
+- May need multiple test files
+
+## Todo List Format
+
+When testing multiple files, use a todo list like this:
+
+```
+Testing: path/to/directory/
+
+Ordered by complexity (simple → complex):
+
+☐ utils/helper.ts           [utility, simple]
+☐ hooks/use-custom-hook.ts  [hook, simple]
+☐ empty-state.tsx           [component, simple]
+☐ item-card.tsx             [component, medium]
+☐ list.tsx                  [component, complex]
+☐ index.tsx                 [integration]
+
+Progress: 0/6 complete
+```
+
+Update status as you complete each:
+
+- ☐ → ⏳ (in progress)
+- ⏳ → ✅ (complete and verified)
+- ⏳ → ❌ (blocked, needs attention)
+
+## When to Stop and Verify
+
+**Always run tests after:**
+
+- Completing a test file
+- Making changes to fix a failure
+- Modifying shared mocks
+- Updating test utilities or helpers
+
+**Signs you should pause:**
+
+- More than 2 consecutive test failures
+- Mock-related errors appearing
+- Unclear why a test is failing
+- Test passing but coverage unexpectedly low
+
+## Common Pitfalls to Avoid
+
+### ❌ Don't: Generate Everything First
+
+```
+# BAD: Writing all files then testing
+Write component-a.spec.tsx
+Write component-b.spec.tsx  
+Write component-c.spec.tsx
+Write component-d.spec.tsx
+Run pnpm test  ← Multiple failures, hard to debug
+```
+
+### ✅ Do: Verify Each Step
+
+```
+# GOOD: Incremental with verification
+Write component-a.spec.tsx
+Run pnpm test -- component-a.spec.tsx ✅
+Write component-b.spec.tsx
+Run pnpm test -- component-b.spec.tsx ✅
+...continue...
+```
+
+### ❌ Don't: Skip Verification for "Simple" Components
+
+Even simple components can have:
+
+- Import errors
+- Missing mock setup
+- Incorrect assumptions about props
+
+**Always verify, regardless of perceived simplicity.**
+
+### ❌ Don't: Continue When Tests Fail
+
+Failing tests compound:
+
+- A mock issue in file A affects files B, C, D
+- Fixing A later requires revisiting all dependent tests
+- Time wasted on debugging cascading failures
+
+**Fix failures immediately before proceeding.**
+
+## Integration with Claude's Todo Feature
+
+When using Claude for multi-file testing:
+
+1. **Ask Claude to create a todo list** before starting
+1. **Request one file at a time** or ensure Claude processes incrementally
+1. **Verify each test passes** before asking for the next
+1. **Mark todos complete** as you progress
+
+Example prompt:
+
+```
+Test all components in `path/to/directory/`.
+First, analyze the directory and create a todo list ordered by complexity.
+Then, process ONE file at a time, waiting for my confirmation that tests pass
+before proceeding to the next.
+```
+
+## Summary Checklist
+
+Before starting multi-file testing:
+
+- [ ] Listed all files needing tests
+- [ ] Ordered by complexity (simple → complex)
+- [ ] Created todo list for tracking
+- [ ] Understand dependencies between files
+
+During testing:
+
+- [ ] Processing ONE file at a time
+- [ ] Running tests after EACH file
+- [ ] Fixing failures BEFORE proceeding
+- [ ] Updating todo list progress
+
+After completion:
+
+- [ ] All individual tests pass
+- [ ] Full directory test run passes
+- [ ] Coverage goals met
+- [ ] Todo list shows all complete

.codex/skills

@@ -0,0 +1 @@
+../.claude/skills

.coveragerc

@@ -0,0 +1,5 @@
+[run]
+omit =
+    api/tests/*
+    api/migrations/*
+    api/core/rag/datasource/vdb/*

.devcontainer/devcontainer.json

@@ -6,6 +6,9 @@
 		"context": "..",
 		"dockerfile": "Dockerfile"
 	},
+	"mounts": [
+		"source=dify-dev-tmp,target=/tmp,type=volume"
+	],
 	"features": {
 		"ghcr.io/devcontainers/features/node:1": {
 			"nodeGypDependencies": true,
@@ -34,19 +37,13 @@
 	},
 	"postStartCommand": "./.devcontainer/post_start_command.sh",
 	"postCreateCommand": "./.devcontainer/post_create_command.sh"
-
 	// Features to add to the dev container. More info: https://containers.dev/features.
 	// "features": {},
-
 	// Use 'forwardPorts' to make a list of ports inside the container available locally.
 	// "forwardPorts": [],
-
 	// Use 'postCreateCommand' to run commands after the container is created.
 	// "postCreateCommand": "python --version",
-
 	// Configure tool-specific properties.
 	// "customizations": {},
-
 	// Uncomment to connect as root instead. More info: https://aka.ms/dev-containers-non-root.
-	// "remoteUser": "root"
-}
+}

.devcontainer/post_create_command.sh

@@ -1,6 +1,7 @@
 #!/bin/bash
 WORKSPACE_ROOT=$(pwd)
 
+export COREPACK_ENABLE_DOWNLOAD_PROMPT=0
 corepack enable
 cd web && pnpm install
 pipx install uv

.github/CODEOWNERS

@@ -6,229 +6,244 @@
 
 * @crazywoola @laipz8200 @Yeuoly
 
+# CODEOWNERS file
+/.github/CODEOWNERS @laipz8200 @crazywoola
+
+# Docs
+/docs/ @crazywoola
+
 # Backend (default owner, more specific rules below will override)
-api/ @QuantumGhost
+/api/ @QuantumGhost
 
 # Backend - MCP
-api/core/mcp/ @Nov1c444
-api/core/entities/mcp_provider.py @Nov1c444
-api/services/tools/mcp_tools_manage_service.py @Nov1c444
-api/controllers/mcp/ @Nov1c444
-api/controllers/console/app/mcp_server.py @Nov1c444
-api/tests/**/*mcp* @Nov1c444
+/api/core/mcp/ @Nov1c444
+/api/core/entities/mcp_provider.py @Nov1c444
+/api/services/tools/mcp_tools_manage_service.py @Nov1c444
+/api/controllers/mcp/ @Nov1c444
+/api/controllers/console/app/mcp_server.py @Nov1c444
+/api/tests/**/*mcp* @Nov1c444
 
 # Backend - Workflow - Engine (Core graph execution engine)
-api/core/workflow/graph_engine/ @laipz8200 @QuantumGhost
-api/core/workflow/runtime/ @laipz8200 @QuantumGhost
-api/core/workflow/graph/ @laipz8200 @QuantumGhost
-api/core/workflow/graph_events/ @laipz8200 @QuantumGhost
-api/core/workflow/node_events/ @laipz8200 @QuantumGhost
-api/core/model_runtime/ @laipz8200 @QuantumGhost
+/api/core/workflow/graph_engine/ @laipz8200 @QuantumGhost
+/api/core/workflow/runtime/ @laipz8200 @QuantumGhost
+/api/core/workflow/graph/ @laipz8200 @QuantumGhost
+/api/core/workflow/graph_events/ @laipz8200 @QuantumGhost
+/api/core/workflow/node_events/ @laipz8200 @QuantumGhost
+/api/core/model_runtime/ @laipz8200 @QuantumGhost
 
 # Backend - Workflow - Nodes (Agent, Iteration, Loop, LLM)
-api/core/workflow/nodes/agent/ @Nov1c444
-api/core/workflow/nodes/iteration/ @Nov1c444
-api/core/workflow/nodes/loop/ @Nov1c444
-api/core/workflow/nodes/llm/ @Nov1c444
+/api/core/workflow/nodes/agent/ @Nov1c444
+/api/core/workflow/nodes/iteration/ @Nov1c444
+/api/core/workflow/nodes/loop/ @Nov1c444
+/api/core/workflow/nodes/llm/ @Nov1c444
 
 # Backend - RAG (Retrieval Augmented Generation)
-api/core/rag/ @JohnJyong
-api/services/rag_pipeline/ @JohnJyong
-api/services/dataset_service.py @JohnJyong
-api/services/knowledge_service.py @JohnJyong
-api/services/external_knowledge_service.py @JohnJyong
-api/services/hit_testing_service.py @JohnJyong
-api/services/metadata_service.py @JohnJyong
-api/services/vector_service.py @JohnJyong
-api/services/entities/knowledge_entities/ @JohnJyong
-api/services/entities/external_knowledge_entities/ @JohnJyong
-api/controllers/console/datasets/ @JohnJyong
-api/controllers/service_api/dataset/ @JohnJyong
-api/models/dataset.py @JohnJyong
-api/tasks/rag_pipeline/ @JohnJyong
-api/tasks/add_document_to_index_task.py @JohnJyong
-api/tasks/batch_clean_document_task.py @JohnJyong
-api/tasks/clean_document_task.py @JohnJyong
-api/tasks/clean_notion_document_task.py @JohnJyong
-api/tasks/document_indexing_task.py @JohnJyong
-api/tasks/document_indexing_sync_task.py @JohnJyong
-api/tasks/document_indexing_update_task.py @JohnJyong
-api/tasks/duplicate_document_indexing_task.py @JohnJyong
-api/tasks/recover_document_indexing_task.py @JohnJyong
-api/tasks/remove_document_from_index_task.py @JohnJyong
-api/tasks/retry_document_indexing_task.py @JohnJyong
-api/tasks/sync_website_document_indexing_task.py @JohnJyong
-api/tasks/batch_create_segment_to_index_task.py @JohnJyong
-api/tasks/create_segment_to_index_task.py @JohnJyong
-api/tasks/delete_segment_from_index_task.py @JohnJyong
-api/tasks/disable_segment_from_index_task.py @JohnJyong
-api/tasks/disable_segments_from_index_task.py @JohnJyong
-api/tasks/enable_segment_to_index_task.py @JohnJyong
-api/tasks/enable_segments_to_index_task.py @JohnJyong
-api/tasks/clean_dataset_task.py @JohnJyong
-api/tasks/deal_dataset_index_update_task.py @JohnJyong
-api/tasks/deal_dataset_vector_index_task.py @JohnJyong
+/api/core/rag/ @JohnJyong
+/api/services/rag_pipeline/ @JohnJyong
+/api/services/dataset_service.py @JohnJyong
+/api/services/knowledge_service.py @JohnJyong
+/api/services/external_knowledge_service.py @JohnJyong
+/api/services/hit_testing_service.py @JohnJyong
+/api/services/metadata_service.py @JohnJyong
+/api/services/vector_service.py @JohnJyong
+/api/services/entities/knowledge_entities/ @JohnJyong
+/api/services/entities/external_knowledge_entities/ @JohnJyong
+/api/controllers/console/datasets/ @JohnJyong
+/api/controllers/service_api/dataset/ @JohnJyong
+/api/models/dataset.py @JohnJyong
+/api/tasks/rag_pipeline/ @JohnJyong
+/api/tasks/add_document_to_index_task.py @JohnJyong
+/api/tasks/batch_clean_document_task.py @JohnJyong
+/api/tasks/clean_document_task.py @JohnJyong
+/api/tasks/clean_notion_document_task.py @JohnJyong
+/api/tasks/document_indexing_task.py @JohnJyong
+/api/tasks/document_indexing_sync_task.py @JohnJyong
+/api/tasks/document_indexing_update_task.py @JohnJyong
+/api/tasks/duplicate_document_indexing_task.py @JohnJyong
+/api/tasks/recover_document_indexing_task.py @JohnJyong
+/api/tasks/remove_document_from_index_task.py @JohnJyong
+/api/tasks/retry_document_indexing_task.py @JohnJyong
+/api/tasks/sync_website_document_indexing_task.py @JohnJyong
+/api/tasks/batch_create_segment_to_index_task.py @JohnJyong
+/api/tasks/create_segment_to_index_task.py @JohnJyong
+/api/tasks/delete_segment_from_index_task.py @JohnJyong
+/api/tasks/disable_segment_from_index_task.py @JohnJyong
+/api/tasks/disable_segments_from_index_task.py @JohnJyong
+/api/tasks/enable_segment_to_index_task.py @JohnJyong
+/api/tasks/enable_segments_to_index_task.py @JohnJyong
+/api/tasks/clean_dataset_task.py @JohnJyong
+/api/tasks/deal_dataset_index_update_task.py @JohnJyong
+/api/tasks/deal_dataset_vector_index_task.py @JohnJyong
 
 # Backend - Plugins
-api/core/plugin/ @Mairuis @Yeuoly @Stream29
-api/services/plugin/ @Mairuis @Yeuoly @Stream29
-api/controllers/console/workspace/plugin.py @Mairuis @Yeuoly @Stream29
-api/controllers/inner_api/plugin/ @Mairuis @Yeuoly @Stream29
-api/tasks/process_tenant_plugin_autoupgrade_check_task.py @Mairuis @Yeuoly @Stream29
+/api/core/plugin/ @Mairuis @Yeuoly @Stream29
+/api/services/plugin/ @Mairuis @Yeuoly @Stream29
+/api/controllers/console/workspace/plugin.py @Mairuis @Yeuoly @Stream29
+/api/controllers/inner_api/plugin/ @Mairuis @Yeuoly @Stream29
+/api/tasks/process_tenant_plugin_autoupgrade_check_task.py @Mairuis @Yeuoly @Stream29
 
 # Backend - Trigger/Schedule/Webhook
-api/controllers/trigger/ @Mairuis @Yeuoly
-api/controllers/console/app/workflow_trigger.py @Mairuis @Yeuoly
-api/controllers/console/workspace/trigger_providers.py @Mairuis @Yeuoly
-api/core/trigger/ @Mairuis @Yeuoly
-api/core/app/layers/trigger_post_layer.py @Mairuis @Yeuoly
-api/services/trigger/ @Mairuis @Yeuoly
-api/models/trigger.py @Mairuis @Yeuoly
-api/fields/workflow_trigger_fields.py @Mairuis @Yeuoly
-api/repositories/workflow_trigger_log_repository.py @Mairuis @Yeuoly
-api/repositories/sqlalchemy_workflow_trigger_log_repository.py @Mairuis @Yeuoly
-api/libs/schedule_utils.py @Mairuis @Yeuoly
-api/services/workflow/scheduler.py @Mairuis @Yeuoly
-api/schedule/trigger_provider_refresh_task.py @Mairuis @Yeuoly
-api/schedule/workflow_schedule_task.py @Mairuis @Yeuoly
-api/tasks/trigger_processing_tasks.py @Mairuis @Yeuoly
-api/tasks/trigger_subscription_refresh_tasks.py @Mairuis @Yeuoly
-api/tasks/workflow_schedule_tasks.py @Mairuis @Yeuoly
-api/tasks/workflow_cfs_scheduler/ @Mairuis @Yeuoly
-api/events/event_handlers/sync_plugin_trigger_when_app_created.py @Mairuis @Yeuoly
-api/events/event_handlers/update_app_triggers_when_app_published_workflow_updated.py @Mairuis @Yeuoly
-api/events/event_handlers/sync_workflow_schedule_when_app_published.py @Mairuis @Yeuoly
-api/events/event_handlers/sync_webhook_when_app_created.py @Mairuis @Yeuoly
+/api/controllers/trigger/ @Mairuis @Yeuoly
+/api/controllers/console/app/workflow_trigger.py @Mairuis @Yeuoly
+/api/controllers/console/workspace/trigger_providers.py @Mairuis @Yeuoly
+/api/core/trigger/ @Mairuis @Yeuoly
+/api/core/app/layers/trigger_post_layer.py @Mairuis @Yeuoly
+/api/services/trigger/ @Mairuis @Yeuoly
+/api/models/trigger.py @Mairuis @Yeuoly
+/api/fields/workflow_trigger_fields.py @Mairuis @Yeuoly
+/api/repositories/workflow_trigger_log_repository.py @Mairuis @Yeuoly
+/api/repositories/sqlalchemy_workflow_trigger_log_repository.py @Mairuis @Yeuoly
+/api/libs/schedule_utils.py @Mairuis @Yeuoly
+/api/services/workflow/scheduler.py @Mairuis @Yeuoly
+/api/schedule/trigger_provider_refresh_task.py @Mairuis @Yeuoly
+/api/schedule/workflow_schedule_task.py @Mairuis @Yeuoly
+/api/tasks/trigger_processing_tasks.py @Mairuis @Yeuoly
+/api/tasks/trigger_subscription_refresh_tasks.py @Mairuis @Yeuoly
+/api/tasks/workflow_schedule_tasks.py @Mairuis @Yeuoly
+/api/tasks/workflow_cfs_scheduler/ @Mairuis @Yeuoly
+/api/events/event_handlers/sync_plugin_trigger_when_app_created.py @Mairuis @Yeuoly
+/api/events/event_handlers/update_app_triggers_when_app_published_workflow_updated.py @Mairuis @Yeuoly
+/api/events/event_handlers/sync_workflow_schedule_when_app_published.py @Mairuis @Yeuoly
+/api/events/event_handlers/sync_webhook_when_app_created.py @Mairuis @Yeuoly
 
 # Backend - Async Workflow
-api/services/async_workflow_service.py @Mairuis @Yeuoly
-api/tasks/async_workflow_tasks.py @Mairuis @Yeuoly
+/api/services/async_workflow_service.py @Mairuis @Yeuoly
+/api/tasks/async_workflow_tasks.py @Mairuis @Yeuoly
 
 # Backend - Billing
-api/services/billing_service.py @hj24 @zyssyz123
-api/controllers/console/billing/ @hj24 @zyssyz123
+/api/services/billing_service.py @hj24 @zyssyz123
+/api/controllers/console/billing/ @hj24 @zyssyz123
 
 # Backend - Enterprise
-api/configs/enterprise/ @GarfieldDai @GareArc
-api/services/enterprise/ @GarfieldDai @GareArc
-api/services/feature_service.py @GarfieldDai @GareArc
-api/controllers/console/feature.py @GarfieldDai @GareArc
-api/controllers/web/feature.py @GarfieldDai @GareArc
+/api/configs/enterprise/ @GarfieldDai @GareArc
+/api/services/enterprise/ @GarfieldDai @GareArc
+/api/services/feature_service.py @GarfieldDai @GareArc
+/api/controllers/console/feature.py @GarfieldDai @GareArc
+/api/controllers/web/feature.py @GarfieldDai @GareArc
 
 # Backend - Database Migrations
-api/migrations/ @snakevash @laipz8200
+/api/migrations/ @snakevash @laipz8200 @MRZHUH
+
+# Backend - Vector DB Middleware
+/api/configs/middleware/vdb/* @JohnJyong
 
 # Frontend
-web/ @iamjoel
+/web/ @iamjoel
+
+# Frontend - Web Tests
+/.github/workflows/web-tests.yml @iamjoel
 
 # Frontend - App - Orchestration
-web/app/components/workflow/ @iamjoel @zxhlyh
-web/app/components/workflow-app/ @iamjoel @zxhlyh
-web/app/components/app/configuration/ @iamjoel @zxhlyh
-web/app/components/app/app-publisher/ @iamjoel @zxhlyh
+/web/app/components/workflow/ @iamjoel @zxhlyh
+/web/app/components/workflow-app/ @iamjoel @zxhlyh
+/web/app/components/app/configuration/ @iamjoel @zxhlyh
+/web/app/components/app/app-publisher/ @iamjoel @zxhlyh
 
 # Frontend - WebApp - Chat
-web/app/components/base/chat/ @iamjoel @zxhlyh
+/web/app/components/base/chat/ @iamjoel @zxhlyh
 
 # Frontend - WebApp - Completion
-web/app/components/share/text-generation/ @iamjoel @zxhlyh
+/web/app/components/share/text-generation/ @iamjoel @zxhlyh
 
 # Frontend - App - List and Creation
-web/app/components/apps/ @JzoNgKVO @iamjoel
-web/app/components/app/create-app-dialog/ @JzoNgKVO @iamjoel
-web/app/components/app/create-app-modal/ @JzoNgKVO @iamjoel
-web/app/components/app/create-from-dsl-modal/ @JzoNgKVO @iamjoel
+/web/app/components/apps/ @JzoNgKVO @iamjoel
+/web/app/components/app/create-app-dialog/ @JzoNgKVO @iamjoel
+/web/app/components/app/create-app-modal/ @JzoNgKVO @iamjoel
+/web/app/components/app/create-from-dsl-modal/ @JzoNgKVO @iamjoel
 
 # Frontend - App - API Documentation
-web/app/components/develop/ @JzoNgKVO @iamjoel
+/web/app/components/develop/ @JzoNgKVO @iamjoel
 
 # Frontend - App - Logs and Annotations
-web/app/components/app/workflow-log/ @JzoNgKVO @iamjoel
-web/app/components/app/log/ @JzoNgKVO @iamjoel
-web/app/components/app/log-annotation/ @JzoNgKVO @iamjoel
-web/app/components/app/annotation/ @JzoNgKVO @iamjoel
+/web/app/components/app/workflow-log/ @JzoNgKVO @iamjoel
+/web/app/components/app/log/ @JzoNgKVO @iamjoel
+/web/app/components/app/log-annotation/ @JzoNgKVO @iamjoel
+/web/app/components/app/annotation/ @JzoNgKVO @iamjoel
 
 # Frontend - App - Monitoring
-web/app/(commonLayout)/app/(appDetailLayout)/\[appId\]/overview/ @JzoNgKVO @iamjoel
-web/app/components/app/overview/ @JzoNgKVO @iamjoel
+/web/app/(commonLayout)/app/(appDetailLayout)/\[appId\]/overview/ @JzoNgKVO @iamjoel
+/web/app/components/app/overview/ @JzoNgKVO @iamjoel
 
 # Frontend - App - Settings
-web/app/components/app-sidebar/ @JzoNgKVO @iamjoel
+/web/app/components/app-sidebar/ @JzoNgKVO @iamjoel
 
 # Frontend - RAG - Hit Testing
-web/app/components/datasets/hit-testing/ @JzoNgKVO @iamjoel
+/web/app/components/datasets/hit-testing/ @JzoNgKVO @iamjoel
 
 # Frontend - RAG - List and Creation
-web/app/components/datasets/list/ @iamjoel @WTW0313
-web/app/components/datasets/create/ @iamjoel @WTW0313
-web/app/components/datasets/create-from-pipeline/ @iamjoel @WTW0313
-web/app/components/datasets/external-knowledge-base/ @iamjoel @WTW0313
+/web/app/components/datasets/list/ @iamjoel @WTW0313
+/web/app/components/datasets/create/ @iamjoel @WTW0313
+/web/app/components/datasets/create-from-pipeline/ @iamjoel @WTW0313
+/web/app/components/datasets/external-knowledge-base/ @iamjoel @WTW0313
 
 # Frontend - RAG - Orchestration (general rule first, specific rules below override)
-web/app/components/rag-pipeline/ @iamjoel @WTW0313
-web/app/components/rag-pipeline/components/rag-pipeline-main.tsx @iamjoel @zxhlyh
-web/app/components/rag-pipeline/store/ @iamjoel @zxhlyh
+/web/app/components/rag-pipeline/ @iamjoel @WTW0313
+/web/app/components/rag-pipeline/components/rag-pipeline-main.tsx @iamjoel @zxhlyh
+/web/app/components/rag-pipeline/store/ @iamjoel @zxhlyh
 
 # Frontend - RAG - Documents List
-web/app/components/datasets/documents/list.tsx @iamjoel @WTW0313
-web/app/components/datasets/documents/create-from-pipeline/ @iamjoel @WTW0313
+/web/app/components/datasets/documents/list.tsx @iamjoel @WTW0313
+/web/app/components/datasets/documents/create-from-pipeline/ @iamjoel @WTW0313
 
 # Frontend - RAG - Segments List
-web/app/components/datasets/documents/detail/ @iamjoel @WTW0313
+/web/app/components/datasets/documents/detail/ @iamjoel @WTW0313
 
 # Frontend - RAG - Settings
-web/app/components/datasets/settings/ @iamjoel @WTW0313
+/web/app/components/datasets/settings/ @iamjoel @WTW0313
 
 # Frontend - Ecosystem - Plugins
-web/app/components/plugins/ @iamjoel @zhsama
+/web/app/components/plugins/ @iamjoel @zhsama
 
 # Frontend - Ecosystem - Tools
-web/app/components/tools/ @iamjoel @Yessenia-d
+/web/app/components/tools/ @iamjoel @Yessenia-d
 
 # Frontend - Ecosystem - MarketPlace
-web/app/components/plugins/marketplace/ @iamjoel @Yessenia-d
+/web/app/components/plugins/marketplace/ @iamjoel @Yessenia-d
 
 # Frontend - Login and Registration
-web/app/signin/ @douxc @iamjoel
-web/app/signup/ @douxc @iamjoel
-web/app/reset-password/ @douxc @iamjoel
-web/app/install/ @douxc @iamjoel
-web/app/init/ @douxc @iamjoel
-web/app/forgot-password/ @douxc @iamjoel
-web/app/account/ @douxc @iamjoel
+/web/app/signin/ @douxc @iamjoel
+/web/app/signup/ @douxc @iamjoel
+/web/app/reset-password/ @douxc @iamjoel
+/web/app/install/ @douxc @iamjoel
+/web/app/init/ @douxc @iamjoel
+/web/app/forgot-password/ @douxc @iamjoel
+/web/app/account/ @douxc @iamjoel
 
 # Frontend - Service Authentication
-web/service/base.ts @douxc @iamjoel
+/web/service/base.ts @douxc @iamjoel
 
 # Frontend - WebApp Authentication and Access Control
-web/app/(shareLayout)/components/ @douxc @iamjoel
-web/app/(shareLayout)/webapp-signin/ @douxc @iamjoel
-web/app/(shareLayout)/webapp-reset-password/ @douxc @iamjoel
-web/app/components/app/app-access-control/ @douxc @iamjoel
+/web/app/(shareLayout)/components/ @douxc @iamjoel
+/web/app/(shareLayout)/webapp-signin/ @douxc @iamjoel
+/web/app/(shareLayout)/webapp-reset-password/ @douxc @iamjoel
+/web/app/components/app/app-access-control/ @douxc @iamjoel
 
 # Frontend - Explore Page
-web/app/components/explore/ @CodingOnStar @iamjoel
+/web/app/components/explore/ @CodingOnStar @iamjoel
 
 # Frontend - Personal Settings
-web/app/components/header/account-setting/ @CodingOnStar @iamjoel
-web/app/components/header/account-dropdown/ @CodingOnStar @iamjoel
+/web/app/components/header/account-setting/ @CodingOnStar @iamjoel
+/web/app/components/header/account-dropdown/ @CodingOnStar @iamjoel
 
 # Frontend - Analytics
-web/app/components/base/ga/ @CodingOnStar @iamjoel
+/web/app/components/base/ga/ @CodingOnStar @iamjoel
 
 # Frontend - Base Components
-web/app/components/base/ @iamjoel @zxhlyh
+/web/app/components/base/ @iamjoel @zxhlyh
 
 # Frontend - Utils and Hooks
-web/utils/classnames.ts @iamjoel @zxhlyh
-web/utils/time.ts @iamjoel @zxhlyh
-web/utils/format.ts @iamjoel @zxhlyh
-web/utils/clipboard.ts @iamjoel @zxhlyh
-web/hooks/use-document-title.ts @iamjoel @zxhlyh
+/web/utils/classnames.ts @iamjoel @zxhlyh
+/web/utils/time.ts @iamjoel @zxhlyh
+/web/utils/format.ts @iamjoel @zxhlyh
+/web/utils/clipboard.ts @iamjoel @zxhlyh
+/web/hooks/use-document-title.ts @iamjoel @zxhlyh
 
 # Frontend - Billing and Education
-web/app/components/billing/ @iamjoel @zxhlyh
-web/app/education-apply/ @iamjoel @zxhlyh
+/web/app/components/billing/ @iamjoel @zxhlyh
+/web/app/education-apply/ @iamjoel @zxhlyh
 
 # Frontend - Workspace
-web/app/components/header/account-dropdown/workplace-selector/ @iamjoel @zxhlyh
+/web/app/components/header/account-dropdown/workplace-selector/ @iamjoel @zxhlyh
+
+# Docker
+/docker/* @laipz8200

.github/copilot-instructions.md

@@ -1,12 +0,0 @@
-# Copilot Instructions
-
-GitHub Copilot must follow the unified frontend testing requirements documented in `web/testing/testing.md`.
-
-Key reminders:
-
-- Generate tests using the mandated tech stack, naming, and code style (AAA pattern, `fireEvent`, descriptive test names, cleans up mocks).
-- Cover rendering, prop combinations, and edge cases by default; extend coverage for hooks, routing, async flows, and domain-specific components when applicable.
-- Target >95% line and branch coverage and 100% function/statement coverage.
-- Apply the project's mocking conventions for i18n, toast notifications, and Next.js utilities.
-
-Any suggestions from Copilot that conflict with `web/testing/testing.md` should be revised before acceptance.

.github/workflows/api-tests.yml

@@ -71,18 +71,18 @@ jobs:
         run: |
           cp api/tests/integration_tests/.env.example api/tests/integration_tests/.env
 
-      - name: Run Workflow
-        run: uv run --project api bash dev/pytest/pytest_workflow.sh
-
-      - name: Run Tool
-        run: uv run --project api bash dev/pytest/pytest_tools.sh
-
-      - name: Run TestContainers
-        run: uv run --project api bash dev/pytest/pytest_testcontainers.sh
-
-      - name: Run Unit tests
+      - name: Run API Tests
+        env:
+          STORAGE_TYPE: opendal
+          OPENDAL_SCHEME: fs
+          OPENDAL_FS_ROOT: /tmp/dify-storage
         run: |
-          uv run --project api bash dev/pytest/pytest_unit_tests.sh
+          uv run --project api pytest \
+            --timeout "${PYTEST_TIMEOUT:-180}" \
+            api/tests/integration_tests/workflow \
+            api/tests/integration_tests/tools \
+            api/tests/test_containers_integration_tests \
+            api/tests/unit_tests
 
       - name: Coverage Summary
         run: |
@@ -93,5 +93,12 @@ jobs:
           # Create a detailed coverage summary
           echo "### Test Coverage Summary :test_tube:" >> $GITHUB_STEP_SUMMARY
           echo "Total Coverage: ${TOTAL_COVERAGE}%" >> $GITHUB_STEP_SUMMARY
-          uv run --project api coverage report --format=markdown >> $GITHUB_STEP_SUMMARY
-
+          {
+            echo ""
+            echo "<details><summary>File-level coverage (click to expand)</summary>"
+            echo ""
+            echo '```'
+            uv run --project api coverage report -m
+            echo '```'
+            echo "</details>"
+          } >> $GITHUB_STEP_SUMMARY

.github/workflows/autofix.yml

@@ -13,11 +13,12 @@ jobs:
     runs-on: ubuntu-latest
     steps:
       - uses: actions/checkout@v4
-
-      # Use uv to ensure we have the same ruff version in CI and locally.
-      - uses: astral-sh/setup-uv@v6
+      - uses: actions/setup-python@v5
         with:
           python-version: "3.11"
+
+      - uses: astral-sh/setup-uv@v6
+
       - run: |
           cd api
           uv sync --dev
@@ -35,10 +36,11 @@ jobs:
 
       - name: ast-grep
         run: |
-          uvx --from ast-grep-cli sg --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all
-          uvx --from ast-grep-cli sg --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all
-          uvx --from ast-grep-cli sg -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all
-          uvx --from ast-grep-cli sg -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all
+          # ast-grep exits 1 if no matches are found; allow idempotent runs.
+          uvx --from ast-grep-cli ast-grep --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all || true
+          uvx --from ast-grep-cli ast-grep -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all || true
           # Convert Optional[T] to T | None (ignoring quoted types)
           cat > /tmp/optional-rule.yml << 'EOF'
           id: convert-optional-to-union
@@ -56,14 +58,15 @@ jobs:
                     pattern: $T
           fix: $T | None
           EOF
-          uvx --from ast-grep-cli sg scan --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all
+          uvx --from ast-grep-cli ast-grep scan . --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all
           # Fix forward references that were incorrectly converted (Python doesn't support "Type" | None syntax)
           find . -name "*.py" -type f -exec sed -i.bak -E 's/"([^"]+)" \| None/Optional["\1"]/g; s/'"'"'([^'"'"']+)'"'"' \| None/Optional['"'"'\1'"'"']/g' {} \;
           find . -name "*.py.bak" -type f -delete
 
+      # mdformat breaks YAML front matter in markdown files. Add --exclude for directories containing YAML front matter.
       - name: mdformat
         run: |
-          uvx mdformat .
+          uvx --python 3.13 mdformat . --exclude ".claude/skills/**/SKILL.md"
 
       - name: Install pnpm
         uses: pnpm/action-setup@v4
@@ -76,7 +79,7 @@ jobs:
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Web dependencies
         working-directory: ./web
@@ -84,7 +87,6 @@ jobs:
 
       - name: oxlint
         working-directory: ./web
-        run: |
-          pnpx oxlint --fix
+        run: pnpm exec oxlint --config .oxlintrc.json --fix .
 
       - uses: autofix-ci/action@635ffb0c9798bd160680f18fd73371e355b85f27

.github/workflows/style.yml

@@ -90,7 +90,7 @@ jobs:
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Web dependencies
         if: steps.changed-files.outputs.any_changed == 'true'

.github/workflows/translate-i18n-base-on-english.yml

@@ -55,7 +55,7 @@ jobs:
         with:
           node-version: 'lts/*'
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Install dependencies
         if: env.FILES_CHANGED == 'true'

.github/workflows/web-tests.yml

@@ -13,6 +13,7 @@ jobs:
     runs-on: ubuntu-latest
     defaults:
       run:
+        shell: bash
         working-directory: ./web
 
     steps:
@@ -21,14 +22,7 @@ jobs:
         with:
           persist-credentials: false
 
-      - name: Check changed files
-        id: changed-files
-        uses: tj-actions/changed-files@v46
-        with:
-          files: web/**
-
       - name: Install pnpm
-        if: steps.changed-files.outputs.any_changed == 'true'
         uses: pnpm/action-setup@v4
         with:
           package_json_file: web/package.json
@@ -36,23 +30,342 @@ jobs:
 
       - name: Setup Node.js
         uses: actions/setup-node@v4
-        if: steps.changed-files.outputs.any_changed == 'true'
         with:
           node-version: 22
           cache: pnpm
-          cache-dependency-path: ./web/package.json
+          cache-dependency-path: ./web/pnpm-lock.yaml
 
       - name: Install dependencies
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
         run: pnpm install --frozen-lockfile
 
       - name: Check i18n types synchronization
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
         run: pnpm run check:i18n-types
 
       - name: Run tests
-        if: steps.changed-files.outputs.any_changed == 'true'
-        working-directory: ./web
-        run: pnpm test
+        run: pnpm test --coverage
+
+      - name: Coverage Summary
+        if: always()
+        id: coverage-summary
+        run: |
+          set -eo pipefail
+
+          COVERAGE_FILE="coverage/coverage-final.json"
+          COVERAGE_SUMMARY_FILE="coverage/coverage-summary.json"
+
+          if [ ! -f "$COVERAGE_FILE" ] && [ ! -f "$COVERAGE_SUMMARY_FILE" ]; then
+            echo "has_coverage=false" >> "$GITHUB_OUTPUT"
+            echo "### 🚨 Test Coverage Report :test_tube:" >> "$GITHUB_STEP_SUMMARY"
+            echo "Coverage data not found. Ensure Vitest runs with coverage enabled." >> "$GITHUB_STEP_SUMMARY"
+            exit 0
+          fi
+
+          echo "has_coverage=true" >> "$GITHUB_OUTPUT"
+
+          node <<'NODE' >> "$GITHUB_STEP_SUMMARY"
+          const fs = require('fs');
+          const path = require('path');
+          let libCoverage = null;
+
+          try {
+            libCoverage = require('istanbul-lib-coverage');
+          } catch (error) {
+            libCoverage = null;
+          }
+
+          const summaryPath = path.join('coverage', 'coverage-summary.json');
+          const finalPath = path.join('coverage', 'coverage-final.json');
+
+          const hasSummary = fs.existsSync(summaryPath);
+          const hasFinal = fs.existsSync(finalPath);
+
+          if (!hasSummary && !hasFinal) {
+            console.log('### Test Coverage Summary :test_tube:');
+            console.log('');
+            console.log('No coverage data found.');
+            process.exit(0);
+          }
+
+          const summary = hasSummary
+            ? JSON.parse(fs.readFileSync(summaryPath, 'utf8'))
+            : null;
+          const coverage = hasFinal
+            ? JSON.parse(fs.readFileSync(finalPath, 'utf8'))
+            : null;
+
+          const getLineCoverageFromStatements = (statementMap, statementHits) => {
+            const lineHits = {};
+
+            if (!statementMap || !statementHits) {
+              return lineHits;
+            }
+
+            Object.entries(statementMap).forEach(([key, statement]) => {
+              const line = statement?.start?.line;
+              if (!line) {
+                return;
+              }
+              const hits = statementHits[key] ?? 0;
+              const previous = lineHits[line];
+              lineHits[line] = previous === undefined ? hits : Math.max(previous, hits);
+            });
+
+            return lineHits;
+          };
+
+          const getFileCoverage = (entry) => (
+            libCoverage ? libCoverage.createFileCoverage(entry) : null
+          );
+
+          const getLineHits = (entry, fileCoverage) => {
+            const lineHits = entry.l ?? {};
+            if (Object.keys(lineHits).length > 0) {
+              return lineHits;
+            }
+            if (fileCoverage) {
+              return fileCoverage.getLineCoverage();
+            }
+            return getLineCoverageFromStatements(entry.statementMap ?? {}, entry.s ?? {});
+          };
+
+          const getUncoveredLines = (entry, fileCoverage, lineHits) => {
+            if (lineHits && Object.keys(lineHits).length > 0) {
+              return Object.entries(lineHits)
+                .filter(([, count]) => count === 0)
+                .map(([line]) => Number(line))
+                .sort((a, b) => a - b);
+            }
+            if (fileCoverage) {
+              return fileCoverage.getUncoveredLines();
+            }
+            return [];
+          };
+
+          const totals = {
+            lines: { covered: 0, total: 0 },
+            statements: { covered: 0, total: 0 },
+            branches: { covered: 0, total: 0 },
+            functions: { covered: 0, total: 0 },
+          };
+          const fileSummaries = [];
+
+          if (summary) {
+            const totalEntry = summary.total ?? {};
+            ['lines', 'statements', 'branches', 'functions'].forEach((key) => {
+              if (totalEntry[key]) {
+                totals[key].covered = totalEntry[key].covered ?? 0;
+                totals[key].total = totalEntry[key].total ?? 0;
+              }
+            });
+
+            Object.entries(summary)
+              .filter(([file]) => file !== 'total')
+              .forEach(([file, data]) => {
+                fileSummaries.push({
+                  file,
+                  pct: data.lines?.pct ?? data.statements?.pct ?? 0,
+                  lines: {
+                    covered: data.lines?.covered ?? 0,
+                    total: data.lines?.total ?? 0,
+                  },
+                });
+              });
+          } else if (coverage) {
+            Object.entries(coverage).forEach(([file, entry]) => {
+              const fileCoverage = getFileCoverage(entry);
+              const lineHits = getLineHits(entry, fileCoverage);
+              const statementHits = entry.s ?? {};
+              const branchHits = entry.b ?? {};
+              const functionHits = entry.f ?? {};
+
+              const lineTotal = Object.keys(lineHits).length;
+              const lineCovered = Object.values(lineHits).filter((n) => n > 0).length;
+
+              const statementTotal = Object.keys(statementHits).length;
+              const statementCovered = Object.values(statementHits).filter((n) => n > 0).length;
+
+              const branchTotal = Object.values(branchHits).reduce((acc, branches) => acc + branches.length, 0);
+              const branchCovered = Object.values(branchHits).reduce(
+                (acc, branches) => acc + branches.filter((n) => n > 0).length,
+                0,
+              );
+
+              const functionTotal = Object.keys(functionHits).length;
+              const functionCovered = Object.values(functionHits).filter((n) => n > 0).length;
+
+              totals.lines.total += lineTotal;
+              totals.lines.covered += lineCovered;
+              totals.statements.total += statementTotal;
+              totals.statements.covered += statementCovered;
+              totals.branches.total += branchTotal;
+              totals.branches.covered += branchCovered;
+              totals.functions.total += functionTotal;
+              totals.functions.covered += functionCovered;
+
+              const pct = (covered, tot) => (tot > 0 ? (covered / tot) * 100 : 0);
+
+              fileSummaries.push({
+                file,
+                pct: pct(lineCovered || statementCovered, lineTotal || statementTotal),
+                lines: {
+                  covered: lineCovered || statementCovered,
+                  total: lineTotal || statementTotal,
+                },
+              });
+            });
+          }
+
+          const pct = (covered, tot) => (tot > 0 ? ((covered / tot) * 100).toFixed(2) : '0.00');
+
+          console.log('### Test Coverage Summary :test_tube:');
+          console.log('');
+          console.log('| Metric | Coverage | Covered / Total |');
+          console.log('|--------|----------|-----------------|');
+          console.log(`| Lines | ${pct(totals.lines.covered, totals.lines.total)}% | ${totals.lines.covered} / ${totals.lines.total} |`);
+          console.log(`| Statements | ${pct(totals.statements.covered, totals.statements.total)}% | ${totals.statements.covered} / ${totals.statements.total} |`);
+          console.log(`| Branches | ${pct(totals.branches.covered, totals.branches.total)}% | ${totals.branches.covered} / ${totals.branches.total} |`);
+          console.log(`| Functions | ${pct(totals.functions.covered, totals.functions.total)}% | ${totals.functions.covered} / ${totals.functions.total} |`);
+
+          console.log('');
+          console.log('<details><summary>File coverage (lowest lines first)</summary>');
+          console.log('');
+          console.log('```');
+          fileSummaries
+            .sort((a, b) => (a.pct - b.pct) || (b.lines.total - a.lines.total))
+            .slice(0, 25)
+            .forEach(({ file, pct, lines }) => {
+              console.log(`${pct.toFixed(2)}%\t${lines.covered}/${lines.total}\t${file}`);
+            });
+          console.log('```');
+          console.log('</details>');
+
+          if (coverage) {
+            const pctValue = (covered, tot) => {
+              if (tot === 0) {
+                return '0';
+              }
+              return ((covered / tot) * 100)
+                .toFixed(2)
+                .replace(/\.?0+$/, '');
+            };
+
+            const formatLineRanges = (lines) => {
+              if (lines.length === 0) {
+                return '';
+              }
+              const ranges = [];
+              let start = lines[0];
+              let end = lines[0];
+
+              for (let i = 1; i < lines.length; i += 1) {
+                const current = lines[i];
+                if (current === end + 1) {
+                  end = current;
+                  continue;
+                }
+                ranges.push(start === end ? `${start}` : `${start}-${end}`);
+                start = current;
+                end = current;
+              }
+              ranges.push(start === end ? `${start}` : `${start}-${end}`);
+              return ranges.join(',');
+            };
+
+            const tableTotals = {
+              statements: { covered: 0, total: 0 },
+              branches: { covered: 0, total: 0 },
+              functions: { covered: 0, total: 0 },
+              lines: { covered: 0, total: 0 },
+            };
+            const tableRows = Object.entries(coverage)
+              .map(([file, entry]) => {
+                const fileCoverage = getFileCoverage(entry);
+                const lineHits = getLineHits(entry, fileCoverage);
+                const statementHits = entry.s ?? {};
+                const branchHits = entry.b ?? {};
+                const functionHits = entry.f ?? {};
+
+                const lineTotal = Object.keys(lineHits).length;
+                const lineCovered = Object.values(lineHits).filter((n) => n > 0).length;
+                const statementTotal = Object.keys(statementHits).length;
+                const statementCovered = Object.values(statementHits).filter((n) => n > 0).length;
+                const branchTotal = Object.values(branchHits).reduce((acc, branches) => acc + branches.length, 0);
+                const branchCovered = Object.values(branchHits).reduce(
+                  (acc, branches) => acc + branches.filter((n) => n > 0).length,
+                  0,
+                );
+                const functionTotal = Object.keys(functionHits).length;
+                const functionCovered = Object.values(functionHits).filter((n) => n > 0).length;
+
+                tableTotals.lines.total += lineTotal;
+                tableTotals.lines.covered += lineCovered;
+                tableTotals.statements.total += statementTotal;
+                tableTotals.statements.covered += statementCovered;
+                tableTotals.branches.total += branchTotal;
+                tableTotals.branches.covered += branchCovered;
+                tableTotals.functions.total += functionTotal;
+                tableTotals.functions.covered += functionCovered;
+
+                const uncoveredLines = getUncoveredLines(entry, fileCoverage, lineHits);
+
+                const filePath = entry.path ?? file;
+                const relativePath = path.isAbsolute(filePath)
+                  ? path.relative(process.cwd(), filePath)
+                  : filePath;
+
+                return {
+                  file: relativePath || file,
+                  statements: pctValue(statementCovered, statementTotal),
+                  branches: pctValue(branchCovered, branchTotal),
+                  functions: pctValue(functionCovered, functionTotal),
+                  lines: pctValue(lineCovered, lineTotal),
+                  uncovered: formatLineRanges(uncoveredLines),
+                };
+              })
+              .sort((a, b) => a.file.localeCompare(b.file));
+
+            const columns = [
+              { key: 'file', header: 'File', align: 'left' },
+              { key: 'statements', header: '% Stmts', align: 'right' },
+              { key: 'branches', header: '% Branch', align: 'right' },
+              { key: 'functions', header: '% Funcs', align: 'right' },
+              { key: 'lines', header: '% Lines', align: 'right' },
+              { key: 'uncovered', header: 'Uncovered Line #s', align: 'left' },
+            ];
+
+            const allFilesRow = {
+              file: 'All files',
+              statements: pctValue(tableTotals.statements.covered, tableTotals.statements.total),
+              branches: pctValue(tableTotals.branches.covered, tableTotals.branches.total),
+              functions: pctValue(tableTotals.functions.covered, tableTotals.functions.total),
+              lines: pctValue(tableTotals.lines.covered, tableTotals.lines.total),
+              uncovered: '',
+            };
+
+            const rowsForOutput = [allFilesRow, ...tableRows];
+            const formatRow = (row) => `| ${columns
+              .map(({ key }) => String(row[key] ?? ''))
+              .join(' | ')} |`;
+            const headerRow = `| ${columns.map(({ header }) => header).join(' | ')} |`;
+            const dividerRow = `| ${columns
+              .map(({ align }) => (align === 'right' ? '---:' : ':---'))
+              .join(' | ')} |`;
+
+            console.log('');
+            console.log('<details><summary>Vitest coverage table</summary>');
+            console.log('');
+            console.log(headerRow);
+            console.log(dividerRow);
+            rowsForOutput.forEach((row) => console.log(formatRow(row)));
+            console.log('</details>');
+          }
+          NODE
+
+      - name: Upload Coverage Artifact
+        if: steps.coverage-summary.outputs.has_coverage == 'true'
+        uses: actions/upload-artifact@v4
+        with:
+          name: web-coverage-report
+          path: web/coverage
+          retention-days: 30
+          if-no-files-found: error

.gitignore

@@ -189,6 +189,7 @@ docker/volumes/matrixone/*
 docker/volumes/mysql/*
 docker/volumes/seekdb/*
 !docker/volumes/oceanbase/init.d
+docker/volumes/iris/*
 
 docker/nginx/conf.d/default.conf
 docker/nginx/ssl/*

.windsurf/rules/testing.md

@@ -1,5 +0,0 @@
-# Windsurf Testing Rules
-
-- Use `web/testing/testing.md` as the single source of truth for frontend automated testing.
-- Honor every requirement in that document when generating or accepting tests.
-- When proposing or saving tests, re-read that document and follow every requirement.

api/.env.example

@@ -116,6 +116,7 @@ ALIYUN_OSS_AUTH_VERSION=v1
 ALIYUN_OSS_REGION=your-region
 # Don't start with '/'. OSS doesn't support leading slash in object names.
 ALIYUN_OSS_PATH=your-path
+ALIYUN_CLOUDBOX_ID=your-cloudbox-id
 
 # Google Storage configuration
 GOOGLE_STORAGE_BUCKET_NAME=your-bucket-name
@@ -133,6 +134,7 @@ HUAWEI_OBS_BUCKET_NAME=your-bucket-name
 HUAWEI_OBS_SECRET_KEY=your-secret-key
 HUAWEI_OBS_ACCESS_KEY=your-access-key
 HUAWEI_OBS_SERVER=your-server-url
+HUAWEI_OBS_PATH_STYLE=false
 
 # Baidu OBS Storage Configuration
 BAIDU_OBS_BUCKET_NAME=your-bucket-name
@@ -543,6 +545,25 @@ APP_MAX_EXECUTION_TIME=1200
 APP_DEFAULT_ACTIVE_REQUESTS=0
 APP_MAX_ACTIVE_REQUESTS=0
 
+# Aliyun SLS Logstore Configuration
+# Aliyun Access Key ID
+ALIYUN_SLS_ACCESS_KEY_ID=
+# Aliyun Access Key Secret
+ALIYUN_SLS_ACCESS_KEY_SECRET=
+# Aliyun SLS Endpoint (e.g., cn-hangzhou.log.aliyuncs.com)
+ALIYUN_SLS_ENDPOINT=
+# Aliyun SLS Region (e.g., cn-hangzhou)
+ALIYUN_SLS_REGION=
+# Aliyun SLS Project Name
+ALIYUN_SLS_PROJECT_NAME=
+# Number of days to retain workflow run logs (default: 365 days， 3650 for permanent storage)
+ALIYUN_SLS_LOGSTORE_TTL=365
+# Enable dual-write to both SLS LogStore and SQL database (default: false)
+LOGSTORE_DUAL_WRITE_ENABLED=false
+# Enable dual-read fallback to SQL database when LogStore returns no results (default: true)
+# Useful for migration scenarios where historical data exists only in SQL database
+LOGSTORE_DUAL_READ_ENABLED=true
+
 # Celery beat configuration
 CELERY_BEAT_SCHEDULER_TIME=1
 
@@ -672,7 +693,6 @@ ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE=5
 ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20
 # Maximum number of concurrent annotation import tasks per tenant
 ANNOTATION_IMPORT_MAX_CONCURRENT=5
-
 # Sandbox expired records clean configuration
 SANDBOX_EXPIRED_RECORDS_CLEAN_GRACEFUL_PERIOD=21
 SANDBOX_EXPIRED_RECORDS_CLEAN_BATCH_SIZE=1000

api/app_factory.py

@@ -75,6 +75,7 @@ def initialize_extensions(app: DifyApp):
         ext_import_modules,
         ext_logging,
         ext_login,
+        ext_logstore,
         ext_mail,
         ext_migrate,
         ext_orjson,
@@ -83,6 +84,7 @@ def initialize_extensions(app: DifyApp):
         ext_redis,
         ext_request_logging,
         ext_sentry,
+        ext_session_factory,
         ext_set_secretkey,
         ext_storage,
         ext_timezone,
@@ -104,6 +106,7 @@ def initialize_extensions(app: DifyApp):
         ext_migrate,
         ext_redis,
         ext_storage,
+        ext_logstore,  # Initialize logstore after storage, before celery
         ext_celery,
         ext_login,
         ext_mail,
@@ -114,6 +117,7 @@ def initialize_extensions(app: DifyApp):
         ext_commands,
         ext_otel,
         ext_request_logging,
+        ext_session_factory,
     ]
     for ext in extensions:
         short_name = ext.__name__.split(".")[-1]

api/commands.py

@@ -37,8 +37,8 @@ from libs.rsa import generate_key_pair
 from models import Tenant
 from models.dataset import Dataset, DatasetCollectionBinding, DatasetMetadata, DatasetMetadataBinding, DocumentSegment
 from models.dataset import Document as DatasetDocument
-from models.model import Account, App, AppAnnotationSetting, AppMode, Conversation, MessageAnnotation, UploadFile
 from models.enums import CreatorUserRole, ExecutionOffLoadType
+from models.model import Account, App, AppAnnotationSetting, AppMode, Conversation, MessageAnnotation, UploadFile
 from models.oauth import DatasourceOauthParamConfig, DatasourceProvider
 from models.provider import Provider, ProviderModel
 from models.provider_ids import DatasourceProviderID, ToolProviderID

api/configs/feature/__init__.py

@@ -218,7 +218,7 @@ class PluginConfig(BaseSettings):
 
     PLUGIN_DAEMON_TIMEOUT: PositiveFloat | None = Field(
         description="Timeout in seconds for requests to the plugin daemon (set to None to disable)",
-        default=300.0,
+        default=600.0,
     )
 
     INNER_API_KEY_FOR_PLUGIN: str = Field(description="Inner api key for plugin", default="inner-api-key")

api/configs/middleware/__init__.py

@@ -26,6 +26,7 @@ from .vdb.clickzetta_config import ClickzettaConfig
 from .vdb.couchbase_config import CouchbaseConfig
 from .vdb.elasticsearch_config import ElasticsearchConfig
 from .vdb.huawei_cloud_config import HuaweiCloudConfig
+from .vdb.iris_config import IrisVectorConfig
 from .vdb.lindorm_config import LindormConfig
 from .vdb.matrixone_config import MatrixoneConfig
 from .vdb.milvus_config import MilvusConfig
@@ -106,7 +107,7 @@ class KeywordStoreConfig(BaseSettings):
 
 class DatabaseConfig(BaseSettings):
     # Database type selector
-    DB_TYPE: Literal["postgresql", "mysql", "oceanbase"] = Field(
+    DB_TYPE: Literal["postgresql", "mysql", "oceanbase", "seekdb"] = Field(
         description="Database type to use. OceanBase is MySQL-compatible.",
         default="postgresql",
     )
@@ -336,6 +337,7 @@ class MiddlewareConfig(
     ChromaConfig,
     ClickzettaConfig,
     HuaweiCloudConfig,
+    IrisVectorConfig,
     MilvusConfig,
     AlibabaCloudMySQLConfig,
     MyScaleConfig,

api/configs/middleware/storage/aliyun_oss_storage_config.py

@@ -41,3 +41,8 @@ class AliyunOSSStorageConfig(BaseSettings):
         description="Base path within the bucket to store objects (e.g., 'my-app-data/')",
         default=None,
     )
+
+    ALIYUN_CLOUDBOX_ID: str | None = Field(
+        description="Cloudbox id for aliyun cloudbox service",
+        default=None,
+    )

api/configs/middleware/storage/huawei_obs_storage_config.py

@@ -26,3 +26,8 @@ class HuaweiCloudOBSStorageConfig(BaseSettings):
         description="Endpoint URL for Huawei Cloud OBS (e.g., 'https://obs.cn-north-4.myhuaweicloud.com')",
         default=None,
     )
+
+    HUAWEI_OBS_PATH_STYLE: bool = Field(
+        description="Flag to indicate whether to use path-style URLs for OBS requests",
+        default=False,
+    )

api/configs/middleware/vdb/iris_config.py

@@ -0,0 +1,91 @@
+"""Configuration for InterSystems IRIS vector database."""
+
+from pydantic import Field, PositiveInt, model_validator
+from pydantic_settings import BaseSettings
+
+
+class IrisVectorConfig(BaseSettings):
+    """Configuration settings for IRIS vector database connection and pooling."""
+
+    IRIS_HOST: str | None = Field(
+        description="Hostname or IP address of the IRIS server.",
+        default="localhost",
+    )
+
+    IRIS_SUPER_SERVER_PORT: PositiveInt | None = Field(
+        description="Port number for IRIS connection.",
+        default=1972,
+    )
+
+    IRIS_USER: str | None = Field(
+        description="Username for IRIS authentication.",
+        default="_SYSTEM",
+    )
+
+    IRIS_PASSWORD: str | None = Field(
+        description="Password for IRIS authentication.",
+        default="Dify@1234",
+    )
+
+    IRIS_SCHEMA: str | None = Field(
+        description="Schema name for IRIS tables.",
+        default="dify",
+    )
+
+    IRIS_DATABASE: str | None = Field(
+        description="Database namespace for IRIS connection.",
+        default="USER",
+    )
+
+    IRIS_CONNECTION_URL: str | None = Field(
+        description="Full connection URL for IRIS (overrides individual fields if provided).",
+        default=None,
+    )
+
+    IRIS_MIN_CONNECTION: PositiveInt = Field(
+        description="Minimum number of connections in the pool.",
+        default=1,
+    )
+
+    IRIS_MAX_CONNECTION: PositiveInt = Field(
+        description="Maximum number of connections in the pool.",
+        default=3,
+    )
+
+    IRIS_TEXT_INDEX: bool = Field(
+        description="Enable full-text search index using %iFind.Index.Basic.",
+        default=True,
+    )
+
+    IRIS_TEXT_INDEX_LANGUAGE: str = Field(
+        description="Language for full-text search index (e.g., 'en', 'ja', 'zh', 'de').",
+        default="en",
+    )
+
+    @model_validator(mode="before")
+    @classmethod
+    def validate_config(cls, values: dict) -> dict:
+        """Validate IRIS configuration values.
+
+        Args:
+            values: Configuration dictionary
+
+        Returns:
+            Validated configuration dictionary
+
+        Raises:
+            ValueError: If required fields are missing or pool settings are invalid
+        """
+        # Only validate required fields if IRIS is being used as the vector store
+        # This allows the config to be loaded even when IRIS is not in use
+
+        # vector_store = os.environ.get("VECTOR_STORE", "")
+        # We rely on Pydantic defaults for required fields if they are missing from env.
+        # Strict existence check is removed to allow defaults to work.
+
+        min_conn = values.get("IRIS_MIN_CONNECTION", 1)
+        max_conn = values.get("IRIS_MAX_CONNECTION", 3)
+        if min_conn > max_conn:
+            raise ValueError("IRIS_MIN_CONNECTION must be less than or equal to IRIS_MAX_CONNECTION")
+
+        return values

api/constants/languages.py

@@ -20,6 +20,7 @@ language_timezone_mapping = {
     "sl-SI": "Europe/Ljubljana",
     "th-TH": "Asia/Bangkok",
     "id-ID": "Asia/Jakarta",
+    "ar-TN": "Africa/Tunis",
 }
 
 languages = list(language_timezone_mapping.keys())

api/controllers/console/admin.py

@@ -6,19 +6,20 @@ from flask import request
 from flask_restx import Resource
 from pydantic import BaseModel, Field, field_validator
 from sqlalchemy import select
-from sqlalchemy.orm import Session
 from werkzeug.exceptions import NotFound, Unauthorized
 
-P = ParamSpec("P")
-R = TypeVar("R")
 from configs import dify_config
 from constants.languages import supported_language
 from controllers.console import console_ns
 from controllers.console.wraps import only_edition_cloud
+from core.db.session_factory import session_factory
 from extensions.ext_database import db
 from libs.token import extract_access_token
 from models.model import App, InstalledApp, RecommendedApp
 
+P = ParamSpec("P")
+R = TypeVar("R")
+
 DEFAULT_REF_TEMPLATE_SWAGGER_2_0 = "#/definitions/{model}"
 
 
@@ -90,7 +91,7 @@ class InsertExploreAppListApi(Resource):
             privacy_policy = site.privacy_policy or payload.privacy_policy or ""
             custom_disclaimer = site.custom_disclaimer or payload.custom_disclaimer or ""
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             recommended_app = session.execute(
                 select(RecommendedApp).where(RecommendedApp.app_id == payload.app_id)
             ).scalar_one_or_none()
@@ -138,7 +139,7 @@ class InsertExploreAppApi(Resource):
     @only_edition_cloud
     @admin_required
     def delete(self, app_id):
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             recommended_app = session.execute(
                 select(RecommendedApp).where(RecommendedApp.app_id == str(app_id))
             ).scalar_one_or_none()
@@ -146,13 +147,13 @@ class InsertExploreAppApi(Resource):
         if not recommended_app:
             return {"result": "success"}, 204
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             app = session.execute(select(App).where(App.id == recommended_app.app_id)).scalar_one_or_none()
 
         if app:
             app.is_public = False
 
-        with Session(db.engine) as session:
+        with session_factory.create_session() as session:
             installed_apps = (
                 session.execute(
                     select(InstalledApp).where(

api/controllers/console/app/annotation.py

@@ -1,6 +1,6 @@
 from typing import Any, Literal
 
-from flask import abort, request
+from flask import abort, make_response, request
 from flask_restx import Resource, fields, marshal, marshal_with
 from pydantic import BaseModel, Field, field_validator
 
@@ -272,7 +272,6 @@ class AnnotationExportApi(Resource):
     @account_initialization_required
     @edit_permission_required
     def get(self, app_id):
-        from flask import make_response
 
         app_id = str(app_id)
         annotation_list = AppAnnotationService.export_annotation_list_by_app_id(app_id)
@@ -340,9 +339,9 @@ class AnnotationBatchImportApi(Resource):
     @edit_permission_required
     def post(self, app_id):
         from configs import dify_config
-        
+
         app_id = str(app_id)
-        
+
         # check file
         if "file" not in request.files:
             raise NoFileUploadedError()
@@ -352,27 +351,26 @@ class AnnotationBatchImportApi(Resource):
 
         # get file from request
         file = request.files["file"]
-        
+
         # check file type
         if not file.filename or not file.filename.lower().endswith(".csv"):
             raise ValueError("Invalid file type. Only CSV files are allowed")
-        
+
         # Check file size before processing
         file.seek(0, 2)  # Seek to end of file
         file_size = file.tell()
         file.seek(0)  # Reset to beginning
-        
         max_size_bytes = dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT * 1024 * 1024
         if file_size > max_size_bytes:
             abort(
                 413,
                 f"File size exceeds maximum limit of {dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT}MB. "
-                f"Please reduce the file size and try again."
+                f"Please reduce the file size and try again.",
             )
-        
+
         if file_size == 0:
             raise ValueError("The uploaded file is empty")
-        
+
         return AppAnnotationService.batch_import_app_annotations(app_id, file)
 
 

api/controllers/console/app/workflow_trigger.py

@@ -114,7 +114,7 @@ class AppTriggersApi(Resource):
 
 @console_ns.route("/apps/<uuid:app_id>/trigger-enable")
 class AppTriggerEnableApi(Resource):
-    @console_ns.expect(console_ns.models[ParserEnable.__name__], validate=True)
+    @console_ns.expect(console_ns.models[ParserEnable.__name__])
     @setup_required
     @login_required
     @account_initialization_required

api/controllers/console/auth/activate.py

@@ -7,9 +7,9 @@ from controllers.console import console_ns
 from controllers.console.error import AlreadyActivateError
 from extensions.ext_database import db
 from libs.datetime_utils import naive_utc_now
-from libs.helper import EmailStr, extract_remote_ip, timezone
+from libs.helper import EmailStr, timezone
 from models import AccountStatus
-from services.account_service import AccountService, RegisterService
+from services.account_service import RegisterService
 
 DEFAULT_REF_TEMPLATE_SWAGGER_2_0 = "#/definitions/{model}"
 
@@ -93,7 +93,6 @@ class ActivateApi(Resource):
             "ActivationResponse",
             {
                 "result": fields.String(description="Operation result"),
-                "data": fields.Raw(description="Login token data"),
             },
         ),
     )
@@ -117,6 +116,4 @@ class ActivateApi(Resource):
         account.initialized_at = naive_utc_now()
         db.session.commit()
 
-        token_pair = AccountService.login(account, ip_address=extract_remote_ip(request))
-
-        return {"result": "success", "data": token_pair.model_dump()}
+        return {"result": "success"}

api/controllers/console/auth/login.py

@@ -22,7 +22,12 @@ from controllers.console.error import (
     NotAllowedCreateWorkspace,
     WorkspacesLimitExceeded,
 )
-from controllers.console.wraps import email_password_login_enabled, setup_required
+from controllers.console.wraps import (
+    decrypt_code_field,
+    decrypt_password_field,
+    email_password_login_enabled,
+    setup_required,
+)
 from events.tenant_event import tenant_was_created
 from libs.helper import EmailStr, extract_remote_ip
 from libs.login import current_account_with_tenant
@@ -79,6 +84,7 @@ class LoginApi(Resource):
     @setup_required
     @email_password_login_enabled
     @console_ns.expect(console_ns.models[LoginPayload.__name__])
+    @decrypt_password_field
     def post(self):
         """Authenticate user and login."""
         args = LoginPayload.model_validate(console_ns.payload)
@@ -218,6 +224,7 @@ class EmailCodeLoginSendEmailApi(Resource):
 class EmailCodeLoginApi(Resource):
     @setup_required
     @console_ns.expect(console_ns.models[EmailCodeLoginPayload.__name__])
+    @decrypt_code_field
     def post(self):
         args = EmailCodeLoginPayload.model_validate(console_ns.payload)
 

api/controllers/console/datasets/data_source.py

@@ -140,6 +140,18 @@ class DataSourceNotionListApi(Resource):
         credential_id = request.args.get("credential_id", default=None, type=str)
         if not credential_id:
             raise ValueError("Credential id is required.")
+
+        # Get datasource_parameters from query string (optional, for GitHub and other datasources)
+        datasource_parameters_str = request.args.get("datasource_parameters", default=None, type=str)
+        datasource_parameters = {}
+        if datasource_parameters_str:
+            try:
+                datasource_parameters = json.loads(datasource_parameters_str)
+                if not isinstance(datasource_parameters, dict):
+                    raise ValueError("datasource_parameters must be a JSON object.")
+            except json.JSONDecodeError:
+                raise ValueError("Invalid datasource_parameters JSON format.")
+
         datasource_provider_service = DatasourceProviderService()
         credential = datasource_provider_service.get_datasource_credentials(
             tenant_id=current_tenant_id,
@@ -187,7 +199,7 @@ class DataSourceNotionListApi(Resource):
             online_document_result: Generator[OnlineDocumentPagesMessage, None, None] = (
                 datasource_runtime.get_online_document_pages(
                     user_id=current_user.id,
-                    datasource_parameters={},
+                    datasource_parameters=datasource_parameters,
                     provider_type=datasource_runtime.datasource_provider_type(),
                 )
             )
@@ -218,14 +230,14 @@ class DataSourceNotionListApi(Resource):
 
 
 @console_ns.route(
-    "/notion/workspaces/<uuid:workspace_id>/pages/<uuid:page_id>/<string:page_type>/preview",
+    "/notion/pages/<uuid:page_id>/<string:page_type>/preview",
     "/datasets/notion-indexing-estimate",
 )
 class DataSourceNotionApi(Resource):
     @setup_required
     @login_required
     @account_initialization_required
-    def get(self, workspace_id, page_id, page_type):
+    def get(self, page_id, page_type):
         _, current_tenant_id = current_account_with_tenant()
 
         credential_id = request.args.get("credential_id", default=None, type=str)
@@ -239,11 +251,10 @@ class DataSourceNotionApi(Resource):
             plugin_id="langgenius/notion_datasource",
         )
 
-        workspace_id = str(workspace_id)
         page_id = str(page_id)
 
         extractor = NotionExtractor(
-            notion_workspace_id=workspace_id,
+            notion_workspace_id="",
             notion_obj_id=page_id,
             notion_page_type=page_type,
             notion_access_token=credential.get("integration_secret"),

api/controllers/console/datasets/datasets.py

@@ -146,7 +146,7 @@ class DatasetUpdatePayload(BaseModel):
     embedding_model: str | None = None
     embedding_model_provider: str | None = None
     retrieval_model: dict[str, Any] | None = None
-    partial_member_list: list[str] | None = None
+    partial_member_list: list[dict[str, str]] | None = None
     external_retrieval_model: dict[str, Any] | None = None
     external_knowledge_id: str | None = None
     external_knowledge_api_id: str | None = None
@@ -223,6 +223,7 @@ def _get_retrieval_methods_by_vector_type(vector_type: str | None, is_mock: bool
         VectorType.COUCHBASE,
         VectorType.OPENGAUSS,
         VectorType.OCEANBASE,
+        VectorType.SEEKDB,
         VectorType.TABLESTORE,
         VectorType.HUAWEI_CLOUD,
         VectorType.TENCENT,
@@ -230,6 +231,7 @@ def _get_retrieval_methods_by_vector_type(vector_type: str | None, is_mock: bool
         VectorType.CLICKZETTA,
         VectorType.BAIDU,
         VectorType.ALIBABACLOUD_MYSQL,
+        VectorType.IRIS,
     }
 
     semantic_methods = {"retrieval_method": [RetrievalMethod.SEMANTIC_SEARCH.value]}

api/controllers/console/datasets/rag_pipeline/datasource_content_preview.py

@@ -26,7 +26,7 @@ console_ns.schema_model(Parser.__name__, Parser.model_json_schema(ref_template=D
 
 @console_ns.route("/rag/pipelines/<uuid:pipeline_id>/workflows/published/datasource/nodes/<string:node_id>/preview")
 class DataSourceContentPreviewApi(Resource):
-    @console_ns.expect(console_ns.models[Parser.__name__], validate=True)
+    @console_ns.expect(console_ns.models[Parser.__name__])
     @setup_required
     @login_required
     @account_initialization_required

api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py

@@ -4,7 +4,7 @@ from typing import Any, Literal, cast
 from uuid import UUID
 
 from flask import abort, request
-from flask_restx import Resource, marshal_with  # type: ignore
+from flask_restx import Resource, marshal_with, reqparse  # type: ignore
 from pydantic import BaseModel, Field
 from sqlalchemy.orm import Session
 from werkzeug.exceptions import Forbidden, InternalServerError, NotFound
@@ -968,7 +968,7 @@ class RagPipelineDatasourceVariableApi(Resource):
         )
         return workflow_node_execution
 
-from flask_restx import reqparse
+
 @console_ns.route("/rag/pipelines/recommended-plugins")
 class RagPipelineRecommendedPluginApi(Resource):
     @setup_required
@@ -976,7 +976,7 @@ class RagPipelineRecommendedPluginApi(Resource):
     @account_initialization_required
     def get(self):
         parser = reqparse.RequestParser()
-        parser.add_argument('type', type=str, location='args', required=False, default='all')
+        parser.add_argument("type", type=str, location="args", required=False, default="all")
         args = parser.parse_args()
         type = args["type"]
 

api/controllers/console/explore/completion.py

@@ -40,7 +40,7 @@ from .. import console_ns
 logger = logging.getLogger(__name__)
 
 
-class CompletionMessagePayload(BaseModel):
+class CompletionMessageExplorePayload(BaseModel):
     inputs: dict[str, Any]
     query: str = ""
     files: list[dict[str, Any]] | None = None
@@ -71,7 +71,7 @@ class ChatMessagePayload(BaseModel):
             raise ValueError("must be a valid UUID") from exc
 
 
-register_schema_models(console_ns, CompletionMessagePayload, ChatMessagePayload)
+register_schema_models(console_ns, CompletionMessageExplorePayload, ChatMessagePayload)
 
 
 # define completion api for user
@@ -80,13 +80,13 @@ register_schema_models(console_ns, CompletionMessagePayload, ChatMessagePayload)
     endpoint="installed_app_completion",
 )
 class CompletionApi(InstalledAppResource):
-    @console_ns.expect(console_ns.models[CompletionMessagePayload.__name__])
+    @console_ns.expect(console_ns.models[CompletionMessageExplorePayload.__name__])
     def post(self, installed_app):
         app_model = installed_app.app
         if app_model.mode != AppMode.COMPLETION:
             raise NotCompletionAppError()
 
-        payload = CompletionMessagePayload.model_validate(console_ns.payload or {})
+        payload = CompletionMessageExplorePayload.model_validate(console_ns.payload or {})
         args = payload.model_dump(exclude_none=True)
 
         streaming = payload.response_mode == "streaming"

api/controllers/console/explore/conversation.py

@@ -1,5 +1,4 @@
 from typing import Any
-from uuid import UUID
 
 from flask import request
 from flask_restx import marshal_with
@@ -13,6 +12,7 @@ from controllers.console.explore.wraps import InstalledAppResource
 from core.app.entities.app_invoke_entities import InvokeFrom
 from extensions.ext_database import db
 from fields.conversation_fields import conversation_infinite_scroll_pagination_fields, simple_conversation_fields
+from libs.helper import UUIDStrOrEmpty
 from libs.login import current_user
 from models import Account
 from models.model import AppMode
@@ -24,7 +24,7 @@ from .. import console_ns
 
 
 class ConversationListQuery(BaseModel):
-    last_id: UUID | None = None
+    last_id: UUIDStrOrEmpty | None = None
     limit: int = Field(default=20, ge=1, le=100)
     pinned: bool | None = None
 

api/controllers/console/explore/installed_app.py

@@ -2,7 +2,8 @@ import logging
 from typing import Any
 
 from flask import request
-from flask_restx import Resource, inputs, marshal_with, reqparse
+from flask_restx import Resource, marshal_with
+from pydantic import BaseModel
 from sqlalchemy import and_, select
 from werkzeug.exceptions import BadRequest, Forbidden, NotFound
 
@@ -18,6 +19,15 @@ from services.account_service import TenantService
 from services.enterprise.enterprise_service import EnterpriseService
 from services.feature_service import FeatureService
 
+
+class InstalledAppCreatePayload(BaseModel):
+    app_id: str
+
+
+class InstalledAppUpdatePayload(BaseModel):
+    is_pinned: bool | None = None
+
+
 logger = logging.getLogger(__name__)
 
 
@@ -105,26 +115,25 @@ class InstalledAppsListApi(Resource):
     @account_initialization_required
     @cloud_edition_billing_resource_check("apps")
     def post(self):
-        parser = reqparse.RequestParser().add_argument("app_id", type=str, required=True, help="Invalid app_id")
-        args = parser.parse_args()
+        payload = InstalledAppCreatePayload.model_validate(console_ns.payload or {})
 
-        recommended_app = db.session.query(RecommendedApp).where(RecommendedApp.app_id == args["app_id"]).first()
+        recommended_app = db.session.query(RecommendedApp).where(RecommendedApp.app_id == payload.app_id).first()
         if recommended_app is None:
-            raise NotFound("App not found")
+            raise NotFound("Recommended app not found")
 
         _, current_tenant_id = current_account_with_tenant()
 
-        app = db.session.query(App).where(App.id == args["app_id"]).first()
+        app = db.session.query(App).where(App.id == payload.app_id).first()
 
         if app is None:
-            raise NotFound("App not found")
+            raise NotFound("App entity not found")
 
         if not app.is_public:
             raise Forbidden("You can't install a non-public app")
 
         installed_app = (
             db.session.query(InstalledApp)
-            .where(and_(InstalledApp.app_id == args["app_id"], InstalledApp.tenant_id == current_tenant_id))
+            .where(and_(InstalledApp.app_id == payload.app_id, InstalledApp.tenant_id == current_tenant_id))
             .first()
         )
 
@@ -133,7 +142,7 @@ class InstalledAppsListApi(Resource):
             recommended_app.install_count += 1
 
             new_installed_app = InstalledApp(
-                app_id=args["app_id"],
+                app_id=payload.app_id,
                 tenant_id=current_tenant_id,
                 app_owner_tenant_id=app.tenant_id,
                 is_pinned=False,
@@ -163,12 +172,11 @@ class InstalledAppApi(InstalledAppResource):
         return {"result": "success", "message": "App uninstalled successfully"}, 204
 
     def patch(self, installed_app):
-        parser = reqparse.RequestParser().add_argument("is_pinned", type=inputs.boolean)
-        args = parser.parse_args()
+        payload = InstalledAppUpdatePayload.model_validate(console_ns.payload or {})
 
         commit_args = False
-        if "is_pinned" in args:
-            installed_app.is_pinned = args["is_pinned"]
+        if payload.is_pinned is not None:
+            installed_app.is_pinned = payload.is_pinned
             commit_args = True
 
         if commit_args:

api/controllers/console/tag/tags.py

@@ -1,31 +1,40 @@
+from typing import Literal
+
 from flask import request
-from flask_restx import Resource, marshal_with, reqparse
+from flask_restx import Resource, marshal_with
+from pydantic import BaseModel, Field
 from werkzeug.exceptions import Forbidden
 
+from controllers.common.schema import register_schema_models
 from controllers.console import console_ns
 from controllers.console.wraps import account_initialization_required, edit_permission_required, setup_required
 from fields.tag_fields import dataset_tag_fields
 from libs.login import current_account_with_tenant, login_required
-from models.model import Tag
 from services.tag_service import TagService
 
 
-def _validate_name(name):
-    if not name or len(name) < 1 or len(name) > 50:
-        raise ValueError("Name must be between 1 to 50 characters.")
-    return name
+class TagBasePayload(BaseModel):
+    name: str = Field(description="Tag name", min_length=1, max_length=50)
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
 
 
-parser_tags = (
-    reqparse.RequestParser()
-    .add_argument(
-        "name",
-        nullable=False,
-        required=True,
-        help="Name must be between 1 to 50 characters.",
-        type=_validate_name,
-    )
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
+class TagBindingPayload(BaseModel):
+    tag_ids: list[str] = Field(description="Tag IDs to bind")
+    target_id: str = Field(description="Target ID to bind tags to")
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
+
+
+class TagBindingRemovePayload(BaseModel):
+    tag_id: str = Field(description="Tag ID to remove")
+    target_id: str = Field(description="Target ID to unbind tag from")
+    type: Literal["knowledge", "app"] | None = Field(default=None, description="Tag type")
+
+
+register_schema_models(
+    console_ns,
+    TagBasePayload,
+    TagBindingPayload,
+    TagBindingRemovePayload,
 )
 
 
@@ -43,7 +52,7 @@ class TagListApi(Resource):
 
         return tags, 200
 
-    @console_ns.expect(parser_tags)
+    @console_ns.expect(console_ns.models[TagBasePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -53,22 +62,17 @@ class TagListApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_tags.parse_args()
-        tag = TagService.save_tags(args)
+        payload = TagBasePayload.model_validate(console_ns.payload or {})
+        tag = TagService.save_tags(payload.model_dump())
 
         response = {"id": tag.id, "name": tag.name, "type": tag.type, "binding_count": 0}
 
         return response, 200
 
 
-parser_tag_id = reqparse.RequestParser().add_argument(
-    "name", nullable=False, required=True, help="Name must be between 1 to 50 characters.", type=_validate_name
-)
-
-
 @console_ns.route("/tags/<uuid:tag_id>")
 class TagUpdateDeleteApi(Resource):
-    @console_ns.expect(parser_tag_id)
+    @console_ns.expect(console_ns.models[TagBasePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -79,8 +83,8 @@ class TagUpdateDeleteApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_tag_id.parse_args()
-        tag = TagService.update_tags(args, tag_id)
+        payload = TagBasePayload.model_validate(console_ns.payload or {})
+        tag = TagService.update_tags(payload.model_dump(), tag_id)
 
         binding_count = TagService.get_tag_binding_count(tag_id)
 
@@ -100,17 +104,9 @@ class TagUpdateDeleteApi(Resource):
         return 204
 
 
-parser_create = (
-    reqparse.RequestParser()
-    .add_argument("tag_ids", type=list, nullable=False, required=True, location="json", help="Tag IDs is required.")
-    .add_argument("target_id", type=str, nullable=False, required=True, location="json", help="Target ID is required.")
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
-)
-
-
 @console_ns.route("/tag-bindings/create")
 class TagBindingCreateApi(Resource):
-    @console_ns.expect(parser_create)
+    @console_ns.expect(console_ns.models[TagBindingPayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -120,23 +116,15 @@ class TagBindingCreateApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_create.parse_args()
-        TagService.save_tag_binding(args)
+        payload = TagBindingPayload.model_validate(console_ns.payload or {})
+        TagService.save_tag_binding(payload.model_dump())
 
         return {"result": "success"}, 200
 
 
-parser_remove = (
-    reqparse.RequestParser()
-    .add_argument("tag_id", type=str, nullable=False, required=True, help="Tag ID is required.")
-    .add_argument("target_id", type=str, nullable=False, required=True, help="Target ID is required.")
-    .add_argument("type", type=str, location="json", choices=Tag.TAG_TYPE_LIST, nullable=True, help="Invalid tag type.")
-)
-
-
 @console_ns.route("/tag-bindings/remove")
 class TagBindingDeleteApi(Resource):
-    @console_ns.expect(parser_remove)
+    @console_ns.expect(console_ns.models[TagBindingRemovePayload.__name__])
     @setup_required
     @login_required
     @account_initialization_required
@@ -146,7 +134,7 @@ class TagBindingDeleteApi(Resource):
         if not (current_user.has_edit_permission or current_user.is_dataset_editor):
             raise Forbidden()
 
-        args = parser_remove.parse_args()
-        TagService.delete_tag_binding(args)
+        payload = TagBindingRemovePayload.model_validate(console_ns.payload or {})
+        TagService.delete_tag_binding(payload.model_dump())
 
         return {"result": "success"}, 200

api/controllers/console/workspace/plugin.py

@@ -46,8 +46,8 @@ class PluginDebuggingKeyApi(Resource):
 
 
 class ParserList(BaseModel):
-    page: int = Field(default=1)
-    page_size: int = Field(default=256)
+    page: int = Field(default=1, ge=1, description="Page number")
+    page_size: int = Field(default=256, ge=1, le=256, description="Page size (1-256)")
 
 
 reg(ParserList)
@@ -106,8 +106,8 @@ class ParserPluginIdentifierQuery(BaseModel):
 
 
 class ParserTasks(BaseModel):
-    page: int
-    page_size: int
+    page: int = Field(default=1, ge=1, description="Page number")
+    page_size: int = Field(default=256, ge=1, le=256, description="Page size (1-256)")
 
 
 class ParserMarketplaceUpgrade(BaseModel):

api/controllers/console/workspace/tool_providers.py

@@ -18,6 +18,7 @@ from controllers.console.wraps import (
     setup_required,
 )
 from core.entities.mcp_provider import MCPAuthentication, MCPConfiguration
+from core.helper.tool_provider_cache import ToolProviderListCache
 from core.mcp.auth.auth_flow import auth, handle_callback
 from core.mcp.error import MCPAuthError, MCPError, MCPRefreshTokenError
 from core.mcp.mcp_client import MCPClient
@@ -944,7 +945,7 @@ class ToolProviderMCPApi(Resource):
         configuration = MCPConfiguration.model_validate(args["configuration"])
         authentication = MCPAuthentication.model_validate(args["authentication"]) if args["authentication"] else None
 
-        # Create provider
+        # Create provider in transaction
         with Session(db.engine) as session, session.begin():
             service = MCPToolManageService(session=session)
             result = service.create_provider(
@@ -960,7 +961,11 @@ class ToolProviderMCPApi(Resource):
                 configuration=configuration,
                 authentication=authentication,
             )
-            return jsonable_encoder(result)
+
+        # Invalidate cache AFTER transaction commits to avoid holding locks during Redis operations
+        ToolProviderListCache.invalidate_cache(tenant_id)
+
+        return jsonable_encoder(result)
 
     @console_ns.expect(parser_mcp_put)
     @setup_required
@@ -972,17 +977,23 @@ class ToolProviderMCPApi(Resource):
         authentication = MCPAuthentication.model_validate(args["authentication"]) if args["authentication"] else None
         _, current_tenant_id = current_account_with_tenant()
 
-        # Step 1: Validate server URL change if needed (includes URL format validation and network operation)
-        validation_result = None
+        # Step 1: Get provider data for URL validation (short-lived session, no network I/O)
+        validation_data = None
         with Session(db.engine) as session:
             service = MCPToolManageService(session=session)
-            validation_result = service.validate_server_url_change(
-                tenant_id=current_tenant_id, provider_id=args["provider_id"], new_server_url=args["server_url"]
+            validation_data = service.get_provider_for_url_validation(
+                tenant_id=current_tenant_id, provider_id=args["provider_id"]
             )
 
-            # No need to check for errors here, exceptions will be raised directly
+        # Step 2: Perform URL validation with network I/O OUTSIDE of any database session
+        # This prevents holding database locks during potentially slow network operations
+        validation_result = MCPToolManageService.validate_server_url_standalone(
+            tenant_id=current_tenant_id,
+            new_server_url=args["server_url"],
+            validation_data=validation_data,
+        )
 
-        # Step 2: Perform database update in a transaction
+        # Step 3: Perform database update in a transaction
         with Session(db.engine) as session, session.begin():
             service = MCPToolManageService(session=session)
             service.update_provider(
@@ -999,7 +1010,11 @@ class ToolProviderMCPApi(Resource):
                 authentication=authentication,
                 validation_result=validation_result,
             )
-            return {"result": "success"}
+
+        # Invalidate cache AFTER transaction commits to avoid holding locks during Redis operations
+        ToolProviderListCache.invalidate_cache(current_tenant_id)
+
+        return {"result": "success"}
 
     @console_ns.expect(parser_mcp_delete)
     @setup_required
@@ -1012,7 +1027,11 @@ class ToolProviderMCPApi(Resource):
         with Session(db.engine) as session, session.begin():
             service = MCPToolManageService(session=session)
             service.delete_provider(tenant_id=current_tenant_id, provider_id=args["provider_id"])
-            return {"result": "success"}
+
+        # Invalidate cache AFTER transaction commits to avoid holding locks during Redis operations
+        ToolProviderListCache.invalidate_cache(current_tenant_id)
+
+        return {"result": "success"}
 
 
 parser_auth = (
@@ -1062,6 +1081,8 @@ class ToolMCPAuthApi(Resource):
                         credentials=provider_entity.credentials,
                         authed=True,
                     )
+                # Invalidate cache after updating credentials
+                ToolProviderListCache.invalidate_cache(tenant_id)
                 return {"result": "success"}
         except MCPAuthError as e:
             try:
@@ -1075,16 +1096,22 @@ class ToolMCPAuthApi(Resource):
                 with Session(db.engine) as session, session.begin():
                     service = MCPToolManageService(session=session)
                     response = service.execute_auth_actions(auth_result)
+                    # Invalidate cache after auth actions may have updated provider state
+                    ToolProviderListCache.invalidate_cache(tenant_id)
                     return response
             except MCPRefreshTokenError as e:
                 with Session(db.engine) as session, session.begin():
                     service = MCPToolManageService(session=session)
                     service.clear_provider_credentials(provider_id=provider_id, tenant_id=tenant_id)
+                # Invalidate cache after clearing credentials
+                ToolProviderListCache.invalidate_cache(tenant_id)
                 raise ValueError(f"Failed to refresh token, please try to authorize again: {e}") from e
         except (MCPError, ValueError) as e:
             with Session(db.engine) as session, session.begin():
                 service = MCPToolManageService(session=session)
                 service.clear_provider_credentials(provider_id=provider_id, tenant_id=tenant_id)
+            # Invalidate cache after clearing credentials
+            ToolProviderListCache.invalidate_cache(tenant_id)
             raise ValueError(f"Failed to connect to MCP server: {e}") from e
 
 

api/controllers/console/wraps.py

@@ -9,10 +9,12 @@ from typing import ParamSpec, TypeVar
 from flask import abort, request
 
 from configs import dify_config
+from controllers.console.auth.error import AuthenticationFailedError, EmailCodeError
 from controllers.console.workspace.error import AccountNotInitializedError
 from enums.cloud_plan import CloudPlan
 from extensions.ext_database import db
 from extensions.ext_redis import redis_client
+from libs.encryption import FieldEncryption
 from libs.login import current_account_with_tenant
 from models.account import AccountStatus
 from models.dataset import RateLimitLog
@@ -25,6 +27,14 @@ from .error import NotInitValidateError, NotSetupError, UnauthorizedAndForceLogo
 P = ParamSpec("P")
 R = TypeVar("R")
 
+# Field names for decryption
+FIELD_NAME_PASSWORD = "password"
+FIELD_NAME_CODE = "code"
+
+# Error messages for decryption failures
+ERROR_MSG_INVALID_ENCRYPTED_DATA = "Invalid encrypted data"
+ERROR_MSG_INVALID_ENCRYPTED_CODE = "Invalid encrypted code"
+
 
 def account_initialization_required(view: Callable[P, R]):
     @wraps(view)
@@ -336,84 +346,155 @@ def is_admin_or_owner_required(f: Callable[P, R]):
 def annotation_import_rate_limit(view: Callable[P, R]):
     """
     Rate limiting decorator for annotation import operations.
-    
+
     Implements sliding window rate limiting with two tiers:
     - Short-term: Configurable requests per minute (default: 5)
     - Long-term: Configurable requests per hour (default: 20)
-    
+
     Uses Redis ZSET for distributed rate limiting across multiple instances.
     """
+
     @wraps(view)
     def decorated(*args: P.args, **kwargs: P.kwargs):
         _, current_tenant_id = current_account_with_tenant()
         current_time = int(time.time() * 1000)
-        
         # Check per-minute rate limit
         minute_key = f"annotation_import_rate_limit:{current_tenant_id}:1min"
         redis_client.zadd(minute_key, {current_time: current_time})
         redis_client.zremrangebyscore(minute_key, 0, current_time - 60000)
         minute_count = redis_client.zcard(minute_key)
         redis_client.expire(minute_key, 120)  # 2 minutes TTL
-        
         if minute_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE:
             abort(
                 429,
                 f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE} "
-                f"requests per minute allowed. Please try again later."
+                f"requests per minute allowed. Please try again later.",
             )
-        
+
         # Check per-hour rate limit
         hour_key = f"annotation_import_rate_limit:{current_tenant_id}:1hour"
         redis_client.zadd(hour_key, {current_time: current_time})
         redis_client.zremrangebyscore(hour_key, 0, current_time - 3600000)
         hour_count = redis_client.zcard(hour_key)
         redis_client.expire(hour_key, 7200)  # 2 hours TTL
-        
         if hour_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR:
             abort(
                 429,
                 f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR} "
-                f"requests per hour allowed. Please try again later."
+                f"requests per hour allowed. Please try again later.",
             )
-        
+
         return view(*args, **kwargs)
-    
+
     return decorated
 
 
 def annotation_import_concurrency_limit(view: Callable[P, R]):
     """
     Concurrency control decorator for annotation import operations.
-    
+
     Limits the number of concurrent import tasks per tenant to prevent
     resource exhaustion and ensure fair resource allocation.
-    
+
     Uses Redis ZSET to track active import jobs with automatic cleanup
     of stale entries (jobs older than 2 minutes).
     """
+
     @wraps(view)
     def decorated(*args: P.args, **kwargs: P.kwargs):
         _, current_tenant_id = current_account_with_tenant()
         current_time = int(time.time() * 1000)
-        
+
         active_jobs_key = f"annotation_import_active:{current_tenant_id}"
-        
+
         # Clean up stale entries (jobs that should have completed or timed out)
         stale_threshold = current_time - 120000  # 2 minutes ago
         redis_client.zremrangebyscore(active_jobs_key, 0, stale_threshold)
-        
+
         # Check current active job count
         active_count = redis_client.zcard(active_jobs_key)
-        
+
         if active_count >= dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT:
             abort(
                 429,
                 f"Too many concurrent import tasks. Maximum {dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT} "
-                f"concurrent imports allowed per workspace. Please wait for existing imports to complete."
+                f"concurrent imports allowed per workspace. Please wait for existing imports to complete.",
             )
-        
+
         # Allow the request to proceed
         # The actual job registration will happen in the service layer
         return view(*args, **kwargs)
-    
+
+    return decorated
+
+
+def _decrypt_field(field_name: str, error_class: type[Exception], error_message: str) -> None:
+    """
+    Helper to decode a Base64 encoded field in the request payload.
+
+    Args:
+        field_name: Name of the field to decode
+        error_class: Exception class to raise on decoding failure
+        error_message: Error message to include in the exception
+    """
+    if not request or not request.is_json:
+        return
+    # Get the payload dict - it's cached and mutable
+    payload = request.get_json()
+    if not payload or field_name not in payload:
+        return
+    encoded_value = payload[field_name]
+    decoded_value = FieldEncryption.decrypt_field(encoded_value)
+
+    # If decoding failed, raise error immediately
+    if decoded_value is None:
+        raise error_class(error_message)
+
+    # Update payload dict in-place with decoded value
+    # Since payload is a mutable dict and get_json() returns the cached reference,
+    # modifying it will affect all subsequent accesses including console_ns.payload
+    payload[field_name] = decoded_value
+
+
+def decrypt_password_field(view: Callable[P, R]):
+    """
+    Decorator to decrypt password field in request payload.
+
+    Automatically decrypts the 'password' field if encryption is enabled.
+    If decryption fails, raises AuthenticationFailedError.
+
+    Usage:
+        @decrypt_password_field
+        def post(self):
+            args = LoginPayload.model_validate(console_ns.payload)
+            # args.password is now decrypted
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _decrypt_field(FIELD_NAME_PASSWORD, AuthenticationFailedError, ERROR_MSG_INVALID_ENCRYPTED_DATA)
+        return view(*args, **kwargs)
+
+    return decorated
+
+
+def decrypt_code_field(view: Callable[P, R]):
+    """
+    Decorator to decrypt verification code field in request payload.
+
+    Automatically decrypts the 'code' field if encryption is enabled.
+    If decryption fails, raises EmailCodeError.
+
+    Usage:
+        @decrypt_code_field
+        def post(self):
+            args = EmailCodeLoginPayload.model_validate(console_ns.payload)
+            # args.code is now decrypted
+    """
+
+    @wraps(view)
+    def decorated(*args: P.args, **kwargs: P.kwargs):
+        _decrypt_field(FIELD_NAME_CODE, EmailCodeError, ERROR_MSG_INVALID_ENCRYPTED_CODE)
+        return view(*args, **kwargs)
+
     return decorated

api/controllers/service_api/app/completion.py

@@ -61,6 +61,9 @@ class ChatRequestPayload(BaseModel):
     @classmethod
     def normalize_conversation_id(cls, value: str | UUID | None) -> str | None:
         """Allow missing or blank conversation IDs; enforce UUID format when provided."""
+        if isinstance(value, str):
+            value = value.strip()
+
         if not value:
             return None
 

api/controllers/service_api/app/conversation.py

@@ -4,7 +4,7 @@ from uuid import UUID
 from flask import request
 from flask_restx import Resource
 from flask_restx._http import HTTPStatus
-from pydantic import BaseModel, Field, model_validator
+from pydantic import BaseModel, Field, field_validator, model_validator
 from sqlalchemy.orm import Session
 from werkzeug.exceptions import BadRequest, NotFound
 
@@ -51,6 +51,32 @@ class ConversationRenamePayload(BaseModel):
 class ConversationVariablesQuery(BaseModel):
     last_id: UUID | None = Field(default=None, description="Last variable ID for pagination")
     limit: int = Field(default=20, ge=1, le=100, description="Number of variables to return")
+    variable_name: str | None = Field(
+        default=None, description="Filter variables by name", min_length=1, max_length=255
+    )
+
+    @field_validator("variable_name", mode="before")
+    @classmethod
+    def validate_variable_name(cls, v: str | None) -> str | None:
+        """
+        Validate variable_name to prevent injection attacks.
+        """
+        if v is None:
+            return v
+
+        # Only allow safe characters: alphanumeric, underscore, hyphen, period
+        if not v.replace("-", "").replace("_", "").replace(".", "").isalnum():
+            raise ValueError(
+                "Variable name can only contain letters, numbers, hyphens (-), underscores (_), and periods (.)"
+            )
+
+        # Prevent SQL injection patterns
+        dangerous_patterns = ["'", '"', ";", "--", "/*", "*/", "xp_", "sp_"]
+        for pattern in dangerous_patterns:
+            if pattern in v.lower():
+                raise ValueError(f"Variable name contains invalid characters: {pattern}")
+
+        return v
 
 
 class ConversationVariableUpdatePayload(BaseModel):
@@ -199,7 +225,7 @@ class ConversationVariablesApi(Resource):
 
         try:
             return ConversationService.get_conversational_variable(
-                app_model, conversation_id, end_user, query_args.limit, last_id
+                app_model, conversation_id, end_user, query_args.limit, last_id, query_args.variable_name
             )
         except services.errors.conversation.ConversationNotExistsError:
             raise NotFound("Conversation Not Exists.")

api/controllers/service_api/dataset/dataset.py

@@ -49,7 +49,7 @@ class DatasetUpdatePayload(BaseModel):
     embedding_model: str | None = None
     embedding_model_provider: str | None = None
     retrieval_model: RetrievalModel | None = None
-    partial_member_list: list[str] | None = None
+    partial_member_list: list[dict[str, str]] | None = None
     external_retrieval_model: dict[str, Any] | None = None
     external_knowledge_id: str | None = None
     external_knowledge_api_id: str | None = None

api/controllers/trigger/trigger.py

@@ -33,7 +33,7 @@ def trigger_endpoint(endpoint_id: str):
             if response:
                 break
         if not response:
-            logger.error("Endpoint not found for {endpoint_id}")
+            logger.info("Endpoint not found for %s", endpoint_id)
             return jsonify({"error": "Endpoint not found"}), 404
         return response
     except ValueError as e:

api/controllers/web/app.py

@@ -1,14 +1,13 @@
 import logging
 
 from flask import request
-from flask_restx import Resource, marshal_with, reqparse
+from flask_restx import Resource, marshal_with
+from pydantic import BaseModel, ConfigDict, Field
 from werkzeug.exceptions import Unauthorized
 
 from constants import HEADER_NAME_APP_CODE
 from controllers.common import fields
-from controllers.web import web_ns
-from controllers.web.error import AppUnavailableError
-from controllers.web.wraps import WebApiResource
+from controllers.common.schema import register_schema_models
 from core.app.app_config.common.parameters_mapping import get_parameters_from_feature_dict
 from libs.passport import PassportService
 from libs.token import extract_webapp_passport
@@ -18,9 +17,23 @@ from services.enterprise.enterprise_service import EnterpriseService
 from services.feature_service import FeatureService
 from services.webapp_auth_service import WebAppAuthService
 
+from . import web_ns
+from .error import AppUnavailableError
+from .wraps import WebApiResource
+
 logger = logging.getLogger(__name__)
 
 
+class AppAccessModeQuery(BaseModel):
+    model_config = ConfigDict(populate_by_name=True)
+
+    app_id: str | None = Field(default=None, alias="appId", description="Application ID")
+    app_code: str | None = Field(default=None, alias="appCode", description="Application code")
+
+
+register_schema_models(web_ns, AppAccessModeQuery)
+
+
 @web_ns.route("/parameters")
 class AppParameterApi(WebApiResource):
     """Resource for app variables."""
@@ -96,21 +109,16 @@ class AppAccessMode(Resource):
         }
     )
     def get(self):
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("appId", type=str, required=False, location="args")
-            .add_argument("appCode", type=str, required=False, location="args")
-        )
-        args = parser.parse_args()
+        raw_args = request.args.to_dict()
+        args = AppAccessModeQuery.model_validate(raw_args)
 
         features = FeatureService.get_system_features()
         if not features.webapp_auth.enabled:
             return {"accessMode": "public"}
 
-        app_id = args.get("appId")
-        if args.get("appCode"):
-            app_code = args["appCode"]
-            app_id = AppService.get_app_id_by_code(app_code)
+        app_id = args.app_id
+        if args.app_code:
+            app_id = AppService.get_app_id_by_code(args.app_code)
 
         if not app_id:
             raise ValueError("appId or appCode must be provided")

api/controllers/web/audio.py

@@ -1,7 +1,8 @@
 import logging
 
 from flask import request
-from flask_restx import fields, marshal_with, reqparse
+from flask_restx import fields, marshal_with
+from pydantic import BaseModel, field_validator
 from werkzeug.exceptions import InternalServerError
 
 import services
@@ -20,6 +21,7 @@ from controllers.web.error import (
 from controllers.web.wraps import WebApiResource
 from core.errors.error import ModelCurrentlyNotSupportError, ProviderTokenNotInitError, QuotaExceededError
 from core.model_runtime.errors.invoke import InvokeError
+from libs.helper import uuid_value
 from models.model import App
 from services.audio_service import AudioService
 from services.errors.audio import (
@@ -29,6 +31,25 @@ from services.errors.audio import (
     UnsupportedAudioTypeServiceError,
 )
 
+from ..common.schema import register_schema_models
+
+
+class TextToAudioPayload(BaseModel):
+    message_id: str | None = None
+    voice: str | None = None
+    text: str | None = None
+    streaming: bool | None = None
+
+    @field_validator("message_id")
+    @classmethod
+    def validate_message_id(cls, value: str | None) -> str | None:
+        if value is None:
+            return value
+        return uuid_value(value)
+
+
+register_schema_models(web_ns, TextToAudioPayload)
+
 logger = logging.getLogger(__name__)
 
 
@@ -88,6 +109,7 @@ class AudioApi(WebApiResource):
 
 @web_ns.route("/text-to-audio")
 class TextApi(WebApiResource):
+    @web_ns.expect(web_ns.models[TextToAudioPayload.__name__])
     @web_ns.doc("Text to Audio")
     @web_ns.doc(description="Convert text to audio using text-to-speech service.")
     @web_ns.doc(
@@ -102,18 +124,11 @@ class TextApi(WebApiResource):
     def post(self, app_model: App, end_user):
         """Convert text to audio"""
         try:
-            parser = (
-                reqparse.RequestParser()
-                .add_argument("message_id", type=str, required=False, location="json")
-                .add_argument("voice", type=str, location="json")
-                .add_argument("text", type=str, location="json")
-                .add_argument("streaming", type=bool, location="json")
-            )
-            args = parser.parse_args()
+            payload = TextToAudioPayload.model_validate(web_ns.payload or {})
 
-            message_id = args.get("message_id", None)
-            text = args.get("text", None)
-            voice = args.get("voice", None)
+            message_id = payload.message_id
+            text = payload.text
+            voice = payload.voice
             response = AudioService.transcript_tts(
                 app_model=app_model, text=text, voice=voice, end_user=end_user.external_user_id, message_id=message_id
             )

api/controllers/web/completion.py

@@ -1,9 +1,11 @@
 import logging
+from typing import Any, Literal
 
-from flask_restx import reqparse
+from pydantic import BaseModel, Field, field_validator
 from werkzeug.exceptions import InternalServerError, NotFound
 
 import services
+from controllers.common.schema import register_schema_models
 from controllers.web import web_ns
 from controllers.web.error import (
     AppUnavailableError,
@@ -34,25 +36,44 @@ from services.errors.llm import InvokeRateLimitError
 logger = logging.getLogger(__name__)
 
 
+class CompletionMessagePayload(BaseModel):
+    inputs: dict[str, Any] = Field(description="Input variables for the completion")
+    query: str = Field(default="", description="Query text for completion")
+    files: list[dict[str, Any]] | None = Field(default=None, description="Files to be processed")
+    response_mode: Literal["blocking", "streaming"] | None = Field(
+        default=None, description="Response mode: blocking or streaming"
+    )
+    retriever_from: str = Field(default="web_app", description="Source of retriever")
+
+
+class ChatMessagePayload(BaseModel):
+    inputs: dict[str, Any] = Field(description="Input variables for the chat")
+    query: str = Field(description="User query/message")
+    files: list[dict[str, Any]] | None = Field(default=None, description="Files to be processed")
+    response_mode: Literal["blocking", "streaming"] | None = Field(
+        default=None, description="Response mode: blocking or streaming"
+    )
+    conversation_id: str | None = Field(default=None, description="Conversation ID")
+    parent_message_id: str | None = Field(default=None, description="Parent message ID")
+    retriever_from: str = Field(default="web_app", description="Source of retriever")
+
+    @field_validator("conversation_id", "parent_message_id")
+    @classmethod
+    def validate_uuid(cls, value: str | None) -> str | None:
+        if value is None:
+            return value
+        return uuid_value(value)
+
+
+register_schema_models(web_ns, CompletionMessagePayload, ChatMessagePayload)
+
+
 # define completion api for user
 @web_ns.route("/completion-messages")
 class CompletionApi(WebApiResource):
     @web_ns.doc("Create Completion Message")
     @web_ns.doc(description="Create a completion message for text generation applications.")
-    @web_ns.doc(
-        params={
-            "inputs": {"description": "Input variables for the completion", "type": "object", "required": True},
-            "query": {"description": "Query text for completion", "type": "string", "required": False},
-            "files": {"description": "Files to be processed", "type": "array", "required": False},
-            "response_mode": {
-                "description": "Response mode: blocking or streaming",
-                "type": "string",
-                "enum": ["blocking", "streaming"],
-                "required": False,
-            },
-            "retriever_from": {"description": "Source of retriever", "type": "string", "required": False},
-        }
-    )
+    @web_ns.expect(web_ns.models[CompletionMessagePayload.__name__])
     @web_ns.doc(
         responses={
             200: "Success",
@@ -67,18 +88,10 @@ class CompletionApi(WebApiResource):
         if app_model.mode != AppMode.COMPLETION:
             raise NotCompletionAppError()
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("inputs", type=dict, required=True, location="json")
-            .add_argument("query", type=str, location="json", default="")
-            .add_argument("files", type=list, required=False, location="json")
-            .add_argument("response_mode", type=str, choices=["blocking", "streaming"], location="json")
-            .add_argument("retriever_from", type=str, required=False, default="web_app", location="json")
-        )
+        payload = CompletionMessagePayload.model_validate(web_ns.payload or {})
+        args = payload.model_dump(exclude_none=True)
 
-        args = parser.parse_args()
-
-        streaming = args["response_mode"] == "streaming"
+        streaming = payload.response_mode == "streaming"
         args["auto_generate_name"] = False
 
         try:
@@ -142,22 +155,7 @@ class CompletionStopApi(WebApiResource):
 class ChatApi(WebApiResource):
     @web_ns.doc("Create Chat Message")
     @web_ns.doc(description="Create a chat message for conversational applications.")
-    @web_ns.doc(
-        params={
-            "inputs": {"description": "Input variables for the chat", "type": "object", "required": True},
-            "query": {"description": "User query/message", "type": "string", "required": True},
-            "files": {"description": "Files to be processed", "type": "array", "required": False},
-            "response_mode": {
-                "description": "Response mode: blocking or streaming",
-                "type": "string",
-                "enum": ["blocking", "streaming"],
-                "required": False,
-            },
-            "conversation_id": {"description": "Conversation UUID", "type": "string", "required": False},
-            "parent_message_id": {"description": "Parent message UUID", "type": "string", "required": False},
-            "retriever_from": {"description": "Source of retriever", "type": "string", "required": False},
-        }
-    )
+    @web_ns.expect(web_ns.models[ChatMessagePayload.__name__])
     @web_ns.doc(
         responses={
             200: "Success",
@@ -173,20 +171,10 @@ class ChatApi(WebApiResource):
         if app_mode not in {AppMode.CHAT, AppMode.AGENT_CHAT, AppMode.ADVANCED_CHAT}:
             raise NotChatAppError()
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("inputs", type=dict, required=True, location="json")
-            .add_argument("query", type=str, required=True, location="json")
-            .add_argument("files", type=list, required=False, location="json")
-            .add_argument("response_mode", type=str, choices=["blocking", "streaming"], location="json")
-            .add_argument("conversation_id", type=uuid_value, location="json")
-            .add_argument("parent_message_id", type=uuid_value, required=False, location="json")
-            .add_argument("retriever_from", type=str, required=False, default="web_app", location="json")
-        )
+        payload = ChatMessagePayload.model_validate(web_ns.payload or {})
+        args = payload.model_dump(exclude_none=True)
 
-        args = parser.parse_args()
-
-        streaming = args["response_mode"] == "streaming"
+        streaming = payload.response_mode == "streaming"
         args["auto_generate_name"] = False
 
         try:

api/controllers/web/message.py

@@ -1,9 +1,12 @@
 import logging
+from typing import Literal
 
-from flask_restx import fields, marshal_with, reqparse
-from flask_restx.inputs import int_range
+from flask import request
+from flask_restx import fields, marshal_with
+from pydantic import BaseModel, Field, field_validator
 from werkzeug.exceptions import InternalServerError, NotFound
 
+from controllers.common.schema import register_schema_models
 from controllers.web import web_ns
 from controllers.web.error import (
     AppMoreLikeThisDisabledError,
@@ -38,6 +41,33 @@ from services.message_service import MessageService
 logger = logging.getLogger(__name__)
 
 
+class MessageListQuery(BaseModel):
+    conversation_id: str = Field(description="Conversation UUID")
+    first_id: str | None = Field(default=None, description="First message ID for pagination")
+    limit: int = Field(default=20, ge=1, le=100, description="Number of messages to return (1-100)")
+
+    @field_validator("conversation_id", "first_id")
+    @classmethod
+    def validate_uuid(cls, value: str | None) -> str | None:
+        if value is None:
+            return value
+        return uuid_value(value)
+
+
+class MessageFeedbackPayload(BaseModel):
+    rating: Literal["like", "dislike"] | None = Field(default=None, description="Feedback rating")
+    content: str | None = Field(default=None, description="Feedback content")
+
+
+class MessageMoreLikeThisQuery(BaseModel):
+    response_mode: Literal["blocking", "streaming"] = Field(
+        description="Response mode",
+    )
+
+
+register_schema_models(web_ns, MessageListQuery, MessageFeedbackPayload, MessageMoreLikeThisQuery)
+
+
 @web_ns.route("/messages")
 class MessageListApi(WebApiResource):
     message_fields = {
@@ -68,7 +98,11 @@ class MessageListApi(WebApiResource):
     @web_ns.doc(
         params={
             "conversation_id": {"description": "Conversation UUID", "type": "string", "required": True},
-            "first_id": {"description": "First message ID for pagination", "type": "string", "required": False},
+            "first_id": {
+                "description": "First message ID for pagination",
+                "type": "string",
+                "required": False,
+            },
             "limit": {
                 "description": "Number of messages to return (1-100)",
                 "type": "integer",
@@ -93,17 +127,12 @@ class MessageListApi(WebApiResource):
         if app_mode not in {AppMode.CHAT, AppMode.AGENT_CHAT, AppMode.ADVANCED_CHAT}:
             raise NotChatAppError()
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("conversation_id", required=True, type=uuid_value, location="args")
-            .add_argument("first_id", type=uuid_value, location="args")
-            .add_argument("limit", type=int_range(1, 100), required=False, default=20, location="args")
-        )
-        args = parser.parse_args()
+        raw_args = request.args.to_dict()
+        query = MessageListQuery.model_validate(raw_args)
 
         try:
             return MessageService.pagination_by_first_id(
-                app_model, end_user, args["conversation_id"], args["first_id"], args["limit"]
+                app_model, end_user, query.conversation_id, query.first_id, query.limit
             )
         except ConversationNotExistsError:
             raise NotFound("Conversation Not Exists.")
@@ -128,7 +157,7 @@ class MessageFeedbackApi(WebApiResource):
                 "enum": ["like", "dislike"],
                 "required": False,
             },
-            "content": {"description": "Feedback content/comment", "type": "string", "required": False},
+            "content": {"description": "Feedback content", "type": "string", "required": False},
         }
     )
     @web_ns.doc(
@@ -145,20 +174,15 @@ class MessageFeedbackApi(WebApiResource):
     def post(self, app_model, end_user, message_id):
         message_id = str(message_id)
 
-        parser = (
-            reqparse.RequestParser()
-            .add_argument("rating", type=str, choices=["like", "dislike", None], location="json")
-            .add_argument("content", type=str, location="json", default=None)
-        )
-        args = parser.parse_args()
+        payload = MessageFeedbackPayload.model_validate(web_ns.payload or {})
 
         try:
             MessageService.create_feedback(
                 app_model=app_model,
                 message_id=message_id,
                 user=end_user,
-                rating=args.get("rating"),
-                content=args.get("content"),
+                rating=payload.rating,
+                content=payload.content,
             )
         except MessageNotExistsError:
             raise NotFound("Message Not Exists.")
@@ -170,17 +194,7 @@ class MessageFeedbackApi(WebApiResource):
 class MessageMoreLikeThisApi(WebApiResource):
     @web_ns.doc("Generate More Like This")
     @web_ns.doc(description="Generate a new completion similar to an existing message (completion apps only).")
-    @web_ns.doc(
-        params={
-            "message_id": {"description": "Message UUID", "type": "string", "required": True},
-            "response_mode": {
-                "description": "Response mode",
-                "type": "string",
-                "enum": ["blocking", "streaming"],
-                "required": True,
-            },
-        }
-    )
+    @web_ns.expect(web_ns.models[MessageMoreLikeThisQuery.__name__])
     @web_ns.doc(
         responses={
             200: "Success",
@@ -197,12 +211,10 @@ class MessageMoreLikeThisApi(WebApiResource):
 
         message_id = str(message_id)
 
-        parser = reqparse.RequestParser().add_argument(
-            "response_mode", type=str, required=True, choices=["blocking", "streaming"], location="args"
-        )
-        args = parser.parse_args()
+        raw_args = request.args.to_dict()
+        query = MessageMoreLikeThisQuery.model_validate(raw_args)
 
-        streaming = args["response_mode"] == "streaming"
+        streaming = query.response_mode == "streaming"
 
         try:
             response = AppGenerateService.generate_more_like_this(

api/core/app/app_config/entities.py

@@ -1,3 +1,4 @@
+import json
 from collections.abc import Sequence
 from enum import StrEnum, auto
 from typing import Any, Literal
@@ -120,7 +121,7 @@ class VariableEntity(BaseModel):
     allowed_file_types: Sequence[FileType] | None = Field(default_factory=list)
     allowed_file_extensions: Sequence[str] | None = Field(default_factory=list)
     allowed_file_upload_methods: Sequence[FileTransferMethod] | None = Field(default_factory=list)
-    json_schema: dict[str, Any] | None = Field(default=None)
+    json_schema: str | None = Field(default=None)
 
     @field_validator("description", mode="before")
     @classmethod
@@ -134,11 +135,17 @@ class VariableEntity(BaseModel):
 
     @field_validator("json_schema")
     @classmethod
-    def validate_json_schema(cls, schema: dict[str, Any] | None) -> dict[str, Any] | None:
+    def validate_json_schema(cls, schema: str | None) -> str | None:
         if schema is None:
             return None
+
         try:
-            Draft7Validator.check_schema(schema)
+            json_schema = json.loads(schema)
+        except json.JSONDecodeError:
+            raise ValueError(f"invalid json_schema value {schema}")
+
+        try:
+            Draft7Validator.check_schema(json_schema)
         except SchemaError as e:
             raise ValueError(f"Invalid JSON schema: {e.message}")
         return schema

api/core/app/apps/base_app_generator.py

@@ -1,3 +1,4 @@
+import json
 from collections.abc import Generator, Mapping, Sequence
 from typing import TYPE_CHECKING, Any, Union, final
 
@@ -104,8 +105,9 @@ class BaseAppGenerator:
             variable_entity.type in {VariableEntityType.FILE, VariableEntityType.FILE_LIST}
             and not variable_entity.required
         ):
-            # Treat empty string (frontend default) or empty list as unset
-            if not value and isinstance(value, (str, list)):
+            # Treat empty string (frontend default) as unset
+            # For FILE_LIST, allow empty list [] to pass through
+            if isinstance(value, str) and not value:
                 return None
 
         if variable_entity.type in {
@@ -175,6 +177,13 @@ class BaseAppGenerator:
                         value = True
                     elif value == 0:
                         value = False
+            case VariableEntityType.JSON_OBJECT:
+                if not isinstance(value, str):
+                    raise ValueError(f"{variable_entity.variable} in input form must be a string")
+                try:
+                    json.loads(value)
+                except json.JSONDecodeError:
+                    raise ValueError(f"{variable_entity.variable} in input form must be a valid JSON object")
             case _:
                 raise AssertionError("this statement should be unreachable.")
 

api/core/app/task_pipeline/easy_ui_based_generate_task_pipeline.py

@@ -342,9 +342,11 @@ class EasyUIBasedGenerateTaskPipeline(BasedGenerateTaskPipeline):
                 self._task_state.llm_result.message.content = current_content
 
                 if isinstance(event, QueueLLMChunkEvent):
+                    event_type = self._message_cycle_manager.get_message_event_type(message_id=self._message_id)
                     yield self._message_cycle_manager.message_to_stream_response(
                         answer=cast(str, delta_text),
                         message_id=self._message_id,
+                        event_type=event_type,
                     )
                 else:
                     yield self._agent_message_to_stream_response(

api/core/app/task_pipeline/message_cycle_manager.py

@@ -5,7 +5,7 @@ from threading import Thread
 from typing import Union
 
 from flask import Flask, current_app
-from sqlalchemy import select
+from sqlalchemy import exists, select
 from sqlalchemy.orm import Session
 
 from configs import dify_config
@@ -54,6 +54,20 @@ class MessageCycleManager:
     ):
         self._application_generate_entity = application_generate_entity
         self._task_state = task_state
+        self._message_has_file: set[str] = set()
+
+    def get_message_event_type(self, message_id: str) -> StreamEvent:
+        if message_id in self._message_has_file:
+            return StreamEvent.MESSAGE_FILE
+
+        with Session(db.engine, expire_on_commit=False) as session:
+            has_file = session.query(exists().where(MessageFile.message_id == message_id)).scalar()
+
+        if has_file:
+            self._message_has_file.add(message_id)
+            return StreamEvent.MESSAGE_FILE
+
+        return StreamEvent.MESSAGE
 
     def generate_conversation_name(self, *, conversation_id: str, query: str) -> Thread | None:
         """
@@ -214,7 +228,11 @@ class MessageCycleManager:
         return None
 
     def message_to_stream_response(
-        self, answer: str, message_id: str, from_variable_selector: list[str] | None = None
+        self,
+        answer: str,
+        message_id: str,
+        from_variable_selector: list[str] | None = None,
+        event_type: StreamEvent | None = None,
     ) -> MessageStreamResponse:
         """
         Message to stream response.
@@ -222,16 +240,12 @@ class MessageCycleManager:
         :param message_id: message id
         :return:
         """
-        with Session(db.engine, expire_on_commit=False) as session:
-            message_file = session.scalar(select(MessageFile).where(MessageFile.id == message_id))
-        event_type = StreamEvent.MESSAGE_FILE if message_file else StreamEvent.MESSAGE
-
         return MessageStreamResponse(
             task_id=self._application_generate_entity.task_id,
             id=message_id,
             answer=answer,
             from_variable_selector=from_variable_selector,
-            event=event_type,
+            event=event_type or StreamEvent.MESSAGE,
         )
 
     def message_replace_to_stream_response(self, answer: str, reason: str = "") -> MessageReplaceStreamResponse:

api/core/db/session_factory.py

@@ -0,0 +1,38 @@
+from sqlalchemy import Engine
+from sqlalchemy.orm import Session, sessionmaker
+
+_session_maker: sessionmaker | None = None
+
+
+def configure_session_factory(engine: Engine, expire_on_commit: bool = False):
+    """Configure the global session factory"""
+    global _session_maker
+    _session_maker = sessionmaker(bind=engine, expire_on_commit=expire_on_commit)
+
+
+def get_session_maker() -> sessionmaker:
+    if _session_maker is None:
+        raise RuntimeError("Session factory not configured. Call configure_session_factory() first.")
+    return _session_maker
+
+
+def create_session() -> Session:
+    return get_session_maker()()
+
+
+# Class wrapper for convenience
+class SessionFactory:
+    @staticmethod
+    def configure(engine: Engine, expire_on_commit: bool = False):
+        configure_session_factory(engine, expire_on_commit)
+
+    @staticmethod
+    def get_session_maker() -> sessionmaker:
+        return get_session_maker()
+
+    @staticmethod
+    def create_session() -> Session:
+        return create_session()
+
+
+session_factory = SessionFactory()

api/core/entities/knowledge_entities.py

@@ -1,4 +1,4 @@
-from pydantic import BaseModel, Field
+from pydantic import BaseModel, Field, field_validator
 
 
 class PreviewDetail(BaseModel):
@@ -20,9 +20,17 @@ class IndexingEstimate(BaseModel):
 class PipelineDataset(BaseModel):
     id: str
     name: str
-    description: str | None = Field(default="", description="knowledge dataset description")
+    description: str = Field(default="", description="knowledge dataset description")
     chunk_structure: str
 
+    @field_validator("description", mode="before")
+    @classmethod
+    def normalize_description(cls, value: str | None) -> str:
+        """Coerce None to empty string so description is always a string."""
+        if value is None:
+            return ""
+        return value
+
 
 class PipelineDocument(BaseModel):
     id: str

api/core/entities/mcp_provider.py

@@ -213,12 +213,23 @@ class MCPProviderEntity(BaseModel):
         return None
 
     def retrieve_tokens(self) -> OAuthTokens | None:
-        """OAuth tokens if available"""
+        """Retrieve OAuth tokens if authentication is complete.
+
+        Returns:
+            OAuthTokens if the provider has been authenticated, None otherwise.
+        """
         if not self.credentials:
             return None
         credentials = self.decrypt_credentials()
+        access_token = credentials.get("access_token", "")
+        # Return None if access_token is empty to avoid generating invalid "Authorization: Bearer " header.
+        # Note: We don't check for whitespace-only strings here because:
+        # 1. OAuth servers don't return whitespace-only access tokens in practice
+        # 2. Even if they did, the server would return 401, triggering the OAuth flow correctly
+        if not access_token:
+            return None
         return OAuthTokens(
-            access_token=credentials.get("access_token", ""),
+            access_token=access_token,
             token_type=credentials.get("token_type", DEFAULT_TOKEN_TYPE),
             expires_in=int(credentials.get("expires_in", str(DEFAULT_EXPIRES_IN)) or DEFAULT_EXPIRES_IN),
             refresh_token=credentials.get("refresh_token", ""),

api/core/llm_generator/llm_generator.py

@@ -72,15 +72,22 @@ class LLMGenerator:
                 prompt_messages=list(prompts), model_parameters={"max_tokens": 500, "temperature": 1}, stream=False
             )
         answer = cast(str, response.message.content)
-        cleaned_answer = re.sub(r"^.*(\{.*\}).*$", r"\1", answer, flags=re.DOTALL)
-        if cleaned_answer is None:
+        if answer is None:
             return ""
         try:
-            result_dict = json.loads(cleaned_answer)
-            answer = result_dict["Your Output"]
+            result_dict = json.loads(answer)
         except json.JSONDecodeError:
-            logger.exception("Failed to generate name after answer, use query instead")
+            result_dict = json_repair.loads(answer)
+
+        if not isinstance(result_dict, dict):
             answer = query
+        else:
+            output = result_dict.get("Your Output")
+            if isinstance(output, str) and output.strip():
+                answer = output.strip()
+            else:
+                answer = query
+
         name = answer.strip()
 
         if len(name) > 75:

api/core/mcp/auth/auth_flow.py

@@ -47,7 +47,11 @@ def build_protected_resource_metadata_discovery_urls(
     """
     Build a list of URLs to try for Protected Resource Metadata discovery.
 
-    Per SEP-985, supports fallback when discovery fails at one URL.
+    Per RFC 9728 Section 5.1, supports fallback when discovery fails at one URL.
+    Priority order:
+    1. URL from WWW-Authenticate header (if provided)
+    2. Well-known URI with path: https://example.com/.well-known/oauth-protected-resource/public/mcp
+    3. Well-known URI at root: https://example.com/.well-known/oauth-protected-resource
     """
     urls = []
 
@@ -58,9 +62,18 @@ def build_protected_resource_metadata_discovery_urls(
     # Fallback: construct from server URL
     parsed = urlparse(server_url)
     base_url = f"{parsed.scheme}://{parsed.netloc}"
-    fallback_url = urljoin(base_url, "/.well-known/oauth-protected-resource")
-    if fallback_url not in urls:
-        urls.append(fallback_url)
+    path = parsed.path.rstrip("/")
+
+    # Priority 2: With path insertion (e.g., /.well-known/oauth-protected-resource/public/mcp)
+    if path:
+        path_url = f"{base_url}/.well-known/oauth-protected-resource{path}"
+        if path_url not in urls:
+            urls.append(path_url)
+
+    # Priority 3: At root (e.g., /.well-known/oauth-protected-resource)
+    root_url = f"{base_url}/.well-known/oauth-protected-resource"
+    if root_url not in urls:
+        urls.append(root_url)
 
     return urls
 
@@ -71,30 +84,34 @@ def build_oauth_authorization_server_metadata_discovery_urls(auth_server_url: st
 
     Supports both OAuth 2.0 (RFC 8414) and OpenID Connect discovery.
 
-    Per RFC 8414 section 3:
-    - If issuer has no path: https://example.com/.well-known/oauth-authorization-server
-    - If issuer has path: https://example.com/.well-known/oauth-authorization-server{path}
-
-    Example:
-    - issuer: https://example.com/oauth
-    - metadata: https://example.com/.well-known/oauth-authorization-server/oauth
+    Per RFC 8414 section 3.1 and section 5, try all possible endpoints:
+    - OAuth 2.0 with path insertion: https://example.com/.well-known/oauth-authorization-server/tenant1
+    - OpenID Connect with path insertion: https://example.com/.well-known/openid-configuration/tenant1
+    - OpenID Connect path appending: https://example.com/tenant1/.well-known/openid-configuration
+    - OAuth 2.0 at root: https://example.com/.well-known/oauth-authorization-server
+    - OpenID Connect at root: https://example.com/.well-known/openid-configuration
     """
     urls = []
     base_url = auth_server_url or server_url
 
     parsed = urlparse(base_url)
     base = f"{parsed.scheme}://{parsed.netloc}"
-    path = parsed.path.rstrip("/")  # Remove trailing slash
+    path = parsed.path.rstrip("/")
+    # OAuth 2.0 Authorization Server Metadata at root (MCP-03-26)
+    urls.append(f"{base}/.well-known/oauth-authorization-server")
 
-    # Try OpenID Connect discovery first (more common)
-    urls.append(urljoin(base + "/", ".well-known/openid-configuration"))
+    # OpenID Connect Discovery at root
+    urls.append(f"{base}/.well-known/openid-configuration")
 
-    # OAuth 2.0 Authorization Server Metadata (RFC 8414)
-    # Include the path component if present in the issuer URL
     if path:
-        urls.append(urljoin(base, f".well-known/oauth-authorization-server{path}"))
-    else:
-        urls.append(urljoin(base, ".well-known/oauth-authorization-server"))
+        # OpenID Connect Discovery with path insertion
+        urls.append(f"{base}/.well-known/openid-configuration{path}")
+
+        # OpenID Connect Discovery path appending
+        urls.append(f"{base}{path}/.well-known/openid-configuration")
+
+        # OAuth 2.0 Authorization Server Metadata with path insertion
+        urls.append(f"{base}/.well-known/oauth-authorization-server{path}")
 
     return urls
 

api/core/mcp/mcp_client.py

@@ -59,7 +59,7 @@ class MCPClient:
             try:
                 logger.debug("Not supported method %s found in URL path, trying default 'mcp' method.", method_name)
                 self.connect_server(sse_client, "sse")
-            except MCPConnectionError:
+            except (MCPConnectionError, ValueError):
                 logger.debug("MCP connection failed with 'sse', falling back to 'mcp' method.")
                 self.connect_server(streamablehttp_client, "mcp")
 

api/core/model_runtime/README.md

@@ -18,34 +18,20 @@ This module provides the interface for invoking and authenticating various model
 
 - Model provider display
 
-  ![image-20231210143654461](./docs/en_US/images/index/image-20231210143654461.png)
-
-  Displays a list of all supported providers, including provider names, icons, supported model types list, predefined model list, configuration method, and credentials form rules, etc. For detailed rule design, see: [Schema](./docs/en_US/schema.md).
+  Displays a list of all supported providers, including provider names, icons, supported model types list, predefined model list, configuration method, and credentials form rules, etc.
 
 - Selectable model list display
 
-  ![image-20231210144229650](./docs/en_US/images/index/image-20231210144229650.png)
-
   After configuring provider/model credentials, the dropdown (application orchestration interface/default model) allows viewing of the available LLM list. Greyed out items represent predefined model lists from providers without configured credentials, facilitating user review of supported models.
 
-  In addition, this list also returns configurable parameter information and rules for LLM, as shown below:
-
-  ![image-20231210144814617](./docs/en_US/images/index/image-20231210144814617.png)
-
-  These parameters are all defined in the backend, allowing different settings for various parameters supported by different models, as detailed in: [Schema](./docs/en_US/schema.md#ParameterRule).
+  In addition, this list also returns configurable parameter information and rules for LLM. These parameters are all defined in the backend, allowing different settings for various parameters supported by different models.
 
 - Provider/model credential authentication
 
-  ![image-20231210151548521](./docs/en_US/images/index/image-20231210151548521.png)
-
-  ![image-20231210151628992](./docs/en_US/images/index/image-20231210151628992.png)
-
-  The provider list returns configuration information for the credentials form, which can be authenticated through Runtime's interface. The first image above is a provider credential DEMO, and the second is a model credential DEMO.
+  The provider list returns configuration information for the credentials form, which can be authenticated through Runtime's interface.
 
 ## Structure
 
-![](./docs/en_US/images/index/image-20231210165243632.png)
-
 Model Runtime is divided into three layers:
 
 - The outermost layer is the factory method
@@ -60,9 +46,6 @@ Model Runtime is divided into three layers:
 
   It offers direct invocation of various model types, predefined model configuration information, getting predefined/remote model lists, model credential authentication methods. Different models provide additional special methods, like LLM's pre-computed tokens method, cost information obtaining method, etc., **allowing horizontal expansion** for different models under the same provider (within supported model types).
 
-## Next Steps
+## Documentation
 
-- Add new provider configuration: [Link](./docs/en_US/provider_scale_out.md)
-- Add new models for existing providers: [Link](./docs/en_US/provider_scale_out.md#AddModel)
-- View YAML configuration rules: [Link](./docs/en_US/schema.md)
-- Implement interface methods: [Link](./docs/en_US/interfaces.md)
+For detailed documentation on how to add new providers or models, please refer to the [Dify documentation](https://docs.dify.ai/).

api/core/model_runtime/README_CN.md

@@ -18,34 +18,20 @@
 
 - 模型供应商展示
 
-  ![image-20231210143654461](./docs/zh_Hans/images/index/image-20231210143654461.png)
-
-​ 展示所有已支持的供应商列表，除了返回供应商名称、图标之外，还提供了支持的模型类型列表，预定义模型列表、配置方式以及配置凭据的表单规则等等，规则设计详见：[Schema](./docs/zh_Hans/schema.md)。
+  展示所有已支持的供应商列表，除了返回供应商名称、图标之外，还提供了支持的模型类型列表，预定义模型列表、配置方式以及配置凭据的表单规则等等。
 
 - 可选择的模型列表展示
 
-  ![image-20231210144229650](./docs/zh_Hans/images/index/image-20231210144229650.png)
+  配置供应商/模型凭据后，可在此下拉（应用编排界面/默认模型）查看可用的 LLM 列表，其中灰色的为未配置凭据供应商的预定义模型列表，方便用户查看已支持的模型。
 
-​ 配置供应商/模型凭据后，可在此下拉（应用编排界面/默认模型）查看可用的 LLM 列表，其中灰色的为未配置凭据供应商的预定义模型列表，方便用户查看已支持的模型。
-
-​ 除此之外，该列表还返回了 LLM 可配置的参数信息和规则，如下图：
-
-​ ![image-20231210144814617](./docs/zh_Hans/images/index/image-20231210144814617.png)
-
-​ 这里的参数均为后端定义，相比之前只有 5 种固定参数，这里可为不同模型设置所支持的各种参数，详见：[Schema](./docs/zh_Hans/schema.md#ParameterRule)。
+  除此之外，该列表还返回了 LLM 可配置的参数信息和规则。这里的参数均为后端定义，相比之前只有 5 种固定参数，这里可为不同模型设置所支持的各种参数。
 
 - 供应商/模型凭据鉴权
 
-  ![image-20231210151548521](./docs/zh_Hans/images/index/image-20231210151548521.png)
-
-![image-20231210151628992](./docs/zh_Hans/images/index/image-20231210151628992.png)
-
-​ 供应商列表返回了凭据表单的配置信息，可通过 Runtime 提供的接口对凭据进行鉴权，上图 1 为供应商凭据 DEMO，上图 2 为模型凭据 DEMO。
+  供应商列表返回了凭据表单的配置信息，可通过 Runtime 提供的接口对凭据进行鉴权。
 
 ## 结构
 
-![](./docs/zh_Hans/images/index/image-20231210165243632.png)
-
 Model Runtime 分三层：
 
 - 最外层为工厂方法
@@ -59,8 +45,7 @@ Model Runtime 分三层：
   对于供应商/模型凭据，有两种情况
 
   - 如 OpenAI 这类中心化供应商，需要定义如**api_key**这类的鉴权凭据
-  - 如[**Xinference**](https://github.com/xorbitsai/inference)这类本地部署的供应商，需要定义如**server_url**这类的地址凭据，有时候还需要定义**model_uid**之类的模型类型凭据，就像下面这样，当在供应商层定义了这些凭据后，就可以在前端页面上直接展示，无需修改前端逻辑。
-    ![Alt text](docs/zh_Hans/images/index/image.png)
+  - 如[**Xinference**](https://github.com/xorbitsai/inference)这类本地部署的供应商，需要定义如**server_url**这类的地址凭据，有时候还需要定义**model_uid**之类的模型类型凭据。当在供应商层定义了这些凭据后，就可以在前端页面上直接展示，无需修改前端逻辑。
 
   当配置好凭据后，就可以通过 DifyRuntime 的外部接口直接获取到对应供应商所需要的**Schema**（凭据表单规则），从而在可以在不修改前端逻辑的情况下，提供新的供应商/模型的支持。
 
@@ -74,20 +59,6 @@ Model Runtime 分三层：
 
   - 模型凭据 (**在供应商层定义**)：这是一类不经常变动，一般在配置好后就不会再变动的参数，如 **api_key**、**server_url** 等。在 DifyRuntime 中，他们的参数名一般为**credentials: dict[str, any]**，Provider 层的 credentials 会直接被传递到这一层，不需要再单独定义。
 
-## 下一步
+## 文档
 
-### [增加新的供应商配置 👈🏻](./docs/zh_Hans/provider_scale_out.md)
-
-当添加后，这里将会出现一个新的供应商
-
-![Alt text](docs/zh_Hans/images/index/image-1.png)
-
-### [为已存在的供应商新增模型 👈🏻](./docs/zh_Hans/provider_scale_out.md#%E5%A2%9E%E5%8A%A0%E6%A8%A1%E5%9E%8B)
-
-当添加后，对应供应商的模型列表中将会出现一个新的预定义模型供用户选择，如 GPT-3.5 GPT-4 ChatGLM3-6b 等，而对于支持自定义模型的供应商，则不需要新增模型。
-
-![Alt text](docs/zh_Hans/images/index/image-2.png)
-
-### [接口的具体实现 👈🏻](./docs/zh_Hans/interfaces.md)
-
-你可以在这里找到你想要查看的接口的具体实现，以及接口的参数和返回值的具体含义。
+有关如何添加新供应商或模型的详细文档，请参阅 [Dify 文档](https://docs.dify.ai/)。

api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py

@@ -6,7 +6,13 @@ from datetime import datetime, timedelta
 from typing import Any, Union, cast
 from urllib.parse import urlparse
 
-from openinference.semconv.trace import OpenInferenceMimeTypeValues, OpenInferenceSpanKindValues, SpanAttributes
+from openinference.semconv.trace import (
+    MessageAttributes,
+    OpenInferenceMimeTypeValues,
+    OpenInferenceSpanKindValues,
+    SpanAttributes,
+    ToolCallAttributes,
+)
 from opentelemetry.exporter.otlp.proto.grpc.trace_exporter import OTLPSpanExporter as GrpcOTLPSpanExporter
 from opentelemetry.exporter.otlp.proto.http.trace_exporter import OTLPSpanExporter as HttpOTLPSpanExporter
 from opentelemetry.sdk import trace as trace_sdk
@@ -95,14 +101,14 @@ def setup_tracer(arize_phoenix_config: ArizeConfig | PhoenixConfig) -> tuple[tra
 
 
 def datetime_to_nanos(dt: datetime | None) -> int:
-    """Convert datetime to nanoseconds since epoch. If None, use current time."""
+    """Convert datetime to nanoseconds since epoch for Arize/Phoenix."""
     if dt is None:
         dt = datetime.now()
     return int(dt.timestamp() * 1_000_000_000)
 
 
 def error_to_string(error: Exception | str | None) -> str:
-    """Convert an error to a string with traceback information."""
+    """Convert an error to a string with traceback information for Arize/Phoenix."""
     error_message = "Empty Stack Trace"
     if error:
         if isinstance(error, Exception):
@@ -114,7 +120,7 @@ def error_to_string(error: Exception | str | None) -> str:
 
 
 def set_span_status(current_span: Span, error: Exception | str | None = None):
-    """Set the status of the current span based on the presence of an error."""
+    """Set the status of the current span based on the presence of an error for Arize/Phoenix."""
     if error:
         error_string = error_to_string(error)
         current_span.set_status(Status(StatusCode.ERROR, error_string))
@@ -138,10 +144,17 @@ def set_span_status(current_span: Span, error: Exception | str | None = None):
 
 
 def safe_json_dumps(obj: Any) -> str:
-    """A convenience wrapper around `json.dumps` that ensures that any object can be safely encoded."""
+    """A convenience wrapper to ensure that any object can be safely encoded for Arize/Phoenix."""
     return json.dumps(obj, default=str, ensure_ascii=False)
 
 
+def wrap_span_metadata(metadata, **kwargs):
+    """Add common metatada to all trace entity types for Arize/Phoenix."""
+    metadata["created_from"] = "Dify"
+    metadata.update(kwargs)
+    return metadata
+
+
 class ArizePhoenixDataTrace(BaseTraceInstance):
     def __init__(
         self,
@@ -183,16 +196,27 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             raise
 
     def workflow_trace(self, trace_info: WorkflowTraceInfo):
-        workflow_metadata = {
-            "workflow_run_id": trace_info.workflow_run_id or "",
-            "message_id": trace_info.message_id or "",
-            "workflow_app_log_id": trace_info.workflow_app_log_id or "",
-            "status": trace_info.workflow_run_status or "",
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens or 0,
-        }
-        workflow_metadata.update(trace_info.metadata)
+        file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else []
+
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.workflow_run_status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="workflow",
+            conversation_id=trace_info.conversation_id or "",
+            workflow_app_log_id=trace_info.workflow_app_log_id or "",
+            workflow_id=trace_info.workflow_id or "",
+            tenant_id=trace_info.tenant_id or "",
+            workflow_run_id=trace_info.workflow_run_id or "",
+            workflow_run_elapsed_time=trace_info.workflow_run_elapsed_time or 0,
+            workflow_run_version=trace_info.workflow_run_version or "",
+            total_tokens=trace_info.total_tokens or 0,
+            file_list=safe_json_dumps(file_list),
+            query=trace_info.query or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.workflow_run_id
         self.ensure_root_span(dify_trace_id)
@@ -201,10 +225,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         workflow_span = self.tracer.start_span(
             name=TraceTaskName.WORKFLOW_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.workflow_run_inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.workflow_run_outputs, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(workflow_metadata, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.workflow_run_inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.workflow_run_outputs),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
                 SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
             },
             start_time=datetime_to_nanos(trace_info.start_time),
@@ -257,6 +283,7 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                         "app_id": app_id,
                         "app_name": node_execution.title,
                         "status": node_execution.status,
+                        "status_message": node_execution.error or "",
                         "level": "ERROR" if node_execution.status == "failed" else "DEFAULT",
                     }
                 )
@@ -290,11 +317,11 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                 node_span = self.tracer.start_span(
                     name=node_execution.node_type,
                     attributes={
+                        SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value,
                         SpanAttributes.INPUT_VALUE: safe_json_dumps(inputs_value),
                         SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
                         SpanAttributes.OUTPUT_VALUE: safe_json_dumps(outputs_value),
                         SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
-                        SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value,
                         SpanAttributes.METADATA: safe_json_dumps(node_metadata),
                         SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
                     },
@@ -339,30 +366,37 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def message_trace(self, trace_info: MessageTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping message trace.")
             return
 
-        file_list = cast(list[str], trace_info.file_list) or []
+        file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else []
         message_file_data: MessageFile | None = trace_info.message_file_data
 
         if message_file_data is not None:
             file_url = f"{self.file_base_url}/{message_file_data.url}" if message_file_data else ""
             file_list.append(file_url)
 
-        message_metadata = {
-            "message_id": trace_info.message_id or "",
-            "conversation_mode": str(trace_info.conversation_mode or ""),
-            "user_id": trace_info.message_data.from_account_id or "",
-            "file_list": json.dumps(file_list),
-            "status": trace_info.message_data.status or "",
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens or 0,
-            "prompt_tokens": trace_info.message_tokens or 0,
-            "completion_tokens": trace_info.answer_tokens or 0,
-            "ls_provider": trace_info.message_data.model_provider or "",
-            "ls_model_name": trace_info.message_data.model_id or "",
-        }
-        message_metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="message",
+            conversation_model=trace_info.conversation_model or "",
+            message_tokens=trace_info.message_tokens or 0,
+            answer_tokens=trace_info.answer_tokens or 0,
+            total_tokens=trace_info.total_tokens or 0,
+            conversation_mode=trace_info.conversation_mode or "",
+            gen_ai_server_time_to_first_token=trace_info.gen_ai_server_time_to_first_token or 0,
+            llm_streaming_time_to_generate=trace_info.llm_streaming_time_to_generate or 0,
+            is_streaming_request=trace_info.is_streaming_request or False,
+            user_id=trace_info.message_data.from_account_id or "",
+            file_list=safe_json_dumps(file_list),
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         # Add end user data if available
         if trace_info.message_data.from_end_user_id:
@@ -370,14 +404,16 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
                 db.session.query(EndUser).where(EndUser.id == trace_info.message_data.from_end_user_id).first()
             )
             if end_user_data is not None:
-                message_metadata["end_user_id"] = end_user_data.session_id
+                metadata["end_user_id"] = end_user_data.session_id
 
         attributes = {
-            SpanAttributes.INPUT_VALUE: trace_info.message_data.query,
-            SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer,
             SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-            SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False),
-            SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
+            SpanAttributes.INPUT_VALUE: trace_info.message_data.query,
+            SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+            SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer,
+            SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+            SpanAttributes.METADATA: safe_json_dumps(metadata),
+            SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "",
         }
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
@@ -393,8 +429,10 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
         try:
             # Convert outputs to string based on type
+            outputs_mime_type = OpenInferenceMimeTypeValues.TEXT.value
             if isinstance(trace_info.outputs, dict | list):
-                outputs_str = json.dumps(trace_info.outputs, ensure_ascii=False)
+                outputs_str = safe_json_dumps(trace_info.outputs)
+                outputs_mime_type = OpenInferenceMimeTypeValues.JSON.value
             elif isinstance(trace_info.outputs, str):
                 outputs_str = trace_info.outputs
             else:
@@ -402,10 +440,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
             llm_attributes = {
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.LLM.value,
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
                 SpanAttributes.OUTPUT_VALUE: outputs_str,
-                SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False),
-                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
+                SpanAttributes.OUTPUT_MIME_TYPE: outputs_mime_type,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
+                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "",
             }
             llm_attributes.update(self._construct_llm_attributes(trace_info.inputs))
             if trace_info.total_tokens is not None and trace_info.total_tokens > 0:
@@ -449,16 +489,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def moderation_trace(self, trace_info: ModerationTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping moderation trace.")
             return
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "moderation",
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.message_data.error or "",
+            level="ERROR" if trace_info.message_data.error else "DEFAULT",
+            trace_entity_type="moderation",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -467,18 +511,19 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.MODERATION_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(
+                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(
                     {
-                        "action": trace_info.action,
                         "flagged": trace_info.flagged,
+                        "action": trace_info.action,
                         "preset_response": trace_info.preset_response,
-                        "inputs": trace_info.inputs,
-                    },
-                    ensure_ascii=False,
+                        "query": trace_info.query,
+                    }
                 ),
-                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -494,22 +539,28 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def suggested_question_trace(self, trace_info: SuggestedQuestionTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping suggested question trace.")
             return
 
         start_time = trace_info.start_time or trace_info.message_data.created_at
         end_time = trace_info.end_time or trace_info.message_data.updated_at
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "suggested_question",
-            "status": trace_info.status,
-            "status_message": trace_info.error or "",
-            "level": "ERROR" if trace_info.error else "DEFAULT",
-            "total_tokens": trace_info.total_tokens,
-            "ls_provider": trace_info.model_provider or "",
-            "ls_model_name": trace_info.model_id or "",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.status or "",
+            status_message=trace_info.status_message or "",
+            level=trace_info.level or "",
+            trace_entity_type="suggested_question",
+            total_tokens=trace_info.total_tokens or 0,
+            from_account_id=trace_info.from_account_id or "",
+            agent_based=trace_info.agent_based or False,
+            from_source=trace_info.from_source or "",
+            model_provider=trace_info.model_provider or "",
+            model_id=trace_info.model_id or "",
+            workflow_run_id=trace_info.workflow_run_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -518,10 +569,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.SUGGESTED_QUESTION_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.suggested_question, ensure_ascii=False),
-                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.suggested_question),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(start_time),
             context=root_span_context,
@@ -537,21 +590,23 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def dataset_retrieval_trace(self, trace_info: DatasetRetrievalTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping dataset retrieval trace.")
             return
 
         start_time = trace_info.start_time or trace_info.message_data.created_at
         end_time = trace_info.end_time or trace_info.message_data.updated_at
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_name": "dataset_retrieval",
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-            "ls_provider": trace_info.message_data.model_provider or "",
-            "ls_model_name": trace_info.message_data.model_id or "",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="dataset_retrieval",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
@@ -560,20 +615,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.DATASET_RETRIEVAL_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps({"documents": trace_info.documents}, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.RETRIEVER.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
-                "start_time": start_time.isoformat() if start_time else "",
-                "end_time": end_time.isoformat() if end_time else "",
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps({"documents": trace_info.documents}),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
             },
             start_time=datetime_to_nanos(start_time),
             context=root_span_context,
         )
 
         try:
-            if trace_info.message_data.error:
-                set_span_status(span, trace_info.message_data.error)
+            if trace_info.error:
+                set_span_status(span, trace_info.error)
             else:
                 set_span_status(span)
         finally:
@@ -584,30 +639,34 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             logger.warning("[Arize/Phoenix] Message data is None, skipping tool trace.")
             return
 
-        metadata = {
-            "message_id": trace_info.message_id,
-            "tool_config": json.dumps(trace_info.tool_config, ensure_ascii=False),
-        }
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.error or "",
+            level="ERROR" if trace_info.error else "DEFAULT",
+            trace_entity_type="tool",
+            tool_config=safe_json_dumps(trace_info.tool_config),
+            time_cost=trace_info.time_cost or 0,
+            file_url=trace_info.file_url or "",
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id
         self.ensure_root_span(dify_trace_id)
         root_span_context = self.propagator.extract(carrier=self.carrier)
 
-        tool_params_str = (
-            json.dumps(trace_info.tool_parameters, ensure_ascii=False)
-            if isinstance(trace_info.tool_parameters, dict)
-            else str(trace_info.tool_parameters)
-        )
-
         span = self.tracer.start_span(
             name=trace_info.tool_name,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.tool_inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs,
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.tool_inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs,
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
                 SpanAttributes.TOOL_NAME: trace_info.tool_name,
-                SpanAttributes.TOOL_PARAMETERS: tool_params_str,
+                SpanAttributes.TOOL_PARAMETERS: safe_json_dumps(trace_info.tool_parameters),
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -623,16 +682,22 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
 
     def generate_name_trace(self, trace_info: GenerateNameTraceInfo):
         if trace_info.message_data is None:
+            logger.warning("[Arize/Phoenix] Message data is None, skipping generate name trace.")
             return
 
-        metadata = {
-            "project_name": self.project,
-            "message_id": trace_info.message_id,
-            "status": trace_info.message_data.status,
-            "status_message": trace_info.message_data.error or "",
-            "level": "ERROR" if trace_info.message_data.error else "DEFAULT",
-        }
-        metadata.update(trace_info.metadata)
+        metadata = wrap_span_metadata(
+            trace_info.metadata,
+            trace_id=trace_info.trace_id or "",
+            message_id=trace_info.message_id or "",
+            status=trace_info.message_data.status or "",
+            status_message=trace_info.message_data.error or "",
+            level="ERROR" if trace_info.message_data.error else "DEFAULT",
+            trace_entity_type="generate_name",
+            model_provider=trace_info.message_data.model_provider or "",
+            model_id=trace_info.message_data.model_id or "",
+            conversation_id=trace_info.conversation_id or "",
+            tenant_id=trace_info.tenant_id,
+        )
 
         dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.conversation_id
         self.ensure_root_span(dify_trace_id)
@@ -641,13 +706,13 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
         span = self.tracer.start_span(
             name=TraceTaskName.GENERATE_NAME_TRACE.value,
             attributes={
-                SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False),
-                SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.outputs, ensure_ascii=False),
                 SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value,
-                SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False),
-                SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id,
-                "start_time": trace_info.start_time.isoformat() if trace_info.start_time else "",
-                "end_time": trace_info.end_time.isoformat() if trace_info.end_time else "",
+                SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs),
+                SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.outputs),
+                SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value,
+                SpanAttributes.METADATA: safe_json_dumps(metadata),
+                SpanAttributes.SESSION_ID: trace_info.conversation_id or "",
             },
             start_time=datetime_to_nanos(trace_info.start_time),
             context=root_span_context,
@@ -688,32 +753,85 @@ class ArizePhoenixDataTrace(BaseTraceInstance):
             raise ValueError(f"[Arize/Phoenix] API check failed: {str(e)}")
 
     def get_project_url(self):
+        """Build a redirect URL that forwards the user to the correct project for Arize/Phoenix."""
         try:
-            if self.arize_phoenix_config.endpoint == "https://otlp.arize.com":
-                return "https://app.arize.com/"
-            else:
-                return f"{self.arize_phoenix_config.endpoint}/projects/"
+            project_name = self.arize_phoenix_config.project
+            endpoint = self.arize_phoenix_config.endpoint.rstrip("/")
+
+            # Arize
+            if isinstance(self.arize_phoenix_config, ArizeConfig):
+                return f"https://app.arize.com/?redirect_project_name={project_name}"
+
+            # Phoenix
+            return f"{endpoint}/projects/?redirect_project_name={project_name}"
+
         except Exception as e:
-            logger.info("[Arize/Phoenix] Get run url failed: %s", str(e), exc_info=True)
-            raise ValueError(f"[Arize/Phoenix] Get run url failed: {str(e)}")
+            logger.info("[Arize/Phoenix] Failed to construct project URL: %s", str(e), exc_info=True)
+            raise ValueError(f"[Arize/Phoenix] Failed to construct project URL: {str(e)}")
 
     def _construct_llm_attributes(self, prompts: dict | list | str | None) -> dict[str, str]:
-        """Helper method to construct LLM attributes with passed prompts."""
-        attributes = {}
+        """Construct LLM attributes with passed prompts for Arize/Phoenix."""
+        attributes: dict[str, str] = {}
+
+        def set_attribute(path: str, value: object) -> None:
+            """Store an attribute safely as a string."""
+            if value is None:
+                return
+            try:
+                if isinstance(value, (dict, list)):
+                    value = safe_json_dumps(value)
+                attributes[path] = str(value)
+            except Exception:
+                attributes[path] = str(value)
+
+        def set_message_attribute(message_index: int, key: str, value: object) -> None:
+            path = f"{SpanAttributes.LLM_INPUT_MESSAGES}.{message_index}.{key}"
+            set_attribute(path, value)
+
+        def set_tool_call_attributes(message_index: int, tool_index: int, tool_call: dict | object | None) -> None:
+            """Extract and assign tool call details safely."""
+            if not tool_call:
+                return
+
+            def safe_get(obj, key, default=None):
+                if isinstance(obj, dict):
+                    return obj.get(key, default)
+                return getattr(obj, key, default)
+
+            function_obj = safe_get(tool_call, "function", {})
+            function_name = safe_get(function_obj, "name", "")
+            function_args = safe_get(function_obj, "arguments", {})
+            call_id = safe_get(tool_call, "id", "")
+
+            base_path = (
+                f"{SpanAttributes.LLM_INPUT_MESSAGES}."
+                f"{message_index}.{MessageAttributes.MESSAGE_TOOL_CALLS}.{tool_index}"
+            )
+
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_NAME}", function_name)
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_ARGUMENTS_JSON}", function_args)
+            set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_ID}", call_id)
+
+        # Handle list of messages
         if isinstance(prompts, list):
-            for i, msg in enumerate(prompts):
-                if isinstance(msg, dict):
-                    attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.content"] = msg.get("text", "")
-                    attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.role"] = msg.get("role", "user")
-                    # todo: handle assistant and tool role messages, as they don't always
-                    # have a text field, but may have a tool_calls field instead
-                    # e.g. 'tool_calls': [{'id': '98af3a29-b066-45a5-b4b1-46c74ddafc58',
-                    # 'type': 'function', 'function': {'name': 'current_time', 'arguments': '{}'}}]}
-        elif isinstance(prompts, dict):
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = json.dumps(prompts)
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user"
-        elif isinstance(prompts, str):
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = prompts
-            attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user"
+            for message_index, message in enumerate(prompts):
+                if not isinstance(message, dict):
+                    continue
+
+                role = message.get("role", "user")
+                content = message.get("text") or message.get("content") or ""
+
+                set_message_attribute(message_index, MessageAttributes.MESSAGE_ROLE, role)
+                set_message_attribute(message_index, MessageAttributes.MESSAGE_CONTENT, content)
+
+                tool_calls = message.get("tool_calls") or []
+                if isinstance(tool_calls, list):
+                    for tool_index, tool_call in enumerate(tool_calls):
+                        set_tool_call_attributes(message_index, tool_index, tool_call)
+
+        # Handle single dict or plain string prompt
+        elif isinstance(prompts, (dict, str)):
+            set_message_attribute(0, MessageAttributes.MESSAGE_CONTENT, prompts)
+            set_message_attribute(0, MessageAttributes.MESSAGE_ROLE, "user")
 
         return attributes

api/core/plugin/impl/base.py

@@ -39,7 +39,7 @@ from core.trigger.errors import (
 plugin_daemon_inner_api_baseurl = URL(str(dify_config.PLUGIN_DAEMON_URL))
 _plugin_daemon_timeout_config = cast(
     float | httpx.Timeout | None,
-    getattr(dify_config, "PLUGIN_DAEMON_TIMEOUT", 300.0),
+    getattr(dify_config, "PLUGIN_DAEMON_TIMEOUT", 600.0),
 )
 plugin_daemon_request_timeout: httpx.Timeout | None
 if _plugin_daemon_timeout_config is None:

api/core/rag/datasource/keyword/jieba/jieba.py

@@ -90,13 +90,17 @@ class Jieba(BaseKeyword):
         sorted_chunk_indices = self._retrieve_ids_by_query(keyword_table or {}, query, k)
 
         documents = []
+
+        segment_query_stmt = db.session.query(DocumentSegment).where(
+            DocumentSegment.dataset_id == self.dataset.id, DocumentSegment.index_node_id.in_(sorted_chunk_indices)
+        )
+        if document_ids_filter:
+            segment_query_stmt = segment_query_stmt.where(DocumentSegment.document_id.in_(document_ids_filter))
+
+        segments = db.session.execute(segment_query_stmt).scalars().all()
+        segment_map = {segment.index_node_id: segment for segment in segments}
         for chunk_index in sorted_chunk_indices:
-            segment_query = db.session.query(DocumentSegment).where(
-                DocumentSegment.dataset_id == self.dataset.id, DocumentSegment.index_node_id == chunk_index
-            )
-            if document_ids_filter:
-                segment_query = segment_query.where(DocumentSegment.document_id.in_(document_ids_filter))
-            segment = segment_query.first()
+            segment = segment_map.get(chunk_index)
 
             if segment:
                 documents.append(

api/core/rag/datasource/retrieval_service.py

@@ -7,6 +7,7 @@ from sqlalchemy import select
 from sqlalchemy.orm import Session, load_only
 
 from configs import dify_config
+from core.db.session_factory import session_factory
 from core.model_manager import ModelManager
 from core.model_runtime.entities.model_entities import ModelType
 from core.rag.data_post_processor.data_post_processor import DataPostProcessor
@@ -138,37 +139,47 @@ class RetrievalService:
 
     @classmethod
     def _deduplicate_documents(cls, documents: list[Document]) -> list[Document]:
-        """Deduplicate documents based on doc_id to avoid duplicate chunks in hybrid search."""
+        """Deduplicate documents in O(n) while preserving first-seen order.
+
+        Rules:
+        - For provider == "dify" and metadata["doc_id"] exists: keep the doc with the highest
+          metadata["score"] among duplicates; if a later duplicate has no score, ignore it.
+        - For non-dify documents (or dify without doc_id): deduplicate by content key
+          (provider, page_content), keeping the first occurrence.
+        """
         if not documents:
             return documents
 
-        unique_documents = []
-        seen_doc_ids = set()
+        # Map of dedup key -> chosen Document
+        chosen: dict[tuple, Document] = {}
+        # Preserve the order of first appearance of each dedup key
+        order: list[tuple] = []
 
-        for document in documents:
-            # For dify provider documents, use doc_id for deduplication
-            if document.provider == "dify" and document.metadata is not None and "doc_id" in document.metadata:
-                doc_id = document.metadata["doc_id"]
-                if doc_id not in seen_doc_ids:
-                    seen_doc_ids.add(doc_id)
-                    unique_documents.append(document)
-                # If duplicate, keep the one with higher score
-                elif "score" in document.metadata:
-                    # Find existing document with same doc_id and compare scores
-                    for i, existing_doc in enumerate(unique_documents):
-                        if (
-                            existing_doc.metadata
-                            and existing_doc.metadata.get("doc_id") == doc_id
-                            and existing_doc.metadata.get("score", 0) < document.metadata.get("score", 0)
-                        ):
-                            unique_documents[i] = document
-                            break
+        for doc in documents:
+            is_dify = doc.provider == "dify"
+            doc_id = (doc.metadata or {}).get("doc_id") if is_dify else None
+
+            if is_dify and doc_id:
+                key = ("dify", doc_id)
+                if key not in chosen:
+                    chosen[key] = doc
+                    order.append(key)
+                else:
+                    # Only replace if the new one has a score and it's strictly higher
+                    if "score" in doc.metadata:
+                        new_score = float(doc.metadata.get("score", 0.0))
+                        old_score = float(chosen[key].metadata.get("score", 0.0)) if chosen[key].metadata else 0.0
+                        if new_score > old_score:
+                            chosen[key] = doc
             else:
-                # For non-dify documents, use content-based deduplication
-                if document not in unique_documents:
-                    unique_documents.append(document)
+                # Content-based dedup for non-dify or dify without doc_id
+                content_key = (doc.provider or "dify", doc.page_content)
+                if content_key not in chosen:
+                    chosen[content_key] = doc
+                    order.append(content_key)
+                # If duplicate content appears, we keep the first occurrence (no score comparison)
 
-        return unique_documents
+        return [chosen[k] for k in order]
 
     @classmethod
     def _get_dataset(cls, dataset_id: str) -> Dataset | None:
@@ -371,58 +382,96 @@ class RetrievalService:
             include_segment_ids = set()
             segment_child_map = {}
             segment_file_map = {}
-            with Session(bind=db.engine, expire_on_commit=False) as session:
-                # Process documents
-                for document in documents:
-                    segment_id = None
-                    attachment_info = None
-                    child_chunk = None
-                    document_id = document.metadata.get("document_id")
-                    if document_id not in dataset_documents:
-                        continue
 
-                    dataset_document = dataset_documents[document_id]
-                    if not dataset_document:
-                        continue
+            valid_dataset_documents = {}
+            image_doc_ids = []
+            child_index_node_ids = []
+            index_node_ids = []
+            doc_to_document_map = {}
+            for document in documents:
+                document_id = document.metadata.get("document_id")
+                if document_id not in dataset_documents:
+                    continue
 
-                    if dataset_document.doc_form == IndexStructureType.PARENT_CHILD_INDEX:
-                        # Handle parent-child documents
-                        if document.metadata.get("doc_type") == DocType.IMAGE:
-                            attachment_info_dict = cls.get_segment_attachment_info(
-                                dataset_document.dataset_id,
-                                dataset_document.tenant_id,
-                                document.metadata.get("doc_id") or "",
-                                session,
-                            )
-                            if attachment_info_dict:
-                                attachment_info = attachment_info_dict["attachment_info"]
-                                segment_id = attachment_info_dict["segment_id"]
-                        else:
-                            child_index_node_id = document.metadata.get("doc_id")
-                            child_chunk_stmt = select(ChildChunk).where(ChildChunk.index_node_id == child_index_node_id)
-                            child_chunk = session.scalar(child_chunk_stmt)
+                dataset_document = dataset_documents[document_id]
+                if not dataset_document:
+                    continue
+                valid_dataset_documents[document_id] = dataset_document
 
-                            if not child_chunk:
-                                continue
-                            segment_id = child_chunk.segment_id
+                if dataset_document.doc_form == IndexStructureType.PARENT_CHILD_INDEX:
+                    doc_id = document.metadata.get("doc_id") or ""
+                    doc_to_document_map[doc_id] = document
+                    if document.metadata.get("doc_type") == DocType.IMAGE:
+                        image_doc_ids.append(doc_id)
+                    else:
+                        child_index_node_ids.append(doc_id)
+                else:
+                    doc_id = document.metadata.get("doc_id") or ""
+                    doc_to_document_map[doc_id] = document
+                    if document.metadata.get("doc_type") == DocType.IMAGE:
+                        image_doc_ids.append(doc_id)
+                    else:
+                        index_node_ids.append(doc_id)
 
-                        if not segment_id:
-                            continue
+            image_doc_ids = [i for i in image_doc_ids if i]
+            child_index_node_ids = [i for i in child_index_node_ids if i]
+            index_node_ids = [i for i in index_node_ids if i]
 
-                        segment = (
-                            session.query(DocumentSegment)
-                            .where(
-                                DocumentSegment.dataset_id == dataset_document.dataset_id,
-                                DocumentSegment.enabled == True,
-                                DocumentSegment.status == "completed",
-                                DocumentSegment.id == segment_id,
-                            )
-                            .first()
-                        )
+            segment_ids = []
+            index_node_segments: list[DocumentSegment] = []
+            segments: list[DocumentSegment] = []
+            attachment_map = {}
+            child_chunk_map = {}
+            doc_segment_map = {}
 
-                        if not segment:
-                            continue
+            with session_factory.create_session() as session:
+                attachments = cls.get_segment_attachment_infos(image_doc_ids, session)
 
+                for attachment in attachments:
+                    segment_ids.append(attachment["segment_id"])
+                    attachment_map[attachment["segment_id"]] = attachment
+                    doc_segment_map[attachment["segment_id"]] = attachment["attachment_id"]
+
+                child_chunk_stmt = select(ChildChunk).where(ChildChunk.index_node_id.in_(child_index_node_ids))
+                child_index_nodes = session.execute(child_chunk_stmt).scalars().all()
+
+                for i in child_index_nodes:
+                    segment_ids.append(i.segment_id)
+                    child_chunk_map[i.segment_id] = i
+                    doc_segment_map[i.segment_id] = i.index_node_id
+
+                if index_node_ids:
+                    document_segment_stmt = select(DocumentSegment).where(
+                        DocumentSegment.enabled == True,
+                        DocumentSegment.status == "completed",
+                        DocumentSegment.index_node_id.in_(index_node_ids),
+                    )
+                    index_node_segments = session.execute(document_segment_stmt).scalars().all()  # type: ignore
+                    for index_node_segment in index_node_segments:
+                        doc_segment_map[index_node_segment.id] = index_node_segment.index_node_id
+                if segment_ids:
+                    document_segment_stmt = select(DocumentSegment).where(
+                        DocumentSegment.enabled == True,
+                        DocumentSegment.status == "completed",
+                        DocumentSegment.id.in_(segment_ids),
+                    )
+                    segments = session.execute(document_segment_stmt).scalars().all()  # type: ignore
+
+                if index_node_segments:
+                    segments.extend(index_node_segments)
+
+            for segment in segments:
+                doc_id = doc_segment_map.get(segment.id)
+                child_chunk = child_chunk_map.get(segment.id)
+                attachment_info = attachment_map.get(segment.id)
+
+                if doc_id:
+                    document = doc_to_document_map[doc_id]
+                    ds_dataset_document: DatasetDocument | None = valid_dataset_documents.get(
+                        document.metadata.get("document_id")
+                    )
+
+                    if ds_dataset_document and ds_dataset_document.doc_form == IndexStructureType.PARENT_CHILD_INDEX:
                         if segment.id not in include_segment_ids:
                             include_segment_ids.add(segment.id)
                             if child_chunk:
@@ -430,10 +479,10 @@ class RetrievalService:
                                     "id": child_chunk.id,
                                     "content": child_chunk.content,
                                     "position": child_chunk.position,
-                                    "score": document.metadata.get("score", 0.0),
+                                    "score": document.metadata.get("score", 0.0) if document else 0.0,
                                 }
                                 map_detail = {
-                                    "max_score": document.metadata.get("score", 0.0),
+                                    "max_score": document.metadata.get("score", 0.0) if document else 0.0,
                                     "child_chunks": [child_chunk_detail],
                                 }
                                 segment_child_map[segment.id] = map_detail
@@ -452,13 +501,14 @@ class RetrievalService:
                                     "score": document.metadata.get("score", 0.0),
                                 }
                                 if segment.id in segment_child_map:
-                                    segment_child_map[segment.id]["child_chunks"].append(child_chunk_detail)
+                                    segment_child_map[segment.id]["child_chunks"].append(child_chunk_detail)  # type: ignore
                                     segment_child_map[segment.id]["max_score"] = max(
-                                        segment_child_map[segment.id]["max_score"], document.metadata.get("score", 0.0)
+                                        segment_child_map[segment.id]["max_score"],
+                                        document.metadata.get("score", 0.0) if document else 0.0,
                                     )
                                 else:
                                     segment_child_map[segment.id] = {
-                                        "max_score": document.metadata.get("score", 0.0),
+                                        "max_score": document.metadata.get("score", 0.0) if document else 0.0,
                                         "child_chunks": [child_chunk_detail],
                                     }
                             if attachment_info:
@@ -467,46 +517,11 @@ class RetrievalService:
                                 else:
                                     segment_file_map[segment.id] = [attachment_info]
                     else:
-                        # Handle normal documents
-                        segment = None
-                        if document.metadata.get("doc_type") == DocType.IMAGE:
-                            attachment_info_dict = cls.get_segment_attachment_info(
-                                dataset_document.dataset_id,
-                                dataset_document.tenant_id,
-                                document.metadata.get("doc_id") or "",
-                                session,
-                            )
-                            if attachment_info_dict:
-                                attachment_info = attachment_info_dict["attachment_info"]
-                                segment_id = attachment_info_dict["segment_id"]
-                                document_segment_stmt = select(DocumentSegment).where(
-                                    DocumentSegment.dataset_id == dataset_document.dataset_id,
-                                    DocumentSegment.enabled == True,
-                                    DocumentSegment.status == "completed",
-                                    DocumentSegment.id == segment_id,
-                                )
-                                segment = session.scalar(document_segment_stmt)
-                                if segment:
-                                    segment_file_map[segment.id] = [attachment_info]
-                        else:
-                            index_node_id = document.metadata.get("doc_id")
-                            if not index_node_id:
-                                continue
-                            document_segment_stmt = select(DocumentSegment).where(
-                                DocumentSegment.dataset_id == dataset_document.dataset_id,
-                                DocumentSegment.enabled == True,
-                                DocumentSegment.status == "completed",
-                                DocumentSegment.index_node_id == index_node_id,
-                            )
-                            segment = session.scalar(document_segment_stmt)
-
-                        if not segment:
-                            continue
                         if segment.id not in include_segment_ids:
                             include_segment_ids.add(segment.id)
                             record = {
                                 "segment": segment,
-                                "score": document.metadata.get("score"),  # type: ignore
+                                "score": document.metadata.get("score", 0.0),  # type: ignore
                             }
                             if attachment_info:
                                 segment_file_map[segment.id] = [attachment_info]
@@ -522,7 +537,7 @@ class RetrievalService:
             for record in records:
                 if record["segment"].id in segment_child_map:
                     record["child_chunks"] = segment_child_map[record["segment"].id].get("child_chunks")  # type: ignore
-                    record["score"] = segment_child_map[record["segment"].id]["max_score"]
+                    record["score"] = segment_child_map[record["segment"].id]["max_score"]  # type: ignore
                 if record["segment"].id in segment_file_map:
                     record["files"] = segment_file_map[record["segment"].id]  # type: ignore[assignment]
 
@@ -565,6 +580,8 @@ class RetrievalService:
         flask_app: Flask,
         retrieval_method: RetrievalMethod,
         dataset: Dataset,
+        all_documents: list[Document],
+        exceptions: list[str],
         query: str | None = None,
         top_k: int = 4,
         score_threshold: float | None = 0.0,
@@ -573,8 +590,6 @@ class RetrievalService:
         weights: dict | None = None,
         document_ids_filter: list[str] | None = None,
         attachment_id: str | None = None,
-        all_documents: list[Document] = [],
-        exceptions: list[str] = [],
     ):
         if not query and not attachment_id:
             return
@@ -696,3 +711,37 @@ class RetrievalService:
                 }
                 return {"attachment_info": attachment_info, "segment_id": attachment_binding.segment_id}
         return None
+
+    @classmethod
+    def get_segment_attachment_infos(cls, attachment_ids: list[str], session: Session) -> list[dict[str, Any]]:
+        attachment_infos = []
+        upload_files = session.query(UploadFile).where(UploadFile.id.in_(attachment_ids)).all()
+        if upload_files:
+            upload_file_ids = [upload_file.id for upload_file in upload_files]
+            attachment_bindings = (
+                session.query(SegmentAttachmentBinding)
+                .where(SegmentAttachmentBinding.attachment_id.in_(upload_file_ids))
+                .all()
+            )
+            attachment_binding_map = {binding.attachment_id: binding for binding in attachment_bindings}
+
+            if attachment_bindings:
+                for upload_file in upload_files:
+                    attachment_binding = attachment_binding_map.get(upload_file.id)
+                    attachment_info = {
+                        "id": upload_file.id,
+                        "name": upload_file.name,
+                        "extension": "." + upload_file.extension,
+                        "mime_type": upload_file.mime_type,
+                        "source_url": sign_upload_file(upload_file.id, upload_file.extension),
+                        "size": upload_file.size,
+                    }
+                    if attachment_binding:
+                        attachment_infos.append(
+                            {
+                                "attachment_id": attachment_binding.attachment_id,
+                                "attachment_info": attachment_info,
+                                "segment_id": attachment_binding.segment_id,
+                            }
+                        )
+        return attachment_infos

api/core/rag/datasource/vdb/iris/iris_vector.py

@@ -0,0 +1,407 @@
+"""InterSystems IRIS vector database implementation for Dify.
+
+This module provides vector storage and retrieval using IRIS native VECTOR type
+with HNSW indexing for efficient similarity search.
+"""
+
+from __future__ import annotations
+
+import json
+import logging
+import threading
+import uuid
+from contextlib import contextmanager
+from typing import TYPE_CHECKING, Any
+
+from configs import dify_config
+from configs.middleware.vdb.iris_config import IrisVectorConfig
+from core.rag.datasource.vdb.vector_base import BaseVector
+from core.rag.datasource.vdb.vector_factory import AbstractVectorFactory
+from core.rag.datasource.vdb.vector_type import VectorType
+from core.rag.embedding.embedding_base import Embeddings
+from core.rag.models.document import Document
+from extensions.ext_redis import redis_client
+from models.dataset import Dataset
+
+if TYPE_CHECKING:
+    import iris
+else:
+    try:
+        import iris
+    except ImportError:
+        iris = None  # type: ignore[assignment]
+
+logger = logging.getLogger(__name__)
+
+# Singleton connection pool to minimize IRIS license usage
+_pool_lock = threading.Lock()
+_pool_instance: IrisConnectionPool | None = None
+
+
+def get_iris_pool(config: IrisVectorConfig) -> IrisConnectionPool:
+    """Get or create the global IRIS connection pool (singleton pattern)."""
+    global _pool_instance  # pylint: disable=global-statement
+    with _pool_lock:
+        if _pool_instance is None:
+            logger.info("Initializing IRIS connection pool")
+            _pool_instance = IrisConnectionPool(config)
+        return _pool_instance
+
+
+class IrisConnectionPool:
+    """Thread-safe connection pool for IRIS database."""
+
+    def __init__(self, config: IrisVectorConfig) -> None:
+        self.config = config
+        self._pool: list[Any] = []
+        self._lock = threading.Lock()
+        self._min_size = config.IRIS_MIN_CONNECTION
+        self._max_size = config.IRIS_MAX_CONNECTION
+        self._in_use = 0
+        self._schemas_initialized: set[str] = set()  # Cache for initialized schemas
+        self._initialize_pool()
+
+    def _initialize_pool(self) -> None:
+        for _ in range(self._min_size):
+            self._pool.append(self._create_connection())
+
+    def _create_connection(self) -> Any:
+        return iris.connect(
+            hostname=self.config.IRIS_HOST,
+            port=self.config.IRIS_SUPER_SERVER_PORT,
+            namespace=self.config.IRIS_DATABASE,
+            username=self.config.IRIS_USER,
+            password=self.config.IRIS_PASSWORD,
+        )
+
+    def get_connection(self) -> Any:
+        """Get a connection from pool or create new if available."""
+        with self._lock:
+            if self._pool:
+                conn = self._pool.pop()
+                self._in_use += 1
+                return conn
+            if self._in_use < self._max_size:
+                conn = self._create_connection()
+                self._in_use += 1
+                return conn
+            raise RuntimeError("Connection pool exhausted")
+
+    def return_connection(self, conn: Any) -> None:
+        """Return connection to pool after validating it."""
+        if not conn:
+            return
+
+        # Validate connection health
+        is_valid = False
+        try:
+            cursor = conn.cursor()
+            cursor.execute("SELECT 1")
+            cursor.close()
+            is_valid = True
+        except (OSError, RuntimeError) as e:
+            logger.debug("Connection validation failed: %s", e)
+            try:
+                conn.close()
+            except (OSError, RuntimeError):
+                pass
+
+        with self._lock:
+            self._pool.append(conn if is_valid else self._create_connection())
+            self._in_use -= 1
+
+    def ensure_schema_exists(self, schema: str) -> None:
+        """Ensure schema exists in IRIS database.
+
+        This method is idempotent and thread-safe. It uses a memory cache to avoid
+        redundant database queries for already-verified schemas.
+
+        Args:
+            schema: Schema name to ensure exists
+
+        Raises:
+            Exception: If schema creation fails
+        """
+        # Fast path: check cache first (no lock needed for read-only set lookup)
+        if schema in self._schemas_initialized:
+            return
+
+        # Slow path: acquire lock and check again (double-checked locking)
+        with self._lock:
+            if schema in self._schemas_initialized:
+                return
+
+            # Get a connection to check/create schema
+            conn = self._pool[0] if self._pool else self._create_connection()
+            cursor = conn.cursor()
+            try:
+                # Check if schema exists using INFORMATION_SCHEMA
+                check_sql = """
+                    SELECT COUNT(*) FROM INFORMATION_SCHEMA.SCHEMATA
+                    WHERE SCHEMA_NAME = ?
+                """
+                cursor.execute(check_sql, (schema,))  # Must be tuple or list
+                exists = cursor.fetchone()[0] > 0
+
+                if not exists:
+                    # Schema doesn't exist, create it
+                    cursor.execute(f"CREATE SCHEMA {schema}")
+                    conn.commit()
+                    logger.info("Created schema: %s", schema)
+                else:
+                    logger.debug("Schema already exists: %s", schema)
+
+                # Add to cache to skip future checks
+                self._schemas_initialized.add(schema)
+
+            except Exception as e:
+                conn.rollback()
+                logger.exception("Failed to ensure schema %s exists", schema)
+                raise
+            finally:
+                cursor.close()
+
+    def close_all(self) -> None:
+        """Close all connections (application shutdown only)."""
+        with self._lock:
+            for conn in self._pool:
+                try:
+                    conn.close()
+                except (OSError, RuntimeError):
+                    pass
+            self._pool.clear()
+            self._in_use = 0
+            self._schemas_initialized.clear()
+
+
+class IrisVector(BaseVector):
+    """IRIS vector database implementation using native VECTOR type and HNSW indexing."""
+
+    def __init__(self, collection_name: str, config: IrisVectorConfig) -> None:
+        super().__init__(collection_name)
+        self.config = config
+        self.table_name = f"embedding_{collection_name}".upper()
+        self.schema = config.IRIS_SCHEMA or "dify"
+        self.pool = get_iris_pool(config)
+
+    def get_type(self) -> str:
+        return VectorType.IRIS
+
+    @contextmanager
+    def _get_cursor(self):
+        """Context manager for database cursor with connection pooling."""
+        conn = self.pool.get_connection()
+        cursor = conn.cursor()
+        try:
+            yield cursor
+            conn.commit()
+        except Exception:
+            conn.rollback()
+            raise
+        finally:
+            cursor.close()
+            self.pool.return_connection(conn)
+
+    def create(self, texts: list[Document], embeddings: list[list[float]], **kwargs) -> list[str]:
+        dimension = len(embeddings[0])
+        self._create_collection(dimension)
+        return self.add_texts(texts, embeddings)
+
+    def add_texts(self, documents: list[Document], embeddings: list[list[float]], **_kwargs) -> list[str]:
+        """Add documents with embeddings to the collection."""
+        added_ids = []
+        with self._get_cursor() as cursor:
+            for i, doc in enumerate(documents):
+                doc_id = doc.metadata.get("doc_id", str(uuid.uuid4())) if doc.metadata else str(uuid.uuid4())
+                metadata = json.dumps(doc.metadata) if doc.metadata else "{}"
+                embedding_str = json.dumps(embeddings[i])
+
+                sql = f"INSERT INTO {self.schema}.{self.table_name} (id, text, meta, embedding) VALUES (?, ?, ?, ?)"
+                cursor.execute(sql, (doc_id, doc.page_content, metadata, embedding_str))
+                added_ids.append(doc_id)
+
+        return added_ids
+
+    def text_exists(self, id: str) -> bool:  # pylint: disable=redefined-builtin
+        try:
+            with self._get_cursor() as cursor:
+                sql = f"SELECT 1 FROM {self.schema}.{self.table_name} WHERE id = ?"
+                cursor.execute(sql, (id,))
+                return cursor.fetchone() is not None
+        except (OSError, RuntimeError, ValueError):
+            return False
+
+    def delete_by_ids(self, ids: list[str]) -> None:
+        if not ids:
+            return
+
+        with self._get_cursor() as cursor:
+            placeholders = ",".join(["?" for _ in ids])
+            sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE id IN ({placeholders})"
+            cursor.execute(sql, ids)
+
+    def delete_by_metadata_field(self, key: str, value: str) -> None:
+        """Delete documents by metadata field (JSON LIKE pattern matching)."""
+        with self._get_cursor() as cursor:
+            pattern = f'%"{key}": "{value}"%'
+            sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE meta LIKE ?"
+            cursor.execute(sql, (pattern,))
+
+    def search_by_vector(self, query_vector: list[float], **kwargs: Any) -> list[Document]:
+        """Search similar documents using VECTOR_COSINE with HNSW index."""
+        top_k = kwargs.get("top_k", 4)
+        score_threshold = float(kwargs.get("score_threshold") or 0.0)
+        embedding_str = json.dumps(query_vector)
+
+        with self._get_cursor() as cursor:
+            sql = f"""
+                SELECT TOP {top_k} id, text, meta, VECTOR_COSINE(embedding, ?) as score
+                FROM {self.schema}.{self.table_name}
+                ORDER BY score DESC
+            """
+            cursor.execute(sql, (embedding_str,))
+
+            docs = []
+            for row in cursor.fetchall():
+                if len(row) >= 4:
+                    text, meta_str, score = row[1], row[2], float(row[3])
+                    if score >= score_threshold:
+                        metadata = json.loads(meta_str) if meta_str else {}
+                        metadata["score"] = score
+                        docs.append(Document(page_content=text, metadata=metadata))
+            return docs
+
+    def search_by_full_text(self, query: str, **kwargs: Any) -> list[Document]:
+        """Search documents by full-text using iFind index or fallback to LIKE search."""
+        top_k = kwargs.get("top_k", 5)
+
+        with self._get_cursor() as cursor:
+            if self.config.IRIS_TEXT_INDEX:
+                # Use iFind full-text search with index
+                text_index_name = f"idx_{self.table_name}_text"
+                sql = f"""
+                    SELECT TOP {top_k} id, text, meta
+                    FROM {self.schema}.{self.table_name}
+                    WHERE %ID %FIND search_index({text_index_name}, ?)
+                """
+                cursor.execute(sql, (query,))
+            else:
+                # Fallback to LIKE search (inefficient for large datasets)
+                query_pattern = f"%{query}%"
+                sql = f"""
+                    SELECT TOP {top_k} id, text, meta
+                    FROM {self.schema}.{self.table_name}
+                    WHERE text LIKE ?
+                """
+                cursor.execute(sql, (query_pattern,))
+
+            docs = []
+            for row in cursor.fetchall():
+                if len(row) >= 3:
+                    metadata = json.loads(row[2]) if row[2] else {}
+                    docs.append(Document(page_content=row[1], metadata=metadata))
+
+            if not docs:
+                logger.info("Full-text search for '%s' returned no results", query)
+
+            return docs
+
+    def delete(self) -> None:
+        """Delete the entire collection (drop table - permanent)."""
+        with self._get_cursor() as cursor:
+            sql = f"DROP TABLE {self.schema}.{self.table_name}"
+            cursor.execute(sql)
+
+    def _create_collection(self, dimension: int) -> None:
+        """Create table with VECTOR column and HNSW index.
+
+        Uses Redis lock to prevent concurrent creation attempts across multiple
+        API server instances (api, worker, worker_beat).
+        """
+        cache_key = f"vector_indexing_{self._collection_name}"
+        lock_name = f"{cache_key}_lock"
+
+        with redis_client.lock(lock_name, timeout=20):  # pylint: disable=not-context-manager
+            if redis_client.get(cache_key):
+                return
+
+            # Ensure schema exists (idempotent, cached after first call)
+            self.pool.ensure_schema_exists(self.schema)
+
+            with self._get_cursor() as cursor:
+                # Create table with VECTOR column
+                sql = f"""
+                    CREATE TABLE {self.schema}.{self.table_name} (
+                        id VARCHAR(255) PRIMARY KEY,
+                        text CLOB,
+                        meta CLOB,
+                        embedding VECTOR(DOUBLE, {dimension})
+                    )
+                """
+                logger.info("Creating table: %s.%s", self.schema, self.table_name)
+                cursor.execute(sql)
+
+                # Create HNSW index for vector similarity search
+                index_name = f"idx_{self.table_name}_embedding"
+                sql_index = (
+                    f"CREATE INDEX {index_name} ON {self.schema}.{self.table_name} "
+                    "(embedding) AS HNSW(Distance='Cosine')"
+                )
+                logger.info("Creating HNSW index: %s", index_name)
+                cursor.execute(sql_index)
+                logger.info("HNSW index created successfully: %s", index_name)
+
+                # Create full-text search index if enabled
+                logger.info(
+                    "IRIS_TEXT_INDEX config value: %s (type: %s)",
+                    self.config.IRIS_TEXT_INDEX,
+                    type(self.config.IRIS_TEXT_INDEX),
+                )
+                if self.config.IRIS_TEXT_INDEX:
+                    text_index_name = f"idx_{self.table_name}_text"
+                    language = self.config.IRIS_TEXT_INDEX_LANGUAGE
+                    # Fixed: Removed extra parentheses and corrected syntax
+                    sql_text_index = f"""
+                        CREATE INDEX {text_index_name} ON {self.schema}.{self.table_name} (text)
+                        AS %iFind.Index.Basic
+                        (LANGUAGE = '{language}', LOWER = 1, INDEXOPTION = 0)
+                    """
+                    logger.info("Creating text index: %s with language: %s", text_index_name, language)
+                    logger.info("SQL for text index: %s", sql_text_index)
+                    cursor.execute(sql_text_index)
+                    logger.info("Text index created successfully: %s", text_index_name)
+                else:
+                    logger.warning("Text index creation skipped - IRIS_TEXT_INDEX is disabled")
+
+            redis_client.set(cache_key, 1, ex=3600)
+
+
+class IrisVectorFactory(AbstractVectorFactory):
+    """Factory for creating IrisVector instances."""
+
+    def init_vector(self, dataset: Dataset, attributes: list, embeddings: Embeddings) -> IrisVector:
+        if dataset.index_struct_dict:
+            class_prefix: str = dataset.index_struct_dict["vector_store"]["class_prefix"]
+            collection_name = class_prefix
+        else:
+            dataset_id = dataset.id
+            collection_name = Dataset.gen_collection_name_by_id(dataset_id)
+            index_struct_dict = self.gen_index_struct_dict(VectorType.IRIS, collection_name)
+            dataset.index_struct = json.dumps(index_struct_dict)
+
+        return IrisVector(
+            collection_name=collection_name,
+            config=IrisVectorConfig(
+                IRIS_HOST=dify_config.IRIS_HOST,
+                IRIS_SUPER_SERVER_PORT=dify_config.IRIS_SUPER_SERVER_PORT,
+                IRIS_USER=dify_config.IRIS_USER,
+                IRIS_PASSWORD=dify_config.IRIS_PASSWORD,
+                IRIS_DATABASE=dify_config.IRIS_DATABASE,
+                IRIS_SCHEMA=dify_config.IRIS_SCHEMA,
+                IRIS_CONNECTION_URL=dify_config.IRIS_CONNECTION_URL,
+                IRIS_MIN_CONNECTION=dify_config.IRIS_MIN_CONNECTION,
+                IRIS_MAX_CONNECTION=dify_config.IRIS_MAX_CONNECTION,
+                IRIS_TEXT_INDEX=dify_config.IRIS_TEXT_INDEX,
+                IRIS_TEXT_INDEX_LANGUAGE=dify_config.IRIS_TEXT_INDEX_LANGUAGE,
+            ),
+        )

api/core/rag/datasource/vdb/oracle/oraclevector.py

@@ -289,7 +289,8 @@ class OracleVector(BaseVector):
                 words = pseg.cut(query)
                 current_entity = ""
                 for word, pos in words:
-                    if pos in {"nr", "Ng", "eng", "nz", "n", "ORG", "v"}:  # nr: 人名，ns: 地名，nt: 机构名
+                    # `nr`: Person, `ns`: Location, `nt`: Organization
+                    if pos in {"nr", "Ng", "eng", "nz", "n", "ORG", "v"}:
                         current_entity += word
                     else:
                         if current_entity:

api/core/rag/datasource/vdb/pyvastbase/vastbase_vector.py

@@ -213,7 +213,7 @@ class VastbaseVector(BaseVector):
 
             with self._get_cursor() as cur:
                 cur.execute(SQL_CREATE_TABLE.format(table_name=self.table_name, dimension=dimension))
-                # Vastbase 支持的向量维度取值范围为 [1,16000]
+                # Vastbase supports vector dimensions in the range [1, 16,000]
                 if dimension <= 16000:
                     cur.execute(SQL_CREATE_INDEX.format(table_name=self.table_name))
             redis_client.set(collection_exist_cache_key, 1, ex=3600)

api/core/rag/datasource/vdb/vector_factory.py

@@ -163,7 +163,7 @@ class Vector:
                 from core.rag.datasource.vdb.lindorm.lindorm_vector import LindormVectorStoreFactory
 
                 return LindormVectorStoreFactory
-            case VectorType.OCEANBASE:
+            case VectorType.OCEANBASE | VectorType.SEEKDB:
                 from core.rag.datasource.vdb.oceanbase.oceanbase_vector import OceanBaseVectorFactory
 
                 return OceanBaseVectorFactory
@@ -187,6 +187,10 @@ class Vector:
                 from core.rag.datasource.vdb.clickzetta.clickzetta_vector import ClickzettaVectorFactory
 
                 return ClickzettaVectorFactory
+            case VectorType.IRIS:
+                from core.rag.datasource.vdb.iris.iris_vector import IrisVectorFactory
+
+                return IrisVectorFactory
             case _:
                 raise ValueError(f"Vector store {vector_type} is not supported.")
 

api/core/rag/datasource/vdb/vector_type.py

@@ -27,8 +27,10 @@ class VectorType(StrEnum):
     UPSTASH = "upstash"
     TIDB_ON_QDRANT = "tidb_on_qdrant"
     OCEANBASE = "oceanbase"
+    SEEKDB = "seekdb"
     OPENGAUSS = "opengauss"
     TABLESTORE = "tablestore"
     HUAWEI_CLOUD = "huawei_cloud"
     MATRIXONE = "matrixone"
     CLICKZETTA = "clickzetta"
+    IRIS = "iris"

api/core/rag/extractor/entity/extract_setting.py

@@ -10,7 +10,7 @@ class NotionInfo(BaseModel):
     """
 
     credential_id: str | None = None
-    notion_workspace_id: str
+    notion_workspace_id: str | None = ""
     notion_obj_id: str
     notion_page_type: str
     document: Document | None = None

api/core/rag/extractor/excel_extractor.py

@@ -1,7 +1,7 @@
 """Abstract interface for document loader implementations."""
 
 import os
-from typing import cast
+from typing import TypedDict
 
 import pandas as pd
 from openpyxl import load_workbook
@@ -10,6 +10,12 @@ from core.rag.extractor.extractor_base import BaseExtractor
 from core.rag.models.document import Document
 
 
+class Candidate(TypedDict):
+    idx: int
+    count: int
+    map: dict[int, str]
+
+
 class ExcelExtractor(BaseExtractor):
     """Load Excel files.
 
@@ -30,32 +36,38 @@ class ExcelExtractor(BaseExtractor):
         file_extension = os.path.splitext(self._file_path)[-1].lower()
 
         if file_extension == ".xlsx":
-            wb = load_workbook(self._file_path, data_only=True)
-            for sheet_name in wb.sheetnames:
-                sheet = wb[sheet_name]
-                data = sheet.values
-                cols = next(data, None)
-                if cols is None:
-                    continue
-                df = pd.DataFrame(data, columns=cols)
-
-                df.dropna(how="all", inplace=True)
-
-                for index, row in df.iterrows():
-                    page_content = []
-                    for col_index, (k, v) in enumerate(row.items()):
-                        if pd.notna(v):
-                            cell = sheet.cell(
-                                row=cast(int, index) + 2, column=col_index + 1
-                            )  # +2 to account for header and 1-based index
-                            if cell.hyperlink:
-                                value = f"[{v}]({cell.hyperlink.target})"
-                                page_content.append(f'"{k}":"{value}"')
-                            else:
-                                page_content.append(f'"{k}":"{v}"')
-                    documents.append(
-                        Document(page_content=";".join(page_content), metadata={"source": self._file_path})
-                    )
+            wb = load_workbook(self._file_path, read_only=True, data_only=True)
+            try:
+                for sheet_name in wb.sheetnames:
+                    sheet = wb[sheet_name]
+                    header_row_idx, column_map, max_col_idx = self._find_header_and_columns(sheet)
+                    if not column_map:
+                        continue
+                    start_row = header_row_idx + 1
+                    for row in sheet.iter_rows(min_row=start_row, max_col=max_col_idx, values_only=False):
+                        if all(cell.value is None for cell in row):
+                            continue
+                        page_content = []
+                        for col_idx, cell in enumerate(row):
+                            value = cell.value
+                            if col_idx in column_map:
+                                col_name = column_map[col_idx]
+                                if hasattr(cell, "hyperlink") and cell.hyperlink:
+                                    target = getattr(cell.hyperlink, "target", None)
+                                    if target:
+                                        value = f"[{value}]({target})"
+                                if value is None:
+                                    value = ""
+                                elif not isinstance(value, str):
+                                    value = str(value)
+                                value = value.strip().replace('"', '\\"')
+                                page_content.append(f'"{col_name}":"{value}"')
+                        if page_content:
+                            documents.append(
+                                Document(page_content=";".join(page_content), metadata={"source": self._file_path})
+                            )
+            finally:
+                wb.close()
 
         elif file_extension == ".xls":
             excel_file = pd.ExcelFile(self._file_path, engine="xlrd")
@@ -63,9 +75,9 @@ class ExcelExtractor(BaseExtractor):
                 df = excel_file.parse(sheet_name=excel_sheet_name)
                 df.dropna(how="all", inplace=True)
 
-                for _, row in df.iterrows():
+                for _, series_row in df.iterrows():
                     page_content = []
-                    for k, v in row.items():
+                    for k, v in series_row.items():
                         if pd.notna(v):
                             page_content.append(f'"{k}":"{v}"')
                     documents.append(
@@ -75,3 +87,61 @@ class ExcelExtractor(BaseExtractor):
             raise ValueError(f"Unsupported file extension: {file_extension}")
 
         return documents
+
+    def _find_header_and_columns(self, sheet, scan_rows=10) -> tuple[int, dict[int, str], int]:
+        """
+        Scan first N rows to find the most likely header row.
+        Returns:
+            header_row_idx: 1-based index of the header row
+            column_map: Dict mapping 0-based column index to column name
+            max_col_idx: 1-based index of the last valid column (for iter_rows boundary)
+        """
+        # Store potential candidates: (row_index, non_empty_count, column_map)
+        candidates: list[Candidate] = []
+
+        # Limit scan to avoid performance issues on huge files
+        # We iterate manually to control the read scope
+        for current_row_idx, row in enumerate(sheet.iter_rows(min_row=1, max_row=scan_rows, values_only=True), start=1):
+            # Filter out empty cells and build a temp map for this row
+            # col_idx is 0-based
+            row_map = {}
+            for col_idx, cell_value in enumerate(row):
+                if cell_value is not None and str(cell_value).strip():
+                    row_map[col_idx] = str(cell_value).strip().replace('"', '\\"')
+
+            if not row_map:
+                continue
+
+            non_empty_count = len(row_map)
+
+            # Header selection heuristic (implemented):
+            # - Prefer the first row with at least 2 non-empty columns.
+            # - Fallback: choose the row with the most non-empty columns
+            #   (tie-breaker: smaller row index).
+            candidates.append({"idx": current_row_idx, "count": non_empty_count, "map": row_map})
+
+        if not candidates:
+            return 0, {}, 0
+
+        # Choose the best candidate header row.
+
+        best_candidate: Candidate | None = None
+
+        # Strategy: prefer the first row with >= 2 non-empty columns; otherwise fallback.
+
+        for cand in candidates:
+            if cand["count"] >= 2:
+                best_candidate = cand
+                break
+
+        # Fallback: if no row has >= 2 columns, or all have 1, just take the one with max columns
+        if not best_candidate:
+            # Sort by count desc, then index asc
+            candidates.sort(key=lambda x: (-x["count"], x["idx"]))
+            best_candidate = candidates[0]
+
+        # Determine max_col_idx (1-based for openpyxl)
+        # It is the index of the last valid column in our map + 1
+        max_col_idx = max(best_candidate["map"].keys()) + 1
+
+        return best_candidate["idx"], best_candidate["map"], max_col_idx

api/core/rag/extractor/extract_processor.py

@@ -166,7 +166,7 @@ class ExtractProcessor:
         elif extract_setting.datasource_type == DatasourceType.NOTION:
             assert extract_setting.notion_info is not None, "notion_info is required"
             extractor = NotionExtractor(
-                notion_workspace_id=extract_setting.notion_info.notion_workspace_id,
+                notion_workspace_id=extract_setting.notion_info.notion_workspace_id or "",
                 notion_obj_id=extract_setting.notion_info.notion_obj_id,
                 notion_page_type=extract_setting.notion_info.notion_page_type,
                 document_model=extract_setting.notion_info.document,

api/core/rag/extractor/helpers.py

@@ -45,6 +45,6 @@ def detect_file_encodings(file_path: str, timeout: int = 5, sample_size: int = 1
         except concurrent.futures.TimeoutError:
             raise TimeoutError(f"Timeout reached while detecting encoding for {file_path}")
 
-    if all(encoding["encoding"] is None for encoding in encodings):
+    if all(encoding.encoding is None for encoding in encodings):
         raise RuntimeError(f"Could not detect encoding for {file_path}")
-    return [FileEncoding(**enc) for enc in encodings if enc["encoding"] is not None]
+    return [enc for enc in encodings if enc.encoding is not None]

api/core/rag/extractor/word_extractor.py

@@ -83,23 +83,46 @@ class WordExtractor(BaseExtractor):
     def _extract_images_from_docx(self, doc):
         image_count = 0
         image_map = {}
+        base_url = dify_config.INTERNAL_FILES_URL or dify_config.FILES_URL
 
-        for rel in doc.part.rels.values():
+        for r_id, rel in doc.part.rels.items():
             if "image" in rel.target_ref:
                 image_count += 1
                 if rel.is_external:
                     url = rel.target_ref
-                    response = ssrf_proxy.get(url)
+                    if not self._is_valid_url(url):
+                        continue
+                    try:
+                        response = ssrf_proxy.get(url)
+                    except Exception as e:
+                        logger.warning("Failed to download image from URL: %s: %s", url, str(e))
+                        continue
                     if response.status_code == 200:
-                        image_ext = mimetypes.guess_extension(response.headers["Content-Type"])
+                        image_ext = mimetypes.guess_extension(response.headers.get("Content-Type", ""))
                         if image_ext is None:
                             continue
                         file_uuid = str(uuid.uuid4())
-                        file_key = "image_files/" + self.tenant_id + "/" + file_uuid + "." + image_ext
+                        file_key = "image_files/" + self.tenant_id + "/" + file_uuid + image_ext
                         mime_type, _ = mimetypes.guess_type(file_key)
                         storage.save(file_key, response.content)
-                    else:
-                        continue
+                        # save file to db
+                        upload_file = UploadFile(
+                            tenant_id=self.tenant_id,
+                            storage_type=dify_config.STORAGE_TYPE,
+                            key=file_key,
+                            name=file_key,
+                            size=0,
+                            extension=str(image_ext),
+                            mime_type=mime_type or "",
+                            created_by=self.user_id,
+                            created_by_role=CreatorUserRole.ACCOUNT,
+                            created_at=naive_utc_now(),
+                            used=True,
+                            used_by=self.user_id,
+                            used_at=naive_utc_now(),
+                        )
+                        db.session.add(upload_file)
+                        image_map[r_id] = f"![image]({base_url}/files/{upload_file.id}/file-preview)"
                 else:
                     image_ext = rel.target_ref.split(".")[-1]
                     if image_ext is None:
@@ -110,27 +133,25 @@ class WordExtractor(BaseExtractor):
                     mime_type, _ = mimetypes.guess_type(file_key)
 
                     storage.save(file_key, rel.target_part.blob)
-                # save file to db
-                upload_file = UploadFile(
-                    tenant_id=self.tenant_id,
-                    storage_type=dify_config.STORAGE_TYPE,
-                    key=file_key,
-                    name=file_key,
-                    size=0,
-                    extension=str(image_ext),
-                    mime_type=mime_type or "",
-                    created_by=self.user_id,
-                    created_by_role=CreatorUserRole.ACCOUNT,
-                    created_at=naive_utc_now(),
-                    used=True,
-                    used_by=self.user_id,
-                    used_at=naive_utc_now(),
-                )
-
-                db.session.add(upload_file)
-                db.session.commit()
-                image_map[rel.target_part] = f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)"
-
+                    # save file to db
+                    upload_file = UploadFile(
+                        tenant_id=self.tenant_id,
+                        storage_type=dify_config.STORAGE_TYPE,
+                        key=file_key,
+                        name=file_key,
+                        size=0,
+                        extension=str(image_ext),
+                        mime_type=mime_type or "",
+                        created_by=self.user_id,
+                        created_by_role=CreatorUserRole.ACCOUNT,
+                        created_at=naive_utc_now(),
+                        used=True,
+                        used_by=self.user_id,
+                        used_at=naive_utc_now(),
+                    )
+                    db.session.add(upload_file)
+                    image_map[rel.target_part] = f"![image]({base_url}/files/{upload_file.id}/file-preview)"
+        db.session.commit()
         return image_map
 
     def _table_to_markdown(self, table, image_map):
@@ -186,11 +207,17 @@ class WordExtractor(BaseExtractor):
                     image_id = blip.get("{http://schemas.openxmlformats.org/officeDocument/2006/relationships}embed")
                     if not image_id:
                         continue
-                    image_part = paragraph.part.rels[image_id].target_part
-
-                    if image_part in image_map:
-                        image_link = image_map[image_part]
-                        paragraph_content.append(image_link)
+                    rel = paragraph.part.rels.get(image_id)
+                    if rel is None:
+                        continue
+                    # For external images, use image_id as key; for internal, use target_part
+                    if rel.is_external:
+                        if image_id in image_map:
+                            paragraph_content.append(image_map[image_id])
+                    else:
+                        image_part = rel.target_part
+                        if image_part in image_map:
+                            paragraph_content.append(image_map[image_part])
             else:
                 paragraph_content.append(run.text)
         return "".join(paragraph_content).strip()
@@ -227,6 +254,18 @@ class WordExtractor(BaseExtractor):
 
         def parse_paragraph(paragraph):
             paragraph_content = []
+
+            def append_image_link(image_id, has_drawing):
+                """Helper to append image link from image_map based on relationship type."""
+                rel = doc.part.rels[image_id]
+                if rel.is_external:
+                    if image_id in image_map and not has_drawing:
+                        paragraph_content.append(image_map[image_id])
+                else:
+                    image_part = rel.target_part
+                    if image_part in image_map and not has_drawing:
+                        paragraph_content.append(image_map[image_part])
+
             for run in paragraph.runs:
                 if hasattr(run.element, "tag") and isinstance(run.element.tag, str) and run.element.tag.endswith("r"):
                     # Process drawing type images
@@ -243,10 +282,18 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}embed"
                             )
                             if embed_id:
-                                image_part = doc.part.related_parts.get(embed_id)
-                                if image_part in image_map:
-                                    has_drawing = True
-                                    paragraph_content.append(image_map[image_part])
+                                rel = doc.part.rels.get(embed_id)
+                                if rel is not None and rel.is_external:
+                                    # External image: use embed_id as key
+                                    if embed_id in image_map:
+                                        has_drawing = True
+                                        paragraph_content.append(image_map[embed_id])
+                                else:
+                                    # Internal image: use target_part as key
+                                    image_part = doc.part.related_parts.get(embed_id)
+                                    if image_part in image_map:
+                                        has_drawing = True
+                                        paragraph_content.append(image_map[image_part])
                     # Process pict type images
                     shape_elements = run.element.findall(
                         ".//{http://schemas.openxmlformats.org/wordprocessingml/2006/main}pict"
@@ -261,9 +308,7 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}id"
                             )
                             if image_id and image_id in doc.part.rels:
-                                image_part = doc.part.rels[image_id].target_part
-                                if image_part in image_map and not has_drawing:
-                                    paragraph_content.append(image_map[image_part])
+                                append_image_link(image_id, has_drawing)
                         # Find imagedata element in VML
                         image_data = shape.find(".//{urn:schemas-microsoft-com:vml}imagedata")
                         if image_data is not None:
@@ -271,9 +316,7 @@ class WordExtractor(BaseExtractor):
                                 "{http://schemas.openxmlformats.org/officeDocument/2006/relationships}id"
                             )
                             if image_id and image_id in doc.part.rels:
-                                image_part = doc.part.rels[image_id].target_part
-                                if image_part in image_map and not has_drawing:
-                                    paragraph_content.append(image_map[image_part])
+                                append_image_link(image_id, has_drawing)
                 if run.text.strip():
                     paragraph_content.append(run.text.strip())
             return "".join(paragraph_content) if paragraph_content else ""

api/core/rag/index_processor/constant/built_in_field.py

@@ -15,3 +15,4 @@ class MetadataDataSource(StrEnum):
     notion_import = "notion"
     local_file = "file_upload"
     online_document = "online_document"
+    online_drive = "online_drive"

api/core/rag/index_processor/index_processor_base.py

@@ -231,7 +231,7 @@ class BaseIndexProcessor(ABC):
 
             if not filename:
                 parsed_url = urlparse(image_url)
-                # unquote 处理 URL 中的中文
+                # Decode percent-encoded characters in the URL path.
                 path = unquote(parsed_url.path)
                 filename = os.path.basename(path)
 

api/core/rag/retrieval/dataset_retrieval.py

@@ -151,20 +151,14 @@ class DatasetRetrieval:
             if ModelFeature.TOOL_CALL in features or ModelFeature.MULTI_TOOL_CALL in features:
                 planning_strategy = PlanningStrategy.ROUTER
         available_datasets = []
-        for dataset_id in dataset_ids:
-            # get dataset from dataset id
-            dataset_stmt = select(Dataset).where(Dataset.tenant_id == tenant_id, Dataset.id == dataset_id)
-            dataset = db.session.scalar(dataset_stmt)
 
-            # pass if dataset is not available
-            if not dataset:
+        dataset_stmt = select(Dataset).where(Dataset.tenant_id == tenant_id, Dataset.id.in_(dataset_ids))
+        datasets: list[Dataset] = db.session.execute(dataset_stmt).scalars().all()  # type: ignore
+        for dataset in datasets:
+            if dataset.available_document_count == 0 and dataset.provider != "external":
                 continue
-
-            # pass if dataset is not available
-            if dataset and dataset.available_document_count == 0 and dataset.provider != "external":
-                continue
-
             available_datasets.append(dataset)
+
         if inputs:
             inputs = {key: str(value) for key, value in inputs.items()}
         else:
@@ -282,26 +276,35 @@ class DatasetRetrieval:
                                 )
                                 context_files.append(attachment_info)
                 if show_retrieve_source:
+                    dataset_ids = [record.segment.dataset_id for record in records]
+                    document_ids = [record.segment.document_id for record in records]
+                    dataset_document_stmt = select(DatasetDocument).where(
+                        DatasetDocument.id.in_(document_ids),
+                        DatasetDocument.enabled == True,
+                        DatasetDocument.archived == False,
+                    )
+                    documents = db.session.execute(dataset_document_stmt).scalars().all()  # type: ignore
+                    dataset_stmt = select(Dataset).where(
+                        Dataset.id.in_(dataset_ids),
+                    )
+                    datasets = db.session.execute(dataset_stmt).scalars().all()  # type: ignore
+                    dataset_map = {i.id: i for i in datasets}
+                    document_map = {i.id: i for i in documents}
                     for record in records:
                         segment = record.segment
-                        dataset = db.session.query(Dataset).filter_by(id=segment.dataset_id).first()
-                        dataset_document_stmt = select(DatasetDocument).where(
-                            DatasetDocument.id == segment.document_id,
-                            DatasetDocument.enabled == True,
-                            DatasetDocument.archived == False,
-                        )
-                        document = db.session.scalar(dataset_document_stmt)
-                        if dataset and document:
+                        dataset_item = dataset_map.get(segment.dataset_id)
+                        document_item = document_map.get(segment.document_id)
+                        if dataset_item and document_item:
                             source = RetrievalSourceMetadata(
-                                dataset_id=dataset.id,
-                                dataset_name=dataset.name,
-                                document_id=document.id,
-                                document_name=document.name,
-                                data_source_type=document.data_source_type,
+                                dataset_id=dataset_item.id,
+                                dataset_name=dataset_item.name,
+                                document_id=document_item.id,
+                                document_name=document_item.name,
+                                data_source_type=document_item.data_source_type,
                                 segment_id=segment.id,
                                 retriever_from=invoke_from.to_source(),
                                 score=record.score or 0.0,
-                                doc_metadata=document.doc_metadata,
+                                doc_metadata=document_item.doc_metadata,
                             )
 
                             if invoke_from.to_source() == "dev":

api/core/rag/splitter/fixed_text_splitter.py

@@ -2,6 +2,7 @@
 
 from __future__ import annotations
 
+import codecs
 import re
 from typing import Any
 
@@ -52,7 +53,7 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
     def __init__(self, fixed_separator: str = "\n\n", separators: list[str] | None = None, **kwargs: Any):
         """Create a new TextSplitter."""
         super().__init__(**kwargs)
-        self._fixed_separator = fixed_separator
+        self._fixed_separator = codecs.decode(fixed_separator, "unicode_escape")
         self._separators = separators or ["\n\n", "\n", "。", ". ", " ", ""]
 
     def split_text(self, text: str) -> list[str]:
@@ -94,7 +95,8 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
                 splits = re.split(r" +", text)
             else:
                 splits = text.split(separator)
-                splits = [item + separator if i < len(splits) else item for i, item in enumerate(splits)]
+                if self._keep_separator:
+                    splits = [s + separator for s in splits[:-1]] + splits[-1:]
         else:
             splits = list(text)
         if separator == "\n":
@@ -103,7 +105,7 @@ class FixedRecursiveCharacterTextSplitter(EnhanceRecursiveCharacterTextSplitter)
             splits = [s for s in splits if (s not in {"", "\n"})]
         _good_splits = []
         _good_splits_lengths = []  # cache the lengths of the splits
-        _separator = separator if self._keep_separator else ""
+        _separator = "" if self._keep_separator else separator
         s_lens = self._length_function(splits)
         if separator != "":
             for s, s_len in zip(splits, s_lens):

api/core/tools/utils/message_transformer.py

@@ -101,6 +101,8 @@ class ToolFileMessageTransformer:
                 meta = message.meta or {}
 
                 mimetype = meta.get("mime_type", "application/octet-stream")
+                if not mimetype:
+                    mimetype = "application/octet-stream"
                 # get filename from meta
                 filename = meta.get("filename", None)
                 # if message is str, encode it to bytes

api/core/workflow/graph_engine/graph_engine.py

@@ -140,6 +140,10 @@ class GraphEngine:
         pause_handler = PauseCommandHandler()
         self._command_processor.register_handler(PauseCommand, pause_handler)
 
+        # === Extensibility ===
+        # Layers allow plugins to extend engine functionality
+        self._layers: list[GraphEngineLayer] = []
+
         # === Worker Pool Setup ===
         # Capture Flask app context for worker threads
         flask_app: Flask | None = None
@@ -158,6 +162,7 @@ class GraphEngine:
             ready_queue=self._ready_queue,
             event_queue=self._event_queue,
             graph=self._graph,
+            layers=self._layers,
             flask_app=flask_app,
             context_vars=context_vars,
             min_workers=self._min_workers,
@@ -196,10 +201,6 @@ class GraphEngine:
             event_emitter=self._event_manager,
         )
 
-        # === Extensibility ===
-        # Layers allow plugins to extend engine functionality
-        self._layers: list[GraphEngineLayer] = []
-
         # === Validation ===
         # Ensure all nodes share the same GraphRuntimeState instance
         self._validate_graph_state_consistency()

api/core/workflow/graph_engine/layers/__init__.py

@@ -8,9 +8,11 @@ with middleware-like components that can observe events and interact with execut
 from .base import GraphEngineLayer
 from .debug_logging import DebugLoggingLayer
 from .execution_limits import ExecutionLimitsLayer
+from .observability import ObservabilityLayer
 
 __all__ = [
     "DebugLoggingLayer",
     "ExecutionLimitsLayer",
     "GraphEngineLayer",
+    "ObservabilityLayer",
 ]

api/core/workflow/graph_engine/layers/base.py

@@ -9,6 +9,7 @@ from abc import ABC, abstractmethod
 
 from core.workflow.graph_engine.protocols.command_channel import CommandChannel
 from core.workflow.graph_events import GraphEngineEvent
+from core.workflow.nodes.base.node import Node
 from core.workflow.runtime import ReadOnlyGraphRuntimeState
 
 
@@ -83,3 +84,29 @@ class GraphEngineLayer(ABC):
             error: The exception that caused execution to fail, or None if successful
         """
         pass
+
+    def on_node_run_start(self, node: Node) -> None:  # noqa: B027
+        """
+        Called immediately before a node begins execution.
+
+        Layers can override to inject behavior (e.g., start spans) prior to node execution.
+        The node's execution ID is available via `node._node_execution_id` and will be
+        consistent with all events emitted by this node execution.
+
+        Args:
+            node: The node instance about to be executed
+        """
+        pass
+
+    def on_node_run_end(self, node: Node, error: Exception | None) -> None:  # noqa: B027
+        """
+        Called after a node finishes execution.
+
+        The node's execution ID is available via `node._node_execution_id` and matches
+        the `id` field in all events emitted by this node execution.
+
+        Args:
+            node: The node instance that just finished execution
+            error: Exception instance if the node failed, otherwise None
+        """
+        pass

api/core/workflow/graph_engine/layers/node_parsers.py

@@ -0,0 +1,61 @@
+"""
+Node-level OpenTelemetry parser interfaces and defaults.
+"""
+
+import json
+from typing import Protocol
+
+from opentelemetry.trace import Span
+from opentelemetry.trace.status import Status, StatusCode
+
+from core.workflow.nodes.base.node import Node
+from core.workflow.nodes.tool.entities import ToolNodeData
+
+
+class NodeOTelParser(Protocol):
+    """Parser interface for node-specific OpenTelemetry enrichment."""
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None: ...
+
+
+class DefaultNodeOTelParser:
+    """Fallback parser used when no node-specific parser is registered."""
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None:
+        span.set_attribute("node.id", node.id)
+        if node.execution_id:
+            span.set_attribute("node.execution_id", node.execution_id)
+        if hasattr(node, "node_type") and node.node_type:
+            span.set_attribute("node.type", node.node_type.value)
+
+        if error:
+            span.record_exception(error)
+            span.set_status(Status(StatusCode.ERROR, str(error)))
+        else:
+            span.set_status(Status(StatusCode.OK))
+
+
+class ToolNodeOTelParser:
+    """Parser for tool nodes that captures tool-specific metadata."""
+
+    def __init__(self) -> None:
+        self._delegate = DefaultNodeOTelParser()
+
+    def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None:
+        self._delegate.parse(node=node, span=span, error=error)
+
+        tool_data = getattr(node, "_node_data", None)
+        if not isinstance(tool_data, ToolNodeData):
+            return
+
+        span.set_attribute("tool.provider.id", tool_data.provider_id)
+        span.set_attribute("tool.provider.type", tool_data.provider_type.value)
+        span.set_attribute("tool.provider.name", tool_data.provider_name)
+        span.set_attribute("tool.name", tool_data.tool_name)
+        span.set_attribute("tool.label", tool_data.tool_label)
+        if tool_data.plugin_unique_identifier:
+            span.set_attribute("tool.plugin.id", tool_data.plugin_unique_identifier)
+        if tool_data.credential_id:
+            span.set_attribute("tool.credential.id", tool_data.credential_id)
+        if tool_data.tool_configurations:
+            span.set_attribute("tool.config", json.dumps(tool_data.tool_configurations, ensure_ascii=False))

api/core/workflow/graph_engine/layers/observability.py

@@ -0,0 +1,169 @@
+"""
+Observability layer for GraphEngine.
+
+This layer creates OpenTelemetry spans for node execution, enabling distributed
+tracing of workflow execution. It establishes OTel context during node execution
+so that automatic instrumentation (HTTP requests, DB queries, etc.) automatically
+associates with the node span.
+"""
+
+import logging
+from dataclasses import dataclass
+from typing import cast, final
+
+from opentelemetry import context as context_api
+from opentelemetry.trace import Span, SpanKind, Tracer, get_tracer, set_span_in_context
+from typing_extensions import override
+
+from configs import dify_config
+from core.workflow.enums import NodeType
+from core.workflow.graph_engine.layers.base import GraphEngineLayer
+from core.workflow.graph_engine.layers.node_parsers import (
+    DefaultNodeOTelParser,
+    NodeOTelParser,
+    ToolNodeOTelParser,
+)
+from core.workflow.nodes.base.node import Node
+from extensions.otel.runtime import is_instrument_flag_enabled
+
+logger = logging.getLogger(__name__)
+
+
+@dataclass(slots=True)
+class _NodeSpanContext:
+    span: "Span"
+    token: object
+
+
+@final
+class ObservabilityLayer(GraphEngineLayer):
+    """
+    Layer that creates OpenTelemetry spans for node execution.
+
+    This layer:
+    - Creates a span when a node starts execution
+    - Establishes OTel context so automatic instrumentation associates with the span
+    - Sets complete attributes and status when node execution ends
+    """
+
+    def __init__(self) -> None:
+        super().__init__()
+        self._node_contexts: dict[str, _NodeSpanContext] = {}
+        self._parsers: dict[NodeType, NodeOTelParser] = {}
+        self._default_parser: NodeOTelParser = cast(NodeOTelParser, DefaultNodeOTelParser())
+        self._is_disabled: bool = False
+        self._tracer: Tracer | None = None
+        self._build_parser_registry()
+        self._init_tracer()
+
+    def _init_tracer(self) -> None:
+        """Initialize OpenTelemetry tracer in constructor."""
+        if not (dify_config.ENABLE_OTEL or is_instrument_flag_enabled()):
+            self._is_disabled = True
+            return
+
+        try:
+            self._tracer = get_tracer(__name__)
+        except Exception as e:
+            logger.warning("Failed to get OpenTelemetry tracer: %s", e)
+            self._is_disabled = True
+
+    def _build_parser_registry(self) -> None:
+        """Initialize parser registry for node types."""
+        self._parsers = {
+            NodeType.TOOL: ToolNodeOTelParser(),
+        }
+
+    def _get_parser(self, node: Node) -> NodeOTelParser:
+        node_type = getattr(node, "node_type", None)
+        if isinstance(node_type, NodeType):
+            return self._parsers.get(node_type, self._default_parser)
+        return self._default_parser
+
+    @override
+    def on_graph_start(self) -> None:
+        """Called when graph execution starts."""
+        self._node_contexts.clear()
+
+    @override
+    def on_node_run_start(self, node: Node) -> None:
+        """
+        Called when a node starts execution.
+
+        Creates a span and establishes OTel context for automatic instrumentation.
+        """
+        if self._is_disabled:
+            return
+
+        try:
+            if not self._tracer:
+                return
+
+            execution_id = node.execution_id
+            if not execution_id:
+                return
+
+            parent_context = context_api.get_current()
+            span = self._tracer.start_span(
+                f"{node.title}",
+                kind=SpanKind.INTERNAL,
+                context=parent_context,
+            )
+
+            new_context = set_span_in_context(span)
+            token = context_api.attach(new_context)
+
+            self._node_contexts[execution_id] = _NodeSpanContext(span=span, token=token)
+
+        except Exception as e:
+            logger.warning("Failed to create OpenTelemetry span for node %s: %s", node.id, e)
+
+    @override
+    def on_node_run_end(self, node: Node, error: Exception | None) -> None:
+        """
+        Called when a node finishes execution.
+
+        Sets complete attributes, records exceptions, and ends the span.
+        """
+        if self._is_disabled:
+            return
+
+        try:
+            execution_id = node.execution_id
+            if not execution_id:
+                return
+            node_context = self._node_contexts.get(execution_id)
+            if not node_context:
+                return
+
+            span = node_context.span
+            parser = self._get_parser(node)
+            try:
+                parser.parse(node=node, span=span, error=error)
+                span.end()
+            finally:
+                token = node_context.token
+                if token is not None:
+                    try:
+                        context_api.detach(token)
+                    except Exception:
+                        logger.warning("Failed to detach OpenTelemetry token: %s", token)
+                self._node_contexts.pop(execution_id, None)
+
+        except Exception as e:
+            logger.warning("Failed to end OpenTelemetry span for node %s: %s", node.id, e)
+
+    @override
+    def on_event(self, event) -> None:
+        """Not used in this layer."""
+        pass
+
+    @override
+    def on_graph_end(self, error: Exception | None) -> None:
+        """Called when graph execution ends."""
+        if self._node_contexts:
+            logger.warning(
+                "ObservabilityLayer: %d node spans were not properly ended",
+                len(self._node_contexts),
+            )
+            self._node_contexts.clear()

api/core/workflow/graph_engine/worker.py

@@ -9,6 +9,7 @@ import contextvars
 import queue
 import threading
 import time
+from collections.abc import Sequence
 from datetime import datetime
 from typing import final
 from uuid import uuid4
@@ -17,6 +18,7 @@ from flask import Flask
 from typing_extensions import override
 
 from core.workflow.graph import Graph
+from core.workflow.graph_engine.layers.base import GraphEngineLayer
 from core.workflow.graph_events import GraphNodeEventBase, NodeRunFailedEvent
 from core.workflow.nodes.base.node import Node
 from libs.flask_utils import preserve_flask_contexts
@@ -39,6 +41,7 @@ class Worker(threading.Thread):
         ready_queue: ReadyQueue,
         event_queue: queue.Queue[GraphNodeEventBase],
         graph: Graph,
+        layers: Sequence[GraphEngineLayer],
         worker_id: int = 0,
         flask_app: Flask | None = None,
         context_vars: contextvars.Context | None = None,
@@ -50,6 +53,7 @@ class Worker(threading.Thread):
             ready_queue: Ready queue containing node IDs ready for execution
             event_queue: Queue for pushing execution events
             graph: Graph containing nodes to execute
+            layers: Graph engine layers for node execution hooks
             worker_id: Unique identifier for this worker
             flask_app: Optional Flask application for context preservation
             context_vars: Optional context variables to preserve in worker thread
@@ -63,6 +67,7 @@ class Worker(threading.Thread):
         self._context_vars = context_vars
         self._stop_event = threading.Event()
         self._last_task_time = time.time()
+        self._layers = layers if layers is not None else []
 
     def stop(self) -> None:
         """Signal the worker to stop processing."""
@@ -122,20 +127,51 @@ class Worker(threading.Thread):
         Args:
             node: The node instance to execute
         """
-        # Execute the node with preserved context if Flask app is provided
+        node.ensure_execution_id()
+
+        error: Exception | None = None
+
         if self._flask_app and self._context_vars:
             with preserve_flask_contexts(
                 flask_app=self._flask_app,
                 context_vars=self._context_vars,
             ):
-                # Execute the node
+                self._invoke_node_run_start_hooks(node)
+                try:
+                    node_events = node.run()
+                    for event in node_events:
+                        self._event_queue.put(event)
+                except Exception as exc:
+                    error = exc
+                    raise
+                finally:
+                    self._invoke_node_run_end_hooks(node, error)
+        else:
+            self._invoke_node_run_start_hooks(node)
+            try:
                 node_events = node.run()
                 for event in node_events:
-                    # Forward event to dispatcher immediately for streaming
                     self._event_queue.put(event)
-        else:
-            # Execute without context preservation
-            node_events = node.run()
-            for event in node_events:
-                # Forward event to dispatcher immediately for streaming
-                self._event_queue.put(event)
+            except Exception as exc:
+                error = exc
+                raise
+            finally:
+                self._invoke_node_run_end_hooks(node, error)
+
+    def _invoke_node_run_start_hooks(self, node: Node) -> None:
+        """Invoke on_node_run_start hooks for all layers."""
+        for layer in self._layers:
+            try:
+                layer.on_node_run_start(node)
+            except Exception:
+                # Silently ignore layer errors to prevent disrupting node execution
+                continue
+
+    def _invoke_node_run_end_hooks(self, node: Node, error: Exception | None) -> None:
+        """Invoke on_node_run_end hooks for all layers."""
+        for layer in self._layers:
+            try:
+                layer.on_node_run_end(node, error)
+            except Exception:
+                # Silently ignore layer errors to prevent disrupting node execution
+                continue

api/core/workflow/graph_engine/worker_management/worker_pool.py

@@ -14,6 +14,7 @@ from configs import dify_config
 from core.workflow.graph import Graph
 from core.workflow.graph_events import GraphNodeEventBase
 
+from ..layers.base import GraphEngineLayer
 from ..ready_queue import ReadyQueue
 from ..worker import Worker
 
@@ -39,6 +40,7 @@ class WorkerPool:
         ready_queue: ReadyQueue,
         event_queue: queue.Queue[GraphNodeEventBase],
         graph: Graph,
+        layers: list[GraphEngineLayer],
         flask_app: "Flask | None" = None,
         context_vars: "Context | None" = None,
         min_workers: int | None = None,
@@ -53,6 +55,7 @@ class WorkerPool:
             ready_queue: Ready queue for nodes ready for execution
             event_queue: Queue for worker events
             graph: The workflow graph
+            layers: Graph engine layers for node execution hooks
             flask_app: Optional Flask app for context preservation
             context_vars: Optional context variables
             min_workers: Minimum number of workers
@@ -65,6 +68,7 @@ class WorkerPool:
         self._graph = graph
         self._flask_app = flask_app
         self._context_vars = context_vars
+        self._layers = layers
 
         # Scaling parameters with defaults
         self._min_workers = min_workers or dify_config.GRAPH_ENGINE_MIN_WORKERS
@@ -144,6 +148,7 @@ class WorkerPool:
             ready_queue=self._ready_queue,
             event_queue=self._event_queue,
             graph=self._graph,
+            layers=self._layers,
             worker_id=worker_id,
             flask_app=self._flask_app,
             context_vars=self._context_vars,

api/core/workflow/nodes/base/node.py

@@ -244,6 +244,15 @@ class Node(Generic[NodeDataT]):
     def graph_init_params(self) -> "GraphInitParams":
         return self._graph_init_params
 
+    @property
+    def execution_id(self) -> str:
+        return self._node_execution_id
+
+    def ensure_execution_id(self) -> str:
+        if not self._node_execution_id:
+            self._node_execution_id = str(uuid4())
+        return self._node_execution_id
+
     def _hydrate_node_data(self, data: Mapping[str, Any]) -> NodeDataT:
         return cast(NodeDataT, self._node_data_type.model_validate(data))
 
@@ -256,14 +265,12 @@ class Node(Generic[NodeDataT]):
         raise NotImplementedError
 
     def run(self) -> Generator[GraphNodeEventBase, None, None]:
-        # Generate a single node execution ID to use for all events
-        if not self._node_execution_id:
-            self._node_execution_id = str(uuid4())
+        execution_id = self.ensure_execution_id()
         self._start_at = naive_utc_now()
 
         # Create and push start event with required fields
         start_event = NodeRunStartedEvent(
-            id=self._node_execution_id,
+            id=execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.title,
@@ -321,7 +328,7 @@ class Node(Generic[NodeDataT]):
                 if isinstance(event, NodeEventBase):  # pyright: ignore[reportUnnecessaryIsInstance]
                     yield self._dispatch(event)
                 elif isinstance(event, GraphNodeEventBase) and not event.in_iteration_id and not event.in_loop_id:  # pyright: ignore[reportUnnecessaryIsInstance]
-                    event.id = self._node_execution_id
+                    event.id = self.execution_id
                     yield event
                 else:
                     yield event
@@ -333,7 +340,7 @@ class Node(Generic[NodeDataT]):
                 error_type="WorkflowNodeError",
             )
             yield NodeRunFailedEvent(
-                id=self._node_execution_id,
+                id=self.execution_id,
                 node_id=self._node_id,
                 node_type=self.node_type,
                 start_at=self._start_at,
@@ -512,7 +519,7 @@ class Node(Generic[NodeDataT]):
         match result.status:
             case WorkflowNodeExecutionStatus.FAILED:
                 return NodeRunFailedEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self.id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -521,7 +528,7 @@ class Node(Generic[NodeDataT]):
                 )
             case WorkflowNodeExecutionStatus.SUCCEEDED:
                 return NodeRunSucceededEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self.id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -537,7 +544,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: StreamChunkEvent) -> NodeRunStreamChunkEvent:
         return NodeRunStreamChunkEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             selector=event.selector,
@@ -550,7 +557,7 @@ class Node(Generic[NodeDataT]):
         match event.node_run_result.status:
             case WorkflowNodeExecutionStatus.SUCCEEDED:
                 return NodeRunSucceededEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self._node_id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -558,7 +565,7 @@ class Node(Generic[NodeDataT]):
                 )
             case WorkflowNodeExecutionStatus.FAILED:
                 return NodeRunFailedEvent(
-                    id=self._node_execution_id,
+                    id=self.execution_id,
                     node_id=self._node_id,
                     node_type=self.node_type,
                     start_at=self._start_at,
@@ -573,7 +580,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: PauseRequestedEvent) -> NodeRunPauseRequestedEvent:
         return NodeRunPauseRequestedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_run_result=NodeRunResult(status=WorkflowNodeExecutionStatus.PAUSED),
@@ -583,7 +590,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: AgentLogEvent) -> NodeRunAgentLogEvent:
         return NodeRunAgentLogEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             message_id=event.message_id,
@@ -599,7 +606,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopStartedEvent) -> NodeRunLoopStartedEvent:
         return NodeRunLoopStartedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -612,7 +619,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopNextEvent) -> NodeRunLoopNextEvent:
         return NodeRunLoopNextEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -623,7 +630,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopSucceededEvent) -> NodeRunLoopSucceededEvent:
         return NodeRunLoopSucceededEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -637,7 +644,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: LoopFailedEvent) -> NodeRunLoopFailedEvent:
         return NodeRunLoopFailedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -652,7 +659,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationStartedEvent) -> NodeRunIterationStartedEvent:
         return NodeRunIterationStartedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -665,7 +672,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationNextEvent) -> NodeRunIterationNextEvent:
         return NodeRunIterationNextEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -676,7 +683,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationSucceededEvent) -> NodeRunIterationSucceededEvent:
         return NodeRunIterationSucceededEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -690,7 +697,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: IterationFailedEvent) -> NodeRunIterationFailedEvent:
         return NodeRunIterationFailedEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             node_title=self.node_data.title,
@@ -705,7 +712,7 @@ class Node(Generic[NodeDataT]):
     @_dispatch.register
     def _(self, event: RunRetrieverResourceEvent) -> NodeRunRetrieverResourceEvent:
         return NodeRunRetrieverResourceEvent(
-            id=self._node_execution_id,
+            id=self.execution_id,
             node_id=self._node_id,
             node_type=self.node_type,
             retriever_resources=event.retriever_resources,

api/core/workflow/nodes/http_request/executor.py

@@ -86,6 +86,11 @@ class Executor:
             node_data.authorization.config.api_key = variable_pool.convert_template(
                 node_data.authorization.config.api_key
             ).text
+            # Validate that API key is not empty after template conversion
+            if not node_data.authorization.config.api_key or not node_data.authorization.config.api_key.strip():
+                raise AuthorizationConfigError(
+                    "API key is required for authorization but was empty. Please provide a valid API key."
+                )
 
         self.url = node_data.url
         self.method = node_data.method

api/core/workflow/nodes/start/start_node.py

@@ -1,3 +1,4 @@
+import json
 from typing import Any
 
 from jsonschema import Draft7Validator, ValidationError
@@ -42,15 +43,25 @@ class StartNode(Node[StartNodeData]):
             if value is None and variable.required:
                 raise ValueError(f"{key} is required in input form")
 
-            if not isinstance(value, dict):
-                raise ValueError(f"{key} must be a JSON object")
-
             schema = variable.json_schema
             if not schema:
                 continue
 
+            if not value:
+                continue
+
             try:
-                Draft7Validator(schema).validate(value)
+                json_schema = json.loads(schema)
+            except json.JSONDecodeError as e:
+                raise ValueError(f"{schema} must be a valid JSON object")
+
+            try:
+                json_value = json.loads(value)
+            except json.JSONDecodeError as e:
+                raise ValueError(f"{value} must be a valid JSON object")
+
+            try:
+                Draft7Validator(json_schema).validate(json_value)
             except ValidationError as e:
                 raise ValueError(f"JSON object for '{key}' does not match schema: {e.message}")
-            node_inputs[key] = value
+            node_inputs[key] = json_value

api/core/workflow/nodes/trigger_webhook/node.py

@@ -1,14 +1,22 @@
+import logging
 from collections.abc import Mapping
 from typing import Any
 
+from core.file import FileTransferMethod
+from core.variables.types import SegmentType
+from core.variables.variables import FileVariable
 from core.workflow.constants import SYSTEM_VARIABLE_NODE_ID
 from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionStatus
 from core.workflow.enums import NodeExecutionType, NodeType
 from core.workflow.node_events import NodeRunResult
 from core.workflow.nodes.base.node import Node
+from factories import file_factory
+from factories.variable_factory import build_segment_with_type
 
 from .entities import ContentType, WebhookData
 
+logger = logging.getLogger(__name__)
+
 
 class TriggerWebhookNode(Node[WebhookData]):
     node_type = NodeType.TRIGGER_WEBHOOK
@@ -60,6 +68,34 @@ class TriggerWebhookNode(Node[WebhookData]):
             outputs=outputs,
         )
 
+    def generate_file_var(self, param_name: str, file: dict):
+        related_id = file.get("related_id")
+        transfer_method_value = file.get("transfer_method")
+        if transfer_method_value:
+            transfer_method = FileTransferMethod.value_of(transfer_method_value)
+            match transfer_method:
+                case FileTransferMethod.LOCAL_FILE | FileTransferMethod.REMOTE_URL:
+                    file["upload_file_id"] = related_id
+                case FileTransferMethod.TOOL_FILE:
+                    file["tool_file_id"] = related_id
+                case FileTransferMethod.DATASOURCE_FILE:
+                    file["datasource_file_id"] = related_id
+
+            try:
+                file_obj = file_factory.build_from_mapping(
+                    mapping=file,
+                    tenant_id=self.tenant_id,
+                )
+                file_segment = build_segment_with_type(SegmentType.FILE, file_obj)
+                return FileVariable(name=param_name, value=file_segment.value, selector=[self.id, param_name])
+            except ValueError:
+                logger.error(
+                    "Failed to build FileVariable for webhook file parameter %s",
+                    param_name,
+                    exc_info=True,
+                )
+        return None
+
     def _extract_configured_outputs(self, webhook_inputs: dict[str, Any]) -> dict[str, Any]:
         """Extract outputs based on node configuration from webhook inputs."""
         outputs = {}
@@ -107,18 +143,33 @@ class TriggerWebhookNode(Node[WebhookData]):
                 outputs[param_name] = str(webhook_data.get("body", {}).get("raw", ""))
                 continue
             elif self.node_data.content_type == ContentType.BINARY:
-                outputs[param_name] = webhook_data.get("body", {}).get("raw", b"")
+                raw_data: dict = webhook_data.get("body", {}).get("raw", {})
+                file_var = self.generate_file_var(param_name, raw_data)
+                if file_var:
+                    outputs[param_name] = file_var
+                else:
+                    outputs[param_name] = raw_data
                 continue
 
             if param_type == "file":
                 # Get File object (already processed by webhook controller)
-                file_obj = webhook_data.get("files", {}).get(param_name)
-                outputs[param_name] = file_obj
+                files = webhook_data.get("files", {})
+                if files and isinstance(files, dict):
+                    file = files.get(param_name)
+                    if file and isinstance(file, dict):
+                        file_var = self.generate_file_var(param_name, file)
+                        if file_var:
+                            outputs[param_name] = file_var
+                        else:
+                            outputs[param_name] = files
+                    else:
+                        outputs[param_name] = files
+                else:
+                    outputs[param_name] = files
             else:
                 # Get regular body parameter
                 outputs[param_name] = webhook_data.get("body", {}).get(param_name)
 
         # Include raw webhook data for debugging/advanced use
         outputs["_webhook_raw"] = webhook_data
-
         return outputs